{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "45aa8473-15fb-4bb6-88ed-d0b1f9d8ec36",
          "code": "17360-25-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17360-25-7",
          "code_system": "CAS",
          "references": [
            "33a4a00b-6893-86a9-d5dc-62ef812b466d"
          ]
        },
        {
          "uuid": "84cf847f-d324-e092-e616-048408c42042",
          "code": "2249310",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2249310",
          "code_system": "PUBCHEM",
          "references": [
            "1747f46a-2d5a-8492-fef6-1e7629250e22"
          ]
        },
        {
          "uuid": "3a68a8e3-dfd8-4812-b49a-6b7fc321799c",
          "code": "KX49VS36SI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fd4cdbbd-acc4-f8ff-2d91-c74db7483e5f",
          "code": "142791",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=142791",
          "code_system": "NSC",
          "references": [
            "8b80905f-3fe7-f2b4-8c34-863b2763b887"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "89b8ed0e-b138-476e-857a-00a2ad91ed60",
          "type": "RACEMATE->ENANTIOMER",
          "references": [
            "c2ed2455-1e7e-443c-898b-e5dc73a122b9"
          ],
          "related_substance": {
            "uuid": "d0aa3ecd-9291-4e39-a8c8-0c4e583a8bea",
            "refuuid": "38eb5c41-cfaf-ac96-2a00-465be8093056",
            "name": "TOSYL VALINE, DL-",
            "unii": "CY91SM6X67",
            "linking_id": "CY91SM6X67",
            "ref_pname": "TOSYL VALINE, DL-"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7797a4f9-7aab-a544-4e45-a25ddd0ac4b4",
          "name": "(2S)-3-METHYL-2-(((4-METHYLPHENYL)SULFONYL)AMINO)BUTANOIC ACID",
          "stdName": "(2S)-3-METHYL-2-(((4-METHYLPHENYL)SULFONYL)AMINO)BUTANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33a4a00b-6893-86a9-d5dc-62ef812b466d"
          ],
          "display_name": false
        },
        {
          "uuid": "560931e4-5655-1721-5463-05724c57d98e",
          "name": "L-VALINE, N-((4-METHYLPHENYL)SULFONYL)-",
          "stdName": "L-VALINE, N-((4-METHYLPHENYL)SULFONYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33a4a00b-6893-86a9-d5dc-62ef812b466d"
          ],
          "display_name": false
        },
        {
          "uuid": "93cdbbca-5f83-fb28-ba04-3648bc61aaa5",
          "name": "N-TOSYLVALINE",
          "stdName": "N-TOSYLVALINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33a4a00b-6893-86a9-d5dc-62ef812b466d"
          ],
          "display_name": false
        },
        {
          "uuid": "9dc0b930-3d84-6f60-733a-10fc3542bdb1",
          "name": "NSC-142791",
          "stdName": "NSC-142791",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b80905f-3fe7-f2b4-8c34-863b2763b887"
          ],
          "display_name": false
        },
        {
          "uuid": "673773c2-3d4e-9557-57e0-6be5ac87492e",
          "name": "TOSYL VALINE",
          "stdName": "TOSYL VALINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7f2fbe2-7a1c-d60a-66b8-08d26fc8127f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f89bab6c-415c-448e-81cb-c07758b35151",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "c2ed2455-1e7e-443c-898b-e5dc73a122b9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "33a4a00b-6893-86a9-d5dc-62ef812b466d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b7f2fbe2-7a1c-d60a-66b8-08d26fc8127f",
          "citation": "PCPC-DB",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1747f46a-2d5a-8492-fef6-1e7629250e22",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "8b80905f-3fe7-f2b4-8c34-863b2763b887",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "69edfec8-de2c-009c-25f7-18e8148a250e",
          "id": "69edfec8-de2c-009c-25f7-18e8148a250e",
          "molfile": "\n  Marvin  01132105302D          \n\n 18 18  0  0  1  0            999 V2000\n   13.8335   -4.0700    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   14.6585   -4.0700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0711   -4.7845    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3565   -5.1970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4835   -5.4989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7855   -4.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7855   -3.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4999   -3.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2145   -3.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9289   -3.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2145   -4.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4999   -4.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4211   -3.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5961   -3.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8335   -2.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4211   -4.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5961   -4.7845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8335   -5.4989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1 13  1  0  0  0  0\n  1 16  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  2  0  0  0  0\n  3  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 12  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@H](C(=O)O)NS(=O)(=O)c1ccc(C)cc1",
          "formula": "C12H17NO4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f45e57a6-54c1-4d10-b11a-63955325e42d"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "271.3342",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c0d931af-5db2-44d1-a148-9e2a74f89a99",
      "version": "9",
      "structure": {
        "id": "934d17ac-900a-a70e-3d94-4a20d7ec40b0",
        "molfile": "L-Valine, N-[(4-methylphenyl)sulfonyl]-\n  Marvin  01132107382D          \n\n 18 18  0  0  1  0            999 V2000\n   15.0711   -4.7845    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6585   -4.0700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8335   -4.0700    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.4211   -3.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5961   -3.3555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8335   -2.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4211   -4.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5961   -4.7845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8335   -5.4989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3565   -5.1970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4835   -5.4989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7855   -4.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7855   -3.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4999   -3.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2145   -3.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2145   -4.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4999   -4.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9289   -3.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  3  7  1  6  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  1 10  2  0  0  0  0\n  1 11  2  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 12 17  1  0  0  0  0\n 15 18  1  0  0  0  0\nM  END",
        "smiles": "CC(C)[C@@H](C(=O)O)NS(=O)(=O)c1ccc(C)cc1",
        "formula": "C12H17NO4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "271.3342",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b7f2fbe2-7a1c-d60a-66b8-08d26fc8127f",
          "33a4a00b-6893-86a9-d5dc-62ef812b466d"
        ],
        "stereo_centers": 1
      },
      "unii": "KX49VS36SI"
    }
  ]
}