{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3aa85aea-3a72-40d4-9e16-d0846ae16dc3",
          "code": "BETA-BOURBONENE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4624",
          "code_system": "JECFA EVALUATION",
          "references": [
            "d8d46188-ca4d-48bf-8400-c29318fe0e0a"
          ]
        },
        {
          "uuid": "6125d0b7-e265-4b50-8c1e-fcde8dd20278",
          "code": "5208-59-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5208-59-3",
          "code_system": "CAS",
          "references": [
            "d8d46188-ca4d-48bf-8400-c29318fe0e0a",
            "de7656e3-abd4-4a2e-ad3a-3c69d6fe779e"
          ]
        },
        {
          "uuid": "6a4b291d-c06c-4f93-b8c3-68e3972a20e7",
          "code": "21 CFR 172.151",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "d8d46188-ca4d-48bf-8400-c29318fe0e0a"
          ]
        },
        {
          "uuid": "88aa2148-3934-4e4f-8287-8d79579b0dd6",
          "code": "62566",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62566",
          "code_system": "PUBCHEM",
          "references": [
            "d8d46188-ca4d-48bf-8400-c29318fe0e0a"
          ]
        },
        {
          "uuid": "6d060876-8adc-0d48-a042-dab4414593a9",
          "code": "DTXSID20881212",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20881212",
          "code_system": "EPA CompTox",
          "references": [
            "df7dc670-27c0-da94-9c2a-35abaf0cfc28"
          ]
        },
        {
          "uuid": "e484d437-2154-4ac4-818c-955217a2bbfd",
          "code": "KIZ51R7NTL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cb33cf8a-ba8b-57fb-4548-98498e058782",
          "code": "288727",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=288727",
          "code_system": "NSC",
          "references": [
            "67c8a470-b773-667e-753a-ec064f620c8b"
          ]
        },
        {
          "uuid": "fbb48451-57b3-55e1-6474-0fe714d403f2",
          "code": "1344",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1344/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "8255e1dc-6c17-c37c-e854-d09c3a82b849"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "83cb3c41-0dae-4761-8398-0a2756485be0",
          "name": "(-)-.BETA.-BOURBONENE",
          "stdName": "(-)-.BETA.-BOURBONENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae91bc85-15dd-470d-b974-a346388e3529",
            "2d55985d-aa50-4115-b7be-c0b438e85058"
          ],
          "display_name": false
        },
        {
          "uuid": "6d5c18ba-6925-40b0-b5b9-49a1da63ecc4",
          "name": ".BETA.-BOURBONENE",
          "stdName": ".BETA.-BOURBONENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae91bc85-15dd-470d-b974-a346388e3529",
            "2d55985d-aa50-4115-b7be-c0b438e85058"
          ],
          "display_name": true
        },
        {
          "uuid": "75850e3a-1743-4816-8fd0-fecfffcbceb6",
          "name": "1,2,3,3A,3B.BETA.,4,5,6,6A.BETA.,6B.ALPHA.-DECA-HYDRO-L.ALPHA.-ISOPROPYL-3AA-METHYL-6-METHYLENE-CYCLOBUTA (1,2:3,4) DICYCLOPENTENE",
          "stdName": "1,2,3,3A,3B.BETA.,4,5,6,6A.BETA.,6B.ALPHA.-DECA-HYDRO-L.ALPHA.-ISOPROPYL-3AA-METHYL-6-METHYLENE-CYCLOBUTA (1,2:3,4) DICYCLOPENTENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d55985d-aa50-4115-b7be-c0b438e85058",
            "bdbc7e19-4867-4ebd-b9b6-1da64a94f2f4"
          ],
          "display_name": false
        },
        {
          "uuid": "f54ebae1-7e78-4baa-8aac-42c5d1c2dca2",
          "name": "BETA-BOURBONENE",
          "stdName": "BETA-BOURBONENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9bc7c78-83d6-46b1-8218-5d97b779d87e"
          ],
          "display_name": false
        },
        {
          "uuid": "61f71d60-3a26-4c24-b06d-02df3ea3a424",
          "name": "CYCLOBUTA(1,2:3,4)DICYCLOPENTENE, DECAHYDRO-3A-METHYL-6-METHYLENE-1-(1-METHYLETHYL)-, (1S,3AS,3BR,6AS,6BR)-",
          "stdName": "CYCLOBUTA(1,2:3,4)DICYCLOPENTENE, DECAHYDRO-3A-METHYL-6-METHYLENE-1-(1-METHYLETHYL)-, (1S,3AS,3BR,6AS,6BR)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae91bc85-15dd-470d-b974-a346388e3529",
            "2d55985d-aa50-4115-b7be-c0b438e85058"
          ],
          "display_name": false
        },
        {
          "uuid": "ab2d0e1b-c2d1-44b8-8563-e961afe007e7",
          "name": "NSC-288727",
          "stdName": "NSC-288727",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae91bc85-15dd-470d-b974-a346388e3529",
            "2d55985d-aa50-4115-b7be-c0b438e85058"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a9bc7c78-83d6-46b1-8218-5d97b779d87e",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bdbc7e19-4867-4ebd-b9b6-1da64a94f2f4",
          "citation": "YES",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d55985d-aa50-4115-b7be-c0b438e85058",
