{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1561d5af-47eb-4c8f-991b-5642927ad51f",
          "code": "23140-52-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=23140-52-5",
          "code_system": "CAS",
          "references": [
            "29e7b1b1-e023-4a3a-b700-f00f59df4b6f",
            "7687c4f8-5d70-4996-89e1-7227b2b700cc"
          ]
        },
        {
          "uuid": "d2115aef-8874-7d47-5a12-bb87dc781ec8",
          "code": "Psicose",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Psicose",
          "code_system": "WIKIPEDIA",
          "references": [
            "cabb7b63-f3eb-361c-4a7d-51294543e765"
          ]
        },
        {
          "uuid": "506ca36f-b723-8e3f-6133-3a4ef0dec05d",
          "code": "DB15087",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB15087",
          "code_system": "DRUG BANK",
          "references": [
            "f15a3bf3-a218-3d34-255e-8cb5a664159d"
          ]
        },
        {
          "uuid": "0a8ccb0c-66f1-4fce-8f85-69b12ddedd9a",
          "code": "KRF88IOA7T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c246c922-06fc-0d9a-6aea-e6f815afeef5",
          "code": "1013115",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1013115",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "f15a3bf3-a218-3d34-255e-8cb5a664159d"
          ]
        },
        {
          "uuid": "3cf5f238-686e-9e17-84c0-f271ab14937a",
          "code": "33951",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:33951",
          "code_system": "CHEBI",
          "references": [
            "f15a3bf3-a218-3d34-255e-8cb5a664159d"
          ]
        },
        {
          "uuid": "cf4156eb-523f-ac34-4b32-72d22a0d4df6",
          "code": "DTXSID901018792",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901018792",
          "code_system": "EPA CompTox",
          "references": [
            "f15a3bf3-a218-3d34-255e-8cb5a664159d"
          ]
        },
        {
          "uuid": "d0e47da1-0b6f-6672-43de-ea9a4c8a7d32",
          "code": "498",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=498",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "f15a3bf3-a218-3d34-255e-8cb5a664159d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "caa0b5cc-29bd-4878-9dda-bb166a451325",
          "name": "ALLULOSE",
          "stdName": "ALLULOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "747530fc-29df-43b2-8cdd-fe3b53f6082f",
            "ae659320-8d4e-493e-b41f-28accb5bd0e9"
          ],
          "display_name": false
        },
        {
          "uuid": "eb13a25c-73c9-97c8-a966-c0f47b18f3a4",
          "name": "ALLULOSE [USP-RS]",
          "stdName": "ALLULOSE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7e7d70f-0001-1cda-6171-972eb5cdd1d8"
          ],
          "display_name": false
        },
        {
          "uuid": "4f983b56-f135-4827-b4c7-a029daea077b",
          "name": "DL-PSICOSE",
          "stdName": "DL-PSICOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "747530fc-29df-43b2-8cdd-fe3b53f6082f",
            "ae659320-8d4e-493e-b41f-28accb5bd0e9"
          ],
          "display_name": false
        },
        {
          "uuid": "6d7d9fab-ff7c-4adb-9b14-90412cb85c46",
          "name": "ERYTHROHEXULOSE",
          "stdName": "ERYTHROHEXULOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "747530fc-29df-43b2-8cdd-fe3b53f6082f",
            "ae659320-8d4e-493e-b41f-28accb5bd0e9"
          ],
          "display_name": false
        },
        {
          "uuid": "6e7c9e46-4288-424f-8062-4bc2db22fc72",
          "name": "PSEUDOFRUCTOSE",
          "stdName": "PSEUDOFRUCTOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "747530fc-29df-43b2-8cdd-fe3b53f6082f",
            "ae659320-8d4e-493e-b41f-28accb5bd0e9"
          ],
          "display_name": false
        },
        {
          "uuid": "9b58e4f0-f77f-4767-9df1-bf0cdd0a3c0a",
          "name": "PSICOSE",
          "stdName": "PSICOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "747530fc-29df-43b2-8cdd-fe3b53f6082f",
            "ae659320-8d4e-493e-b41f-28accb5bd0e9"
          ],
          "display_name": false
        },
        {
          "uuid": "6b2f9b9f-87fe-44b6-b236-af2d5143af59",
          "name": "PSICOSE, DL-",
          "stdName": "PSICOSE, DL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "747530fc-29df-43b2-8cdd-fe3b53f6082f",
            "ce373cf5-5534-4269-991c-31cb27ed9f58"
          ],
          "display_name": true
        },
        {
          "uuid": "de9712ce-d911-4b96-9b18-ec34710275fa",
          "name": "RIBO-2-HEXULOSE",
          "stdName": "RIBO-2-HEXULOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "747530fc-29df-43b2-8cdd-fe3b53f6082f",
            "ae659320-8d4e-493e-b41f-28accb5bd0e9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ce373cf5-5534-4269-991c-31cb27ed9f58",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "747530fc-29df-43b2-8cdd-fe3b53f6082f",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae659320-8d4e-493e-b41f-28accb5bd0e9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29e7b1b1-e023-4a3a-b700-f00f59df4b6f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393133000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a497bcff-1164-4711-aaeb-e513a5298e0c",
          "citation": "SRS import [KRF88IOA7T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KRF88IOA7T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393133000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cabb7b63-f3eb-361c-4a7d-51294543e765",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Psicose",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6ef02caa-1072-9cd8-53c5-fe4a6a82c564",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "7687c4f8-5d70-4996-89e1-7227b2b700cc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f15a3bf3-a218-3d34-255e-8cb5a664159d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a7e7d70f-0001-1cda-6171-972eb5cdd1d8",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "f849b76d-33a3-0934-1f9e-9c41db4f51b9",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9e2dbf03-8449-419c-9737-0dae6988afd3",
          "id": "9e2dbf03-8449-419c-9737-0dae6988afd3",
          "molfile": "\n  Marvin  01132108132D          \n\n 12 11  0  0  0  0            999 V2000\n    7.8286   -5.5627    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.8286   -6.3877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1141   -5.1502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3997   -5.5628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5431   -5.1502    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.5431   -4.3252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2576   -5.5627    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.2576   -6.3877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9721   -5.1502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9721   -4.3252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6865   -5.5627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4010   -5.1502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
          "smiles": "C([C@H]([C@H]([C@H](C(=O)CO)O)O)O)O",
          "formula": "C6H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a2d13fde-1c97-4ba7-b0c4-d43616b5b227"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "180.1561",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a7532018-9201-41f0-acff-21a9b57a320d",
      "version": "18",
      "structure": {
        "id": "4f49ee76-0567-46b6-a0d9-991949f06927",
        "molfile": "\n  Marvin  01132104082D          \n\n 12 11  0  0  0  0            999 V2000\n    8.5431   -5.1502    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.8286   -5.5627    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.2576   -5.5627    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.5431   -4.3252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8286   -6.3877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1141   -5.1502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3997   -5.5628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2576   -6.3877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9721   -5.1502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9721   -4.3252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6865   -5.5627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4010   -5.1502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  1  0  0  0\n  2  5  1  6  0  0  0\n  2  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  3  8  1  6  0  0  0\n  3  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\nM  END",
        "smiles": "C([C@H]([C@H]([C@H](C(=O)CO)O)O)O)O",
        "formula": "C6H12O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "180.1561",
        "optical_activity": "( + / - )",
        "references": [
          "ae659320-8d4e-493e-b41f-28accb5bd0e9",
          "a497bcff-1164-4711-aaeb-e513a5298e0c"
        ],
        "stereo_centers": 3
      },
      "unii": "KRF88IOA7T"
    }
  ]
}