{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "acfe559c-b954-486e-8bfa-c6ce3e236ae0", "code": "120068-36-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=120068-36-2", "code_system": "CAS", "references": [ "ab904768-efcb-4cfc-bb69-67005cb1a1f0", "98e6b5ca-29f5-4f52-b728-e67e0c6d9e41" ] }, { "uuid": "4e29573a-033b-46fb-bc8f-ae81bc4dcc47", "code": "605555", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:862", "code_system": "EPA PESTICIDE CODE", "references": [ "ab904768-efcb-4cfc-bb69-67005cb1a1f0" ] }, { "uuid": "3b2e2fef-99d4-4d29-98dd-b786e0880be9", "code": "3078139", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3078139", "code_system": "PUBCHEM", "references": [ "ab904768-efcb-4cfc-bb69-67005cb1a1f0" ] }, { "uuid": "b930a2d4-f089-f7c3-15ce-1f8ae091b42e", "code": "DTXSID6074750", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6074750", "code_system": "EPA CompTox", "references": [ "285d10c5-28a6-7018-44fe-a5d82d84fb52" ] }, { "uuid": "b0aec9c9-5ea4-4313-9f16-8e3fae07a395", "code": "KE7T0T1PQ7", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "48819528-b2fb-ff14-6b8b-09d1e26c4534", "code": "300000023795", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "c021e6ff-7051-5f6b-c2e8-2d0ca5176358" ] } ], "relationships": [ { "uuid": "6ea54e22-f84f-4a34-8575-faf184c7ea07", "amount": { "uuid": "8648834a-4d95-44be-89b6-c3b4eacfee27" }, "type": "PARENT->METABOLITE", "references": [ "829d644c-8bed-4935-99c0-a7f69e766950" ], "related_substance": { "uuid": "28bb9da8-e4fc-49b6-a3b1-642722def15f", "refuuid": "7fab2e02-70b6-414b-aea3-401acf0e0d1f", "name": "FIPRONIL", "unii": "QGH063955F", "linking_id": "QGH063955F", "ref_pname": "FIPRONIL", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "afaee174-985a-4c25-af20-589b6b9d1026", "name": "1H-PYRAZOLE-3-CARBONITRILE, 5-AMINO-1-(2,6-DICHLORO-", "stdName": "1H-PYRAZOLE-3-CARBONITRILE, 5-AMINO-1-(2,6-DICHLORO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "782c7d24-8272-4fe9-8a47-615fdd78ede3", "0e857cfb-02ef-4ec4-bc0e-451b730ecf17" ], "display_name": false }, { "uuid": "2c6f4da3-9d1d-45cd-bc97-b3804901505b", "name": "5-AMINO-1-(2,6-DICHLORO-4-TRIFLUORMETHYLPHENYL)-3-CYANO-4-TRIFLUOROMETHYLSULFONYLPYRAZOLE", "stdName": "5-AMINO-1-(2,6-DICHLORO-4-TRIFLUORMETHYLPHENYL)-3-CYANO-4-TRIFLUOROMETHYLSULFONYLPYRAZOLE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f6a1eb34-a44a-41b1-a2c7-a782ef91e2bd", "0e857cfb-02ef-4ec4-bc0e-451b730ecf17" ], "display_name": false }, { "uuid": "e05b90e5-278d-4ddd-9358-98505e66dca3", "name": "FIPRONIL SULFONE", "stdName": "FIPRONIL SULFONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "782c7d24-8272-4fe9-8a47-615fdd78ede3", "0e857cfb-02ef-4ec4-bc0e-451b730ecf17" ], "display_name": true } ], "references": [ { "uuid": "f6a1eb34-a44a-41b1-a2c7-a782ef91e2bd", "citation": "EPA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0e857cfb-02ef-4ec4-bc0e-451b730ecf17", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "782c7d24-8272-4fe9-8a47-615fdd78ede3", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ab904768-efcb-4cfc-bb69-67005cb1a1f0", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391020000, "tags": [ "NOMEN" ] }, { "uuid": "653068d5-51ea-4e4c-8e08-30632547918e", "citation": "SRS import [KE7T0T1PQ7]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KE7T0T1PQ7", "doc_type": "SRS", "public_domain": true, "document_date": 1493391020000, "tags": [ "NOMEN" ] }, { "uuid": "a6912d96-301c-4265-a429-ce7541f6bb42", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "285d10c5-28a6-7018-44fe-a5d82d84fb52", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=120068-36-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "829d644c-8bed-4935-99c0-a7f69e766950", "citation": "Br J Pharmacol 2008 Nov;155(5):783-94", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "98e6b5ca-29f5-4f52-b728-e67e0c6d9e41", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "c021e6ff-7051-5f6b-c2e8-2d0ca5176358", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4ed6000f-6532-4456-855f-2d2f6fdd7cfe", "id": "4ed6000f-6532-4456-855f-2d2f6fdd7cfe", "molfile": "\n Marvin 01132104072D \n\n 27 28 0 0 0 0 999 V2000\n 5.0982 -2.6555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8432 -3.4401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0586 -3.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0586 -4.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8432 -4.7750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3296 -4.1099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1546 -4.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5648 -4.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1546 -5.5390 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3898 -4.