{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1a05d37f-47c2-4e1d-8479-63b737b5a600",
          "code": "559-70-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=559-70-6",
          "code_system": "CAS",
          "references": [
            "f7204ac3-f566-4a7f-bc32-471d0044a136",
            "7460df75-26d2-4a06-b68f-7ef5713b9e56"
          ]
        },
        {
          "uuid": "b7268283-ce5c-413f-bedf-f67feb73db67",
          "code": "C036380",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67036380",
          "code_system": "MESH",
          "references": [
            "f7204ac3-f566-4a7f-bc32-471d0044a136"
          ]
        },
        {
          "uuid": "1d4cbb16-4f2f-4975-a642-1b565b5ab586",
          "code": "AMYRIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Amyrin",
          "code_system": "WIKIPEDIA",
          "references": [
            "f7204ac3-f566-4a7f-bc32-471d0044a136"
          ]
        },
        {
          "uuid": "2cdd95a0-df99-4631-8a41-9b026e55f5ae",
          "code": "209-204-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.368",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f7204ac3-f566-4a7f-bc32-471d0044a136"
          ]
        },
        {
          "uuid": "dfcf90b0-16c6-4f0a-b6e2-a536e597800f",
          "code": "m1881",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1881?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f7204ac3-f566-4a7f-bc32-471d0044a136"
          ]
        },
        {
          "uuid": "8abbc2ea-b207-4a15-9791-7ab9e9178523",
          "code": "73145",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73145",
          "code_system": "PUBCHEM",
          "references": [
            "f7204ac3-f566-4a7f-bc32-471d0044a136"
          ]
        },
        {
          "uuid": "33463e07-724c-4987-9f4e-980806c3057d",
          "code": "KM8353IPSO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a56803cd-7fab-c35e-cb2c-4960875502f9",
          "code": "10352",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:10352",
          "code_system": "CHEBI",
          "references": [
            "8febfa33-69a0-f607-c8d5-d2d4b5a4a9e1"
          ]
        },
        {
          "uuid": "4dee8279-60ee-b726-58ba-ac60ea47659e",
          "code": "DTXSID201025005",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201025005",
          "code_system": "EPA CompTox",
          "references": [
            "8febfa33-69a0-f607-c8d5-d2d4b5a4a9e1"
          ]
        },
        {
          "uuid": "8bf63919-1cce-24cd-327b-b42aed930dc6",
          "code": "527971",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=527971",
          "code_system": "NSC",
          "references": [
            "befdbc0a-9d3d-e9f8-7a91-de265c6029cf"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0b39777f-e3f4-44b7-88b0-2a3d37cefc8c",
          "comments": "CALENDULA OFFICINALIS FLOWER terpenoid",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "91c503ac-1c66-42a7-a36f-bdfb555bbb76"
          ],
          "related_substance": {
            "uuid": "03d55dae-2f4e-46b2-b0a9-3bcf52b9b660",
            "refuuid": "e2dbbdeb-f16f-4daa-8570-a3f703139cb9",
            "name": "CALENDULA OFFICINALIS FLOWER",
            "unii": "P0M7O4Y7YD",
            "linking_id": "P0M7O4Y7YD",
            "ref_pname": "CALENDULA OFFICINALIS FLOWER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "691e5da9-0a8b-46d5-81a2-ff16e2faf9ba",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "91c503ac-1c66-42a7-a36f-bdfb555bbb76"
          ],
          "related_substance": {
            "uuid": "d0760398-18f5-469a-8a6f-005d08e53d96",
            "refuuid": "2f00e021-a109-40d1-bf86-43b69127d5f4",
            "name": "CENTAURIUM ERYTHRAEA WHOLE",
            "unii": "T0N9DND3W1",
            "linking_id": "T0N9DND3W1",
            "ref_pname": "CENTAURIUM ERYTHRAEA WHOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3d971bdb-e331-4487-87d3-6f7092cb25a6",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "cf62b9a2-917e-4584-b077-2a687cc3e555"
          ],
          "related_substance": {
            "uuid": "95a929ac-9e7a-47d3-a433-dadcf6c3f498",
            "refuuid": "4970c3f6-62a4-4374-856c-03a20cc08401",
            "name": "VIBURNUM OPULUS BARK",
            "unii": "T1UG6H6805",
            "linking_id": "T1UG6H6805",
            "ref_pname": "VIBURNUM OPULUS BARK",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "69bc2425-782c-49ea-addd-3bd46d0ebd4a",
          "name": ".BETA.-AMYRENOL",
          "stdName": ".BETA.-AMYRENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d434d622-e517-4c80-bca3-d27f5810eb89",
            "74fa6f57-8432-47f2-a924-fe6bbae56c5e"
          ],
          "display_name": false
        },
        {
          "uuid": "ec64c64a-a80e-4ca2-9c3a-38e202b499b8",
          "name": ".BETA.-AMYRIN",
          "stdName": ".BETA.-AMYRIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2db1b6b-8b45-4040-ab71-046070c87d49",
