{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d889a132-3aae-4a1b-a88e-36d351e23756",
          "code": "C68467",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68467",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8f11a0d4-98b2-43e7-9cf6-bdc07f519124"
          ]
        },
        {
          "uuid": "00375046-5b5b-48fa-813e-2e51fe133767",
          "code": "491-70-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=491-70-3",
          "code_system": "CAS",
          "references": [
            "8f11a0d4-98b2-43e7-9cf6-bdc07f519124",
            "4479f6ad-002f-4f5b-ad0c-42819f582aa2"
          ]
        },
        {
          "uuid": "632669d8-7ae2-4a9f-96bd-54cedddf7ce1",
          "code": "D047311",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68047311",
          "code_system": "MESH",
          "references": [
            "8f11a0d4-98b2-43e7-9cf6-bdc07f519124"
          ]
        },
        {
          "uuid": "f2fd2564-0487-44f4-b3b5-6a243b4a6013",
          "code": "LUTEOLIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Luteolin",
          "code_system": "WIKIPEDIA",
          "references": [
            "8f11a0d4-98b2-43e7-9cf6-bdc07f519124"
          ]
        },
        {
          "uuid": "ee40c92b-c77f-4c7c-9aab-2be92bc6d497",
          "code": "207-741-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.038",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8f11a0d4-98b2-43e7-9cf6-bdc07f519124"
          ]
        },
        {
          "uuid": "36d00957-a98c-4340-ba85-b06eb29a7fba",
          "code": "m6945",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6945?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8f11a0d4-98b2-43e7-9cf6-bdc07f519124"
          ]
        },
        {
          "uuid": "f87bb9b6-aaa9-4675-85aa-82151ed0370f",
          "code": "SUB183951",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8f11a0d4-98b2-43e7-9cf6-bdc07f519124"
          ]
        },
        {
          "uuid": "acc7c723-eab1-4b3a-935f-09985bb531a8",
          "code": "5280445",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5280445",
          "code_system": "PUBCHEM",
          "references": [
            "8f11a0d4-98b2-43e7-9cf6-bdc07f519124"
          ]
        },
        {
          "uuid": "146f5466-1b68-eafc-36fd-f120becaf9f2",
          "code": "DTXSID4074988",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4074988",
          "code_system": "EPA CompTox",
          "references": [
            "9c3a798d-a024-a744-949f-b1b18dbb2dc6"
          ]
        },
        {
          "uuid": "5f33670c-8b00-b19b-17cc-572f7e234797",
          "code": "C68464",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Polyphenol[C70553]|Dietary Flavonoid[C70554]|Flavone",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68464",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ad4b9e5a-79f3-db59-943c-f84358daabc4"
          ]
        },
        {
          "uuid": "f5b78e64-eb44-8417-a274-effe698053c9",
          "code": "2388 (Number of products:95)",
          "comments": "Dietary Supplement Label Database|chemical|Luteolin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2388&item=Luteolin",
          "code_system": "DSLD",
          "references": [
            "ad4b9e5a-79f3-db59-943c-f84358daabc4"
          ]
        },
        {
          "uuid": "4108976b-8b11-defa-2e6b-5291fa73d5fa",
          "code": "DB15584",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB15584",
          "code_system": "DRUG BANK",
          "references": [
            "ad4b9e5a-79f3-db59-943c-f84358daabc4"
          ]
        },
        {
          "uuid": "8466c655-b5b4-4d44-99db-803a75395558",
          "code": "KUX1ZNC9J2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4fd29ff3-152d-2c50-e33b-988a8add992d",
          "code": "15864",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:15864",
          "code_system": "CHEBI",
          "references": [
            "ad4b9e5a-79f3-db59-943c-f84358daabc4"
          ]
        },
        {
          "uuid": "03c6be6b-f6e3-6468-4c69-5e38d6f4449a",
          "code": "57545",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:57545",
          "code_system": "CHEBI",
          "references": [
            "ad4b9e5a-79f3-db59-943c-f84358daabc4"
          ]
        },
        {
          "uuid": "c7d29749-e2f3-725b-8583-d683b9384edf",
