{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "851c68cf-d32c-461f-b4a8-d160a20c6931",
          "code": "7874",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7874",
          "code_system": "PUBCHEM",
          "references": [
            "68140105-236b-46d7-bfec-1a7c1cab62c1"
          ]
        },
        {
          "uuid": "0ce1ee60-b1e0-4109-a518-f58a2302ba2d",
          "code": "107-50-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=107-50-6",
          "code_system": "CAS",
          "references": [
            "68140105-236b-46d7-bfec-1a7c1cab62c1",
            "4fa1d6cd-9f6e-402e-a7f0-5e1b489ebbb3"
          ]
        },
        {
          "uuid": "f5c01365-58fd-4f5f-b5d1-b37e3d28bfd2",
          "code": "203-496-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.180",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "68140105-236b-46d7-bfec-1a7c1cab62c1"
          ]
        },
        {
          "uuid": "0bb6eec7-0230-2359-c3e3-05c1a6cf5592",
          "code": "DTXSID8059348",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8059348",
          "code_system": "EPA CompTox",
          "references": [
            "ba8d87d1-9f00-65c1-0bc6-8b61d3b17ea3"
          ]
        },
        {
          "uuid": "7fdf10ce-1d78-03bd-fb29-6d3e1136fed2",
          "code": "1862729",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1862729/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "6123dbb4-e712-44a9-b6fd-46b600e9aa63",
          "code": "KCK5L8VU47",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "aa211d0d-424c-3e19-3f38-de66c4d47a17",
          "code": "87988",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:87988",
          "code_system": "CHEBI",
          "references": [
            "2a52ab78-680e-365e-da85-aadb8f4db5f1"
          ]
        },
        {
          "uuid": "79fa8b21-8dfb-801c-f023-971b3ce379ae",
          "code": "KCK5L8VU47",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=KCK5L8VU47",
          "code_system": "DAILYMED",
          "references": [
            "1d07df9b-f78b-42e5-f12f-3dbecd4544b3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "99ebb3d4-31b3-48a8-a6b7-add0aac6f168",
          "name": "2,2,4,4,6,6,8,8,10,10,12,12,14,14-TETRADECAMETHYL-1,3,5,7,9,11,13-HEPTAOXA-2,4,6,8,10,12,14-HEPTASILACYCLOTETRADECANE",
          "stdName": "2,2,4,4,6,6,8,8,10,10,12,12,14,14-TETRADECAMETHYL-1,3,5,7,9,11,13-HEPTAOXA-2,4,6,8,10,12,14-HEPTASILACYCLOTETRADECANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3042fffc-ce38-4a3b-85a1-9664f552aa59"
          ],
          "display_name": false
        },
        {
          "uuid": "aecec6df-ce5c-467c-8561-714ec25aff5b",
          "name": "2,2,4,4,6,6,8,8,10,10,12,12,14,14-TETRADECAMETHYLCYCLOTETRADECANEHEPTASILOXANE",
          "stdName": "2,2,4,4,6,6,8,8,10,10,12,12,14,14-TETRADECAMETHYLCYCLOTETRADECANEHEPTASILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a73dd155-1dda-4d6f-ad95-733c0b837444"
          ],
          "display_name": false
        },
        {
          "uuid": "0fda3d1b-8818-4f89-9e33-3cf2c8feaaec",
          "name": "CYCLOHEPTASILOXANE",
          "stdName": "CYCLOHEPTASILOXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "e276cbb8-6b66-402f-a929-ddd28b0e5b8a",
            "f6106bea-2418-4f53-9139-6e5f79169305"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "53eb171c-bc9d-4c3a-9701-8af6e99db6dd",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9b4ba58b-2cad-4b3f-aeac-150fb57eb690",
          "name": "CYCLOHEPTASILOXANE, 2,2,4,4,6,6,8,8,10,10,12,12,14,14-TETRADECAMETHYL-",
          "stdName": "CYCLOHEPTASILOXANE, 2,2,4,4,6,6,8,8,10,10,12,12,14,14-TETRADECAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5860647-633b-4535-a1d2-d134e05f827f"
          ],
          "display_name": false
        },
        {
          "uuid": "dd330e19-3c8f-49c0-b11c-12583dd00d9d",
          "name": "CYCLOHEPTASILOXANE, TETRADECAMETHYL-",
          "stdName": "CYCLOHEPTASILOXANE, TETRADECAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5860647-633b-4535-a1d2-d134e05f827f"
          ],
          "display_name": false
        },
        {
          "uuid": "f8e69390-7b90-442f-9149-8ea3d6c3a9ee",
          "name": "CYCLOMETHICONE 7",
          "stdName": "CYCLOMETHICONE 7",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee934efd-e378-48e7-baff-390d3623e109"
          ],
          "display_name": true
        },
        {
          "uuid": "09843151-489e-4772-9b2f-29d3415e99e0",
          "name": "D-7",
          "stdName": "D-7",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee934efd-e378-48e7-baff-390d3623e109"
          ],
          "display_name": false
        },
        {
          "uuid": "d253ed09-32fa-44aa-9df9-286f16172b00",
          "name": "D7",
          "stdName": "D7",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee934efd-e378-48e7-baff-390d3623e109"
          ],
          "display_name": false
        },
        {
          "uuid": "5f6e7b3b-b74f-425f-843b-642aa1654831",
          "name": "J182.220I",
          "stdName": "J182.220I",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a73dd155-1dda-4d6f-ad95-733c0b837444"
          ],
          "display_name": false
        },
        {
          "uuid": "7fc094af-df79-411c-be8d-407860e7b373",
          "name": "TETRADECAMETHYLCYCLOHEPTASILOXANE",
          "stdName": "TETRADECAMETHYLCYCLOHEPTASILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0654b011-b0f1-451e-b7b7-2e4d8cdea6dc"
          ],
          "display_name": false
        },
        {
          "uuid": "9ba3d933-b149-4874-98c4-a339545484d0",
          "name": "TETRADECAMETHYLCYCLOTETRADECANEHEPTASILOXANE",
          "stdName": "TETRADECAMETHYLCYCLOTETRADECANEHEPTASILOXANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a73dd155-1dda-4d6f-ad95-733c0b837444"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0654b011-b0f1-451e-b7b7-2e4d8cdea6dc",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f6106bea-2418-4f53-9139-6e5f79169305",
          "citation": "pcpc",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee934efd-e378-48e7-baff-390d3623e109",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5860647-633b-4535-a1d2-d134e05f827f",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a73dd155-1dda-4d6f-ad95-733c0b837444",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J182.220I",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J182.220I",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3042fffc-ce38-4a3b-85a1-9664f552aa59",
          "citation": "http://pubchem.ncbi.nlm.nih.gov/compound/7874#section=Top",
