{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7df7653f-f14e-4276-be81-664672aa5d05", "code": "110204-68-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=110204-68-7", "code_system": "CAS", "references": [ "37a9c7a5-66f4-4729-8ba1-0e01a054e9dd", "f5acda9b-1c36-4242-8a76-16644ff73d92" ] }, { "uuid": "d4052426-430b-7684-1298-bae07c50bcf0", "code": "DTXSID601021386", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601021386", "code_system": "EPA CompTox" }, { "uuid": "0f9d8ae3-6b45-4944-94a4-22005ff84b60", "code": "KT4PA9405Y", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "b25feb15-f98f-699f-63e1-e007c78b7c97", "code": "91936878", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91936878", "code_system": "PUBCHEM", "references": [ "cb7c2b00-8f47-6817-aa47-21ad91412549" ] } ], "substance_class": "chemical", "names": [ { "uuid": "419bf83e-1b9f-4c59-aebd-6e1822e63bf1", "name": "2-HYDROXYETHYL SORBITOL", "stdName": "2-HYDROXYETHYL SORBITOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8aadac7d-624a-415f-8fce-ecbcf6260905", "b77bceab-dc57-482d-aac7-acadccec612a" ], "display_name": true }, { "uuid": "66683a0a-01a7-40dc-90bd-1732660fc6dd", "name": "D-GLUCITOL, 2-O-(2-HYDROXYETHYL)-", "stdName": "D-GLUCITOL, 2-O-(2-HYDROXYETHYL)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "72aeed0e-8bb0-4953-a60d-9b32edfbf9a4", "b77bceab-dc57-482d-aac7-acadccec612a" ], "display_name": false } ], "references": [ { "uuid": "8aadac7d-624a-415f-8fce-ecbcf6260905", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "b77bceab-dc57-482d-aac7-acadccec612a", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "72aeed0e-8bb0-4953-a60d-9b32edfbf9a4", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "37a9c7a5-66f4-4729-8ba1-0e01a054e9dd", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393223000, "tags": [ "NOMEN" ] }, { "uuid": "4385db02-1306-4c85-bf59-798590eb75ec", "citation": "SRS import [KT4PA9405Y]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KT4PA9405Y", "doc_type": "SRS", "public_domain": true, "document_date": 1493393223000, "tags": [ "NOMEN" ] }, { "uuid": "f5acda9b-1c36-4242-8a76-16644ff73d92", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "cb7c2b00-8f47-6817-aa47-21ad91412549", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d350d55d-9c31-4980-b6df-6b2c0a0975a7", "id": "d350d55d-9c31-4980-b6df-6b2c0a0975a7", "molfile": "\n Marvin 01132110552D \n\n 15 14 0 0 1 0 999 V2000\n 13.4495 -3.1547 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 13.3992 -3.9868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7432 -2.7284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1195 -3.0696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1857 -2.7741 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 14.1857 -1.9545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8841 -3.2130 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 14.8841 -4.0496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6156 -2.8369 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 16.3139 -3.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0627 -2.8998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6156 -2.0174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8635 -1.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8635 -0.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1115 -0.2806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 5 1 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 6 1 1 0 0 0\n 7 5 1 0 0 0 0\n 7 8 1 1 0 0 0\n 9 7 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 12 1 6 0 0 0\n 11 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\nM END", "smiles": "C(CO[C@H](CO)[C@H]([C@@H]([C@H](CO)O)O)O)O", "formula": "C8H18O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "bb59923e-e1f5-4830-a4ff-c7942a146ad6" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "226.2247", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "8195c0ac-1123-47e7-9501-6649d90c6c1c", "version": "5", "structure": { "id": "9d553d14-bb8b-4da1-8660-1de8c9173f92", "molfile": "\n Marvin 01132108112D \n\n 15 14 0 0 1 0 999 V2000\n 12.7432 -2.7284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1195 -3.0696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4495 -3.1547 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.3992 -3.9868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1857 -2.7741 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.1857 -1.9545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8841 -3.2130 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.8841 -4.0496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6156 -2.8369 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.6156 -2.0174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3139 -3.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0627 -2.8998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8635 -1.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8635 -0.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1115 -0.2806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 0 0 0 0\n 3 4 1 1 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 1 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 1 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 6 0 0 0\n 9 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 10 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\nM END", "smiles": "C(CO[C@H](CO)[C@H]([C@@H]([C@H](CO)O)O)O)O", "formula": "C8H18O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "226.2247", "optical_activity": "UNSPECIFIED", "references": [ "72aeed0e-8bb0-4953-a60d-9b32edfbf9a4", "4385db02-1306-4c85-bf59-798590eb75ec" ], "stereo_centers": 4 }, "unii": "KT4PA9405Y" } ] }