{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6c48cef8-73fc-473f-aeb1-e52323fc8f93",
          "code": "135304-07-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=135304-07-3",
          "code_system": "CAS",
          "references": [
            "142f7d68-11bb-40f2-ac63-980450ecd1d9",
            "cda75c1a-3568-4fd9-88b4-9c2662035321"
          ]
        },
        {
          "uuid": "045d71d0-5778-4101-a9fc-114b5d47d897",
          "code": "C068268",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67068268",
          "code_system": "MESH",
          "references": [
            "142f7d68-11bb-40f2-ac63-980450ecd1d9"
          ]
        },
        {
          "uuid": "bab53cf7-1647-4287-b4bf-ee5ded2f5629",
          "code": "m1359",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1359?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "142f7d68-11bb-40f2-ac63-980450ecd1d9"
          ]
        },
        {
          "uuid": "18184027-d4a4-40ed-a59a-84a0cbfc1855",
          "code": "6438381",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6438381",
          "code_system": "PUBCHEM",
          "references": [
            "142f7d68-11bb-40f2-ac63-980450ecd1d9"
          ]
        },
        {
          "uuid": "595b59c9-4ba1-68e2-d70f-78921fd87b01",
          "code": "1868830",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1868830/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "5310fdba-1d0f-4e1c-8eea-e26cabf5ab02",
          "code": "KK6984C8O3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "650c016a-8dda-44f5-78e5-a90410afd58f",
          "code": "DTXSID701021741",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701021741",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "c8bd89de-67c8-cb18-15ea-7ae699a34b46",
          "code": "KK6984C8O3",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=KK6984C8O3",
          "code_system": "DAILYMED",
          "references": [
            "5970806a-b727-35e1-9293-b8627175137f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cfd4d306-3056-463b-92a7-3be5549c1e56",
          "name": "ACETYL FARNESYLCYSTEINE",
          "stdName": "ACETYL FARNESYLCYSTEINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75534b84-8a85-4c60-9469-942581f41cb0",
            "39512050-352a-48bb-975b-247d386ecc87",
            "23bca95b-17c1-42f7-a17a-a9e0b9837047",
            "2fdb9dad-9f1e-4aff-a6a5-cc0120455227"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "302aac1f-bbf5-48b9-8b4f-44bcbd41992f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "994b48e7-8f0b-4741-a74c-1e9d65f77378",
          "name": "ACETYLFARNESYLCYSTEINE",
          "stdName": "ACETYLFARNESYLCYSTEINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75534b84-8a85-4c60-9469-942581f41cb0",
            "39512050-352a-48bb-975b-247d386ecc87"
          ],
          "display_name": false
        },
        {
          "uuid": "412ed61f-887b-41df-b2d2-d2c1158b80db",
          "name": "AFC",
          "stdName": "AFC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75534b84-8a85-4c60-9469-942581f41cb0",
            "39512050-352a-48bb-975b-247d386ecc87"
          ],
          "display_name": false
        },
        {
          "uuid": "c04f89a5-c295-4101-ae54-7e7783a4b08a",
          "name": "ARAZINE",
          "stdName": "ARAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75534b84-8a85-4c60-9469-942581f41cb0",
            "39512050-352a-48bb-975b-247d386ecc87"
          ],
          "display_name": false
        },
        {
          "uuid": "31e30d4f-1820-410b-bb6a-37c6efd5bf80",
          "name": "L-CYSTEINE, N-ACETYL-S-((2E,6E)-3,7,11-TRIMETHYL-2,6,10-DODECATRIEN-1-YL)-",
          "stdName": "L-CYSTEINE, N-ACETYL-S-((2E,6E)-3,7,11-TRIMETHYL-2,6,10-DODECATRIEN-1-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75534b84-8a85-4c60-9469-942581f41cb0",
            "39512050-352a-48bb-975b-247d386ecc87"
          ],
          "display_name": false
        },
        {
          "uuid": "c59b49f5-0657-40b1-a8d1-f03183dd3e5e",
          "name": "L-CYSTEINE, N-ACETYL-S-((2E,6E)-3,7,11-TRIMETHYL-2,6,10-DODECATRIENYL)-",
          "stdName": "L-CYSTEINE, N-ACETYL-S-((2E,6E)-3,7,11-TRIMETHYL-2,6,10-DODECATRIENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75534b84-8a85-4c60-9469-942581f41cb0",
            "39512050-352a-48bb-975b-247d386ecc87"
          ],
          "display_name": false
        },
        {
          "uuid": "5314a43a-0029-4bbb-b924-dc6b7bc4bd2a",