            "24754d2b-9b6b-4607-99d3-4b347e0e8b24",
            "d434d622-e517-4c80-bca3-d27f5810eb89",
            "7dd05155-eabc-4206-a22b-01cd24d3720a"
          ],
          "display_name": true
        },
        {
          "uuid": "e32b664b-f963-4b5c-92b0-52161605dd82",
          "name": ".BETA.-AMYRIN [MI]",
          "stdName": ".BETA.-AMYRIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a2db1b6b-8b45-4040-ab71-046070c87d49",
            "d434d622-e517-4c80-bca3-d27f5810eb89"
          ],
          "display_name": false
        },
        {
          "uuid": "0a561868-bfad-4c0b-ac4a-1117aa1aeb72",
          "name": "AMYRIN",
          "stdName": "AMYRIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d434d622-e517-4c80-bca3-d27f5810eb89",
            "74fa6f57-8432-47f2-a924-fe6bbae56c5e"
          ],
          "display_name": false
        },
        {
          "uuid": "8d8c4720-e556-437f-b793-c3e0382711a2",
          "name": "AMYRIN, BETA-",
          "stdName": "AMYRIN, BETA-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e52a78fe-7a7b-4875-8c29-8c721e1414ae"
          ],
          "display_name": false
        },
        {
          "uuid": "ed9fcf07-7a71-4a8a-b941-1834008cdd6a",
          "name": "NSC-527971",
          "stdName": "NSC-527971",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d434d622-e517-4c80-bca3-d27f5810eb89",
            "74fa6f57-8432-47f2-a924-fe6bbae56c5e"
          ],
          "display_name": false
        },
        {
          "uuid": "385811b8-f10d-458a-8e75-2d3b369e6f94",
          "name": "OLEAN-12-EN-3.BETA.-OL",
          "stdName": "OLEAN-12-EN-3.BETA.-OL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d434d622-e517-4c80-bca3-d27f5810eb89",
            "74fa6f57-8432-47f2-a924-fe6bbae56c5e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e52a78fe-7a7b-4875-8c29-8c721e1414ae",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a2db1b6b-8b45-4040-ab71-046070c87d49",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d434d622-e517-4c80-bca3-d27f5810eb89",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24754d2b-9b6b-4607-99d3-4b347e0e8b24",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74fa6f57-8432-47f2-a924-fe6bbae56c5e",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7204ac3-f566-4a7f-bc32-471d0044a136",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390994000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "91c503ac-1c66-42a7-a36f-bdfb555bbb76",
          "citation": "HERBAL MEDICINES 4TH ED 2103",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf62b9a2-917e-4584-b077-2a687cc3e555",
          "citation": "HERBAL MEDICINES 4TH ED",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8df5c6cf-4b23-4b7e-aeb7-8b4e711ee307",
          "citation": "SRS import [KM8353IPSO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KM8353IPSO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390994000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9047442-084f-4bbb-8e5b-c784484f53c0",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7dd05155-eabc-4206-a22b-01cd24d3720a",
          "citation": ".BETA.-AMYRIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8febfa33-69a0-f607-c8d5-d2d4b5a4a9e1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "befdbc0a-9d3d-e9f8-7a91-de265c6029cf",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7460df75-26d2-4a06-b68f-7ef5713b9e56",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8aa6d9e1-0189-4546-b92a-aaa0d0ff4ca3",
          "id": "8aa6d9e1-0189-4546-b92a-aaa0d0ff4ca3",
          "molfile": "\n  Marvin  01132107122D          \n\n 31 35  0  0  1  0            999 V2000\n    3.9643   -7.4621    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.3186   -7.8957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9643   -6.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6925   -6.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4100   -6.6460    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.4100   -5.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4100   -7.4621    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.1277   -7.8698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8505   -7.4621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8505   -6.6460    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.8505   -5.8147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1277   -6.2330    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.1277   -5.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8505   -5.0094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5732   -5.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2755   -4.9992    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.2755   -4.1883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9880   -3.