{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5ed0337a-6121-454d-a210-2a0faaad9b28",
          "code": "27314-13-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=27314-13-2",
          "code_system": "CAS",
          "references": [
            "7fb79cf7-4f8e-4252-ab1f-ecc9c074efef",
            "0176e448-1f98-4cb5-9239-0bc53dfd24dc"
          ]
        },
        {
          "uuid": "3e56c6ba-4371-481c-868a-99b8a5e97f2b",
          "code": "105801",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3072",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "7fb79cf7-4f8e-4252-ab1f-ecc9c074efef"
          ]
        },
        {
          "uuid": "3fb67b3d-1d16-4b31-96ef-2b8eae785b88",
          "code": "248-397-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.983",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7fb79cf7-4f8e-4252-ab1f-ecc9c074efef"
          ]
        },
        {
          "uuid": "8452b486-6b8e-412d-9f75-6e769696ac08",
          "code": "m8060",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8060?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7fb79cf7-4f8e-4252-ab1f-ecc9c074efef"
          ]
        },
        {
          "uuid": "feac7efc-e7e5-40b2-82e7-b55f9b907e33",
          "code": "33775",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/33775",
          "code_system": "PUBCHEM",
          "references": [
            "7fb79cf7-4f8e-4252-ab1f-ecc9c074efef"
          ]
        },
        {
          "uuid": "e8d25d1b-f10d-7a66-f61d-0c8b8b4fc84c",
          "code": "6845",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6845",
          "code_system": "HSDB",
          "references": [
            "cbe26722-0f15-e65b-d50b-c2d9a019938c"
          ]
        },
        {
          "uuid": "20e2b1f7-b5af-c3b3-99b8-b54c35ab04f2",
          "code": "DTXSID8024234",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8024234",
          "code_system": "EPA CompTox",
          "references": [
            "aa77be83-159c-a2fe-c4f9-84c61b0998d3"
          ]
        },
        {
          "uuid": "874137dc-3885-41a7-9438-3686b2a3e3d4",
          "code": "KES1HB07E4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7b1cdf12-1e52-2a8a-a549-9d8d2ab74007",
          "code": "50842",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:50842",
          "code_system": "CHEBI",
          "references": [
            "0c7acdf7-7314-4146-5a36-fe665f98d505"
          ]
        },
        {
          "uuid": "afd3f739-18a0-d4c8-e434-965bb8e12ca2",
          "code": "norflurazon",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/norflurazon.html",
          "code_system": "ALANWOOD",
          "references": [
            "db6e6771-6a32-4db0-3f45-7b940b0a5b81"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "16b02010-5ab1-48e9-ad80-da5f34159cd8",
          "name": "1-(3-TRIFLUOROMETHYLPHENYL)-4-METHYLAMINO-5-CHLOROPYRIDAZONE",
          "stdName": "1-(3-TRIFLUOROMETHYLPHENYL)-4-METHYLAMINO-5-CHLOROPYRIDAZONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3987faf5-bf7b-45c5-96d8-b8fb5ccac04b",
            "4935532a-5b3b-4389-9b6f-f1d9b02e6718"
          ],
          "display_name": false
        },
        {
          "uuid": "9c5dc453-f78d-4653-8b32-544c7065b5dc",
          "name": "4-CHLORO-5-(METHYLAMINO)-2-(3-(TRIFLUOROMETHYL)PHENYL)-3(2H)-PYRIDAZINONE",
          "stdName": "4-CHLORO-5-(METHYLAMINO)-2-(3-(TRIFLUOROMETHYL)PHENYL)-3(2H)-PYRIDAZINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ee82f8c-2da6-4e45-8dd5-2bdeb0e30d44",
            "7d685033-09db-47cf-8b87-0d6c2af31e6c"
          ],
          "display_name": false
        },
        {
          "uuid": "a0247738-61a2-4bf9-9f10-12ad341f3d84",
          "name": "4-CHLORO-5-METHYLAMINO-2-(.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-M-TOLYL)PYRIDAZIN-3(2H)-ONE",
          "stdName": "4-CHLORO-5-METHYLAMINO-2-(.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-M-TOLYL)PYRIDAZIN-3(2H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "037e9151-6d62-4eac-8902-a50047eee35b",
            "7d685033-09db-47cf-8b87-0d6c2af31e6c"
          ],
          "display_name": false
        },
        {
          "uuid": "9664bfea-53db-416e-8857-4c9e171415cf",
          "name": "EVITAL",
          "stdName": "EVITAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b30805d2-8b30-478a-96d6-241dcb7f9cee",
            "3987faf5-bf7b-45c5-96d8-b8fb5ccac04b"
          ],
          "display_name": false
        },
        {
          "uuid": "3b682607-1729-4779-b281-371093279676",
          "name": "NORFLURAZON",
          "stdName": "NORFLURAZON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6eac539b-38b8-4a07-aa66-1b86f7f98c95",
            "7859be38-4550-4ab4-a2a8-2d2a6ec80561",
            "8e9ff7da-1571-4ee1-8498-ceed506c3d8f",
