{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "da87d403-2983-4085-8ecf-e761aeeee228", "code": "337458-27-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=337458-27-2", "code_system": "CAS", "references": [ "263714ba-9cf5-442c-b797-d2ddd87a8cc0", "74650955-129a-4db5-902f-c27cd1474d88" ] }, { "uuid": "d4aa91c9-3eee-43d4-b3c8-9c87e97397d3", "code": "555555", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:328", "code_system": "EPA PESTICIDE CODE", "references": [ "263714ba-9cf5-442c-b797-d2ddd87a8cc0" ] }, { "uuid": "d26f4fd5-c712-4954-8444-7a516ba3d899", "code": "11842644", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11842644", "code_system": "PUBCHEM", "references": [ "263714ba-9cf5-442c-b797-d2ddd87a8cc0" ] }, { "uuid": "bbd1c2db-f418-c562-b8b8-6e8a598159dc", "code": "DTXSID6058057", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6058057", "code_system": "EPA CompTox", "references": [ "3f355e46-8df9-51be-3b51-0cc4a948e3f3" ] }, { "uuid": "291a655a-3910-47f5-9140-f113cda1876e", "code": "KKS8BX5SNW", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "404d85ee-ecdd-bf57-19ae-86f166a97f59", "code": "pyrifluquinazon", "type": "PRIMARY", "url": "https://pesticidecompendium.bcpc.org/pyrifluquinazon.html", "code_system": "ALANWOOD", "references": [ "93626ae8-fbb6-d9cf-b6dd-bb12ac5c4cdd" ] } ], "substance_class": "chemical", "names": [ { "uuid": "e46ed620-a02d-40f7-b9d2-5d2c4b3879ed", "name": "1-ACETYL-1,2,3,4-TETRAHYDRO-3-((3-PYRIDYLMETHYL)AMINO)-6-(1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL)QUINAZOLIN-2-ONE", "stdName": "1-ACETYL-1,2,3,4-TETRAHYDRO-3-((3-PYRIDYLMETHYL)AMINO)-6-(1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL)QUINAZOLIN-2-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fd562bd5-0e16-491b-8b07-fd6f5fa299b9", "374f095a-e8c5-41c8-8b54-83ef2ad0f79c" ], "display_name": false }, { "uuid": "d91e8d1d-daab-49e5-b975-6546d72af8c2", "name": "1-ACETYL-3,4-DIHYDRO-3-((3-PYRIDINYLMETHYL)AMINO)-6-(1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL)-2(1H)-QUINAZOLINONE", "stdName": "1-ACETYL-3,4-DIHYDRO-3-((3-PYRIDINYLMETHYL)AMINO)-6-(1,2,2,2-TETRAFLUORO-1-(TRIFLUOROMETHYL)ETHYL)-2(1H)-QUINAZOLINONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bbac5f5a-186a-4290-86cf-7872dfd84af8", "fd562bd5-0e16-491b-8b07-fd6f5fa299b9" ], "display_name": false }, { "uuid": "767170e7-8322-485d-9b44-ff7882762407", "name": "PYRIFLUQUINAZON", "stdName": "PYRIFLUQUINAZON", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ceaba186-b51f-4d44-9f47-ac18373de510", "87e0fa70-1d01-42a5-a20f-c359f454fddc", "6e8f0ce7-7f83-413c-b989-b4a9e12afca9", "1a7541d2-623a-468f-ab68-dbb79d699aad" ], "display_name": true }, { "uuid": "79522992-a9ce-4e4f-b6a2-8d3aab3db922", "name": "PYRIFLUQUINAZON [ISO]", "stdName": "PYRIFLUQUINAZON [ISO]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ceaba186-b51f-4d44-9f47-ac18373de510", "87e0fa70-1d01-42a5-a20f-c359f454fddc" ], "display_name": false } ], "references": [ { "uuid": "fd562bd5-0e16-491b-8b07-fd6f5fa299b9", "citation": "ALANWOOD.NET", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "374f095a-e8c5-41c8-8b54-83ef2ad0f79c", "citation": "ALANWOOD IUPAC", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bbac5f5a-186a-4290-86cf-7872dfd84af8", "citation": "ALANWOOD CAS", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1a7541d2-623a-468f-ab68-dbb79d699aad", "citation": "ALANWOOD.NET 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "87e0fa70-1d01-42a5-a20f-c359f454fddc", "citation": "http://www.alanwood.net/pesticides/pyrifluquinazon.html", "url": "http://www.alanwood.net/pesticides/pyrifluquinazon.html", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ceaba186-b51f-4d44-9f47-ac18373de510", "citation": "ISO", "doc_type": "ISO", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "263714ba-9cf5-442c-b797-d2ddd87a8cc0", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390982000, "tags": [ "NOMEN" ] }, { "uuid": "2fd34f90-5eff-4b32-918f-ffd78fe61abc", "citation": "SRS import [KKS8BX5SNW]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KKS8BX5SNW", "doc_type": "SRS", "public_domain": true, "document_date": 1493390982000, "tags": [ "NOMEN" ] }, { "uuid": "7840327a-cefd-43e3-b8f6-1029878647cf", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6e8f0ce7-7f83-413c-b989-b4a9e12afca9", "citation": "PYRIFLUQUINAZON [ISO]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3f355e46-8df9-51be-3b51-0cc4a948e3f3", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=337458-27-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "93626ae8-fbb6-d9cf-b6dd-bb12ac5c4cdd", "citation": "BCPC", "doc_type": "ALANWOOD", "public_domain": true }, { "uuid": "74650955-129a-4db5-902f-c27cd1474d88", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3f96af95-9544-4d13-bb9c-3dfce08e24d7", "id": "3f96af95-9544-4d13-bb9c-3dfce08e24d7", "molfile": "\n Marvin 01132103222D \n\n 32 34 0 0 0 0 999 V2000\n 6.1269 -3.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8579 -3.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5527 -3.1544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8579 -4.4047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5792 -4.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2923 -4.3853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5792 -5.6405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8825 -6.