{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "69436a7e-5898-48f5-99ef-a373b042db7b",
          "code": "139-13-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=139-13-9",
          "code_system": "CAS",
          "references": [
            "4473437c-2799-4add-bc09-0cc39b350cd0",
            "0c2b8f04-2088-4ecd-a594-c141f159be5a"
          ]
        },
        {
          "uuid": "baa00e7d-c535-4651-bf18-e2774333714b",
          "code": "D009571",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68009571",
          "code_system": "MESH",
          "references": [
            "4473437c-2799-4add-bc09-0cc39b350cd0"
          ]
        },
        {
          "uuid": "45b28127-ab59-43fb-b6d5-76b05d226772",
          "code": "NITRILOTRIACETIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Nitrilotriacetic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "4473437c-2799-4add-bc09-0cc39b350cd0"
          ]
        },
        {
          "uuid": "30ad0815-b25e-4bac-8bb6-a27279afaf76",
          "code": "C44408",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C44408",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4473437c-2799-4add-bc09-0cc39b350cd0"
          ]
        },
        {
          "uuid": "2492e877-027f-4fde-b16c-87f76bd25a06",
          "code": "m7935",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7935?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4473437c-2799-4add-bc09-0cc39b350cd0"
          ]
        },
        {
          "uuid": "17fd4c4f-d6fb-4da1-973e-bb7c4524ae39",
          "code": "205-355-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.869",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4473437c-2799-4add-bc09-0cc39b350cd0"
          ]
        },
        {
          "uuid": "f2841543-fc16-44d1-a453-ef0fad67cc04",
          "code": "8758",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8758",
          "code_system": "PUBCHEM",
          "references": [
            "4473437c-2799-4add-bc09-0cc39b350cd0"
          ]
        },
        {
          "uuid": "53329697-ea5a-63ce-2375-a8deda4dbd6a",
          "code": "2853",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2853",
          "code_system": "HSDB",
          "references": [
            "9e873dad-4a59-c807-c8c4-f2768abec175"
          ]
        },
        {
          "uuid": "04b38434-32ed-649d-b115-e847809807f6",
          "code": "DTXSID6020939",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6020939",
          "code_system": "EPA CompTox",
          "references": [
            "d4ac169a-0a7d-5e7d-f33c-9ac335591dab"
          ]
        },
        {
          "uuid": "61920274-f79d-d83d-a7e2-a202cd3bfcc4",
          "code": "C45176",
          "comments": "Chemical Modifier[C1932]|Carcinogen[C347]|Chemical Carcinogen[C1743]|Organic Carcinogen[C45175]|Organo-nitrogen Carcinogen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45176",
          "code_system": "NCI_THESAURUS",
          "references": [
            "38261918-70e9-317b-e59c-3ddb3dd4e9fb"
          ]
        },
        {
          "uuid": "0a110728-16e4-f4de-187b-83c797adb143",
          "code": "DB03040",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03040",
          "code_system": "DRUG BANK",
          "references": [
            "38261918-70e9-317b-e59c-3ddb3dd4e9fb"
          ]
        },
        {
          "uuid": "53c6b426-e683-400a-8d40-e7701587a95d",
          "code": "KA90006V9D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "abce8e1e-7750-af64-798d-3a633a8707f4",
          "code": "1463950",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1463950",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "38261918-70e9-317b-e59c-3ddb3dd4e9fb"
          ]
        },
        {
          "uuid": "233f64b3-7795-c50b-55d3-4761138f99f0",
          "code": "44557",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:44557",
          "code_system": "CHEBI",
          "references": [
            "38261918-70e9-317b-e59c-3ddb3dd4e9fb"
          ]
        },
        {
          "uuid": "a08b95db-4fee-61a3-013d-4a7ecaf52f26",
          "code": "2121",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2121",
          "code_system": "NSC",
          "references": [
            "8d7f123d-e2f7-558a-17ce-8f1a3c5952e2"
          ]
        },
        {
          "uuid": "e1e34c97-af05-7f25-9614-6e7b83d59825",
          "code": "300000053476",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "57352e0d-d942-180f-a37a-5cd90a79e322"
          ]
        },
        {
          "uuid": "80de6cc8-27eb-aa6b-f78d-b45eb836e27f",
          "code": "KA90006V9D",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(KA90006V9D)",
          "code_system": "DAILYMED",
          "references": [
            "d04942e5-41eb-d934-e551-a55dd9d5701d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "fb83a240-2086-4ee2-a82b-2ee18e77b24b",
          "amount": {
