{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8a794045-f40a-447d-89f8-fb03c4919df5",
          "code": "83891-03-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=83891-03-6",
          "code_system": "CAS",
          "references": [
            "30f99ea9-4fa5-4bdf-bf70-1976301e793f",
            "10d62179-3045-405d-8669-260b9e211181"
          ]
        },
        {
          "uuid": "37994672-cf23-4663-bce2-5cce955e10ff",
          "code": "C036139",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67036139",
          "code_system": "MESH",
          "references": [
            "30f99ea9-4fa5-4bdf-bf70-1976301e793f"
          ]
        },
        {
          "uuid": "a0862c0e-5ff2-4f36-ad26-4e34d52e882f",
          "code": "SUB32375",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "30f99ea9-4fa5-4bdf-bf70-1976301e793f"
          ]
        },
        {
          "uuid": "feec523e-3334-4abc-b2f7-38e41e94f688",
          "code": "4541",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4541",
          "code_system": "PUBCHEM",
          "references": [
            "30f99ea9-4fa5-4bdf-bf70-1976301e793f"
          ]
        },
        {
          "uuid": "7ba86954-f9a7-4556-9961-afd678e821ce",
          "code": "K8D70XE2F4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7bd8d47d-1a65-8aa5-5902-24add5bf42a4",
          "code": "Norfluoxetine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Norfluoxetine",
          "code_system": "WIKIPEDIA",
          "references": [
            "9ad84d0f-eddd-1c18-e186-353b746f28ce"
          ]
        },
        {
          "uuid": "d10daf87-0278-df93-2bda-a12ae1621a31",
          "code": "100000124308",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "56a28a2c-fb78-56cf-3b10-d7835e7c2097"
          ]
        },
        {
          "uuid": "b77f81c8-8340-41f7-0df5-1ac8a896beb5",
          "code": "DTXSID80866540",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80866540",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "04708227-b6b6-43d9-8212-003fcd831598",
          "amount": {
            "uuid": "f2cd9890-6ac0-47eb-ac13-e8eb183f2d70"
          },
          "type": "PARENT->METABOLITE ACTIVE",
          "references": [
            "6aa8c8d3-9953-4f28-9869-43721ee6a8d6"
          ],
          "related_substance": {
            "uuid": "8018c363-c575-4806-8319-ebbe38fe4f54",
            "refuuid": "288a962b-7ef1-4a4e-9cfe-0eb1bb3ce661",
            "name": "FLUOXETINE",
            "unii": "01K63SUP8D",
            "linking_id": "01K63SUP8D",
            "ref_pname": "FLUOXETINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e0476f20-9a85-4c1c-8e4f-af5e02145af8",
          "name": "(±)-DESMETHYLFLUOXETINE",
          "stdName": "(+/-)-DESMETHYLFLUOXETINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c65983ea-d324-4b10-bec3-650057f551d3",
            "0db51fe2-b025-490c-b083-8874dc199f92"
          ],
          "display_name": false
        },
        {
          "uuid": "5ecb9e87-66a7-43fc-9fdb-81e5f41801a5",
          "name": "BENZENEPROPANAMINE, .GAMMA.-(4-(TRIFLUOROMETHYL)PHENOXY)-, (±)-",
          "stdName": "BENZENEPROPANAMINE, .GAMMA.-(4-(TRIFLUOROMETHYL)PHENOXY)-, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0db51fe2-b025-490c-b083-8874dc199f92",
            "37b8fa17-4eb9-4400-9e21-fbbdd3bdf7e6"
          ],
          "display_name": false
        },
        {
          "uuid": "a32038c9-bde4-45bb-a2ab-292ddf0b32f8",
          "name": "DESMETHYLFLUOXETINE",
          "stdName": "DESMETHYLFLUOXETINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0db51fe2-b025-490c-b083-8874dc199f92",
            "37b8fa17-4eb9-4400-9e21-fbbdd3bdf7e6"
          ],
          "display_name": false
        },
        {
          "uuid": "a6f958a3-a312-4d31-8377-b7a85c9dabfa",
          "name": "NORFLUOXETINE",
          "stdName": "NORFLUOXETINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0db51fe2-b025-490c-b083-8874dc199f92",
            "37b8fa17-4eb9-4400-9e21-fbbdd3bdf7e6"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "37b8fa17-4eb9-4400-9e21-fbbdd3bdf7e6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0db51fe2-b025-490c-b083-8874dc199f92",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c65983ea-d324-4b10-bec3-650057f551d3",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30f99ea9-4fa5-4bdf-bf70-1976301e793f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391769000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d625d0d-bd79-4982-8757-548dd9875aa7",
          "citation": "SRS import [K8D70XE2F4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K8D70XE2F4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391769000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ad84d0f-eddd-1c18-e186-353b746f28ce",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Norfluoxetine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5e7fbddc-f305-4a65-9988-d8cb7317a442",
          "citation": "Clin Chem 1982;28(10):2100",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "10d62179-3045-405d-8669-260b9e211181",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "56a28a2c-fb78-56cf-3b10-d7835e7c2097",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "6aa8c8d3-9953-4f28-9869-43721ee6a8d6",
          "citation": "Clin Chem 1982;28(10):2100",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d043d6fb-3e14-4954-be90-acd166b148de",
          "id": "d043d6fb-3e14-4954-be90-acd166b148de",
          "molfile": "\n  Marvin  01132110462D          \n\n 21 22  0  0  0  0            999 V2000\n    9.8965   -4.8766    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1841   -5.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4623   -4.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4623   -4.0630    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.7454   -3.6585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0291   -4.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0291   -4.9016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3156   -5.3209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5959   -4.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5959   -4.0813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3136   -3.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8820   -5.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1657   -4.9025    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8820   -6.1479    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1601   -5.7269    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1749   -3.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8882   -4.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6000   -3.6365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6000   -2.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8725   -2.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1749   -2.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 16  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 11  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 12  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 21 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(CCN)Oc2ccc(cc2)C(F)(F)F",
          "formula": "C16H16F3NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5a9aa14b-5018-4493-ade1-64e4fb77e823"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "295.3001",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2947e7b6-36fb-4683-8c6f-d397ef54bfc4",
      "version": "7",
      "structure": {
        "id": "53329356-11bf-4e2a-942c-4b8447656b4f",
        "molfile": "\n  Marvin  01132104202D          \n\n 21 22  0  0  0  0            999 V2000\n    5.5959   -4.0813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5959   -4.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3156   -5.3209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0291   -4.9016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0291   -4.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3136   -3.6674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7454   -3.6585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4623   -4.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1749   -3.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8882   -4.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6000   -3.6365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6000   -2.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8725   -2.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1749   -2.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4623   -4.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1841   -5.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8965   -4.8766    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8820   -5.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1657   -4.9025    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8820   -6.1479    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1601   -5.7269    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14  9  1  0  0  0  0\n  8 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n  2 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C(CCN)Oc2ccc(cc2)C(F)(F)F",
        "formula": "C16H16F3NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "295.3001",
        "optical_activity": "( + / - )",
        "references": [
          "3d625d0d-bd79-4982-8757-548dd9875aa7",
          "37b8fa17-4eb9-4400-9e21-fbbdd3bdf7e6"
        ],
        "stereo_centers": 1
      },
      "unii": "K8D70XE2F4"
    }
  ]
}