{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "13ce8b65-55a6-43bc-842f-69028f5612fd",
          "code": "N0000175426",
          "comments": "Established Pharmacologic Class [EPC]|Antiarrhythmic [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175426",
          "code_system": "NDF-RT",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "66163524-73bc-4c63-9b86-f93280e57715",
          "code": "C01BC04",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|CARDIAC THERAPY|ANTIARRHYTHMICS, CLASS I AND III|Antiarrhythmics, class Ic|flecainide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C01BC04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "2e5e8275-6691-480b-822b-461be0adeaa9",
          "code": "QC01BC04",
          "comments": "VATC|CARDIAC THERAPY|ANTIARRYTHMICS, CLASS I  AND III|Antiarrhythmics, class Ic|flecainide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC01BC04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "8f533866-799e-44de-a02f-e0c8e0d153e4",
          "code": "54143-55-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=54143-55-4",
          "code_system": "CAS",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963",
            "952005e6-d8dd-45d0-b0e8-9ced06fa2f46"
          ]
        },
        {
          "uuid": "1cdb7d5e-2c3b-4656-b839-385639aa9924",
          "code": "C62029",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C62029",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "3b2595f1-6906-481b-b193-f05f084a3dec",
          "code": "D005424",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68005424",
          "code_system": "MESH",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "34908fcf-cd7e-4fcb-8b59-455bd60b050b",
          "code": "NBK548023",
          "comments": "LiverTox|Cardiac|Anti-arrhythmic|Na channel blocker: Class Ic",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548023/",
          "code_system": "LIVERTOX",
          "references": [
            "f3e94b1d-b541-0618-5c42-a88238521471"
          ]
        },
        {
          "uuid": "72c5a747-cb1a-4e14-b747-14c3d8e866d1",
          "code": "FLECAINIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Flecainide",
          "code_system": "WIKIPEDIA",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "26134964-d5a7-45b5-96a1-5d88f9d4f196",
          "code": "SUB07637MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "ff27fe5e-a8f3-48a0-8d07-a3ace38699f1",
          "code": "4096",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4096",
          "code_system": "INN",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "ff278b10-9cc8-440e-b8f7-652ebb6624d3",
          "code": "2560",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=2560",
          "code_system": "IUPHAR",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "4c68de50-3dee-4fde-89be-d461a44e9a1d",
          "code": "4441",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/4441/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "0a95091d-dfa2-4548-92da-a104210e05e6",
          "code": "m5400",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5400?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "7a852c30-d7a4-401f-b29b-26c8b35f6029",
          "code": "DB01195",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01195",
          "code_system": "DRUG BANK",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "c66ea7a5-23c5-4c00-8803-f0bce5458953",
          "code": "CHEMBL652",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL652",
          "code_system": "ChEMBL",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "18615afd-b2ed-4901-944d-45ddc8d04eff",
          "code": "3356",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3356",
          "code_system": "PUBCHEM",
          "references": [
            "5047028a-b3c5-4680-948c-de265ce7a963"
          ]
        },
        {
          "uuid": "96d24000-958b-97e0-cd2c-ff0e0be7c1f4",
          "code": "DTXSID8023054",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8023054",
          "code_system": "EPA CompTox",
          "references": [
            "a2207ceb-3ac9-f6f6-d3c1-bfd059bb8ea1"
          ]
        },
        {
          "uuid": "be0a92ae-b54e-d391-8001-e617bc0fc9df",
          "code": "Flecainide",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM112/",
          "code_system": "LACTMED",
          "references": [
            "f3e94b1d-b541-0618-5c42-a88238521471"
          ]
        },
        {
          "uuid": "9cfa638e-50ce-10c8-a7d8-1e2c6020e3e8",
