{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "59b73c8b-bcfc-4af7-bd66-f53f7525d035",
          "code": "51115-70-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51115-70-9",
          "code_system": "CAS",
          "references": [
            "a3646005-9589-465e-91d7-b40c31d5a374",
            "1d5a0f7c-b1d8-4fd1-b88f-b0c09f174c9e"
          ]
        },
        {
          "uuid": "81c87f93-e12d-41f0-90d6-ad7ddfcb335f",
          "code": "256-978-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.051.781",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a3646005-9589-465e-91d7-b40c31d5a374"
          ]
        },
        {
          "uuid": "0da2ede7-528d-493d-9ec1-a766e8ff605c",
          "code": "3016598",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3016598",
          "code_system": "PUBCHEM",
          "references": [
            "a3646005-9589-465e-91d7-b40c31d5a374"
          ]
        },
        {
          "uuid": "141ea104-37c5-8ee1-1ad7-65423d19d651",
          "code": "DTXSID20199127",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20199127",
          "code_system": "EPA CompTox",
          "references": [
            "3ddf2e40-8df3-5a91-be95-62301a0bd890"
          ]
        },
        {
          "uuid": "f64a01c9-0375-417c-b1bd-725ff7611681",
          "code": "K94244JM5H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fc0bbc61-d283-2657-2267-00836cc7feb3",
          "code": "1983",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1983/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "d561468e-4d8d-1db3-5ec8-814a47563cf6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f98732bf-aa8a-4575-bb68-aeda140259da",
          "name": "BUTANAMIDE, N,2-DIETHYL-3-METHYL-2-(1-METHYLETHYL)-",
          "stdName": "BUTANAMIDE, N,2-DIETHYL-3-METHYL-2-(1-METHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ff4c479-746c-4dbf-a227-24bdb428a57a",
            "d57d8652-306a-4f6a-ac7d-f6c9e289ecea"
          ],
          "display_name": false
        },
        {
          "uuid": "5c24169d-39be-49ef-9a06-ce7d692c2b21",
          "name": "BUTANAMIDE, N-ETHYL-2,2-BIS(1-METHYLETHYL)-",
          "stdName": "BUTANAMIDE, N-ETHYL-2,2-BIS(1-METHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ff4c479-746c-4dbf-a227-24bdb428a57a",
            "d57d8652-306a-4f6a-ac7d-f6c9e289ecea"
          ],
          "display_name": false
        },
        {
          "uuid": "2f495fdb-8e8d-4b00-9806-9210fae43af3",
          "name": "FEMA NO. 4557",
          "stdName": "FEMA NO. 4557",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b578771-d76f-41fb-8eeb-11c68ecce2c7",
            "d57d8652-306a-4f6a-ac7d-f6c9e289ecea"
          ],
          "display_name": false
        },
        {
          "uuid": "684d7328-8a3c-4a3e-aef1-74aa850d389b",
          "name": "N,2-DIETHYL-2-(ISOPROPYL)-3-METHYLBUTYRAMIDE",
          "stdName": "N,2-DIETHYL-2-(ISOPROPYL)-3-METHYLBUTYRAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b578771-d76f-41fb-8eeb-11c68ecce2c7",
            "d57d8652-306a-4f6a-ac7d-f6c9e289ecea"
          ],
          "display_name": false
        },
        {
          "uuid": "68d0db69-819e-4ef6-a49f-8850abe90856",
          "name": "N-ETHYL-2,2-DIISOPROPYLBUTANAMIDE",
          "stdName": "N-ETHYL-2,2-DIISOPROPYLBUTANAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ff4c479-746c-4dbf-a227-24bdb428a57a",
            "d57d8652-306a-4f6a-ac7d-f6c9e289ecea"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "1ff4c479-746c-4dbf-a227-24bdb428a57a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d57d8652-306a-4f6a-ac7d-f6c9e289ecea",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b578771-d76f-41fb-8eeb-11c68ecce2c7",
          "citation": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "url": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3646005-9589-465e-91d7-b40c31d5a374",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391422000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ba29ba8-ed6b-4034-9181-1a20f8c41dd7",
          "citation": "SRS import [K94244JM5H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K94244JM5H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391422000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ddf2e40-8df3-5a91-be95-62301a0bd890",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=51115-70-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1d5a0f7c-b1d8-4fd1-b88f-b0c09f174c9e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d561468e-4d8d-1db3-5ec8-814a47563cf6",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3252bc94-e9a6-4ad8-8d83-93617af38112",
          "id": "3252bc94-e9a6-4ad8-8d83-93617af38112",
          "molfile": "\n  Marvin  01132102422D          \n\n 14 13  0  0  0  0            999 V2000\n    6.4273   -3.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1427   -3.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8542   -3.5361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5693   -3.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5693   -2.2994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2847   -3.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8738   -4.2515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0481   -4.2515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9962   -3.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9962   -4.7727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7115   -3.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6957   -2.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5214   -2.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2847   -2.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  9  1  0  0  0  0\n  6 12  1  0  0  0  0\n  8  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\nM  END",
          "smiles": "CCC(C(C)C)(C(C)C)C(=O)NCC",
          "formula": "C12H25NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a6d8ccbb-82f0-41e8-88ff-73186a288d28"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "199.3335",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8336ac83-6058-48d5-9b7f-d1dc5b5ab292",
      "version": "4",
      "structure": {
        "id": "720a8dbf-94c1-4902-97f8-dfd6b620fb46",
        "molfile": "\n  Marvin  01132105552D          \n\n 14 13  0  0  0  0            999 V2000\n    6.4273   -3.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1427   -3.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9962   -4.7727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7115   -3.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9962   -3.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5214   -2.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2847   -2.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6957   -2.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8542   -3.5361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5693   -2.2994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0481   -4.2515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8738   -4.2515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2847   -3.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5693   -3.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  9  2  1  0  0  0  0\n  1  2  1  0  0  0  0\n 13  5  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  5  1  0  0  0  0\n 13  8  1  0  0  0  0\n  6  8  1  0  0  0  0\n  7  8  1  0  0  0  0\n 14  9  1  0  0  0  0\n 14 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
        "smiles": "CCC(C(C)C)(C(C)C)C(=O)NCC",
        "formula": "C12H25NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "199.3335",
        "optical_activity": "NONE",
        "references": [
          "0ba29ba8-ed6b-4034-9181-1a20f8c41dd7",
          "1ff4c479-746c-4dbf-a227-24bdb428a57a"
        ],
        "stereo_centers": 0
      },
      "unii": "K94244JM5H"
    }
  ]
}