          "name": "L-CYSTEINE, N-ACETYL-S-(3,7,11-TRIMETHYL-2,6,10-DODECATRIENYL)-, (E,E)-",
          "stdName": "L-CYSTEINE, N-ACETYL-S-(3,7,11-TRIMETHYL-2,6,10-DODECATRIENYL)-, (E,E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75534b84-8a85-4c60-9469-942581f41cb0",
            "39512050-352a-48bb-975b-247d386ecc87"
          ],
          "display_name": false
        },
        {
          "uuid": "71725b41-b031-4428-ae98-734034c222bd",
          "name": "N-ACETYL-L-FARNESYLCYSTEINE",
          "stdName": "N-ACETYL-L-FARNESYLCYSTEINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f65cea4f-c595-4fa4-9782-584d8eb760df",
            "75534b84-8a85-4c60-9469-942581f41cb0",
            "39512050-352a-48bb-975b-247d386ecc87",
            "573b0660-eee0-4140-80a0-601f5f9fdddf"
          ],
          "display_name": false
        },
        {
          "uuid": "20ea2588-658b-42a5-b7b3-bc290f6ca2e1",
          "name": "N-ACETYL-L-FARNESYLCYSTEINE [MI]",
          "stdName": "N-ACETYL-L-FARNESYLCYSTEINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f65cea4f-c595-4fa4-9782-584d8eb760df",
            "39512050-352a-48bb-975b-247d386ecc87"
          ],
          "display_name": false
        },
        {
          "uuid": "6a1af5e3-827a-4408-ba1a-edd82b60e256",
          "name": "N-ACETYL-S-FARNESYL-L-CYSTEINE",
          "stdName": "N-ACETYL-S-FARNESYL-L-CYSTEINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75534b84-8a85-4c60-9469-942581f41cb0",
            "39512050-352a-48bb-975b-247d386ecc87"
          ],
          "display_name": false
        },
        {
          "uuid": "1947a705-84d1-4c45-8900-3ceb9d737fec",
          "name": "N-ACETYL-S-FARNESYLCYSTEINE",
          "stdName": "N-ACETYL-S-FARNESYLCYSTEINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39512050-352a-48bb-975b-247d386ecc87",
            "af9e633f-6bbd-4169-af53-799db2b5742d"
          ],
          "display_name": false
        },
        {
          "uuid": "738864d3-46d7-42a9-ad34-73318e545d04",
          "name": "N-ACETYL-S-TRANS,TRANS-FARNESYL-L-CYSTEINE",
          "stdName": "N-ACETYL-S-TRANS,TRANS-FARNESYL-L-CYSTEINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75534b84-8a85-4c60-9469-942581f41cb0",
            "39512050-352a-48bb-975b-247d386ecc87"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2fdb9dad-9f1e-4aff-a6a5-cc0120455227",
          "citation": "personal care products coun",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "39512050-352a-48bb-975b-247d386ecc87",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75534b84-8a85-4c60-9469-942581f41cb0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f65cea4f-c595-4fa4-9782-584d8eb760df",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af9e633f-6bbd-4169-af53-799db2b5742d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "142f7d68-11bb-40f2-ac63-980450ecd1d9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391217000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b19a076f-da8c-4b44-988b-6637c313e4f0",
          "citation": "SRS import [KK6984C8O3]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KK6984C8O3",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391217000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1bf9ec4-7d02-421e-84dc-a2454631cb8a",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23bca95b-17c1-42f7-a17a-a9e0b9837047",
          "citation": "ACETYL FARNESYLCYSTEINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "573b0660-eee0-4140-80a0-601f5f9fdddf",
          "citation": "N-ACETYL-L-FARNESYLCYSTEINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cda75c1a-3568-4fd9-88b4-9c2662035321",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5970806a-b727-35e1-9293-b8627175137f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fce13031-2488-4e5f-9f87-6a9095295658",
          "id": "fce13031-2488-4e5f-9f87-6a9095295658",