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1492 -5.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4546 -6.0752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7373 -5.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7373 -4.8584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4289 -4.4277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1492 -4.8269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0313 -6.1072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3115 -5.7072 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8022 -5.3156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3742 -4.6598 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0010 -5.1174 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0591 -4.6489 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0313 -6.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3437 -7.3572 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7694 -7.3253 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2485 -6.7317 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3091 -6.0457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0233 -6.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7351 -6.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7351 -5.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4405 -4.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1694 -5.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1694 -6.0205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4529 -6.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 14 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 25 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 14 9 2 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 11 15 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 15 21 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 17 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 21 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 27 32 2 0 0 0 0\n 29 28 2 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 2 0 0 0 0\n 32 31 1 0 0 0 0\nM END", "smiles": "CC(=O)N1c2ccc(cc2CN(C1=O)NCc3cccnc3)C(C(F)(F)F)(C(F)(F)F)F", "formula": "C19H15F7N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "714aec69-96e7-4863-9622-c6c28b1d7f87" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "464.3375", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "7b71592c-017f-413f-b366-f88de701f6d2", "version": "4", "structure": { "id": "1db419e0-73af-490a-9ab5-d1bd55dfdfc1", "molfile": "\n Marvin 01132101432D \n\n 32 34 0 0 0 0 999 V2000\n 9.7351 -5.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4405 -4.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1694 -5.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1694 -6.0205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4529 -6.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7351 -6.0340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0233 -6.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3091 -6.0457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5792 -5.6405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8825 -6.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1492 -5.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4546 -6.0752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7373 -5.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7373 -4.8584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4289 -4.4277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1492 -4.8269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8579 -4.4047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5792 -4.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2923 -4.3853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8579 -3.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5527 -3.1544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1269 -3.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0313 -6.1072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8022 -5.3156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3742 -4.6598 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0010 -5.1174 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0591 -4.6489 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3115 -5.7072 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0313 -6.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3437 -7.3572 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7694 -7.3253 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2485 -6.7317 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 1 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 16 11 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 9 1 0 0 0 0\n 18 19 2 0 0 0 0\n 17 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 13 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 24 27 1 0 0 0 0\n 23 28 1 0 0 0 0\n 23 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 29 32 1 0 0 0 0\nM END", "smiles": "CC(=O)N1c2ccc(cc2CN(C1=O)NCc3cccnc3)C(C(F)(F)F)(C(F)(F)F)F", "formula": "C19H15F7N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "464.3375", "optical_activity": "NONE", "references": [ "2fd34f90-5eff-4b32-918f-ffd78fe61abc", "7840327a-cefd-43e3-b8f6-1029878647cf" ], "stereo_centers": 0 }, "unii": "KKS8BX5SNW" } ] }