{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "df89f0ff-15f8-4383-a92d-f2c14e5cc56b",
          "code": "CHEMBL3707342",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL3707342",
          "code_system": "ChEMBL",
          "references": [
            "0e6915b0-ebad-42e2-996a-4719306b9664"
          ]
        },
        {
          "uuid": "f2179b23-2463-4fac-8704-22897bc25864",
          "code": "N02BA12",
          "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OTHER ANALGESICS AND ANTIPYRETICS|Salicylic acid and derivatives|potassium salicylate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N02BA12&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "0e6915b0-ebad-42e2-996a-4719306b9664"
          ]
        },
        {
          "uuid": "70f6dbd8-4798-4920-a058-ef653896b9de",
          "code": "QN02BA12",
          "comments": "VATC|ANALGESICS|OTHER ANALGESICS AND ANTIPYRETICS|Salicylic acid and derivatives|potassium salicylate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02BA12&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "0e6915b0-ebad-42e2-996a-4719306b9664"
          ]
        },
        {
          "uuid": "09619d29-73ea-454a-8134-bf3bc9f9e591",
          "code": "578-36-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=578-36-9",
          "code_system": "CAS",
          "references": [
            "0e6915b0-ebad-42e2-996a-4719306b9664",
            "26ac422b-9236-4c52-a32e-c52b003c9fb0"
          ]
        },
        {
          "uuid": "a6c14e63-d2b0-4478-8d4c-173b9808e9c0",
          "code": "C84100",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C84100",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0e6915b0-ebad-42e2-996a-4719306b9664"
          ]
        },
        {
          "uuid": "8d66e2e8-2dc6-4a13-be71-1ba876affafb",
          "code": "POTASSIUM SALICYLATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Potassium_salicylate",
          "code_system": "WIKIPEDIA",
          "references": [
            "0e6915b0-ebad-42e2-996a-4719306b9664"
          ]
        },
        {
          "uuid": "666f2411-2864-4218-97ca-9c50c42c7f1c",
          "code": "209-421-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.566",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0e6915b0-ebad-42e2-996a-4719306b9664"
          ]
        },
        {
          "uuid": "a1363463-2106-4cb9-9a85-16b2d699e46c",
          "code": "235418",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/235418/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0e6915b0-ebad-42e2-996a-4719306b9664"
          ]
        },
        {
          "uuid": "aa5e7a3b-5e89-4796-8324-66f29ee0df7b",
          "code": "m9055",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9055?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0e6915b0-ebad-42e2-996a-4719306b9664"
          ]
        },
        {
          "uuid": "5168ed66-80c3-49b9-9f77-99168ccb9b8d",
          "code": "SUB14994MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0e6915b0-ebad-42e2-996a-4719306b9664"
          ]
        },
        {
          "uuid": "eaa2aa67-2f36-17d8-ae96-6423a60ce91c",
          "code": "23664627",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23664627",
          "code_system": "PUBCHEM",
          "references": [
            "ddfc7d00-b64e-af76-1749-c9039bd303ee"
          ]
        },
        {
          "uuid": "c94eb267-3836-3445-6526-42bf98303051",
          "code": "DTXSID9060366",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9060366",
          "code_system": "EPA CompTox",
          "references": [
            "38997bbc-f853-e240-b4d9-95d313f71580"
          ]
        },
        {
          "uuid": "eca99596-fb03-7da2-a851-7d827b57214c",
          "code": "C257",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257",
          "code_system": "NCI_THESAURUS",
          "references": [
            "942eaa88-143c-5d2a-1eea-852db00f68d4"
          ]
        },
        {
          "uuid": "13ecc36d-78bd-0fcc-87e9-f99b3a64c5d4",
          "code": "DBSALT002536",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT002536",
          "code_system": "DRUG BANK",
          "references": [
            "942eaa88-143c-5d2a-1eea-852db00f68d4"
          ]
        },
        {
          "uuid": "faaa0b7c-bb3e-43f9-9a31-f4851e58cb4b",
          "code": "K91YT16P5M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7d053905-121b-fca5-0e6d-fdec3c9cdd02",
          "code": "100000078845",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9c4962ed-49bf-e57d-0d02-fea864b64962"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7604004c-1b50-4f74-808d-d7b04e50d3df",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "58078ba0-d9b3-4371-bacc-074992b94e13",
            "refuuid": "77ecc185-155e-4f2d-8b74-81c91be840d2",
            "name": "Salicylic acid",
            "unii": "O414PZ4LPZ",
            "linking_id": "O414PZ4LPZ",
            "ref_pname": "Salicylic acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1696ffad-d246-43db-865c-cfce52bc0cff",
          "name": "BENZOIC ACID, 2-HYDROXY-, POTASSIUM SALT (1:1)",
          "stdName": "BENZOIC ACID, 2-HYDROXY-, POTASSIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e8b8ef2-cea3-41d6-a865-3b6db227bff4"
          ],
          "display_name": false
        },
        {
          "uuid": "2ee00987-1a3e-40ce-948f-dd9a36bd6d97",
          "name": "POTASSIUM SALICYLATE",
          "stdName": "POTASSIUM SALICYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4984a91-0e56-4b56-997e-b66fa109254d",
            "2ca7ec90-3f65-4092-bdbe-831d05ced70d",
            "55b7f9b3-c874-480d-be8e-c385f5cc239f",
            "5038c641-f610-40b9-9e96-10f30387a9d2",
            "56a9a547-9a91-41ad-98bd-6967d7ad4877",
            "75005180-2278-4b4a-b42f-9b0df7687efd",
            "77f3d085-e9fd-4f58-9df8-64e611995579",
            "eebcdb43-e195-4b62-9598-858a3bf034a3",
            "0237dc44-6e49-44c4-aedf-622c43ce9b3a"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "52466acf-3e49-4b28-a05b-f50da6f3560f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "61dc6e40-9dc2-495e-ab98-4da6aa05f647",
          "name": "POTASSIUM SALICYLATE [MI]",
          "stdName": "POTASSIUM SALICYLATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "75005180-2278-4b4a-b42f-9b0df7687efd"
