{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fbf09b7c-48fe-402b-9033-ebe6d20b7cc7",
          "code": "103361-09-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=103361-09-7",
          "code_system": "CAS",
          "references": [
            "3c8d661d-9f1c-4741-bb8c-d7cda4efb5cd",
            "965c3387-2d4a-493a-9238-34f94c6d3a9a"
          ]
        },
        {
          "uuid": "1deff787-b31e-4933-8fec-b92aca930e09",
          "code": "C106487",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67106487",
          "code_system": "MESH",
          "references": [
            "3c8d661d-9f1c-4741-bb8c-d7cda4efb5cd"
          ]
        },
        {
          "uuid": "74a0fb9d-801c-4b67-a72d-0a9d292d0cb4",
          "code": "129034",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2397",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "3c8d661d-9f1c-4741-bb8c-d7cda4efb5cd"
          ]
        },
        {
          "uuid": "462e0fcc-b181-4fb8-af37-db2b5be47e7b",
          "code": "m5444",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5444?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3c8d661d-9f1c-4741-bb8c-d7cda4efb5cd"
          ]
        },
        {
          "uuid": "56302665-e183-4e21-b946-c94c4de5b12a",
          "code": "92425",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92425",
          "code_system": "PUBCHEM",
          "references": [
            "3c8d661d-9f1c-4741-bb8c-d7cda4efb5cd"
          ]
        },
        {
          "uuid": "b71d2f57-0606-3ef2-fd3f-8e12826b8ee2",
          "code": "7012",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7012",
          "code_system": "HSDB",
          "references": [
            "7de91509-cc12-624f-847c-8e88311351be"
          ]
        },
        {
          "uuid": "f5472bec-68e6-9625-bd34-b6f074a83df5",
          "code": "DTXSID7032555",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7032555",
          "code_system": "EPA CompTox",
          "references": [
            "c6f7cf17-7898-9969-4b93-f20c3d9fe068"
          ]
        },
        {
          "uuid": "048b55a7-0118-432d-ac97-d8696f61205c",
          "code": "L0PX7OGI22",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cbc685f4-99af-d380-a5f1-8cdc03c1833d",
          "code": "8939",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:8939",
          "code_system": "CHEBI",
          "references": [
            "4c1b9d3e-e325-766f-1129-ffcd1002e14e"
          ]
        },
        {
          "uuid": "dafb25ba-d95c-3387-3f15-723df053dc1f",
          "code": "flumioxazin",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/flumioxazin.html",
          "code_system": "ALANWOOD",
          "references": [
            "458c1aca-ad81-b6ec-8cf8-dd546c3862c2"
          ]
        },
        {
          "uuid": "579548bb-83bf-85d2-43ad-f48ec82e70de",
          "code": "300000052858",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b8a27be6-40c2-87d3-0fcc-58043603be33"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cdd8bb01-13ec-4fc8-87bf-2b35cad6a855",
          "name": "2-(7-FLUORO-3,4-DIHYDRO-3-OXO-4-(2-PROPYNYL)-2H-1,4-BENZOXAZIN-6-YL)-4,5,6,7-TETRAHYDRO-1H-ISOINDOLE-1,3(2H)-DIONE",
          "stdName": "2-(7-FLUORO-3,4-DIHYDRO-3-OXO-4-(2-PROPYNYL)-2H-1,4-BENZOXAZIN-6-YL)-4,5,6,7-TETRAHYDRO-1H-ISOINDOLE-1,3(2H)-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3ebc860-82b1-46e0-a61c-ed255b8fa015",
            "bada1c4a-978d-44a5-94b4-78cf9feb5e94"
          ],
          "display_name": false
        },
        {
          "uuid": "301d6d0f-0aac-4d54-9435-54d921c22631",
          "name": "FLUMIOXAZIN",
          "stdName": "FLUMIOXAZIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff63eee1-242d-40b9-a85b-637db1d79bdc",
            "dcf20bbb-ef0b-4d7e-a838-c702aef594ba",
            "4a8b475d-3685-4be0-9f4f-797d877f39b3",
            "5288b906-3f66-41c2-8299-22187d2cb107",
            "e1f522d2-a2cd-437c-87ff-32a875d49fe8",
            "e8ff731b-5bef-435b-be65-6f460b356608",
            "d5b86e2c-0a18-44b0-a3e2-474faafcc73d",
            "7a4dd045-f904-40a7-a487-47e9d60d5ea6"
          ],
          "display_name": true
        },
        {
          "uuid": "7bd84cda-1510-4ee4-ab28-5c9031856aab",
          "name": "FLUMIOXAZIN [HSDB]",
          "stdName": "FLUMIOXAZIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5288b906-3f66-41c2-8299-22187d2cb107",
            "d5b86e2c-0a18-44b0-a3e2-474faafcc73d"
          ],
          "display_name": false
        },
        {
          "uuid": "df5a6a14-7cf8-43fb-9f35-b26176c64b93",
          "name": "FLUMIOXAZIN [ISO]",
          "stdName": "FLUMIOXAZIN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5288b906-3f66-41c2-8299-22187d2cb107",
            "7a4dd045-f904-40a7-a487-47e9d60d5ea6"
          ],
          "display_name": false
        },
        {
          "uuid": "fc8bbb79-7f8f-4776-9a94-960c8723b889",
