{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ef952b68-902f-4de9-a513-2000b309d069",
          "code": "21597-77-3",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=21597-77-3",
          "code_system": "CAS",
          "references": [
            "f9157145-12c2-4a8a-a1a2-9dfecd93ef32",
            "046ff030-e8eb-4836-be79-3ef0d6466aac"
          ]
        },
        {
          "uuid": "57a954fc-0af4-447c-87dd-dee139817457",
          "code": "5-BROMOURIDINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/5-Bromouridine",
          "code_system": "WIKIPEDIA",
          "references": [
            "f9157145-12c2-4a8a-a1a2-9dfecd93ef32"
          ]
        },
        {
          "uuid": "bf74c338-cb2e-4efb-8f00-706e77071b85",
          "code": "957-75-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=957-75-5",
          "code_system": "CAS",
          "references": [
            "f9157145-12c2-4a8a-a1a2-9dfecd93ef32",
            "c83fc57a-e534-4a54-b82f-b4a8b33b9ccb"
          ]
        },
        {
          "uuid": "6302e5f9-eb42-42fb-a0df-6ef45da16d9f",
          "code": "213-486-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.260",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f9157145-12c2-4a8a-a1a2-9dfecd93ef32"
          ]
        },
        {
          "uuid": "eb503ef5-3887-4f44-89cc-3ce550de5f7a",
          "code": "91494",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91494",
          "code_system": "PUBCHEM",
          "references": [
            "f9157145-12c2-4a8a-a1a2-9dfecd93ef32"
          ]
        },
        {
          "uuid": "7ad3d86d-fbef-7c54-c0d3-853fc3194257",
          "code": "DTXSID401317210",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401317210",
          "code_system": "EPA CompTox",
          "references": [
            "eb5fec3e-14f4-3b8f-2eaa-2369020589cb"
          ]
        },
        {
          "uuid": "06bf879a-bb1b-4c9d-a196-288cc6f27c44",
          "code": "KEY8PG1BRC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d5271050-be89-01c6-ec81-d43d96a26ff1",
          "code": "20553",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:20553",
          "code_system": "CHEBI",
          "references": [
            "fbc11df0-e9cf-d4b7-55ac-39d601f3d272"
          ]
        },
        {
          "uuid": "80d6b664-5009-6c24-7852-057c647cc1b9",
          "code": "38296",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=38296",
          "code_system": "NSC",
          "references": [
            "520cc7f8-68c4-5787-1941-5c67cc5f041f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f7864980-dbe3-4db0-8410-4d16ace57638",
          "name": "(-)-5-BROMOURIDINE",
          "stdName": "(-)-5-BROMOURIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81aaf453-cb65-4573-9c6d-1b8b4acb50d9",
            "a1442b93-b3f0-4ea0-a02a-e6db4e7371ed"
          ],
          "display_name": false
        },
        {
          "uuid": "49209898-f6ce-4c71-9586-f5d8369ded27",
          "name": "5-BROMOURIDINE",
          "stdName": "5-BROMOURIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81aaf453-cb65-4573-9c6d-1b8b4acb50d9",
            "a1442b93-b3f0-4ea0-a02a-e6db4e7371ed"
          ],
          "display_name": true
        },
        {
          "uuid": "0da34970-ffdf-4cbe-9324-8e5c05340442",
          "name": "BROMOURIDINE",
          "stdName": "BROMOURIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81aaf453-cb65-4573-9c6d-1b8b4acb50d9",
            "a1442b93-b3f0-4ea0-a02a-e6db4e7371ed"
          ],
          "display_name": false
        },
        {
          "uuid": "bafc554d-4967-4406-99c7-ac4296eb258e",
          "name": "NSC-38296",
          "stdName": "NSC-38296",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81aaf453-cb65-4573-9c6d-1b8b4acb50d9",
            "a1442b93-b3f0-4ea0-a02a-e6db4e7371ed"
          ],
          "display_name": false
        },
        {
          "uuid": "f1b62202-01f9-442d-81b4-1e2712197f51",
          "name": "URIDINE, 5-BROMO-",
          "stdName": "URIDINE, 5-BROMO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81aaf453-cb65-4573-9c6d-1b8b4acb50d9",
            "a1442b93-b3f0-4ea0-a02a-e6db4e7371ed"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "81aaf453-cb65-4573-9c6d-1b8b4acb50d9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a1442b93-b3f0-4ea0-a02a-e6db4e7371ed",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9157145-12c2-4a8a-a1a2-9dfecd93ef32",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389705000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f885345-9f9a-424c-a2ed-a347594f4c7c",
          "citation": "SRS import [KEY8PG1BRC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KEY8PG1BRC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389705000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c83fc57a-e534-4a54-b82f-b4a8b33b9ccb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "046ff030-e8eb-4836-be79-3ef0d6466aac",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fbc11df0-e9cf-d4b7-55ac-39d601f3d272",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "520cc7f8-68c4-5787-1941-5c67cc5f041f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "eb5fec3e-14f4-3b8f-2eaa-2369020589cb",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ea6f0062-be02-42f5-97cf-8e8c120ab924",
          "id": "ea6f0062-be02-42f5-97cf-8e8c120ab924",
          "molfile": "\n  Marvin  01132112082D          \n\n 18 19  0  0  1  0            999 V2000\n    5.8539   -7.8807    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.2267   -7.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3972   -7.3433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6457   -7.4376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4330   -7.8761    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.4330   -6.7069    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7259   -6.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7259   -5.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0141   -5.0570    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    7.4378   -5.0570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4378   -4.2368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1495   -5.4718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1495   -6.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8566   -6.7069    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1267   -8.4793    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.4424   -9.2384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1507   -8.4793    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.8255   -9.2384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 17  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  6  0  0  0\n  5  6  1  0  0  0  0\n 15  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 13  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 16  1  6  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  6  0  0  0\nM  END",
          "smiles": "c1c(c(=O)[nH]c(=O)n1[C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)O)Br",
          "formula": "C9H11BrN2O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "53021f98-4097-4130-a41c-3baa41178837"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "323.0973",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a8af5a7d-2000-4969-b31e-a238241b0feb",
      "version": "5",
      "structure": {
        "id": "e513e54d-a7c8-481f-93c1-6f1b0891b547",
        "molfile": "\n  Marvin  01132111522D          \n\n 18 19  0  0  1  0            999 V2000\n    7.4330   -6.7069    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    7.4330   -7.8761    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1267   -8.4793    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.1507   -8.4793    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.8255   -9.2384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8539   -7.8807    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.6457   -7.4376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2267   -7.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3972   -7.3433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4424   -9.2384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1495   -6.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1495   -5.4718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4378   -5.0570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7259   -5.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7259   -6.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0141   -5.0570    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    7.4378   -4.2368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8566   -6.7069    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  1  0  0  0  0\n  6  8  1  1  0  0  0\n  9  8  1  0  0  0  0\n  3 10  1  6  0  0  0\n 11  1  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15  1  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 13  2  0  0  0  0\n 18 11  2  0  0  0  0\nM  END",
        "smiles": "c1c(c(=O)[nH]c(=O)n1[C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)O)Br",
        "formula": "C9H11BrN2O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "323.0973",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9f885345-9f9a-424c-a2ed-a347594f4c7c",
          "81aaf453-cb65-4573-9c6d-1b8b4acb50d9"
        ],
        "stereo_centers": 4
      },
      "unii": "KEY8PG1BRC"
    }
  ]
}