{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5b7f7a8e-8f47-41ab-ac46-df27ff701d13",
          "code": "119-47-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=119-47-1",
          "code_system": "CAS",
          "references": [
            "a1034266-06bf-4175-a4da-de23173cb18e",
            "0ea10428-d311-40b7-958a-9f8a56b2a8e1"
          ]
        },
        {
          "uuid": "f79f3b83-ddca-43fc-8808-1ae75f1a87f4",
          "code": "204-327-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.934",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a1034266-06bf-4175-a4da-de23173cb18e"
          ]
        },
        {
          "uuid": "24dcdba1-19cd-49d7-a130-77a7b7b844d4",
          "code": "8398",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8398",
          "code_system": "PUBCHEM",
          "references": [
            "a1034266-06bf-4175-a4da-de23173cb18e"
          ]
        },
        {
          "uuid": "46fc99ae-3db8-b20e-2f0a-7cf602daf37a",
          "code": "5585",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5585",
          "code_system": "HSDB",
          "references": [
            "28f72189-63f8-f45d-4834-318714d8863f"
          ]
        },
        {
          "uuid": "b8f1ab29-1722-2b97-315b-331d46be1f76",
          "code": "DTXSID4020870",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4020870",
          "code_system": "EPA CompTox",
          "references": [
            "d5fcddfc-826a-d49c-5715-64b15cde573a"
          ]
        },
        {
          "uuid": "07f44883-0d77-4449-8f43-ff16462a7e4c",
          "code": "KVM0X4X57B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "dbcd9877-af55-2d92-1559-05acdb16ddb7",
          "code": "100000156078",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a74d17e0-f75c-93a2-b631-3162ed5c31d5"
          ]
        },
        {
          "uuid": "58af94ce-3ea3-6443-9fd7-05371d5ded1b",
          "code": "7781",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7781",
          "code_system": "NSC",
          "references": [
            "95598c98-2f7a-0172-756a-d7fbe35b03c5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1b7ba0f8-06a8-4d79-8546-272d3b1f754c",
          "name": "2,2'-BIS(4-METHYL-6-TERT-BUTYLPHENOL)METHANE",
          "stdName": "2,2'-BIS(4-METHYL-6-TERT-BUTYLPHENOL)METHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "06a6114e-a1c8-457f-acb7-a200e9e7822d"
          ],
          "display_name": false
        },
        {
          "uuid": "a0c23689-0f03-4869-b5cf-38be87b6cff4",
          "name": "2,2'-METHYLENEBIS(4-METHYL-6-TERT-BUTYLPHENOL)",
          "stdName": "2,2'-METHYLENEBIS(4-METHYL-6-TERT-BUTYLPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "2e8950d0-668d-4e98-ac64-84bb87f26573"
          ],
          "display_name": false
        },
        {
          "uuid": "b1af5b15-0358-4d29-a69f-64ec6d26d02d",
          "name": "2,2'-METHYLENEBIS(6-(1,1-DIMETHYLETHYL)-4-METHYL)PHENOL",
          "stdName": "2,2'-METHYLENEBIS(6-(1,1-DIMETHYLETHYL)-4-METHYL)PHENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "06a6114e-a1c8-457f-acb7-a200e9e7822d"
          ],
          "display_name": false
        },
        {
          "uuid": "3c9e7806-ba81-432b-a910-e33c3ff9bd62",
          "name": "2,2'-METHYLENEBIS(6-TERT-BUTYL-4-METHYLPHENOL)",
          "stdName": "2,2'-METHYLENEBIS(6-TERT-BUTYL-4-METHYLPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "06a6114e-a1c8-457f-acb7-a200e9e7822d"
          ],
          "display_name": false
        },
        {
          "uuid": "3c1cbc12-d8f6-469d-bd74-89ac7c81ec66",
          "name": "2,2'-METHYLENEBIS(6-TERT-BUTYL-P-CRESOL)",
          "stdName": "2,2'-METHYLENEBIS(6-TERT-BUTYL-P-CRESOL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "2e8950d0-668d-4e98-ac64-84bb87f26573"
          ],
          "display_name": false
        },
        {
          "uuid": "8439768f-0111-4f34-ac9e-ad6f9711cec1",
          "name": "2,2'-METHYLENEBIS(6-TERT.BUTYL-4-METHYL-PHENOL)",
          "stdName": "2,2'-METHYLENEBIS(6-TERT.BUTYL-4-METHYL-PHENOL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "c6c873f8-a83c-4b7f-a5bc-52b2c01475c8"
          ],
          "display_name": false
        },
        {
          "uuid": "213f74cc-a9db-4bf2-8435-0f32659af6e1",
          "name": "2,2'-METHYLENEBIS-(6-TERT-BUTYL-P-CRESOL)",
          "stdName": "2,2'-METHYLENEBIS-(6-TERT-BUTYL-P-CRESOL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "60da104f-8dd2-4e7c-8a37-a6179c598c65"
          ],
          "display_name": false
        },
        {
          "uuid": "6bb14653-8a46-4d7e-bd32-bdd57203e3b8",
          "name": "3,3'-DI-TERT-BUTYL-2,2'-DIHYDROXY-5,5'-DIMETHYLDIPHENYLMETHANE",
          "stdName": "3,3'-DI-TERT-BUTYL-2,2'-DIHYDROXY-5,5'-DIMETHYLDIPHENYLMETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "06a6114e-a1c8-457f-acb7-a200e9e7822d"
          ],
          "display_name": false
        },
        {
          "uuid": "8cbc12e8-9285-4925-9c3b-6ae1cfaa4387",
          "name": "6,6'-DI-TERT-BUTYL-4,4'-DIMETHYL-2,2'-METHYLENEDIPHENOL",
