{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cbfb13e0-5c63-4f19-8f46-0dedcad3a4ae",
          "code": "106-01-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=106-01-4",
          "code_system": "CAS",
          "references": [
            "162c381b-87ad-430e-8b2f-f56a00c97fad",
            "c51e5fb9-b139-41b2-b914-6b4ecbaac926"
          ]
        },
        {
          "uuid": "bac67e9a-8cca-4af9-84c7-cfbb0f654b88",
          "code": "203-353-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.049",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "162c381b-87ad-430e-8b2f-f56a00c97fad"
          ]
        },
        {
          "uuid": "5be4e88f-0994-4d74-b075-6178c6b8dd9a",
          "code": "66933",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66933",
          "code_system": "PUBCHEM",
          "references": [
            "162c381b-87ad-430e-8b2f-f56a00c97fad"
          ]
        },
        {
          "uuid": "427b3f81-4c96-b115-637c-077a860559f7",
          "code": "DTXSID4059330",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4059330",
          "code_system": "EPA CompTox",
          "references": [
            "98165de9-35e4-d5ef-b912-f861d59dce82"
          ]
        },
        {
          "uuid": "7bfc3f39-989a-4d26-a176-533ab3ebc487",
          "code": "L0M9V67KIQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "79e395b6-4b7b-4147-a147-21a294f8950e",
          "name": "DIETHYLENE GLYCOL DINONANOATE",
          "stdName": "DIETHYLENE GLYCOL DINONANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "199432b8-55aa-4aa8-bb37-df0bcb656584",
            "f999967f-25e3-4e83-bd21-a97e7b477cbf"
          ],
          "display_name": true
        },
        {
          "uuid": "e345694f-8274-46c7-9048-93279478934b",
          "name": "DIETHYLENE GLYCOL DIPELARGONATE",
          "stdName": "DIETHYLENE GLYCOL DIPELARGONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "199432b8-55aa-4aa8-bb37-df0bcb656584",
            "f999967f-25e3-4e83-bd21-a97e7b477cbf"
          ],
          "display_name": false
        },
        {
          "uuid": "38b0164f-9b0b-4bb9-b232-6cee9486ed42",
          "name": "NONANOIC ACID, 1,1'-(OXYDI-2,1-ETHANEDIYL) ESTER",
          "stdName": "NONANOIC ACID, 1,1'-(OXYDI-2,1-ETHANEDIYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "199432b8-55aa-4aa8-bb37-df0bcb656584",
            "f999967f-25e3-4e83-bd21-a97e7b477cbf"
          ],
          "display_name": false
        },
        {
          "uuid": "51c94451-197c-414e-ab0f-e5e1e9a1751e",
          "name": "PELARGONIC ACID DIETHYLENE GLYCOL ESTER",
          "stdName": "PELARGONIC ACID DIETHYLENE GLYCOL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "199432b8-55aa-4aa8-bb37-df0bcb656584",
            "f999967f-25e3-4e83-bd21-a97e7b477cbf"
          ],
          "display_name": false
        },
        {
          "uuid": "f5cc8c3e-1310-4edb-99a1-57c64e40a0df",
          "name": "PLASTOLEIN 9055",
          "stdName": "PLASTOLEIN 9055",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "199432b8-55aa-4aa8-bb37-df0bcb656584",
            "f999967f-25e3-4e83-bd21-a97e7b477cbf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f999967f-25e3-4e83-bd21-a97e7b477cbf",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "199432b8-55aa-4aa8-bb37-df0bcb656584",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "162c381b-87ad-430e-8b2f-f56a00c97fad",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392587000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b160fcb1-20b2-47ea-836f-eceb644c6085",
          "citation": "SRS import [L0M9V67KIQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L0M9V67KIQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392587000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "630f207e-1686-4f7a-97a4-5d5dbdd504d5",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98165de9-35e4-d5ef-b912-f861d59dce82",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=106-01-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c51e5fb9-b139-41b2-b914-6b4ecbaac926",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "698dd74e-62fa-4895-ae64-bf67680ba276",
          "id": "698dd74e-62fa-4895-ae64-bf67680ba276",
          "molfile": "\n  Marvin  01132105292D          \n\n 27 26  0  0  0  0            999 V2000\n    0.4743    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0516   -0.7115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4537   -1.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0413   -2.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4434   -2.8564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0206   -3.5679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4331   -4.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0103   -4.9910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4125   -5.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -6.4140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2477   -5.7128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6602   -5.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4852   -5.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9079   -4.3104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7329   -4.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1454   -3.6091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9703   -3.6195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3931   -2.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9806   -2.1861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2180   -2.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6202   -3.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4452   -3.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8576   -4.3516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6826   -4.3516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0848   -5.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9097   -5.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3119   -5.7850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCC(=O)OCCOCCOC(=O)CCCCCCCC",
          "formula": "C22H42O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0b05bbfb-e889-49f5-b681-f323d9599293"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "386.5667",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cbc6596c-24c6-4d33-8cb2-be58c787f596",
      "version": "3",
      "structure": {
        "id": "7c8cbabb-07f8-49ae-800b-96754b83ccf9",
        "molfile": "\n  Marvin  01132106282D          \n\n 27 26  0  0  0  0            999 V2000\n    4.9806   -2.1861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3931   -2.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9703   -3.6195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1454   -3.6091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7329   -4.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9079   -4.3104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4852   -5.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6602   -5.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2477   -5.7128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4125   -5.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -6.4140    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0103   -4.9910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4331   -4.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0206   -3.5679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4434   -2.8564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0413   -2.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4537   -1.4230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0516   -0.7115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4743    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2180   -2.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6202   -3.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4452   -3.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8576   -4.3516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6826   -4.3516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0848   -5.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9097   -5.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3119   -5.7850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2 20  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCC(=O)OCCOCCOC(=O)CCCCCCCC",
        "formula": "C22H42O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "386.5667",
        "optical_activity": "NONE",
        "references": [
          "b160fcb1-20b2-47ea-836f-eceb644c6085",
          "630f207e-1686-4f7a-97a4-5d5dbdd504d5"
        ],
        "stereo_centers": 0
      },
      "unii": "L0M9V67KIQ"
    }
  ]
}