          "code": "C47793",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Antiarrhythmic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47793",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f3e94b1d-b541-0618-5c42-a88238521471"
          ]
        },
        {
          "uuid": "c59e0375-42b1-2511-8f46-58ca1ca69fcb",
          "code": "C93038",
          "comments": "Pharmacologic Substance[C1909]|Cation Channel Blocker",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C93038",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f3e94b1d-b541-0618-5c42-a88238521471"
          ]
        },
        {
          "uuid": "6639f2bc-6cf1-43d8-95b6-9f91fb5bf435",
          "code": "K94FTS1806",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6f62cf2f-b0c3-b4f8-91e8-7744062fd1fe",
          "code": "1176",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1176",
          "code_system": "DRUG CENTRAL",
          "references": [
            "f3e94b1d-b541-0618-5c42-a88238521471"
          ]
        },
        {
          "uuid": "586e9744-86f7-f25f-ffb7-46c04c8ebcca",
          "code": "75984",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:75984",
          "code_system": "CHEBI",
          "references": [
            "f3e94b1d-b541-0618-5c42-a88238521471"
          ]
        },
        {
          "uuid": "5c7f823d-450f-ace7-d25a-ca91e8d04f81",
          "code": "536716",
          "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of narcolepsy",
          "codeText": "ORPHAN DRUG|Designated/Withdrawn|Treatment of narcolepsy",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=536716",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "c3ae1dc8-7672-4bd2-7601-15afceaf3289",
          "code": "100000080972",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a23a3ef9-2b9e-c3ab-8f45-52d92004a92c"
          ]
        },
        {
          "uuid": "3ff53ff0-7616-da06-4365-7cc953281a1b",
          "code": "K94FTS1806",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=K94FTS1806",
          "code_system": "DAILYMED",
          "references": [
            "04b367c0-8040-5486-b1a3-dbbe9fd75e87"
          ]
        },
        {
          "uuid": "47502c36-8521-0c76-2ab5-1c8ce873d162",
          "code": "719273",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=719273",
          "code_system": "NSC",
          "references": [
            "9431f5bc-c609-76a0-0e2b-f666bab9510e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "56efee2f-d6a9-4d0f-85f6-45cb40ea8455",
          "amount": {
            "uuid": "3cc4d4af-85a7-4912-9af9-31a25a9ab203"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2b22f9dd-a5e7-41e7-8e4c-d1e76657c002",
            "refuuid": "de4ce18c-445a-4590-b8dc-cc58250a7198",
            "name": "FLECAINIDE",
            "unii": "K94FTS1806",
            "linking_id": "K94FTS1806",
            "ref_pname": "FLECAINIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "97341f82-43d3-4d3d-9f9d-aca6394abaf0",
          "amount": {
            "uuid": "0b431df8-9cc0-455a-8b18-9a1d401b8863"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "71a57cf7-eb38-402f-b84d-2556df931308",
            "refuuid": "8651c25a-2df8-4dd3-aaa9-95a0eea0ca32",
            "name": "FLECAINIDE ACETATE",
            "unii": "M8U465Q1WQ",
            "linking_id": "M8U465Q1WQ",
            "ref_pname": "FLECAINIDE ACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d2148005-0699-40a5-86b3-422cc833cbd4",
          "amount": {
            "uuid": "e475f0a1-af66-41d1-ad9d-215d7f188ca9"
          },
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "b5e201cf-a1cd-4a22-8654-084309f3edac",
            "refuuid": "3a91042b-6cb6-45fd-b405-160928106c14",
            "name": "SODIUM CHANNEL PROTEIN TYPE 5 SUBUNIT ALPHA",
            "unii": "F660L4205N",
            "linking_id": "F660L4205N",
            "ref_pname": "SODIUM CHANNEL PROTEIN TYPE 5 SUBUNIT ALPHA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f8db9668-9040-41d3-b16d-c8f588a0ea31",
          "amount": {
            "uuid": "1f39fdaf-7a80-4862-980c-0ad4dcfcf315"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "dc438710-bce0-4979-ab5c-c3588f0e3bc3"
          ],
          "related_substance": {
            "uuid": "cb5bff67-0520-4555-87fc-ef8477a2c0d5",
            "refuuid": "d7c85270-dafa-46ca-9023-150d1ec10fd1",
            "name": "5-HYDROXY-N-((6-OXO-2-PIPERIDINYL)METHYL)-2-(2,2,2-TRIFLUOROETHOXY)BENZAMIDE",
            "unii": "AM5ZFE94FL",
            "linking_id": "AM5ZFE94FL",
            "ref_pname": "5-HYDROXY-N-((6-OXO-2-PIPERIDINYL)METHYL)-2-(2,2,2-TRIFLUOROETHOXY)BENZAMIDE"
          }
        },