          "stdName": "6,6'-DI-TERT-BUTYL-4,4'-DIMETHYL-2,2'-METHYLENEDIPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "06a6114e-a1c8-457f-acb7-a200e9e7822d"
          ],
          "display_name": false
        },
        {
          "uuid": "302a55b9-3a20-40dd-925d-b6bcd942b33a",
          "name": "ANTIOXIDANT OMB",
          "stdName": "ANTIOXIDANT OMB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "06a6114e-a1c8-457f-acb7-a200e9e7822d"
          ],
          "display_name": false
        },
        {
          "uuid": "a63e7927-c475-43c0-a140-3c10a5cc099b",
          "name": "BIS(2-HYDROXY-3-TERT-BUTYL-5-METHYLPHENYL)METHANE",
          "stdName": "BIS(2-HYDROXY-3-TERT-BUTYL-5-METHYLPHENYL)METHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "06a6114e-a1c8-457f-acb7-a200e9e7822d"
          ],
          "display_name": false
        },
        {
          "uuid": "ced7a735-1c97-49aa-aaa4-5568a99d5ea8",
          "name": "LOWINOX 22M46",
          "stdName": "LOWINOX 22M46",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef60489a-1ee5-4ba8-a1ec-3e6fedf44bfb",
            "697600e4-e6cb-4408-ab70-9e47936a021c"
          ],
          "display_name": false
        },
        {
          "uuid": "41d5753a-8689-4453-8519-cf828a8d7690",
          "name": "METHYLENE DI-T-BUTYLCRESOL",
          "stdName": "METHYLENE DI-T-BUTYLCRESOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef60489a-1ee5-4ba8-a1ec-3e6fedf44bfb",
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "816aa2f6-8571-4136-8f8e-1add07f62045"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d888b3f5-30fd-4e33-b63d-7bcd058234b0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6105b67c-9006-42b9-89e9-b391f3bd0999",
          "name": "METHYLENEBIS(6-TERT-BUTYL-P-CRESOL), 2,2'-",
          "stdName": "METHYLENEBIS(6-TERT-BUTYL-P-CRESOL), 2,2'-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b74fc8f6-35d2-4227-b8cc-76b69fb0b662"
          ],
          "display_name": false
        },
        {
          "uuid": "2faa0e8d-1c76-423c-88fc-b5e7a0c04d26",
          "name": "NSC-7781",
          "stdName": "NSC-7781",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "2e8950d0-668d-4e98-ac64-84bb87f26573"
          ],
          "display_name": false
        },
        {
          "uuid": "da2783ff-6a4d-44a7-b980-1087ae5f0265",
          "name": "P-CRESOL, 2,2'-METHYLENEBIS(6-TERT- BUTYL- [HSDB]",
          "stdName": "P-CRESOL, 2,2'-METHYLENEBIS(6-TERT- BUTYL- [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "f8017f7b-f31b-46f5-8323-7e092c3d17c9"
          ],
          "display_name": false
        },
        {
          "uuid": "1b549620-cca7-4388-a465-642a466177be",
          "name": "P-CRESOL, 2,2'-METHYLENEBIS(6-TERT-BUTYL-",
          "stdName": "P-CRESOL, 2,2'-METHYLENEBIS(6-TERT-BUTYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "2e8950d0-668d-4e98-ac64-84bb87f26573"
          ],
          "display_name": false
        },
        {
          "uuid": "0f57a81e-85fe-477a-b3bb-a57781a9d989",
          "name": "PHENOL, 2,2'-METHYLENEBIS(6-(1,1-DIMETHYLETHYL)-4-METHYL-",
          "stdName": "PHENOL, 2,2'-METHYLENEBIS(6-(1,1-DIMETHYLETHYL)-4-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "697600e4-e6cb-4408-ab70-9e47936a021c",
            "06a6114e-a1c8-457f-acb7-a200e9e7822d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b74fc8f6-35d2-4227-b8cc-76b69fb0b662",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ef60489a-1ee5-4ba8-a1ec-3e6fedf44bfb",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "697600e4-e6cb-4408-ab70-9e47936a021c",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e8950d0-668d-4e98-ac64-84bb87f26573",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06a6114e-a1c8-457f-acb7-a200e9e7822d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8017f7b-f31b-46f5-8323-7e092c3d17c9",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6c873f8-a83c-4b7f-a5bc-52b2c01475c8",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60da104f-8dd2-4e7c-8a37-a6179c598c65",
          "citation": "EVMPD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1034266-06bf-4175-a4da-de23173cb18e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390931000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c047f09-681c-4064-880e-1b1779d4974c",
          "citation": "SRS import [KVM0X4X57B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KVM0X4X57B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390931000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0109a78-d500-4d43-be82-6e5552a9456c",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "816aa2f6-8571-4136-8f8e-1add07f62045",
          "citation": "METHYLENE DI-T-BUTYLCRESOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "28f72189-63f8-f45d-4834-318714d8863f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+119-47-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d5fcddfc-826a-d49c-5715-64b15cde573a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=119-47-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "95598c98-2f7a-0172-756a-d7fbe35b03c5",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0ea10428-d311-40b7-958a-9f8a56b2a8e1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a74d17e0-f75c-93a2-b631-3162ed5c31d5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "07443e9a-2e70-4d21-ad28-4071dcc76409",