          "name": "FLUMIOXAZIN [MI]",
          "stdName": "FLUMIOXAZIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5288b906-3f66-41c2-8299-22187d2cb107",
            "e8ff731b-5bef-435b-be65-6f460b356608"
          ],
          "display_name": false
        },
        {
          "uuid": "1abf1d05-fb29-49e8-85e3-e66c776bea72",
          "name": "N-(7-FLUORO-3,4-DIHYDRO-3-OXO-4-PROP-2-YNYL-2H-1,4-BENZOXAZIN-6-YL)CYCLOHEX-1-ENE-1,2-DICARBOXAMIDE",
          "stdName": "N-(7-FLUORO-3,4-DIHYDRO-3-OXO-4-PROP-2-YNYL-2H-1,4-BENZOXAZIN-6-YL)CYCLOHEX-1-ENE-1,2-DICARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3ebc860-82b1-46e0-a61c-ed255b8fa015",
            "eea91502-69cb-470d-93c2-362646892129"
          ],
          "display_name": false
        },
        {
          "uuid": "015c98fa-8409-4817-9f75-f1cb629bad1e",
          "name": "S-53482",
          "stdName": "S-53482",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "587b1456-a068-4dd4-8f35-cb9d38eb4934",
            "5288b906-3f66-41c2-8299-22187d2cb107"
          ],
          "display_name": false
        },
        {
          "uuid": "d830b25e-7d03-432f-9084-550709a20925",
          "name": "SUMISOYA",
          "stdName": "SUMISOYA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5288b906-3f66-41c2-8299-22187d2cb107",
            "fbc9c4f9-0576-480a-aeab-d861d7ea7d52"
          ],
          "display_name": false
        },
        {
          "uuid": "d0debc7a-265c-4136-95f4-2b6420fc4767",
          "name": "V-53482",
          "stdName": "V-53482",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "587b1456-a068-4dd4-8f35-cb9d38eb4934",
            "5288b906-3f66-41c2-8299-22187d2cb107"
          ],
          "display_name": false
        },
        {
          "uuid": "83e7d9ac-d390-477d-b804-eb756ed233a0",
          "name": "VALOR",
          "stdName": "VALOR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5288b906-3f66-41c2-8299-22187d2cb107",
            "fbc9c4f9-0576-480a-aeab-d861d7ea7d52"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4a8b475d-3685-4be0-9f4f-797d877f39b3",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d3ebc860-82b1-46e0-a61c-ed255b8fa015",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bada1c4a-978d-44a5-94b4-78cf9feb5e94",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eea91502-69cb-470d-93c2-362646892129",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8ff731b-5bef-435b-be65-6f460b356608",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5288b906-3f66-41c2-8299-22187d2cb107",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "587b1456-a068-4dd4-8f35-cb9d38eb4934",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fbc9c4f9-0576-480a-aeab-d861d7ea7d52",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5b86e2c-0a18-44b0-a3e2-474faafcc73d",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a4dd045-f904-40a7-a487-47e9d60d5ea6",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c8d661d-9f1c-4741-bb8c-d7cda4efb5cd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390953000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b669203-f226-4d07-9c4c-a233b7d53708",
          "citation": "SRS import [L0PX7OGI22]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L0PX7OGI22",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390953000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00d7e325-4556-4bac-99f3-6fa083a553c6",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1f522d2-a2cd-437c-87ff-32a875d49fe8",
          "citation": "FLUMIOXAZIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ff63eee1-242d-40b9-a85b-637db1d79bdc",
          "citation": "FLUMIOXAZIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dcf20bbb-ef0b-4d7e-a838-c702aef594ba",
          "citation": "FLUMIOXAZIN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c6f7cf17-7898-9969-4b93-f20c3d9fe068",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=103361-09-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7de91509-cc12-624f-847c-8e88311351be",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+103361-09-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "458c1aca-ad81-b6ec-8cf8-dd546c3862c2",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "965c3387-2d4a-493a-9238-34f94c6d3a9a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4c1b9d3e-e325-766f-1129-ffcd1002e14e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b8a27be6-40c2-87d3-0fcc-58043603be33",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "342dc366-bc3a-4833-a72c-29e317871d18",
          "id": "342dc366-bc3a-4833-a72c-29e317871d18",