          "code": "100000170151",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "750dd756-2bf7-aaf3-9e82-5bc5e2e7343e"
          ]
        },
        {
          "uuid": "e3acb88c-e182-851a-a037-beeaf33d85e0",
          "code": "KUX1ZNC9J2",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(KUX1ZNC9J2)",
          "code_system": "DAILYMED",
          "references": [
            "ff820060-0946-245d-2568-e0a2084affd4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ece775d5-1884-40b4-a398-dbfc4beefcc5",
          "comments": "Luteolin all significantly inhibited p38 and JNK phosphorylation at 5 and 10 uM.\nThe SEAP reporter assay was conducted to evaluate the inhibitory\neffects of luteolin in inhibiting NF-.KAPPA.B activation in our\nprevious report. The IC50 value of this compound was\nestimated at 12.4 uM for luteolin.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "27797e90-83ac-4925-9da4-84d4d764649b"
          ],
          "related_substance": {
            "uuid": "607b0d32-ef14-40ae-8eb2-f4a0387922a7",
            "refuuid": "39e1efc1-f4cc-4d06-87fb-d9557dd1ff9e",
            "name": "ACAI",
            "unii": "46AM2VJ0AW",
            "linking_id": "46AM2VJ0AW",
            "ref_pname": "ACAI",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "619d1933-d5e6-4a9b-b793-abca759d7717",
          "comments": "ORAC value expressed as umol TE/g for this compound was 7870 +/- 350.\nORAC is a chemical antioxidant assay that is based on the inhibition of the peroxyl-radical induced oxidation initiated by thermal decomposition of AAPH. CAP-e value expressed as GAE/g was 5040 +/- 260.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "c7dbe7a4-2e05-49d0-8622-095d0e21658e"
          ],
          "related_substance": {
            "uuid": "823fc521-0601-41d4-98e3-76a1ae748204",
            "refuuid": "46ab5b1a-f4c0-4c23-ad5c-bcc4dba3092f",
            "name": "ACAI FRUIT PULP",
            "unii": "51U7FI9EXO",
            "linking_id": "51U7FI9EXO",
            "ref_pname": "ACAI FRUIT PULP",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c7ae478a-aefe-4dcc-adfa-f0b2327bd277",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "13d11d36-d3f6-42c2-9ef3-15af06c31470"
          ],
          "related_substance": {
            "uuid": "b6a1d1f2-c088-4e70-be8e-d0b20e28a19e",
            "refuuid": "975b34dd-24d6-4363-900c-3a5d4a9dba32",
            "name": "PRIMULA VERIS FLOWER",
            "unii": "W5BET37294",
            "linking_id": "W5BET37294",
            "ref_pname": "PRIMULA VERIS FLOWER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e0d73b29-5347-418c-a31c-0d753d7a1307",
          "comments": "37% Cell growth rate of human acute promyelocytic leukemia HL-60 cells at 50 uM of compound vs control",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "2bb0cb7e-3cb7-4a0e-b474-829fa50d2bea"
          ],
          "related_substance": {
            "uuid": "ea8c5ca2-de68-448a-9142-8288296252a1",
            "refuuid": "f0c781b9-482b-457c-8c0c-f6d19a4ea7fc",
            "name": "CITRUS AURANTIUM FRUIT RIND",
            "unii": "055456JHI7",
            "linking_id": "055456JHI7",
            "ref_pname": "CITRUS AURANTIUM FRUIT RIND",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b01591b1-6dfc-4148-83fc-db67b84df8a0",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "ce1ee7ff-413b-45b7-aad7-c64b4c0f9caa"
          ],
          "related_substance": {
            "uuid": "22964bca-bd99-40a0-8dbb-49a3ec36d210",
            "refuuid": "8e61faef-71bb-4cbd-8b70-716ea0fd1d02",
            "name": "CANNABIS SATIVA SUBSP. INDICA TOP",
            "unii": "FTS5RM302N",
            "linking_id": "FTS5RM302N",
            "ref_pname": "CANNABIS SATIVA SUBSP. INDICA TOP",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5674535b-8e64-4d69-a0d6-c6acd0e09123",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "7f44dae8-91cb-4987-baf4-ef568111e974"
          ],
          "related_substance": {
            "uuid": "1f5778d4-fce8-4ed4-9bc5-3a791e893660",
            "refuuid": "8fa87a89-edcc-49bb-b128-3ee9838c7335",
            "name": "ARNICA MONTANA FLOWER",
            "unii": "OZ0E5Y15PZ",
            "linking_id": "OZ0E5Y15PZ",
            "ref_pname": "ARNICA MONTANA FLOWER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4a826581-fb7d-41ba-8c61-cd5792435250",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "1eb27e0f-53e8-47ff-b73d-b3593e75fbbb"
