{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a52ff276-835a-4c0e-9e9f-622e2e144055",
          "code": "39923-41-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=39923-41-6",
          "code_system": "CAS",
          "references": [
            "64ebf65f-50c1-4e96-ac0a-8105a24d1ef4",
            "ad749c75-7bb4-404c-89f7-da5a8b28c94a"
          ]
        },
        {
          "uuid": "3696e2c1-46b3-4422-846e-773d31b64d24",
          "code": "54678442",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54678442",
          "code_system": "PUBCHEM",
          "references": [
            "64ebf65f-50c1-4e96-ac0a-8105a24d1ef4"
          ]
        },
        {
          "uuid": "5b9387a5-7597-b3d1-a508-c5e134335d7e",
          "code": "DTXSID40192973",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40192973",
          "code_system": "EPA CompTox",
          "references": [
            "e3339971-c9f8-d7bf-9379-66b7ee818bca"
          ]
        },
        {
          "uuid": "ed8c105c-f5ce-4ac8-9d29-c61ae518593d",
          "code": "KM7NF9BVF9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "53f6cec6-86ec-f09f-f88f-bf92b24cc204",
          "code": "240925",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=240925",
          "code_system": "NSC",
          "references": [
            "9b3511b0-75ab-2bc7-ae44-5c06a13025aa"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "99bf66b6-a478-7349-dfd9-4521a74ff966",
          "name": "2H-1-BENZOPYRAN-2-ONE, 4-HYDROXY-3-(1-NAPHTHALENYL)-",
          "stdName": "2H-1-BENZOPYRAN-2-ONE, 4-HYDROXY-3-(1-NAPHTHALENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b66dd460-2a02-7fe6-5332-182c62d96b59"
          ],
          "display_name": false
        },
        {
          "uuid": "69b5381a-1957-bd5c-b49c-ee2491979d9f",
          "name": "4-HYDROXY-3-(1-NAPHTHALENYL)-2H-1-BENZOPYRAN-2-ONE",
          "stdName": "4-HYDROXY-3-(1-NAPHTHALENYL)-2H-1-BENZOPYRAN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b66dd460-2a02-7fe6-5332-182c62d96b59"
          ],
          "display_name": false
        },
        {
          "uuid": "d5ff3064-a1fb-0b0c-0cb2-12e9504b1df7",
          "name": "4-HYDROXY-3-(1-NAPHTHYL)COUMARIN",
          "stdName": "4-HYDROXY-3-(1-NAPHTHYL)COUMARIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b66dd460-2a02-7fe6-5332-182c62d96b59"
          ],
          "display_name": true
        },
        {
          "uuid": "0924996c-a69f-4def-5795-9a005c12d464",
          "name": "COUMARIN, 4-HYDROXY-3-(1-NAPHTHYL)-",
          "stdName": "COUMARIN, 4-HYDROXY-3-(1-NAPHTHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b66dd460-2a02-7fe6-5332-182c62d96b59"
          ],
          "display_name": false
        },
        {
          "uuid": "6e68ddde-3361-493d-9940-cd23c10abd16",
          "name": "COUMARIN, 4-HYDROXY-3-(ALPHA-NAPHTHYL)-",
          "stdName": "COUMARIN, 4-HYDROXY-3-(ALPHA-NAPHTHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01a11fa8-edc2-419a-9a90-1c0e39262aa2",
            "7c213e4b-f7ca-40ab-b569-c444f682c27d"
          ],
          "display_name": false
        },
        {
          "uuid": "37dd3b81-f716-47c3-b9d0-63a5a8f999b2",
          "name": "NSC-240925",
          "stdName": "NSC-240925",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01a11fa8-edc2-419a-9a90-1c0e39262aa2",
            "7c213e4b-f7ca-40ab-b569-c444f682c27d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "01a11fa8-edc2-419a-9a90-1c0e39262aa2",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c213e4b-f7ca-40ab-b569-c444f682c27d",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64ebf65f-50c1-4e96-ac0a-8105a24d1ef4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394177000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3339971-c9f8-d7bf-9379-66b7ee818bca",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=39923-41-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b66dd460-2a02-7fe6-5332-182c62d96b59",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9b3511b0-75ab-2bc7-ae44-5c06a13025aa",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ad749c75-7bb4-404c-89f7-da5a8b28c94a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "951bfccf-f66b-441f-992e-8e1df2775205",
          "id": "951bfccf-f66b-441f-992e-8e1df2775205",
          "molfile": "\n  Marvin  01132107442D          \n\n 22 25  0  0  0  0            999 V2000\n    0.8717    1.7207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1653    1.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5433    1.7022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2539    1.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9728    1.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6792    1.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6792    0.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9728    0.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2539    0.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5433    0.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5433   -0.7643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1653    0.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8717    0.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5844    0.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2930    0.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2930   -0.7643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5741   -1.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5741   -1.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8655   -2.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1529   -2.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1529   -1.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8717   -0.7643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 12  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 22  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 22 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)cccc2-c3c(=O)c4ccccc4oc3O",
          "formula": "C19H12O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ef467d81-bba0-43f6-b621-b079f6cb9496"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "288.2975",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d6f5cd96-7af2-49cd-8f53-b5ff6115d50c",
      "version": "7",
      "structure": {
        "id": "93d568cc-44df-4bc9-990b-1e512c9c74e7",
        "molfile": "\n  Marvin  01132107402D          \n\n 22 25  0  0  0  0            999 V2000\n    0.8717    0.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1653    0.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8717   -0.7643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5844    0.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5433    0.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1653    1.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5741   -1.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1529   -1.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2930    0.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2539    0.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5433   -0.7643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5433    1.7022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8717    1.7207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2930   -0.7643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5741   -1.9996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1529   -2.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2539    1.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9728    0.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8655   -2.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9728    1.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6792    0.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6792    1.3014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  2  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  3  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6 12  1  0  0  0  0\n  6 13  2  0  0  0  0\n  7 14  1  0  0  0  0\n  7 15  1  0  0  0  0\n  8 16  2  0  0  0  0\n 10 17  2  0  0  0  0\n 10 18  1  0  0  0  0\n 15 19  2  0  0  0  0\n 17 20  1  0  0  0  0\n 18 21  2  0  0  0  0\n 20 22  2  0  0  0  0\n  9 14  2  0  0  0  0\n 12 17  1  0  0  0  0\n 16 19  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)cccc2-c3c(c4ccccc4oc3=O)O",
        "formula": "C19H12O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "288.2975",
        "optical_activity": "NONE",
        "references": [
          "b66dd460-2a02-7fe6-5332-182c62d96b59",
          "01a11fa8-edc2-419a-9a90-1c0e39262aa2"
        ],
        "stereo_centers": 0
      },
      "unii": "KM7NF9BVF9"
    }
  ]
}