          "url": "http://pubchem.ncbi.nlm.nih.gov/compound/7874#section=Top",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68140105-236b-46d7-bfec-1a7c1cab62c1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392091000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23a233cd-b300-4450-b7c6-5068c048a505",
          "citation": "SRS import [KCK5L8VU47]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KCK5L8VU47",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392091000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e276cbb8-6b66-402f-a929-ddd28b0e5b8a",
          "citation": "CYCLOHEPTASILOXANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ba8d87d1-9f00-65c1-0bc6-8b61d3b17ea3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=107-50-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4fa1d6cd-9f6e-402e-a7f0-5e1b489ebbb3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2a52ab78-680e-365e-da85-aadb8f4db5f1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1d07df9b-f78b-42e5-f12f-3dbecd4544b3",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "45bd3253-42a2-d7c4-626b-3fd9001c4e66",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "da9cc451-5e08-4b04-babf-67f63ab6d290",
          "id": "da9cc451-5e08-4b04-babf-67f63ab6d290",
          "molfile": "\n  Marvin  01132111202D          \n\n 28 28  0  0  0  0            999 V2000\n    4.8149   -1.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0318   -1.1889    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.8551   -0.8764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4443   -0.4744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6947   -0.1297    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7918    0.1657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9868    0.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2823    0.5847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6090    0.1080    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    2.3588    0.8941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8940    1.1030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7840    0.1080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8602   -0.7134    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    1.1703   -0.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7340   -0.3915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1295   -1.0963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3796   -1.8825    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    0.3891   -1.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9381   -2.5794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1972   -1.7726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1634   -2.5970    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    2.3626   -3.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5103   -3.1009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9693   -2.7733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2830   -2.0104    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    3.6096   -3.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0391   -2.8004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1080   -2.0103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2 28  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 25 28  1  0  0  0  0\nM  END",
          "smiles": "C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1",
          "formula": "C14H42O7Si7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bc0d50c2-6fef-4699-81b0-bf49e768aefb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "519.0773",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bc65a488-67d9-4838-8136-5f931506a2ed",
      "version": "11",
      "structure": {
        "id": "78490f47-28d3-4b17-b502-e95306c3bfa3",
        "molfile": "\n  Marvin  01132106152D          \n\n 28 28  0  0  0  0            999 V2000\n    1.3796   -1.8825    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1972   -1.7726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1634   -2.5970    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    2.9693   -2.7733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2830   -2.0104    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1080   -2.0103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0318   -1.1889    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.8149   -1.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8551   -0.8764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4443   -0.4744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6947   -0.1297    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    3.2823    0.5847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6090    0.1080    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    1.7840    0.1080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8602   -0.7134    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    1.1295   -1.0963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1703   -0.0052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7340   -0.3915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3588    0.8941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8940    1.1030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7918    0.1657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9868    0.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6096   -3.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0391   -2.8004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3626   -3.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5103   -3.1009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3891   -1.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9381   -2.5794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n  1 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 13 19  1  0  0  0  0\n 13 20  1  0  0  0  0\n 11 21  1  0  0  0  0\n 11 22  1  0  0  0  0\n  5 23  1  0  0  0  0\n  5 24  1  0  0  0  0\n  3 25  1  0  0  0  0\n  3 26  1  0  0  0  0\n  1 27  1  0  0  0  0\n  1 28  1  0  0  0  0\nM  END",
        "smiles": "C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1",
        "formula": "C14H42O7Si7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "519.0773",
        "optical_activity": "NONE",
        "references": [
          "0654b011-b0f1-451e-b7b7-2e4d8cdea6dc",
          "23a233cd-b300-4450-b7c6-5068c048a505"
        ],
        "stereo_centers": 0
      },
      "unii": "KCK5L8VU47"
    }
  ]
}