          ],
          "related_substance": {
            "uuid": "dd516fb9-de13-41be-ba5a-9681be322dec",
            "refuuid": "2ba21cff-62f7-40a2-aa50-daef1722fcad",
            "name": "CHAMAEMELUM NOBILE FLOWER",
            "unii": "O2T154T6OG",
            "linking_id": "O2T154T6OG",
            "ref_pname": "CHAMAEMELUM NOBILE FLOWER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "40bf5cbc-6239-4513-af96-0f914e4fa290",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "1eb27e0f-53e8-47ff-b73d-b3593e75fbbb"
          ],
          "related_substance": {
            "uuid": "bc09de10-1eeb-471d-a4f8-b7000c951741",
            "refuuid": "3347cc3f-fac6-4a3c-945d-f0bd68dd3c46",
            "name": "CHAMOMILE",
            "unii": "FGL3685T2X",
            "linking_id": "FGL3685T2X",
            "ref_pname": "CHAMOMILE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d6c9029b-15e2-43cb-b2aa-944fed7655a5",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "ee2183d1-ad11-4712-bed5-810150da1635",
            "refuuid": "5a26b9f9-0f16-4add-944c-6d068d18b740",
            "name": "FENUGREEK SEED",
            "unii": "654825W09Z",
            "linking_id": "654825W09Z",
            "ref_pname": "FENUGREEK SEED"
          }
        },
        {
          "uuid": "3b19d1a7-8450-070f-3b08-f01fbaa2b985",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "4479f6ad-002f-4f5b-ad0c-42819f582aa2"
          ],
          "related_substance": {
            "uuid": "bd30e40d-f1f1-454b-9c5a-c018e9eb703a",
            "refuuid": "b0f852a5-6050-4cda-af2a-a025a529e062",
            "name": "LUTEOLIN MONOHYDRATE",
            "unii": "N79TPJ3DTD",
            "linking_id": "N79TPJ3DTD",
            "ref_pname": "LUTEOLIN MONOHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "78d6b1d0-299a-4759-9591-5d8df66ad2de",
          "name": "4H-1-BENZOPYRAN-4-ONE, 2-(3,4-DIHYDROXYPHENYL)-5,7-DIHYDROXY-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 2-(3,4-DIHYDROXYPHENYL)-5,7-DIHYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c574cdbd-8f7d-41fb-b1df-09842af8a3fb",
            "a293c895-ac5e-4513-93ef-f0aaa4dc7c80"
          ],
          "display_name": false
        },
        {
          "uuid": "95cc923c-c2b7-4f57-85ff-bcd53fdf9e84",
          "name": "CYANIDENON-1470",
          "stdName": "CYANIDENON-1470",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c574cdbd-8f7d-41fb-b1df-09842af8a3fb",
            "a293c895-ac5e-4513-93ef-f0aaa4dc7c80"
          ],
          "display_name": false
        },
        {
          "uuid": "1fa8580e-5af3-4c11-b1de-7326ccfc082c",
          "name": "FLACITRAN",
          "stdName": "FLACITRAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c574cdbd-8f7d-41fb-b1df-09842af8a3fb",
            "a293c895-ac5e-4513-93ef-f0aaa4dc7c80"
          ],
          "display_name": false
        },
        {
          "uuid": "e84d9e6b-0a4c-4c5e-9f40-7bf954a9f19c",
          "name": "LUTEOLIN",
          "stdName": "LUTEOLIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e758fcdf-7219-48f1-9a12-113b0b48cc69",
            "671487c7-ab73-47e7-a0ae-dc7a1b0a383a",
            "cc35a89a-70bc-4d09-b477-831791ac8f52",
            "f7cb0bfd-be42-4203-81ae-34e4f941e7de",
            "a293c895-ac5e-4513-93ef-f0aaa4dc7c80",
            "b8a14190-5dcf-4c59-91e1-84611e567a31"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a13f630b-0bd2-477e-84ac-00cbc649d0bb",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7d50717f-b8d3-415b-bacc-58e3b72fa7b8",
          "name": "LUTEOLIN [MI]",
          "stdName": "LUTEOLIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "671487c7-ab73-47e7-a0ae-dc7a1b0a383a",
            "a293c895-ac5e-4513-93ef-f0aaa4dc7c80"
          ],
          "display_name": false
        },
        {
          "uuid": "9600d912-8b27-e753-a81a-78901f619b7e",
          "name": "Luteolin [WHO-DD]",
          "stdName": "LUTEOLIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3bdf5544-dceb-8a5a-71e7-b9bfe3b7fa12"
          ],
          "display_name": false
        },
        {
          "uuid": "ff87604a-8b62-4c7a-a65b-db479a44e0b3",
          "name": "SALIFAZIDE",
          "stdName": "SALIFAZIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c574cdbd-8f7d-41fb-b1df-09842af8a3fb",
