{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1de8aa41-5166-4f0c-9740-7ad6dbf131e3", "code": "51947-52-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=51947-52-5", "code_system": "CAS", "references": [ "d6ca2fed-3ee6-44a5-9ce9-40bba753185c", "8ea05288-7530-48a4-b43b-f4d12e589e61" ] }, { "uuid": "99ccf2fc-f8ce-4a48-9ff6-f3e210b70cc4", "code": "257-541-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.052.293", "code_system": "ECHA (EC/EINECS)", "references": [ "d6ca2fed-3ee6-44a5-9ce9-40bba753185c" ] }, { "uuid": "2f2fc4d1-c814-46d7-b3f5-3e1d0f1cd88f", "code": "104025", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/104025", "code_system": "PUBCHEM", "references": [ "d6ca2fed-3ee6-44a5-9ce9-40bba753185c" ] }, { "uuid": "9284e238-82fa-efa2-de3a-16e053d03bad", "code": "DTXSID6068690", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6068690", "code_system": "EPA CompTox", "references": [ "f562c89b-bbfc-083f-e835-dc3d771338cc" ] }, { "uuid": "96bc7993-ec02-430b-9487-ba3b180aad03", "code": "KM9K7CSX7E", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "4728147c-f413-45e2-991e-180fe0536a06", "name": "BENZOIC ACID, 2-AMINO-5-((4-AMINOPHENYL)METHYL)-, METHYL ESTER", "stdName": "BENZOIC ACID, 2-AMINO-5-((4-AMINOPHENYL)METHYL)-, METHYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a65615f5-c4e8-475f-9b10-495d3c27462d", "f525dcbe-e2ff-4ae1-8767-c3b65e163229" ], "display_name": false }, { "uuid": "0059844d-7cab-4230-adbe-6ecff7790adb", "name": "METHYL 2-AMINO-5-((4-AMINOPHENYL)METHYL)BENZOATE", "stdName": "METHYL 2-AMINO-5-((4-AMINOPHENYL)METHYL)BENZOATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8ea05288-7530-48a4-b43b-f4d12e589e61" ], "display_name": false }, { "uuid": "eceef02a-af8e-4758-9feb-300319d85193", "name": "METHYL 5-((4-AMINOPHENYL)METHYL)ANTHRANILATE", "stdName": "METHYL 5-((4-AMINOPHENYL)METHYL)ANTHRANILATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "21962050-6e92-4a44-89c0-c8ab3c93439b" ], "display_name": true } ], "references": [ { "uuid": "f525dcbe-e2ff-4ae1-8767-c3b65e163229", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a65615f5-c4e8-475f-9b10-495d3c27462d", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d6ca2fed-3ee6-44a5-9ce9-40bba753185c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393973000, "tags": [ "NOMEN" ] }, { "uuid": "f562c89b-bbfc-083f-e835-dc3d771338cc", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=51947-52-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "21962050-6e92-4a44-89c0-c8ab3c93439b", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8ea05288-7530-48a4-b43b-f4d12e589e61", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "fb06ad3e-309f-4d0f-93eb-a0a0c983e632", "id": "fb06ad3e-309f-4d0f-93eb-a0a0c983e632", "molfile": "\n Marvin 01132113002D \n\n 19 20 0 0 0 0 999 V2000\n 7.4621 -10.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6200 -10.7773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9105 -10.3646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1926 -10.7770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9128 -9.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1997 -9.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2044 -8.2967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4925 -7.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7755 -8.2879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0606 -7.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3482 -8.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3423 -9.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6242 -9.5089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0488 -9.5202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7696 -9.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9180 -7.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6309 -8.3062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6304 -9.1269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3444 -9.5402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 3 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 18 2 0 0 0 0\n 7 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 16 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 15 9 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\nM END", "smiles": "COC(=O)c1cc(ccc1N)Cc2ccc(cc2)N", "formula": "C15H16N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8ca74198-98a5-47b5-9dff-d47eef218765" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "256.3003", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "3179f9ec-c37b-469e-84bc-1af67ef4d3cc", "version": "5", "structure": { "id": "858ad3bc-a98a-426d-b2c5-4687a75bbf04", "molfile": "\n Marvin 01132106562D \n\n 19 20 0 0 0 0 999 V2000\n 5.1926 -10.7770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9105 -10.3646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6200 -10.7773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4621 -10.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9128 -9.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6304 -9.1269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3444 -9.5402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6309 -8.3062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9180 -7.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2044 -8.2967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4925 -7.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7755 -8.2879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0606 -7.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3482 -8.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3423 -9.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6242 -9.5089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0488 -9.5202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7696 -9.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1997 -9.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 12 2 0 0 0 0\n 10 19 1 0 0 0 0\n 19 5 2 0 0 0 0\nM END", "smiles": "COC(=O)c1cc(ccc1N)Cc2ccc(cc2)N", "formula": "C15H16N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "256.3003", "optical_activity": "NONE", "references": [ "f525dcbe-e2ff-4ae1-8767-c3b65e163229" ], "stereo_centers": 0 }, "unii": "KM9K7CSX7E" } ] }