{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a14c3d18-b0ff-4c7e-a694-7f15f54e6f47", "code": "55794-20-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=55794-20-2", "code_system": "CAS", "references": [ "4c529ee3-893d-4517-9443-1d68504bf6cd", "6cba61b6-90b6-48ac-8ef8-5833b0d063a1" ] }, { "uuid": "bc187bf6-85f4-4523-b4a3-2b92543c367a", "code": "259-820-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.054.365", "code_system": "ECHA (EC/EINECS)", "references": [ "4c529ee3-893d-4517-9443-1d68504bf6cd" ] }, { "uuid": "ae6740ad-fc7f-47da-bb43-8cc4976504e2", "code": "108769", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/108769", "code_system": "PUBCHEM", "references": [ "4c529ee3-893d-4517-9443-1d68504bf6cd" ] }, { "uuid": "8da117b8-34b0-bd66-3c0f-c8f57a4f8209", "code": "DTXSID4069050", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4069050", "code_system": "EPA CompTox", "references": [ "00385906-6e98-e90c-fcc4-af0e3d1537b9" ] }, { "uuid": "8462dd9d-e8c0-40cb-87c4-9db1c02a5037", "code": "KAB9RC3PEN", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "0d2b0d5c-411d-41ca-b540-bdd2dc039253", "name": "Butanoic acid, 3,3-bis[(1,1-dimethylethyl)dioxy]-, ethyl ester", "stdName": "BUTANOIC ACID, 3,3-BIS((1,1-DIMETHYLETHYL)DIOXY)-, ETHYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "01e6182a-750c-4ed1-8ac8-27313960791f", "50219a4e-30fb-477b-957c-58e31119cdea", "6cba61b6-90b6-48ac-8ef8-5833b0d063a1" ], "display_name": false }, { "uuid": "87cea8f9-0fa3-47b0-8267-319fd4104f22", "name": "Ethyl 3,3-bis(tert-butylperoxy)butanoate", "stdName": "ETHYL 3,3-BIS(TERT-BUTYLPEROXY)BUTANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6cba61b6-90b6-48ac-8ef8-5833b0d063a1" ], "display_name": true }, { "uuid": "81f7cd3a-bc1f-401d-a04b-ab80c190f358", "name": "Ethyl 3,3-bis(tert-butylperoxy)butyrate", "stdName": "ETHYL 3,3-BIS(TERT-BUTYLPEROXY)BUTYRATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6cba61b6-90b6-48ac-8ef8-5833b0d063a1" ], "display_name": false }, { "uuid": "1c2b9bf7-1791-4111-8cb9-a41d69a3b939", "name": "Ethyl 3,3-di(t-butylperoxy)butyrate", "stdName": "ETHYL 3,3-DI(T-BUTYLPEROXY)BUTYRATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6cba61b6-90b6-48ac-8ef8-5833b0d063a1" ], "display_name": false }, { "uuid": "f4955687-5c64-4582-94e7-65ae8c1a9f5b", "name": "Ethyl 3,3-di(tert-butylperoxy)butyrate", "stdName": "ETHYL 3,3-DI(TERT-BUTYLPEROXY)BUTYRATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6cba61b6-90b6-48ac-8ef8-5833b0d063a1" ], "display_name": false } ], "references": [ { "uuid": "50219a4e-30fb-477b-957c-58e31119cdea", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "01e6182a-750c-4ed1-8ac8-27313960791f", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4c529ee3-893d-4517-9443-1d68504bf6cd", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394054000, "tags": [ "NOMEN" ] }, { "uuid": "00385906-6e98-e90c-fcc4-af0e3d1537b9", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=55794-20-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6cba61b6-90b6-48ac-8ef8-5833b0d063a1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9318bc0f-ed95-4f40-bdf5-8dbe97b738f7", "id": "9318bc0f-ed95-4f40-bdf5-8dbe97b738f7", "molfile": "\n Marvin 01132107372D \n\n 20 19 0 0 0 0 999 V2000\n 1.0955 -2.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8335 -3.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5730 -2.7093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3110 -3.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3030 -3.9992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0505 -2.7268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7885 -3.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3792 -2.5866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7835 -4.0196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7913 -4.8572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5692 -5.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2567 -5.6266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1662 -5.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0208 -4.6681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7530 -3.3844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4190 -2.7461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1121 -3.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5645 -2.7995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6707 -3.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6074 -3.7613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 15 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 11 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 17 20 1 0 0 0 0\nM END", "smiles": "CCOC(=O)CC(C)(OOC(C)(C)C)OOC(C)(C)C", "formula": "C14H28O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2b4c3a6e-f26c-4f5d-81ce-485d8b92cf6d" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "292.3691", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "2dc1ccad-057d-421d-a249-7e8d059da742", "version": "6", "structure": { "id": "e5480dcc-3657-444f-b7b0-06eeab094a79", "molfile": "\n Marvin 01132111522D \n\n 20 19 0 0 0 0 999 V2000\n 3.3030 -3.9992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3110 -3.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5730 -2.7093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8335 -3.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0955 -2.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0505 -2.7268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7885 -3.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7835 -4.0196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7913 -4.8572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5692 -5.3086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2567 -5.6266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1662 -5.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0208 -4.6681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7530 -3.3844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4190 -2.7461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1121 -3.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5645 -2.7995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6707 -3.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6074 -3.7613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3792 -2.5866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 10 13 1 0 0 0 0\n 7 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 16 19 1 0 0 0 0\n 7 20 1 0 0 0 0\nM END", "smiles": "CCOC(=O)CC(C)(OOC(C)(C)C)OOC(C)(C)C", "formula": "C14H28O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "292.3691", "optical_activity": "NONE", "references": [ "50219a4e-30fb-477b-957c-58e31119cdea" ], "stereo_centers": 0 }, "unii": "KAB9RC3PEN" } ] }