            "a293c895-ac5e-4513-93ef-f0aaa4dc7c80"
          ],
          "display_name": false
        },
        {
          "uuid": "e5f146ba-fae3-48e8-a852-c9579d9da7af",
          "name": "WELD LAKE",
          "stdName": "WELD LAKE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c574cdbd-8f7d-41fb-b1df-09842af8a3fb",
            "a293c895-ac5e-4513-93ef-f0aaa4dc7c80"
          ],
          "display_name": false
        },
        {
          "uuid": "97dc7592-b75f-4278-a0b2-61a0279caca6",
          "name": "YAMA KARIYASU",
          "stdName": "YAMA KARIYASU",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c574cdbd-8f7d-41fb-b1df-09842af8a3fb",
            "a293c895-ac5e-4513-93ef-f0aaa4dc7c80"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f7cb0bfd-be42-4203-81ae-34e4f941e7de",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7f44dae8-91cb-4987-baf4-ef568111e974",
          "citation": "HERBAL MEDICINES 3RD ED 2007",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1eb27e0f-53e8-47ff-b73d-b3593e75fbbb",
          "citation": "HERBAL MEDICINES 4TH ED 2103",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1547cf25-9032-4204-8510-2e578ef20733",
          "citation": "SRS import [KUX1ZNC9J2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KUX1ZNC9J2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390950000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8dfcb824-e377-417a-ac4d-4ff2b9613416",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8a14190-5dcf-4c59-91e1-84611e567a31",
          "citation": "LUTEOLIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cc35a89a-70bc-4d09-b477-831791ac8f52",
          "citation": "LUTEOLIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "671487c7-ab73-47e7-a0ae-dc7a1b0a383a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a293c895-ac5e-4513-93ef-f0aaa4dc7c80",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e758fcdf-7219-48f1-9a12-113b0b48cc69",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c574cdbd-8f7d-41fb-b1df-09842af8a3fb",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f11a0d4-98b2-43e7-9cf6-bdc07f519124",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390950000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27797e90-83ac-4925-9da4-84d4d764649b",
          "citation": "XIE, C, ET AL, JOURNAL OF NUTRITIONAL BIOCHEMISTRY, 23(9)1184-1191,2012",
          "url": "http://ac.els-cdn.com/S0955286311002099/1-s2.0-S0955286311002099-main.pdf?_tid=356dc566-6531-11e4-a86b-00000aacb361&acdnat=1415222455_6a59cf52731cfba5e7bd34284567906b",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7dbe7a4-2e05-49d0-8622-095d0e21658e",
          "citation": "KANG, J ET AL, ANTI-OXIDANT CAPACITIES OF FLAVONOID COMPOUNDS ISOLATED FROM ACAI PULP (EUTERPE OLERACEA MART.), FOOD CHEMISTRY, 122(3)610-617, 2010",
          "url": "http://ac.els-cdn.com/S0308814610002803/1-s2.0-S0308814610002803-main.pdf?_tid=7db9d21c-65e3-11e4-be61-00000aacb35f&acdnat=1415299027_e71a88df70ad0a036c0b11155fc8f75c",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13d11d36-d3f6-42c2-9ef3-15af06c31470",
          "citation": "HERBAL MEDICINES 4TH ED",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2bb0cb7e-3cb7-4a0e-b474-829fa50d2bea",
          "citation": "SUGIYAMA S, CHEM PHARM BULL 41(4)714-19(1993)",
          "url": "https://www.jstage.jst.go.jp/article/cpb1958/41/4/41_4_714/_pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce1ee7ff-413b-45b7-aad7-c64b4c0f9caa",
          "citation": "CHAPTER 2 : CHEMISTRY AND ANALYSIS OF PHYTOCANNABINOIDS AND OTHER CANNABIS CONSTITUENTS BY RUDOLF BRENNEISEN; PAGES 17-49",
          "url": "http://www.medicinalgenomics.com/wp-content/uploads/2011/12/Chemical-constituents-of-cannabis.pdf",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a04289b4-fa57-57b7-fb14-024a48d7ecac",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9c3a798d-a024-a744-949f-b1b18dbb2dc6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=491-70-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ad4b9e5a-79f3-db59-943c-f84358daabc4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4479f6ad-002f-4f5b-ad0c-42819f582aa2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3bdf5544-dceb-8a5a-71e7-b9bfe3b7fa12",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "32774d11-0fdc-4d15-863a-a372798c3e97",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "750dd756-2bf7-aaf3-9e82-5bc5e2e7343e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ff820060-0946-245d-2568-e0a2084affd4",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7fde949e-6907-42fc-a935-81d0139e2486",
