{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "91cd6366-1cac-4d0d-8652-0c460ddc44b4", "code": "647828-16-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=647828-16-8", "code_system": "CAS", "references": [ "55c2095e-7c91-4c45-ac11-5803e528e7af", "2449a8c6-dd11-4df5-bbb8-c7b144f071a8" ] }, { "uuid": "761d1d65-2371-400e-5d0c-6bd472a17d7f", "code": "59018943", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/59018943", "code_system": "PUBCHEM", "references": [ "d1acd334-95ae-8b37-2dc8-60c8dfee9c44" ] }, { "uuid": "f27690d5-92b1-4f04-9389-b82ad858ca45", "code": "K8R4083BCL", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "037c05cc-383c-43e5-ab54-9cf6cf86043b", "name": "3,3,10,10,11,12,12-HEPTAMETHYL-4-OXATRICYCLO(7.3.0.01,5)DODECANE", "stdName": "3,3,10,10,11,12,12-HEPTAMETHYL-4-OXATRICYCLO(7.3.0.01,5)DODECANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f031b4ec-f1ec-481c-a0df-cf8b3b23aa44", "443da621-da2b-43b6-9bfc-def6b43b5a8f" ], "display_name": false }, { "uuid": "3ca98afe-0baf-4a26-88c9-d4836aeb2d02", "name": "DECAHYDRO-2,2,7,7,8,9,9-HEPTAMETHYLINDENO(4,3A-B)FURAN", "stdName": "DECAHYDRO-2,2,7,7,8,9,9-HEPTAMETHYLINDENO(4,3A-B)FURAN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f031b4ec-f1ec-481c-a0df-cf8b3b23aa44", "443da621-da2b-43b6-9bfc-def6b43b5a8f" ], "display_name": true } ], "references": [ { "uuid": "f031b4ec-f1ec-481c-a0df-cf8b3b23aa44", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "443da621-da2b-43b6-9bfc-def6b43b5a8f", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "55c2095e-7c91-4c45-ac11-5803e528e7af", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391932000, "tags": [ "NOMEN" ] }, { "uuid": "506e80d4-7010-412c-a599-ad329a8b7d9d", "citation": "SRS import [K8R4083BCL]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K8R4083BCL", "doc_type": "SRS", "public_domain": true, "document_date": 1493391932000, "tags": [ "NOMEN" ] }, { "uuid": "b1f298d6-c3b5-c768-d616-8bc667533603", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=647828-16-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d1acd334-95ae-8b37-2dc8-60c8dfee9c44", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "2449a8c6-dd11-4df5-bbb8-c7b144f071a8", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f2f1b688-8eaf-41b2-b914-eefef9eb1080", "id": "f2f1b688-8eaf-41b2-b914-eefef9eb1080", "molfile": "\n Marvin 01132112362D \n\n 19 21 0 0 0 0 999 V2000\n 7.3623 -5.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1873 -5.5054 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.6722 -6.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9577 -6.5853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0078 -6.9265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4568 -5.9179 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 10.1713 -6.3304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8857 -5.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8857 -5.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1713 -4.6804 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 9.9998 -3.8734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1793 -3.7871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3508 -2.9802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3947 -3.5323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8437 -4.5408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4568 -5.0929 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.6722 -4.8380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7870 -4.0210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8876 -4.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 17 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 6 3 1 0 0 0 0\n 6 7 1 0 0 0 0\n 16 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 16 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 15 12 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 19 1 0 0 0 0\nM END", "smiles": "CC1C(C)(C)C2CCCC3C2(CC(C)(C)O3)C1(C)C", "formula": "C18H32O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a4a2775b-1447-4586-bdfb-78c7e4251c18" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "264.4468", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "5e437f38-0e4d-411d-9e00-8f19d348de35", "version": "6", "structure": { "id": "f0f001d4-cd4c-4152-8978-be3d3d6cfedf", "molfile": "\n Marvin 01132112302D \n\n 19 21 0 0 0 0 999 V2000\n 8.7870 -4.0210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6722 -4.8380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1873 -5.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3623 -5.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6722 -6.1728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9577 -6.5853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0078 -6.9265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4568 -5.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1713 -6.3304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8857 -5.9179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8857 -5.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1713 -4.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9998 -3.8734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1793 -3.7871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3508 -2.9802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3947 -3.5323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8437 -4.5408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4568 -5.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8876 -4.5830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 8 5 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 17 14 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 12 1 0 0 0 0\n 18 8 1 0 0 0 0\n 2 18 1 0 0 0 0\n 2 19 1 0 0 0 0\nM END", "smiles": "CC1C(C)(C)C2CCCC3C2(CC(C)(C)O3)C1(C)C", "formula": "C18H32O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "264.4468", "optical_activity": "UNSPECIFIED", "references": [ "506e80d4-7010-412c-a599-ad329a8b7d9d", "f031b4ec-f1ec-481c-a0df-cf8b3b23aa44" ], "stereo_centers": 4 }, "unii": "K8R4083BCL" } ] }