        {
          "uuid": "8850f0f0-154b-40de-86f6-fe7745f42925",
          "type": "METABOLITE->PARENT",
          "references": [
            "417bd70e-5fdc-4341-80ab-d2dfb1a4216e"
          ],
          "related_substance": {
            "uuid": "8ced9be4-0482-40ed-a098-a2050ef0c76f",
            "refuuid": "c26fa20d-b2f1-4e22-bb3a-ead09d4c9852",
            "name": "FLECAINIDE META-O-DEALKYLATED",
            "unii": "K6RB757PWW",
            "linking_id": "K6RB757PWW",
            "ref_pname": "FLECAINIDE META-O-DEALKYLATED"
          }
        },
        {
          "uuid": "6ad4ac32-6b02-45b8-b952-6ea7fce82e5b",
          "amount": {
            "uuid": "e7e41131-bd50-4363-98d7-daf89a39bd2e"
          },
          "comments": "Intermediate",
          "type": "PARENT->IMPURITY",
          "related_substance": {
            "uuid": "d418cab8-5649-4b90-898a-3e3f33cd1669",
            "refuuid": "8651c25a-2df8-4dd3-aaa9-95a0eea0ca32",
            "name": "FLECAINIDE ACETATE",
            "unii": "M8U465Q1WQ",
            "linking_id": "M8U465Q1WQ",
            "ref_pname": "FLECAINIDE ACETATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fd88942a-cdbd-4525-b64e-75e58f2231a0",
          "name": "FLECAINIDE",
          "stdName": "FLECAINIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4043b742-6ece-42b2-991d-c2512ae45b9f",
            "1a4a40ec-1dff-4660-8ca4-78a60f46b6c7",
            "e826f1c9-c90e-4714-8e7e-4323c7935707",
            "b3995150-24a8-4cac-8765-e616802a863e",
            "76d1240c-c75a-440c-a136-273e60b96056",
            "bc815a2e-87e4-4e0f-b841-1972c7f83dba",
            "58dabcc9-8400-4995-83e3-562d74781db9",
            "a496cdea-bcc0-4e86-81b5-9a0ee82fce54",
            "755bbe1d-cd3c-4c39-98d9-6846fdcceece"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "c5242fa9-b6d3-4044-be8d-03cd6e79f1ac",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "b9b9ed24-3207-4f84-85d3-3ffb2f96350a",
          "name": "FLECAINIDE [MI]",
          "stdName": "FLECAINIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a496cdea-bcc0-4e86-81b5-9a0ee82fce54"
          ],
          "display_name": false
        },
        {
          "uuid": "6abf0ffe-9f89-4c9f-8f6d-d3dbc6ed13ed",
          "name": "FLECAINIDE [VANDF]",
          "stdName": "FLECAINIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "755bbe1d-cd3c-4c39-98d9-6846fdcceece"
          ],
          "display_name": false
        },
        {
          "uuid": "74a0de16-b2b6-ec85-d99f-6691d1e8b032",
          "name": "Flecainide [WHO-DD]",
          "stdName": "FLECAINIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a393d945-d862-1264-3ebb-c29ef134dcce"
          ],
          "display_name": false
        },
        {
          "uuid": "3d116ddf-cbf0-4f9c-851c-854a5650304d",
          "name": "N-(2-PIPERIDYLMETHYL)-2,5-BIS(2,2,2-TRIFLUOROETHOXY)BENZAMIDE",
          "stdName": "N-(2-PIPERIDYLMETHYL)-2,5-BIS(2,2,2-TRIFLUOROETHOXY)BENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e819c13-00fb-4be6-8d92-a2e2207642c4"
          ],
          "display_name": false
        },
        {
          "uuid": "d2efa6a6-f62b-b015-bce0-851ee5e11461",
          "name": "NSC-719273",
          "stdName": "NSC-719273",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9431f5bc-c609-76a0-0e2b-f666bab9510e"
          ],
          "display_name": false
        },
        {
          "uuid": "6f4454f3-5e2e-f6e0-3dff-8aae78d5edfd",
          "name": "THN-102 COMPONENT FLECAINIDE",
          "stdName": "THN-102 COMPONENT FLECAINIDE",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff8abbfe-387a-94f0-86bc-cc030bc7aea1"
          ],
          "display_name": false
        },
        {
          "uuid": "6af8bb63-b88a-d527-c3d2-bdb46ac4e593",
          "name": "THN102 COMPONENT FLECAINIDE",
          "stdName": "THN102 COMPONENT FLECAINIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff8abbfe-387a-94f0-86bc-cc030bc7aea1"
          ],
          "display_name": false
        },
        {
          "uuid": "e956785c-0a8e-4a07-8f65-7d3ab5605e00",
          "name": "flecainide [INN]",
          "stdName": "FLECAINIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3995150-24a8-4cac-8765-e616802a863e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "58dabcc9-8400-4995-83e3-562d74781db9",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6300eba7-74e3-4a08-a8ec-b135d22d8a8e",
          "citation": "ACD 9.0 (INN-MEDNET)",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e819c13-00fb-4be6-8d92-a2e2207642c4",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3995150-24a8-4cac-8765-e616802a863e",