          "id": "7fde949e-6907-42fc-a935-81d0139e2486",
          "molfile": "\n  Marvin  01132106382D          \n\n 21 23  0  0  0  0            999 V2000\n    3.8531   -5.9219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6067   -5.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6067   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3511   -4.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3511   -3.4663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0667   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0667   -5.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3511   -5.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7720   -5.9219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4691   -5.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4691   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7720   -4.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7720   -3.4663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1362   -5.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1362   -6.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8414   -7.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5477   -6.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3809   -7.1271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5477   -5.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3014   -5.5013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8414   -5.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6 12  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 14  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 21  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1-c2cc(=O)c3c(cc(cc3o2)O)O)O)O",
          "formula": "C15H10O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1b8219d1-53bd-4d97-8282-a04a2b8623e9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "286.2369",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "17b6d74a-7d98-4b91-b491-072e2df10495",
      "version": "22",
      "structure": {
        "id": "1c99957e-2770-4399-aed1-4da02920255f",
        "molfile": "\n  Marvin  01132101392D          \n\n 21 23  0  0  0  0            999 V2000\n    6.0667   -5.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0667   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7720   -4.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4691   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4691   -5.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7720   -5.9219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1362   -5.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8414   -5.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5477   -5.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5477   -6.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3809   -7.1271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8414   -7.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1362   -6.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3014   -5.5013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7720   -3.4663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3511   -4.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6067   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6067   -5.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3511   -5.9219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8531   -5.9219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3511   -3.4663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13 12  1  0  0  0  0\n  7 13  2  0  0  0  0\n  9 14  1  0  0  0  0\n  3 15  2  0  0  0  0\n  2 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n  1 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 16 21  1  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1-c2cc(=O)c3c(cc(cc3o2)O)O)O)O",
        "formula": "C15H10O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "286.2369",
        "optical_activity": "NONE",
        "references": [
          "1547cf25-9032-4204-8510-2e578ef20733",
          "8dfcb824-e377-417a-ac4d-4ff2b9613416"
        ],
        "stereo_centers": 0
      },
      "unii": "KUX1ZNC9J2"
    }
  ]
}