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7010   -3.3676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2755   -3.3676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7010   -4.1985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7010   -5.0094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9828   -5.4123    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.5562   -5.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9828   -6.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2755   -6.6359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5732   -6.2330    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.5732   -7.0592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6925   -7.8698    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6925   -8.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0157   -8.3863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1 29  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  5 12  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 29  1  1  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  1  0  0  0\n 12 10  1  0  0  0  0\n 10 27  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  6  0  0  0\n 15 27  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 23  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  1  0  0  0  0\n 18 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  1  0  0  0\n 23 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  6  0  0  0\n 30 29  1  0  0  0  0\n 31 29  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@]43C)O)[C@@H]2C1",
          "formula": "C30H50O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "02142425-bbd0-4b5b-af5c-51763ff98a66"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "426.7185",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ed24ef61-f5f9-44ac-8acd-ba0e7b1376e2",
      "version": "5",
      "structure": {
        "id": "465483e7-e660-4039-97b2-33e3d15b9879",
        "molfile": "\n  Marvin  01132103422D          \n\n 34 38  0  0  1  0            999 V2000\n    7.5715   -6.2316    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.5715   -5.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2736   -4.9981    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2736   -4.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9860   -3.7851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6988   -3.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2736   -3.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6988   -4.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6988   -5.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9808   -5.4111    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.9808   -6.2316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2736   -6.6344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5540   -5.9839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2736   -5.8241    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8489   -5.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1263   -5.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1263   -6.2316    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.4088   -6.6445    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6914   -6.2316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9634   -6.6445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9634   -7.4604    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6914   -7.8680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4088   -7.4604    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.1263   -7.8680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8489   -7.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8489   -6.6445    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.8489   -5.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5329   -8.2606    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6914   -8.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0148   -8.3844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3178   -7.8939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4088   -5.6019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1263   -7.0576    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5715   -7.0576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  1  1  0  0  0  0\n 10 13  1  1  0  0  0\n  3 10  1  0  0  0  0\n  3 14  1  1  0  0  0\n 15  2  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26  1  1  0  0  0  0\n 17 26  1  0  0  0  0\n 26 27  1  1  0  0  0\n 23 28  1  6  0  0  0\n 18 23  1  0  0  0  0\n 29 22  1  0  0  0  0\n 30 22  1  0  0  0  0\n 21 31  1  1  0  0  0\n 18 32  1  1  0  0  0\n 17 33  1  6  0  0  0\n  1 34  1  6  0  0  0\nM  END",
        "smiles": "CC1(C)CC[C@]2(C)CC[C@]3(C)C(=CC[C@]4([H])[C@@]5(C)CC[C@@H](C(C)(C)[C@]5([H])CC[C@]43C)O)[C@]2([H])C1",
        "formula": "C30H50O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "426.7185",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e9047442-084f-4bbb-8e5b-c784484f53c0",
          "8df5c6cf-4b23-4b7e-aeb7-8b4e711ee307"
        ],
        "stereo_centers": 8
      },
      "unii": "KM8353IPSO"
    }
  ]
}