          ],
          "display_name": false
        },
        {
          "uuid": "d3f410e3-dd38-483b-8c81-6da196832112",
          "name": "POTASSIUM SALICYLATE [VANDF]",
          "stdName": "POTASSIUM SALICYLATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77f3d085-e9fd-4f58-9df8-64e611995579"
          ],
          "display_name": false
        },
        {
          "uuid": "77a61370-f61d-5fc6-5551-03dbafd1522a",
          "name": "Potassium salicylate [WHO-DD]",
          "stdName": "POTASSIUM SALICYLATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33706454-4bc3-083e-b1c0-1141fbe37c06"
          ],
          "display_name": false
        },
        {
          "uuid": "f27e3475-a9f0-40e0-a366-454dba82ae98",
          "name": "SALICYLIC ACID POTASSIUM SALT",
          "stdName": "SALICYLIC ACID POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ffa7f67-af89-4e05-a929-4838715dad8d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "56a9a547-9a91-41ad-98bd-6967d7ad4877",
          "citation": "MERCK 14TH",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9ffa7f67-af89-4e05-a929-4838715dad8d",
          "citation": "http://www.chemblink.com/products/578-36-9.htm",
          "url": "http://www.chemblink.com/products/578-36-9.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75005180-2278-4b4a-b42f-9b0df7687efd",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5038c641-f610-40b9-9e96-10f30387a9d2",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e8b8ef2-cea3-41d6-a865-3b6db227bff4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eebcdb43-e195-4b62-9598-858a3bf034a3",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77f3d085-e9fd-4f58-9df8-64e611995579",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e6915b0-ebad-42e2-996a-4719306b9664",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389651000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "372b902b-64ce-4325-b227-a66df4b61f1e",
          "citation": "SRS import [K91YT16P5M]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K91YT16P5M",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389651000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0237dc44-6e49-44c4-aedf-622c43ce9b3a",
          "citation": "POTASSIUM SALICYLATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e4984a91-0e56-4b56-997e-b66fa109254d",
          "citation": "POTASSIUM SALICYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "55b7f9b3-c874-480d-be8e-c385f5cc239f",
          "citation": "POTASSIUM SALICYLATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2ca7ec90-3f65-4092-bdbe-831d05ced70d",
          "citation": "POTASSIUM SALICYLATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "38997bbc-f853-e240-b4d9-95d313f71580",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=578-36-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "942eaa88-143c-5d2a-1eea-852db00f68d4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "26ac422b-9236-4c52-a32e-c52b003c9fb0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ddfc7d00-b64e-af76-1749-c9039bd303ee",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "33706454-4bc3-083e-b1c0-1141fbe37c06",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9c4962ed-49bf-e57d-0d02-fea864b64962",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f7caa381-82a7-41cf-a792-f6222cabc14a",
          "id": "f7caa381-82a7-41cf-a792-f6222cabc14a",
          "molfile": "\n  Marvin  01132112512D          \n\n  1  0  0  0  0  0            999 V2000\n   -1.5701   -2.1184    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "98ca1d65-84c2-4669-8267-3ece33ab0393"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "089a135b-8dc9-47a8-a35e-ad752cc1ac10",
          "id": "089a135b-8dc9-47a8-a35e-ad752cc1ac10",
          "molfile": "\n  Marvin  01132100432D          \n\n 10 10  0  0  0  0            999 V2000\n    0.0240   -1.3120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6147   -2.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3998   -2.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9081   -2.6905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5116   -3.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6866   -3.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2156   -2.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5908   -2.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1177   -2.1184    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -1.0033   -3.5847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  CHG  1   9  -1\nM  END",
          "smiles": "c1ccc(c(c1)C(=O)[O-])O",
          "formula": "C7H5O3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b18563e6-6512-4bcd-bfb6-542831dbc5a0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "137.1131",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6c17f9d0-5e9f-4e84-bcb3-40bcf9d33e19",
      "version": "17",
      "structure": {
        "id": "0d4f61dc-ce8f-497c-a3e8-492c4008948c",
        "molfile": "\n  Marvin  01132100562D          \n\n 11 10  0  0  0  0            999 V2000\n    0.2156   -2.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5908   -2.7890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6147   -2.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1177   -2.1184    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -1.0033   -3.5847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0240   -1.3120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6866   -3.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3998   -2.0518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5116   -3.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9081   -2.6905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5701   -2.1184    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  3  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  CHG  2   4  -1  11   1\nM  END",
        "smiles": "c1ccc(c(c1)C(=O)[O-])O.[K+]",
        "formula": "C7H5O3.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "176.2114",
        "optical_activity": "NONE",
        "references": [
          "56a9a547-9a91-41ad-98bd-6967d7ad4877",
          "372b902b-64ce-4325-b227-a66df4b61f1e"
        ],
        "stereo_centers": 0
      },
      "unii": "K91YT16P5M"
    }
  ]
}