            "uuid": "ddff11e6-309f-4692-934a-d95dd12efeba"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "da2b1613-8b1c-4efe-ad98-fa244d1c5bc7",
            "refuuid": "aa607fbc-5283-4d02-a583-1ed28c3ea2a8",
            "name": "Nitrilotriacetic acid",
            "unii": "KA90006V9D",
            "linking_id": "KA90006V9D",
            "ref_pname": "Nitrilotriacetic acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "beda9fe5-b510-4e46-b5fb-74f91833d270",
          "amount": {
            "uuid": "45946a97-5b07-4ff9-b8c3-710bb254b92e"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "219a8414-29a7-4996-8c53-2e627d61e026",
            "refuuid": "fb0f7312-00e6-483d-b835-61b939cb064b",
            "name": "TRIPOTASSIUM NITRILOTRIACETATE",
            "unii": "36H9YT65LM",
            "linking_id": "36H9YT65LM",
            "ref_pname": "TRIPOTASSIUM NITRILOTRIACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "da430986-29ad-4b1f-ae41-48cae6702366",
          "amount": {
            "uuid": "aceeeee3-b7a8-4a43-b829-1cb8851484eb"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "8df678e4-5267-4ede-b9fc-53b00fd5ddde",
            "refuuid": "719a9274-facc-47a2-94cb-dc9d3a4f9916",
            "name": "DISODIUM NITRILOACETATE",
            "unii": "LLV4KI749R",
            "linking_id": "LLV4KI749R",
            "ref_pname": "DISODIUM NITRILOACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "17dbe58f-06d7-4516-a8c8-6e24a1754bd2",
          "amount": {
            "uuid": "faa0ddc6-ac9b-40b0-85da-988b6b16cb86"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "2b8d4b4d-328c-49f8-8b0a-cec2eee347fb",
            "refuuid": "71911fee-9b1f-4564-a6ee-ef66d12391a3",
            "name": "DISODIUM NITRILOTRIACETATE MONOHYDRATE",
            "unii": "NLA3BW4578",
            "linking_id": "NLA3BW4578",
            "ref_pname": "DISODIUM NITRILOTRIACETATE MONOHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9c07358d-f23d-4a57-a251-3bde6fab05f7",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "3dc4f382-acc9-4df9-b824-811ce9e6e547",
            "refuuid": "7635d408-ab2e-4131-9248-f35099625427",
            "name": "FERRIC NITRILOTRIACETATE",
            "unii": "Z3U5ED15B9",
            "linking_id": "Z3U5ED15B9",
            "ref_pname": "FERRIC NITRILOTRIACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c8c726c6-1d67-4514-8c18-dcfdff101322",
          "amount": {
            "uuid": "94c905f1-17a1-4169-b629-b9ced5f9ca70",
            "type": "WEIGHT PERCENT",
            "units": "%",
            "high_limit": 0.1,
            "non_numeric_value": "PEAK VALUE"
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "ee82f3f2-b551-37e8-3c29-cbb0f7ba9c56"
          ],
          "related_substance": {
            "uuid": "aeae6b88-98e4-4b2c-a218-e24050454b94",
            "refuuid": "f80509e9-8951-4d2d-ae96-abf4064c8f2b",
            "name": "EDETATE CALCIUM DISODIUM ANHYDROUS",
            "unii": "8U5D034955",
            "linking_id": "8U5D034955",
            "ref_pname": "EDETATE CALCIUM DISODIUM ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "38323cc9-f955-474f-8efc-7a21e523189a",
          "amount": {
            "uuid": "872bd9f2-7f88-4030-bc45-69c98948cf22",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "6c5d6665-b719-4a50-98cf-d9489b4e75b1"
          ],
          "related_substance": {
            "uuid": "95065d74-fb50-4825-8882-363adbd5e1f5",
            "refuuid": "47a2515b-7275-43fc-8c6c-146e392ea7bc",
            "name": "EDETATE DISODIUM",
            "unii": "7FLD91C86K",
            "linking_id": "7FLD91C86K",
            "ref_pname": "EDETATE DISODIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9cfc170c-0f4e-49f1-8658-9c07337917d9",
          "name": "2,2',2''-NITRILOTRIACETIC ACID",
          "stdName": "2,2',2''-NITRILOTRIACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92d7471b-8b64-44d0-990c-48dad93d3eb4",
            "bd36780a-d837-4bde-a98b-975cfa938fdc"
          ],
          "display_name": false
        },
        {
          "uuid": "8e4cad55-c9f2-44a9-9a18-c749976f9ade",
          "name": "A,A',A''-TRIMETHYLAMINETRICARBOXYLIC ACID",
          "stdName": "A,A',A''-TRIMETHYLAMINETRICARBOXYLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92d7471b-8b64-44d0-990c-48dad93d3eb4",
            "bd36780a-d837-4bde-a98b-975cfa938fdc"
          ],
          "display_name": false
        },
        {
          "uuid": "d6bf117f-3680-e7ce-f232-f4b596651c27",
          "name": "DISODIUM EDETATE IMPURITY A [EP IMPURITY]",
          "stdName": "DISODIUM EDETATE IMPURITY A [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c5d6665-b719-4a50-98cf-d9489b4e75b1"
          ],
          "display_name": false
        },
        {
          "uuid": "bb50bfc1-5c1a-49f5-97e8-eb8bd26a8b37",
          "name": "GLYCINE, N,N-BIS(CARBOXYMETHYL)-",