          "molfile": "\n  Marvin  01132113062D          \n\n 25 24  0  0  1  0            999 V2000\n    6.6429   -4.5010    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.9290   -4.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2150   -4.5093    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5010   -4.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7870   -4.5135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0731   -4.9269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0772   -5.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3591   -4.5135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6451   -4.9269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9311   -4.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2171   -4.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2213   -5.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4968   -4.5261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2108   -4.9394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9248   -4.5261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6388   -4.9394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3527   -4.5302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6346   -5.7661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6429   -3.6743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3569   -3.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3569   -2.4342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0750   -3.6743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3569   -4.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0709   -4.5010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3610   -5.7411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 19  1  6  0  0  0\n  1 23  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 23  2  0  0  0  0\nM  END",
          "smiles": "CC(=CCC/C(=C/CC/C(=C/CSC[C@@H](C(=O)O)NC(=O)C)/C)/C)C",
          "formula": "C20H33NO3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ae130cd6-d668-45e8-a3b2-f5f911103df8"
          },
          "defined_stereo": 1,
          "ez_centers": 2,
          "molecular_weight": "367.5478",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c35f4afe-a4e0-400c-90f7-5516a743686c",
      "version": "6",
      "structure": {
        "id": "66d050d0-bcd7-4874-9df4-b6e238cf24a2",
        "molfile": "\n  Marvin  01132105212D          \n\n 25 24  0  0  1  0            999 V2000\n    6.6429   -4.5010    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3569   -4.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6429   -3.6743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3569   -3.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0709   -4.5010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0750   -3.6743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2171   -4.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6388   -4.9394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0731   -4.9269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9248   -4.5261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9311   -4.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7870   -4.5135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3610   -5.7411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2150   -4.5093    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9290   -4.9144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6451   -4.9269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2108   -4.9394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5010   -4.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4968   -4.5261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3591   -4.5135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3569   -2.4342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3527   -4.5302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6346   -5.7661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0772   -5.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2213   -5.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  3  1  6  0  0  0\n  4  3  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  4  2  0  0  0  0\n  7 11  2  0  0  0  0\n  8 10  2  0  0  0  0\n  9 12  2  0  0  0  0\n 10 17  1  0  0  0  0\n 11 16  1  0  0  0  0\n 12 18  1  0  0  0  0\n 13  2  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15  1  1  0  0  0  0\n 16 20  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 14  1  0  0  0  0\n 19  7  1  0  0  0  0\n 20  9  1  0  0  0  0\n 21  4  1  0  0  0  0\n 22  8  1  0  0  0  0\n 23  8  1  0  0  0  0\n 24  9  1  0  0  0  0\n 25  7  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCC/C(=C/CC/C(=C/CSC[C@@H](C(=O)O)NC(=O)C)/C)/C)C",
        "formula": "C20H33NO3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 2,
        "molecular_weight": "367.5478",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c1bf9ec4-7d02-421e-84dc-a2454631cb8a",
          "b19a076f-da8c-4b44-988b-6637c313e4f0"
        ],
        "stereo_centers": 1
      },
      "unii": "KK6984C8O3"
    }
  ]
}