{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7166a2d7-4b63-4be7-bde3-f3a8090948ca",
          "code": "20109-39-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=20109-39-1",
          "code_system": "CAS",
          "references": [
            "d4aeb057-3225-4cdc-bb04-d46de64b39ee",
            "0777b712-c501-49e5-8637-9a149405247d"
          ]
        },
        {
          "uuid": "da8739f2-767c-4323-98c4-519459610498",
          "code": "243-517-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.039.547",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d4aeb057-3225-4cdc-bb04-d46de64b39ee"
          ]
        },
        {
          "uuid": "1ffbccf4-e33b-4de1-abff-89c6b8b2a190",
          "code": "89272",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/89272",
          "code_system": "PUBCHEM",
          "references": [
            "d4aeb057-3225-4cdc-bb04-d46de64b39ee"
          ]
        },
        {
          "uuid": "4b8379f1-36bb-4f52-8ff6-02c40ff02c2e",
          "code": "KY5QZY215I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "050ffb67-efe6-962c-ea21-6c6d0e43e3ae",
          "code": "DTXSID40864921",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40864921",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fac7c2d2-58b8-406f-a35b-f3199a4a072a",
          "name": "1-PROPANOL, 2-(2-(BENZOYLOXY)PROPOXY)-, 1-BENZOATE",
          "stdName": "1-PROPANOL, 2-(2-(BENZOYLOXY)PROPOXY)-, 1-BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf06e3e3-93ef-4ef1-afe0-8629b2d851ad"
          ],
          "display_name": false
        },
        {
          "uuid": "857b6d7f-ddff-4016-8a72-b620557c256f",
          "name": "1-PROPANOL, 2-(2-(BENZOYLOXY)PROPOXY)-, BENZOATE",
          "stdName": "1-PROPANOL, 2-(2-(BENZOYLOXY)PROPOXY)-, BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf06e3e3-93ef-4ef1-afe0-8629b2d851ad"
          ],
          "display_name": false
        },
        {
          "uuid": "2bcc1fd6-9ad6-4430-813b-6146c4e3a42a",
          "name": "2-(2-(BENZOYLOXY)PROPOXY)-1-PROPANOL 1-BENZOATE",
          "stdName": "2-(2-(BENZOYLOXY)PROPOXY)-1-PROPANOL 1-BENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4559fa26-a13a-44a2-94d4-9c395f85949b"
          ],
          "display_name": true
        },
        {
          "uuid": "ef48b23d-eaaf-436b-82b8-6833eeb67950",
          "name": "2-(2-(BENZOYLOXY)PROPOXY)-1-PROPANOL BENZOATE",
          "stdName": "2-(2-(BENZOYLOXY)PROPOXY)-1-PROPANOL BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ba36564-36b6-44f8-b0c0-66ecea1fd7a8"
          ],
          "display_name": false
        },
        {
          "uuid": "b215d211-8aee-4c5c-b488-840a6fd18d16",
          "name": "DI(1,2-PROPYLENE GLYCOL) DIBENZOATE, HEAD TO TAIL-",
          "stdName": "DI(1,2-PROPYLENE GLYCOL) DIBENZOATE, HEAD TO TAIL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4559fa26-a13a-44a2-94d4-9c395f85949b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4559fa26-a13a-44a2-94d4-9c395f85949b",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf06e3e3-93ef-4ef1-afe0-8629b2d851ad",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4aeb057-3225-4cdc-bb04-d46de64b39ee",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391317000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9bb1326-6111-4b46-bb45-a389e079aef6",
          "citation": "SRS import [KY5QZY215I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KY5QZY215I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391317000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2615ee20-c415-4ab6-a9e4-6f55d7e97ff2",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ba36564-36b6-44f8-b0c0-66ecea1fd7a8",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0777b712-c501-49e5-8637-9a149405247d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "af89c650-197c-4618-8cdd-7ef179d782b2",
          "id": "af89c650-197c-4618-8cdd-7ef179d782b2",
          "molfile": "\n  Marvin  01132109062D          \n\n 25 26  0  0  0  0            999 V2000\n    3.7363   -2.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7363   -1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.0217   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3071   -1.5804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5925   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5925   -0.3436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8779   -1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8779   -2.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1633   -2.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5513   -2.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5513   -1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1633   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4509   -1.1681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1380   -1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8526   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.8526   -0.3436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5672   -1.5804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2818   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2818   -0.3436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9964   -1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9964   -2.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7110   -2.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4256   -2.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4256   -1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7110   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 13  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 25  2  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
          "smiles": "CC(COC(=O)c1ccccc1)OCC(C)OC(=O)c2ccccc2",
          "formula": "C20H22O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b21a3913-02fd-4d1b-b929-0e539b36ca3a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "342.3864",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "29ef5fc6-3acd-421b-92a7-7351fe802afd",
      "version": "3",
      "structure": {
        "id": "492f8d77-f57c-40be-878d-881c3fd4d7f6",
        "molfile": "\n  Marvin  01132103502D          \n\n 25 26  0  0  0  0            999 V2000\n    8.7110   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9964   -1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9964   -2.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7110   -2.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4256   -2.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4256   -1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2818   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2818   -0.3436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5672   -1.5804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8526   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1380   -1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4509   -1.1681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7363   -1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0217   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3071   -1.5804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5925   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8779   -1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8779   -2.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1633   -2.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5513   -2.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5513   -1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1633   -1.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5925   -0.3436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7363   -2.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8526   -0.3436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  7  2  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 17 22  2  0  0  0  0\n 16 23  2  0  0  0  0\n 13 24  1  0  0  0  0\n 10 25  1  0  0  0  0\nM  END",
        "smiles": "CC(COC(=O)c1ccccc1)OCC(C)OC(=O)c2ccccc2",
        "formula": "C20H22O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "342.3864",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "2615ee20-c415-4ab6-a9e4-6f55d7e97ff2",
          "e9bb1326-6111-4b46-bb45-a389e079aef6"
        ],
        "stereo_centers": 2
      },
      "unii": "KY5QZY215I"
    }
  ]
}