          "stdName": "GLYCINE, N,N-BIS(CARBOXYMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92d7471b-8b64-44d0-990c-48dad93d3eb4",
            "bd36780a-d837-4bde-a98b-975cfa938fdc"
          ],
          "display_name": false
        },
        {
          "uuid": "e5d344c3-28dd-6bf5-014e-36a7827d089b",
          "name": "N,N-BIS(CARBOXYMETHYL)GLYCINE",
          "stdName": "N,N-BIS(CARBOXYMETHYL)GLYCINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "021f17dc-c13e-89eb-08bb-257c4090130e"
          ],
          "display_name": false
        },
        {
          "uuid": "91e697d6-9607-660c-c7de-2fc85a2a6e3d",
          "name": "NITRILO-2,2',2''-TRIACETIC ACID",
          "stdName": "NITRILO-2,2',2''-TRIACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "021f17dc-c13e-89eb-08bb-257c4090130e"
          ],
          "display_name": false
        },
        {
          "uuid": "4f682e5d-bd87-3b7e-0c91-53accb6367c2",
          "name": "NITRILO-N,N,N-TRIACETIC ACID",
          "stdName": "NITRILO-N,N,N-TRIACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "021f17dc-c13e-89eb-08bb-257c4090130e"
          ],
          "display_name": false
        },
        {
          "uuid": "1f481635-29ec-14a4-bb67-4e5aedc2abcf",
          "name": "NITRILOTRIACETIC ACID AND ITS SALTS [IARC]",
          "stdName": "NITRILOTRIACETIC ACID AND ITS SALTS [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e654aa5-1970-aa24-824b-1056a7a4f871"
          ],
          "display_name": false
        },
        {
          "uuid": "3d3b4941-5ff1-437f-a310-27fa697fe06b",
          "name": "NITRILOTRIACETIC ACID [HSDB]",
          "stdName": "NITRILOTRIACETIC ACID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0172970f-35a7-4eb9-848a-da5c5fac844f",
            "bd36780a-d837-4bde-a98b-975cfa938fdc"
          ],
          "display_name": false
        },
        {
          "uuid": "ba89b6af-fde5-426f-9869-8c2b4d9653be",
          "name": "NITRILOTRIACETIC ACID [MI]",
          "stdName": "NITRILOTRIACETIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf404c8a-6793-4157-a227-7ac1600d46ca",
            "bd36780a-d837-4bde-a98b-975cfa938fdc"
          ],
          "display_name": false
        },
        {
          "uuid": "a45a79e0-8962-4d6d-a493-bc493f8eed34",
          "name": "NITRILOTRIACETIC ACID [USP-RS]",
          "stdName": "NITRILOTRIACETIC ACID [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ce9b760b-88d8-4e97-9c03-07b93cdd600e",
            "bd36780a-d837-4bde-a98b-975cfa938fdc"
          ],
          "display_name": false
        },
        {
          "uuid": "bf5af712-c9fd-496e-9e67-86403e66b6a3",
          "name": "NSC-2121",
          "stdName": "NSC-2121",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdb4b305-9b80-45c7-8c41-02a70f7942e4",
            "bd36780a-d837-4bde-a98b-975cfa938fdc"
          ],
          "display_name": false
        },
        {
          "uuid": "5ca33ce3-a012-46e5-8d63-46ff04547bcd",
          "name": "NTA",
          "stdName": "NTA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92d7471b-8b64-44d0-990c-48dad93d3eb4",
            "bd36780a-d837-4bde-a98b-975cfa938fdc"
          ],
          "display_name": false
        },
        {
          "uuid": "986c4198-30bb-4972-87d9-4d77a207967e",
          "name": "Nitrilotriacetic acid",
          "stdName": "NITRILOTRIACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf404c8a-6793-4157-a227-7ac1600d46ca",
            "92d7471b-8b64-44d0-990c-48dad93d3eb4",
            "cf1ba257-e84e-41e0-819c-491e89dc91fa",
            "f5a40b73-ccfa-4fd9-9e4b-818e7c6612d6",
            "ce9b760b-88d8-4e97-9c03-07b93cdd600e",
            "0172970f-35a7-4eb9-848a-da5c5fac844f",
            "bd36780a-d837-4bde-a98b-975cfa938fdc",
            "d242957e-f484-4f56-9f14-c42f58f8cbe0"
          ],
          "display_name": true
        },
        {
          "uuid": "62588f69-f9c4-1bee-9e6e-e9912cc0c25e",
          "name": "SODIUM CALCIUM EDETATE IMPURITY A [EP IMPURITY]",
          "stdName": "SODIUM CALCIUM EDETATE IMPURITY A [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee82f3f2-b551-37e8-3c29-cbb0f7ba9c56"
          ],
          "display_name": false
        },
        {
          "uuid": "cdd893ff-8828-5dfc-7001-e36110613f42",
          "name": "TRIGLYCOLLAMIC ACID",
          "stdName": "TRIGLYCOLLAMIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "021f17dc-c13e-89eb-08bb-257c4090130e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "92d7471b-8b64-44d0-990c-48dad93d3eb4",
          "citation": "CHEMSPIDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bd36780a-d837-4bde-a98b-975cfa938fdc",
          "citation": "CHEMSPIDER",