            "bc98eee1-0c1e-4203-8e3c-24f8a8036b33",
            "8320a11a-23d1-4b1b-8cb2-45d1b793c6b9",
            "3987faf5-bf7b-45c5-96d8-b8fb5ccac04b",
            "3c9040ad-0d9e-4097-9404-807f4ab0c4d7",
            "253cb342-b1b7-4476-90b0-67cf29a31a21"
          ],
          "display_name": true
        },
        {
          "uuid": "32d899db-2da8-4f43-aa03-32be74d58d6f",
          "name": "NORFLURAZON [HSDB]",
          "stdName": "NORFLURAZON [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6eac539b-38b8-4a07-aa66-1b86f7f98c95",
            "3987faf5-bf7b-45c5-96d8-b8fb5ccac04b"
          ],
          "display_name": false
        },
        {
          "uuid": "92d707d2-57a4-40f1-aa6d-a4127316f1e2",
          "name": "NORFLURAZON [ISO]",
          "stdName": "NORFLURAZON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7859be38-4550-4ab4-a2a8-2d2a6ec80561",
            "3987faf5-bf7b-45c5-96d8-b8fb5ccac04b"
          ],
          "display_name": false
        },
        {
          "uuid": "33df7735-d180-43e4-ae59-2bd12c79f96c",
          "name": "NORFLURAZON [MI]",
          "stdName": "NORFLURAZON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc98eee1-0c1e-4203-8e3c-24f8a8036b33",
            "3987faf5-bf7b-45c5-96d8-b8fb5ccac04b"
          ],
          "display_name": false
        },
        {
          "uuid": "5238fb20-96e9-4dd7-9f0a-242f2c4ffd4a",
          "name": "PREDICT",
          "stdName": "PREDICT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a5ca850-c468-4487-b5e9-63607f29abd3",
            "3987faf5-bf7b-45c5-96d8-b8fb5ccac04b"
          ],
          "display_name": false
        },
        {
          "uuid": "2ed9331a-3508-4670-915d-1a1fdb9eaef5",
          "name": "SAN 9789",
          "stdName": "SAN 9789",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3987faf5-bf7b-45c5-96d8-b8fb5ccac04b",
            "4935532a-5b3b-4389-9b6f-f1d9b02e6718"
          ],
          "display_name": false
        },
        {
          "uuid": "4fcbabb2-fa55-4c00-a854-1631ce11624d",
          "name": "SAN-9789",
          "stdName": "SAN-9789",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3987faf5-bf7b-45c5-96d8-b8fb5ccac04b",
            "4935532a-5b3b-4389-9b6f-f1d9b02e6718"
          ],
          "display_name": false
        },
        {
          "uuid": "8f11733f-412d-4b68-acbf-ca8b36af34b9",
          "name": "SOLICAM",
          "stdName": "SOLICAM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3987faf5-bf7b-45c5-96d8-b8fb5ccac04b",
            "4935532a-5b3b-4389-9b6f-f1d9b02e6718"
          ],
          "display_name": false
        },
        {
          "uuid": "182e884c-bb18-42f3-be67-e5db8c2682b6",
          "name": "TELOK",
          "stdName": "TELOK",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a5ca850-c468-4487-b5e9-63607f29abd3",
            "3987faf5-bf7b-45c5-96d8-b8fb5ccac04b"
          ],
          "display_name": false
        },
        {
          "uuid": "5a616aa2-dbab-4c2a-821d-de168bd3810d",
          "name": "ZORIAL",
          "stdName": "ZORIAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3987faf5-bf7b-45c5-96d8-b8fb5ccac04b",
            "4935532a-5b3b-4389-9b6f-f1d9b02e6718"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8e9ff7da-1571-4ee1-8498-ceed506c3d8f",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7d685033-09db-47cf-8b87-0d6c2af31e6c",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "037e9151-6d62-4eac-8902-a50047eee35b",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ee82f8c-2da6-4e45-8dd5-2bdeb0e30d44",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc98eee1-0c1e-4203-8e3c-24f8a8036b33",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3987faf5-bf7b-45c5-96d8-b8fb5ccac04b",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4935532a-5b3b-4389-9b6f-f1d9b02e6718",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a5ca850-c468-4487-b5e9-63607f29abd3",
          "citation": "dose",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b30805d2-8b30-478a-96d6-241dcb7f9cee",
          "citation": "DOSE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6eac539b-38b8-4a07-aa66-1b86f7f98c95",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7859be38-4550-4ab4-a2a8-2d2a6ec80561",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7fb79cf7-4f8e-4252-ab1f-ecc9c074efef",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60450da8-ddbe-495b-b548-e951f50043a9",
          "citation": "SRS import [KES1HB07E4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KES1HB07E4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d82bb4e7-387d-4625-93ac-50647b399282",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "253cb342-b1b7-4476-90b0-67cf29a31a21",
          "citation": "NORFLURAZON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8320a11a-23d1-4b1b-8cb2-45d1b793c6b9",