          "citation": "CFR",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae91bc85-15dd-470d-b974-a346388e3529",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8d46188-ca4d-48bf-8400-c29318fe0e0a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390991000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "954572d7-c366-4aec-b777-1a5c201276c3",
          "citation": "SRS import [KIZ51R7NTL]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KIZ51R7NTL",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390991000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee8a8e6c-c557-4aa8-8354-95355910da8e",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de7656e3-abd4-4a2e-ad3a-3c69d6fe779e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "67c8a470-b773-667e-753a-ec064f620c8b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "df7dc670-27c0-da94-9c2a-35abaf0cfc28",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "8255e1dc-6c17-c37c-e854-d09c3a82b849",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3d7cfd77-a252-4138-84fe-074ed1439100",
          "id": "3d7cfd77-a252-4138-84fe-074ed1439100",
          "molfile": "\n  Marvin  01132103152D          \n\n 15 17  0  0  1  0            999 V2000\n    4.7679   -5.6777    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.9853   -5.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4945   -6.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9811   -6.7569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7229   -7.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7679   -6.5023    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.5893   -6.5023    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.3761   -6.7569    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.8628   -6.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3767   -5.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5893   -5.6777    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.6405   -4.8548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6344   -7.5405    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.0824   -8.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4444   -7.7102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  6  1  1  0  0  0  0\n 11  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  6  0  0  0\n  7  8  1  0  0  0  0\n  7 11  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  1  1  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@H]1CC[C@@]2(C)[C@@H]3CCC(=C)[C@H]3[C@@H]12",
          "formula": "C15H24",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7873d18b-db80-4597-90c7-32d1b460ee6e"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "204.3516",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8c4d7445-c020-49dc-8f97-0528350c7b2c",
      "version": "8",
      "structure": {
        "id": "c2678cbd-3e1c-49d0-aca2-97fe863b8abc",
        "molfile": "\n  Marvin  01132110032D          \n\n 18 20  0  0  1  0            999 V2000\n    3.4945   -6.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9811   -6.7569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7679   -6.5023    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.5893   -6.5023    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.3761   -6.7569    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.6344   -7.5405    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.0824   -8.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4444   -7.7102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8628   -6.0853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3767   -5.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5893   -5.6777    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.7679   -5.6777    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.9853   -5.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7102   -4.8553    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6405   -4.8548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6413   -7.3251    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7160   -7.3251    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7229   -7.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12 11  1  0  0  0  0\n  3 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13  1  1  0  0  0  0\n 12 14  1  6  0  0  0\n 11 15  1  1  0  0  0\n  4 16  1  1  0  0  0\n  3 17  1  6  0  0  0\n  2 18  2  0  0  0  0\nM  END",
        "smiles": "CC(C)[C@@H]1CC[C@@]2(C)[C@]3([H])CCC(=C)[C@]3([H])[C@@]12[H]",
        "formula": "C15H24",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "204.3516",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "954572d7-c366-4aec-b777-1a5c201276c3",
          "ee8a8e6c-c557-4aa8-8354-95355910da8e"
        ],
        "stereo_centers": 5
      },
      "unii": "KIZ51R7NTL"
    }
  ]
}