          "id": "07443e9a-2e70-4d21-ad28-4071dcc76409",
          "molfile": "\n  Marvin  01132100392D          \n\n 25 26  0  0  0  0            999 V2000\n    5.7068   -3.5037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7068   -4.3287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4232   -4.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4232   -5.5483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1350   -5.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8468   -5.5483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8468   -4.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5585   -4.3287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5585   -3.5037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2749   -4.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2749   -5.5483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5585   -5.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5585   -6.7952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9913   -5.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5761   -5.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9913   -6.7951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8344   -6.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7068   -5.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7068   -6.7952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9860   -5.5483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9860   -4.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2786   -5.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4218   -6.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1608   -6.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6983   -5.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 21  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4 18  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 12  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 14  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 25  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(Cc2cc(C)cc(c2O)C(C)(C)C)c(c(c1)C(C)(C)C)O",
          "formula": "C23H32O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "10ea83dd-7ce9-4d64-820e-85e93dc3e2f9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "340.4998",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9765a058-e070-4bf8-b23c-a8b4c1a6bfa6",
      "version": "7",
      "structure": {
        "id": "c401fe98-a6d1-4070-b309-c647d65de5cf",
        "molfile": "\n  Marvin  01132110082D          \n\n 25 26  0  0  0  0            999 V2000\n    6.4232   -5.5483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7068   -5.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9860   -5.5483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9860   -4.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7068   -4.3287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4232   -4.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7068   -3.5037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2786   -5.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4218   -6.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1608   -6.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6983   -5.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7068   -6.7952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1350   -5.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8468   -5.5483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5585   -5.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2749   -5.5483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2749   -4.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5585   -4.3287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8468   -4.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5585   -3.5037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9913   -5.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5761   -5.3852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9913   -6.7951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8344   -6.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5585   -6.7952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n  2 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 14 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 16 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\n 15 25  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc(Cc2cc(C)cc(c2O)C(C)(C)C)c(c(c1)C(C)(C)C)O",
        "formula": "C23H32O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "340.4998",
        "optical_activity": "NONE",
        "references": [
          "a0109a78-d500-4d43-be82-6e5552a9456c",
          "9c047f09-681c-4064-880e-1b1779d4974c"
        ],
        "stereo_centers": 0
      },
      "unii": "KVM0X4X57B"
    }
  ]
}