          "citation": "NORFLURAZON [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3c9040ad-0d9e-4097-9404-807f4ab0c4d7",
          "citation": "NORFLURAZON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cbe26722-0f15-e65b-d50b-c2d9a019938c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+27314-13-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aa77be83-159c-a2fe-c4f9-84c61b0998d3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=27314-13-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "db6e6771-6a32-4db0-3f45-7b940b0a5b81",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "0c7acdf7-7314-4146-5a36-fe665f98d505",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0176e448-1f98-4cb5-9239-0bc53dfd24dc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a60f8d6e-0c9b-439b-a982-159b622e0fa2",
          "id": "a60f8d6e-0c9b-439b-a982-159b622e0fa2",
          "molfile": "\n  Marvin  01132108382D          \n\n 20 21  0  0  0  0            999 V2000\n    4.1591   -5.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8748   -5.9160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5868   -5.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5868   -4.6772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3025   -4.2668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0258   -4.6695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7368   -4.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7368   -3.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4457   -3.0164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1645   -3.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1645   -4.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4488   -4.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8839   -4.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8839   -5.4903    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4678   -4.0742    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5959   -5.0730    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0258   -5.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7407   -5.9160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3025   -5.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3025   -6.7444    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n 19  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 17  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CNc1cnn(-c2cccc(c2)C(F)(F)F)c(=O)c1Cl",
          "formula": "C12H9ClF3N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2a1a3aad-184a-4996-8550-fdfeaea7d112"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "303.668",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "df9172db-d976-493e-95ea-7624a0f8aa44",
      "version": "6",
      "structure": {
        "id": "d27f3a3a-eb57-4812-bc55-3506c5e3412a",
        "molfile": "\n  Marvin  01132110532D          \n\n 20 21  0  0  0  0            999 V2000\n    7.0258   -4.6695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7368   -4.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4488   -4.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1645   -4.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1645   -3.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4457   -3.0164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7368   -3.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8839   -4.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8839   -5.4903    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4678   -4.0742    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5959   -5.0730    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0258   -5.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3025   -5.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5868   -5.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8748   -5.9160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1591   -5.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5868   -4.6772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3025   -4.2668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3025   -6.7444    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.7407   -5.9160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  2  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 14  1  0  0  0  0\n 18 17  2  0  0  0  0\n  1 18  1  0  0  0  0\n 13 19  1  0  0  0  0\n 12 20  2  0  0  0  0\nM  END",
        "smiles": "CNc1cnn(-c2cccc(c2)C(F)(F)F)c(=O)c1Cl",
        "formula": "C12H9ClF3N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "303.668",
        "optical_activity": "NONE",
        "references": [
          "60450da8-ddbe-495b-b548-e951f50043a9",
          "d82bb4e7-387d-4625-93ac-50647b399282"
        ],
        "stereo_centers": 0
      },
      "unii": "KES1HB07E4"
    }
  ]
}