          "doc_type": "CHEMSPIDER",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0172970f-35a7-4eb9-848a-da5c5fac844f",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce9b760b-88d8-4e97-9c03-07b93cdd600e",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf404c8a-6793-4157-a227-7ac1600d46ca",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdb4b305-9b80-45c7-8c41-02a70f7942e4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4473437c-2799-4add-bc09-0cc39b350cd0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391417000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce828d1d-7703-4494-8229-08c996b1fca0",
          "citation": "SRS import [KA90006V9D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=KA90006V9D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391417000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5a40b73-ccfa-4fd9-9e4b-818e7c6612d6",
          "citation": "NITRILOTRIACETIC ACID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d242957e-f484-4f56-9f14-c42f58f8cbe0",
          "citation": "NITRILOTRIACETIC ACID [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cf1ba257-e84e-41e0-819c-491e89dc91fa",
          "citation": "NITRILOTRIACETIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9e873dad-4a59-c807-c8c4-f2768abec175",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+139-13-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d4ac169a-0a7d-5e7d-f33c-9ac335591dab",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=139-13-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7e654aa5-1970-aa24-824b-1056a7a4f871",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "38261918-70e9-317b-e59c-3ddb3dd4e9fb",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "021f17dc-c13e-89eb-08bb-257c4090130e",
          "citation": "SCIFINDER",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ee82f3f2-b551-37e8-3c29-cbb0f7ba9c56",
          "citation": "EP",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0c2b8f04-2088-4ecd-a594-c141f159be5a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6c5d6665-b719-4a50-98cf-d9489b4e75b1",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8d7f123d-e2f7-558a-17ce-8f1a3c5952e2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d04942e5-41eb-d934-e551-a55dd9d5701d",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "57352e0d-d942-180f-a37a-5cd90a79e322",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "61f00685-4011-45c3-9d12-4899f0703ddd",
          "id": "61f00685-4011-45c3-9d12-4899f0703ddd",
          "molfile": "\n  CDK     05032415422D\n\n 13 12  0  0  0  0  0  0  0  0999 V2000\n   24.5956   -8.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9465   -9.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9465  -11.2060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2975   -8.8660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5956   -7.3060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2445   -6.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8936   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8936   -8.8660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5425   -6.5260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9465   -6.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9465   -4.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5956   -4.1860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2975   -4.1860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\nM  END",
          "smiles": "C(C(=O)O)N(CC(=O)O)CC(=O)O",
          "formula": "C6H9NO6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "28227ddc-28d2-4e62-a983-86821a4b206f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "191.139",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "aa607fbc-5283-4d02-a583-1ed28c3ea2a8",
      "version": "24",
      "structure": {
        "id": "242a3b79-cc5d-43d6-b7ad-2e58651d7706",
        "molfile": "\n   JSDraw205032415422D\n\n 13 12  0  0  0  0              0 V2000\n   24.5956   -8.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9465   -9.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9465  -11.2060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2975   -8.8660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5956   -7.3060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2445   -6.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8936   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8936   -8.8660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5425   -6.5260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9465   -6.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9465   -4.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5956   -4.1860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2975   -4.1860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\nM  END",
        "smiles": "C(C(=O)O)N(CC(=O)O)CC(=O)O",
        "formula": "C6H9NO6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "191.139",
        "optical_activity": "NONE",
        "references": [
          "92d7471b-8b64-44d0-990c-48dad93d3eb4",
          "ce828d1d-7703-4494-8229-08c996b1fca0"
        ],
        "stereo_centers": 0
      },
      "unii": "KA90006V9D"
    }
  ]
}