{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "aebc88b6-4385-4cf5-ac8e-e3b6cee7ed80", "code": "91864829", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91864829", "code_system": "PUBCHEM", "references": [ "1454ecd3-fe40-428e-8fbf-9593f5fde5bd" ] }, { "uuid": "f2539d61-414d-4dc2-83c5-1addbe1da777", "code": "KW3DXV9636", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "07d0d240-8e15-4753-adba-5ca3fecb376a", "name": "AMMONIUM .BETA.-SITOSTERYL SULFATE", "stdName": "AMMONIUM .BETA.-SITOSTERYL SULFATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bcecf229-9e05-49ca-ad51-27b7db6d8e93", "ab6ff214-9243-4614-a355-9579eca9adb0" ], "display_name": true }, { "uuid": "b89cd1ca-605e-43db-8c7e-c18939f5059f", "name": "STIGMAST-5-EN-3-OL, 3-(HYDROGEN SULFATE), (3.BETA.)-, AMMONIUM SALT", "stdName": "STIGMAST-5-EN-3-OL, 3-(HYDROGEN SULFATE), (3.BETA.)-, AMMONIUM SALT", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bc8fcf9c-809e-4f4c-85cd-063aff5c6674", "ab6ff214-9243-4614-a355-9579eca9adb0" ], "display_name": false } ], "references": [ { "uuid": "bc8fcf9c-809e-4f4c-85cd-063aff5c6674", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ab6ff214-9243-4614-a355-9579eca9adb0", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bcecf229-9e05-49ca-ad51-27b7db6d8e93", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1454ecd3-fe40-428e-8fbf-9593f5fde5bd", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393061000, "tags": [ "NOMEN" ] }, { "uuid": "6351522b-f4c3-44ed-9482-0838b2c06b6a", "citation": "SRS import [KW3DXV9636]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KW3DXV9636", "doc_type": "SRS", "public_domain": true, "document_date": 1493393061000, "tags": [ "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "40cce1cb-f8e0-4c89-b924-d4ad0714548f", "id": "40cce1cb-f8e0-4c89-b924-d4ad0714548f", "molfile": "\n Marvin 01132103252D \n\n 1 0 0 0 1 0 999 V2000\n 3.5189 -9.2339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\nM END", "smiles": "N", "formula": "H3N", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1bb4fb7c-b1eb-4e5b-baa8-1ec9cd159a79" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "17.0305", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "f5661975-ac38-45fe-b788-d8c9c39eadc7", "id": "f5661975-ac38-45fe-b788-d8c9c39eadc7", "molfile": "\n Marvin 01132112432D \n\n 34 37 0 0 1 0 999 V2000\n 11.8074 -6.1812 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 11.1350 -5.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5576 -5.8381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6356 -5.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3858 -4.6737 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 14.0581 -5.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9802 -5.9731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4638 -3.8524 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.7915 -3.3743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2140 -3.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7294 -7.0025 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 12.0985 -7.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5108 -8.3194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7786 -7.9395 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 10.0062 -8.2294 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.8710 -9.0433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0988 -9.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4614 -8.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6892 -9.0993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0519 -8.5753 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 7.1868 -7.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9593 -7.4716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5966 -7.9954 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.7315 -7.1816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3689 -7.7055 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.5039 -6.8916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2763 -6.6016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9136 -7.1255 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 11.1330 -6.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2795 -8.8653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1443 -9.6792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3305 -9.5441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0093 -10.4930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9582 -9.8143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 11 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 8 1 6 0 0 0\n 7 6 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 8 1 0 0 0 0\n 11 12 1 1 0 0 0\n 11 28 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 1 0 0 0\n 14 15 1 0 0 0 0\n 28 14 1 0 0 0 0\n 15 16 1 6 0 0 0\n 15 25 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 2 0 0 0 0\n 19 18 1 0 0 0 0\n 23 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 30 1 1 0 0 0\n 21 22 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 1 0 0 0\n 25 23 1 0 0 0 0\n 25 26 1 1 0 0 0\n 26 27 1 0 0 0 0\n 28 27 1 0 0 0 0\n 28 29 1 1 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 2 0 0 0 0\n 31 34 2 0 0 0 0\nM END", "smiles": "CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)OS(=O)(=O)O)[C@H](C)C", "formula": "C29H50O4S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "cb2c295a-f5c1-49d7-b456-5cb1e67f4b49" }, "defined_stereo": 9, "ez_centers": 0, "molecular_weight": "494.7721", "optical_activity": "UNSPECIFIED", "stereo_centers": 9 } ], "definition_level": "COMPLETE", "uuid": "d9074da1-9ea8-4f12-8515-9b99f5433e8d", "version": "2", "structure": { "id": "d9c02ed5-f3eb-4703-9e55-32a980ce6232", "molfile": "\n Marvin 01132111172D \n\n 39 41 0 0 1 0 999 V2000\n 10.9136 -7.1255 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.7294 -7.0025 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.8074 -6.1812 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.3858 -4.6737 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.7786 -7.9395 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.0062 -8.2294 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.0519 -8.5753 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.5966 -7.9954 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.3689 -7.7055 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.1330 -6.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5018 -6.7126 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1350 -5.7030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5576 -5.8381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6356 -5.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0581 -5.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9802 -5.9731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4638 -3.8524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7915 -3.3743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2140 -3.5093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0985 -7.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5108 -8.3194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7292 -8.7630 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1412 -7.4155 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8710 -9.0433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0988 -9.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4614 -8.8093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6892 -9.0993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1868 -7.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9593 -7.4716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7315 -7.1816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5039 -6.8916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2763 -6.6016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2338 -8.5194 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2795 -8.8653 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1443 -9.6792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0093 -10.4930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9582 -9.8143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3305 -9.5441 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 3.5189 -9.2339 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 5 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 6 1 0 0 0 0\n 1 10 1 1 0 0 0\n 2 11 1 6 0 0 0\n 3 12 1 6 0 0 0\n 13 3 1 0 0 0 0\n 4 14 1 0 0 0 0\n 14 13 1 0 0 0 0\n 4 15 1 6 0 0 0\n 16 15 1 0 0 0 0\n 17 4 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 17 1 0 0 0 0\n 20 2 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 5 1 0 0 0 0\n 5 22 1 6 0 0 0\n 6 23 1 1 0 0 0\n 24 6 1 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 8 1 0 0 0 0\n 7 27 1 0 0 0 0\n 27 26 1 0 0 0 0\n 7 28 1 0 0 0 0\n 29 8 1 0 0 0 0\n 28 29 1 0 0 0 0\n 8 30 1 1 0 0 0\n 31 9 1 0 0 0 0\n 32 1 1 0 0 0 0\n 31 32 1 0 0 0 0\n 9 33 1 6 0 0 0\n 7 34 1 1 0 0 0\n 34 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 35 37 2 0 0 0 0\n 35 38 1 0 0 0 0\nM CHG 2 38 -1 39 1\nM END", "smiles": "CC[C@H](CC[C@@H](C)[C@@]1([H])CC[C@@]2([H])[C@]3([H])CC=C4C[C@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)OS(=O)(=O)[O-])C(C)C.[NH4+]", "formula": "C29H49O4S.H4N", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 9, "ez_centers": 0, "molecular_weight": "511.8026", "optical_activity": "UNSPECIFIED", "references": [ "bcecf229-9e05-49ca-ad51-27b7db6d8e93", "6351522b-f4c3-44ed-9482-0838b2c06b6a" ], "stereo_centers": 9 }, "unii": "KW3DXV9636" } ] }