          "citation": "INN Proposed List 37",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL37.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a496cdea-bcc0-4e86-81b5-9a0ee82fce54",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76d1240c-c75a-440c-a136-273e60b96056",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "755bbe1d-cd3c-4c39-98d9-6846fdcceece",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5047028a-b3c5-4680-948c-de265ce7a963",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390009000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb17d219-7203-49e2-92fa-e137c8120fd1",
          "citation": "SRS import [K94FTS1806]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K94FTS1806",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390009000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0b28e9b-ce98-4f37-bba8-a0a37559fbe3",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc815a2e-87e4-4e0f-b841-1972c7f83dba",
          "citation": "FLECAINIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4043b742-6ece-42b2-991d-c2512ae45b9f",
          "citation": "FLECAINIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1a4a40ec-1dff-4660-8ca4-78a60f46b6c7",
          "citation": "FLECAINIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e826f1c9-c90e-4714-8e7e-4323c7935707",
          "citation": "FLECAINIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3519a04c-a16d-fe42-6dde-600854786e23",
          "citation": "https://en.wikipedia.org/wiki/Flecainide",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "ff8abbfe-387a-94f0-86bc-cc030bc7aea1",
          "citation": "http://adisinsight.springer.com/drugs/800045045",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "a2207ceb-3ac9-f6f6-d3c1-bfd059bb8ea1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=54143-55-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c93b0bc2-6ffb-bffb-8ab9-143cd2d9af4f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+54143-55-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f3e94b1d-b541-0618-5c42-a88238521471",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "952005e6-d8dd-45d0-b0e8-9ced06fa2f46",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "417bd70e-5fdc-4341-80ab-d2dfb1a4216e",
          "citation": "McQuinn, R. L., et al. \"Biotransformation and elimination of 14C-flecainide acetate in humans.\" Drug metabolism and disposition 12.4 (1984): 414-420.",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dc438710-bce0-4979-ab5c-c3588f0e3bc3",
          "citation": "McQuinn, R. L., et al. \"Biotransformation and elimination of 14C-flecainide acetate in humans.\" Drug metabolism and disposition 12.4 (1984): 414-420.",
          "url": "http://dmd.aspetjournals.org/content/dmd/12/4/414.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9431f5bc-c609-76a0-0e2b-f666bab9510e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a393d945-d862-1264-3ebb-c29ef134dcce",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "04b367c0-8040-5486-b1a3-dbbe9fd75e87",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "a23a3ef9-2b9e-c3ab-8f45-52d92004a92c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "62195dff-24ee-456d-9d7e-59d675954afb",
          "id": "62195dff-24ee-456d-9d7e-59d675954afb",
          "molfile": "\n  Marvin  01132105052D          \n\n 28 29  0  0  0  0            999 V2000\n   -0.0654   -5.7279    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0628   -6.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6516   -6.1414    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6516   -6.9682    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7772   -6.9682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4942   -6.5575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4967   -5.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2164   -5.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2059   -4.5138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4680   -4.1082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4758   -3.2787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1928   -2.8626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9150   -3.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6424   -3.6922    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9202   -4.1108    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6372   -2.8548    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7588   -4.4929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7667   -5.