{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0b1c16b6-cc68-440f-8f7d-d539d0ace64e", "code": "50607-64-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=50607-64-2", "code_system": "CAS", "references": [ "26ba5359-02fc-4827-9d72-7e7e5d8b49ac", "a8483063-2f80-48d9-9581-804248995664" ] }, { "uuid": "bde6754e-2cef-4753-b066-7109afec463c", "code": "256-650-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.051.483", "code_system": "ECHA (EC/EINECS)", "references": [ "26ba5359-02fc-4827-9d72-7e7e5d8b49ac" ] }, { "uuid": "9afeee93-4c1f-b29e-a510-33278352b83d", "code": "DTXSID8052142", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8052142", "code_system": "EPA CompTox", "references": [ "e3b1f589-16a8-86b4-06c8-72d33ffb58e0" ] }, { "uuid": "c3b891ab-ccd4-427e-9c20-6144b1e50390", "code": "KVC5M5005S", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "7f5b51d8-ff08-487d-b649-9b0608a8a811", "name": "BENZOIC ACID, 2-((2-METHYLPENTYLIDENE)AMINO)-, METHYL ESTER", "stdName": "BENZOIC ACID, 2-((2-METHYLPENTYLIDENE)AMINO)-, METHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fde364b5-395b-49e2-aec3-a0208d4aff18" ], "display_name": false }, { "uuid": "80eae7bd-fafe-4a97-8df4-11f2a55cd858", "name": "METHYL N-(2-METHYLPENTYLIDENE)ANTHRANILATE", "stdName": "METHYL N-(2-METHYLPENTYLIDENE)ANTHRANILATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4cb71dbc-444c-4917-a59b-72e4f7e624d7" ], "display_name": true } ], "references": [ { "uuid": "fde364b5-395b-49e2-aec3-a0208d4aff18", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4cb71dbc-444c-4917-a59b-72e4f7e624d7", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "26ba5359-02fc-4827-9d72-7e7e5d8b49ac", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391998000, "tags": [ "NOMEN" ] }, { "uuid": "6a4ba0c5-d99b-4b7f-99ae-521340f0f5e3", "citation": "SRS import [KVC5M5005S]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KVC5M5005S", "doc_type": "SRS", "public_domain": true, "document_date": 1493391998000, "tags": [ "NOMEN" ] }, { "uuid": "e3b1f589-16a8-86b4-06c8-72d33ffb58e0", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=50607-64-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a8483063-2f80-48d9-9581-804248995664", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e5ab890f-66b7-4eab-b15c-99b8da2334bc", "id": "e5ab890f-66b7-4eab-b15c-99b8da2334bc", "molfile": "\n Marvin 01132111532D \n\n 17 17 0 0 0 0 999 V2000\n 5.0400 -6.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0399 -5.1755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7544 -4.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7544 -3.9381 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 6.4689 -3.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0399 -3.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3255 -3.9381 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6110 -3.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8965 -3.9381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1820 -3.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1820 -2.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8965 -2.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6110 -2.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3255 -2.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3255 -1.4631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0399 -2.7006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7544 -2.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 13 2 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 2 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\nM END", "smiles": "CCCC(C)/C=N/c1ccccc1C(=O)OC", "formula": "C14H19NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5a73abd4-abe9-4420-bdba-e943ef3597e5" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "233.3067", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "6b23504f-0714-443c-8aa3-a791b5ba635e", "version": "4", "structure": { "id": "cde7e87c-73ea-417f-a35f-49bf5d0327a8", "molfile": "\n Marvin 01132110382D \n\n 17 17 0 0 0 0 999 V2000\n 2.1820 -2.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1820 -3.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8965 -3.9381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6110 -3.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6110 -2.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8965 -2.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3255 -2.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3255 -1.4631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0399 -2.7006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7544 -2.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3255 -3.9381 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0399 -3.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7544 -3.9381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4689 -3.5256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7544 -4.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0399 -5.1755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0400 -6.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 1 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 4 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\nM END", "smiles": "CCCC(C)/C=N/c1ccccc1C(=O)OC", "formula": "C14H19NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "233.3067", "optical_activity": "( + / - )", "references": [ "6a4ba0c5-d99b-4b7f-99ae-521340f0f5e3", "fde364b5-395b-49e2-aec3-a0208d4aff18" ], "stereo_centers": 1 }, "unii": "KVC5M5005S" } ] }