          "molfile": "\n  Marvin  01132102472D          \n\n 26 29  0  0  0  0            999 V2000\n    7.4065   -7.4149    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8220   -6.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6474   -6.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0580   -5.9947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8867   -5.9947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2955   -5.2763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8836   -4.5644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2947   -3.8490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0631   -4.5644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6500   -3.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0631   -3.1390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4762   -2.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6482   -5.2787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8277   -5.2787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4121   -5.9861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5858   -5.9861    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1001   -5.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3582   -4.5260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3101   -5.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3101   -6.3869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5894   -6.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8932   -6.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8932   -5.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6073   -5.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0979   -6.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3484   -7.4297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n 15  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n 13  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 13  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  3  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 25 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 19 24  1  0  0  0  0\n 21 20  1  0  0  0  0\n 20 25  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 26  2  0  0  0  0\nM  END",
          "smiles": "C#CCN1c2cc(c(cc2OCC1=O)F)N3C(=O)C4=C(CCCC4)C3=O",
          "formula": "C19H15FN2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6759a538-7f0a-499f-af79-2d1c30cca941"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "354.3325",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a3de2362-73d9-4b09-8265-155a1f3b8ee7",
      "version": "8",
      "structure": {
        "id": "cbad70b4-db4e-4073-8e62-4dc8d9a34cd8",
        "molfile": "\n  Marvin  01132110312D          \n\n 26 29  0  0  0  0            999 V2000\n    7.4065   -7.4149    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8220   -6.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6474   -6.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0580   -5.9947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8867   -5.9947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2955   -5.2763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8836   -4.5644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2947   -3.8490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0631   -4.5644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6500   -3.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0631   -3.1390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4762   -2.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6482   -5.2787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8277   -5.2787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4121   -5.9861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5858   -5.9861    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1001   -5.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3582   -4.5260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3101   -5.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6073   -5.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8932   -5.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8932   -6.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5894   -6.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3101   -6.3869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0979   -6.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3484   -7.4297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  3  0  0  0  0\n  9 13  1  0  0  0  0\n 13  4  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15  2  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 19  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25 16  1  0  0  0  0\n 25 26  2  0  0  0  0\nM  END",
        "smiles": "C#CCN1c2cc(c(cc2OCC1=O)F)N3C(=O)C4=C(CCCC4)C3=O",
        "formula": "C19H15FN2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "354.3325",
        "optical_activity": "NONE",
        "references": [
          "2b669203-f226-4d07-9c4c-a233b7d53708",
          "00d7e325-4556-4bac-99f3-6fa083a553c6"
        ],
        "stereo_centers": 0
      },
      "unii": "L0PX7OGI22"
    }
  ]
}