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0550   -4.0977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0602   -3.2787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6568   -4.5033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3711   -4.0847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0855   -4.5112    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.0908   -5.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8077   -5.7620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5221   -5.3564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5195   -4.5164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8182   -4.1056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 18  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 17  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 13  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 19  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 28 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  1  0  0  0  0\nM  END",
          "smiles": "C1CCNC(C1)CNC(=O)c2cc(ccc2OCC(F)(F)F)OCC(F)(F)F",
          "formula": "C17H20F6N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ffa5ef5e-d0e8-47d1-a13f-be0b3e8b2f62"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "414.3434",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "de4ce18c-445a-4590-b8dc-cc58250a7198",
      "version": "28",
      "structure": {
        "id": "78166943-7201-4400-949a-ecbc8eecbc07",
        "molfile": "\n  Marvin  01132106142D          \n\n 28 29  0  0  0  0            999 V2000\n   -0.7588   -4.4929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0550   -4.0977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9150   -3.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0628   -6.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4680   -4.1082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6568   -4.5033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7667   -5.3093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8182   -4.1056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4758   -3.2787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0602   -3.2787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1928   -2.8626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7772   -6.9682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2059   -4.5138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6424   -3.6922    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0654   -5.7279    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6516   -6.1414    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6516   -6.9682    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9202   -4.1108    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6372   -2.8548    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4967   -5.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4942   -6.5575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3711   -4.0847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0855   -4.5112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2164   -5.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5195   -4.5164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0908   -5.3538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5221   -5.3564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8077   -5.7620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3 11  1  0  0  0  0\n  4 12  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  2  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8 23  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  2  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 21  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15  4  1  0  0  0  0\n 16  4  1  0  0  0  0\n 17  4  1  0  0  0  0\n 18  3  1  0  0  0  0\n 19  3  1  0  0  0  0\n 20  7  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22  6  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 13  2  0  0  0  0\n 25  8  1  0  0  0  0\n 26 23  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 26  1  0  0  0  0\n 20 24  1  0  0  0  0\n 25 27  1  0  0  0  0\nM  END",
        "smiles": "C1CCNC(C1)CNC(=O)c2cc(ccc2OCC(F)(F)F)OCC(F)(F)F",
        "formula": "C17H20F6N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "414.3434",
        "optical_activity": "( + / - )",
        "references": [
          "f0b28e9b-ce98-4f37-bba8-a0a37559fbe3",
          "eb17d219-7203-49e2-92fa-e137c8120fd1",
          "b3995150-24a8-4cac-8765-e616802a863e"
        ],
        "stereo_centers": 1
      },
      "unii": "K94FTS1806"
    }
  ]
}