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8046 -4.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3898 -3.3929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5648 -3.3929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1546 -2.6807 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6296 -4.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6296 -3.2849 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4547 -4.1099 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6296 -4.9349 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3888 -5.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7237 -5.4926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1892 -3.0646 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6756 -2.3994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7076 -3.7345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5241 -2.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0377 -3.2482 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0058 -1.9132 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8543 -2.0966 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 6 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 21 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 19 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 13 2 0 0 0 0\n 8 9 1 0 0 0 0\n 10 8 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 11 15 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 15 18 1 0 0 0 0\n 19 20 3 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 2 0 0 0 0\n 21 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 24 27 1 0 0 0 0\nM END", "smiles": "c1c(cc(c(c1Cl)-n2c(c(c(C#N)n2)S(=O)(=O)C(F)(F)F)N)Cl)C(F)(F)F", "formula": "C12H4Cl2F6N4O2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "aefb6e8f-14b7-467b-8f6e-61a5b94f8e11" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "453.1486", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "79c8024b-940d-4c02-815c-9c5bf3e0e830", "version": "5", "structure": { "id": "b7b92f92-a490-462d-aec2-1d59e6996b5c", "molfile": "\n Marvin 01132109302D \n\n 27 28 0 0 0 0 999 V2000\n 5.3296 -4.1099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8432 -4.7750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0586 -4.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0586 -3.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8432 -3.4401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0982 -2.6555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1892 -3.0646 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6756 -2.3994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7076 -3.7345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5241 -2.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0377 -3.2482 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0058 -1.9132 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8543 -2.0966 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3888 -5.0064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7237 -5.4926 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1546 -4.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5648 -3.3929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3898 -3.3929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8046 -4.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3898 -4.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5648 -4.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1546 -5.5390 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6296 -4.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6296 -3.2849 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4547 -4.1099 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6296 -4.9349 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1546 -2.6807 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 1 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 4 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 2 0 0 0 0\n 7 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 13 1 0 0 0 0\n 3 14 1 0 0 0 0\n 14 15 3 0 0 0 0\n 1 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 16 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 19 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 23 26 1 0 0 0 0\n 17 27 1 0 0 0 0\nM END", "smiles": "c1c(cc(c(c1Cl)-n2c(c(c(C#N)n2)S(=O)(=O)C(F)(F)F)N)Cl)C(F)(F)F", "formula": "C12H4Cl2F6N4O2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "453.1486", "optical_activity": "NONE", "references": [ "a6912d96-301c-4265-a429-ce7541f6bb42", "653068d5-51ea-4e4c-8e08-30632547918e" ], "stereo_centers": 0 }, "unii": "KE7T0T1PQ7" } ] }