{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "61a47de8-c9d3-4e22-aa35-b06bb3c5dda6",
          "code": "2315-02-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2315-02-8",
          "code_system": "CAS",
          "references": [
            "59f32d2e-73da-4921-a708-a7ae0b8ea82d",
            "660acc8b-55e8-4003-8154-3794ef2057bf"
          ]
        },
        {
          "uuid": "c3f9572b-8719-4d57-95a4-36da33f99115",
          "code": "C29313",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29313",
          "code_system": "NCI_THESAURUS",
          "references": [
            "59f32d2e-73da-4921-a708-a7ae0b8ea82d"
          ]
        },
        {
          "uuid": "5a9ef2bb-6d01-4b01-928e-ea63948727fb",
          "code": "21 CFR 341.20",
          "comments": "PART 341 -- COLD, COUGH, ALLERGY, BRONCHODILATOR, AND ANTIASTHMATIC DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE|Subpart B--Active Ingredients|Sec. 341.20 Nasal decongestant active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=341.20",
          "code_system": "CFR",
          "references": [
            "59f32d2e-73da-4921-a708-a7ae0b8ea82d"
          ]
        },
        {
          "uuid": "73384112-289f-4a24-82f0-cc0d4f175a70",
          "code": "106101",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/106101/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "59f32d2e-73da-4921-a708-a7ae0b8ea82d"
          ]
        },
        {
          "uuid": "0ff9efb9-fbba-416d-beb7-68984222d362",
          "code": "m8335",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8335?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "59f32d2e-73da-4921-a708-a7ae0b8ea82d"
          ]
        },
        {
          "uuid": "e8d8a18c-493f-43da-abc0-8f10b3b3fd65",
          "code": "SUB03589MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "59f32d2e-73da-4921-a708-a7ae0b8ea82d"
          ]
        },
        {
          "uuid": "3a8912a7-153b-483a-b0da-412798a3e297",
          "code": "CHEMBL762",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL762",
          "code_system": "ChEMBL",
          "references": [
            "59f32d2e-73da-4921-a708-a7ae0b8ea82d"
          ]
        },
        {
          "uuid": "8e6b5b5e-e843-4060-9cbe-c586c8951627",
          "code": "219-015-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.287",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "59f32d2e-73da-4921-a708-a7ae0b8ea82d"
          ]
        },
        {
          "uuid": "97c5d222-27ca-3e64-82d4-602f7aedcd6e",
          "code": "EU/3/17/1892",
          "comments": "EU ORPHAN DRUG|Positive|Treatment of spinal cord injury",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu3171892",
          "code_system": "EU-Orphan Drug",
          "references": [
            "53206486-061a-7b48-9863-94c684721ed5"
          ]
        },
        {
          "uuid": "32c4d6d4-0de4-31ab-1fff-47418f158cbd",
          "code": "DTXSID80177729",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80177729",
          "code_system": "EPA CompTox",
          "references": [
            "7314e9e8-19bb-c8db-6b29-226f91dde282"
          ]
        },
        {
          "uuid": "52058c4a-0dec-5869-9fe5-200535041f60",
          "code": "C29709",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Adrenergic Agent[C29747]|Adrenergic Agonist[C87053]|Alpha-Adrenergic Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29709",
          "code_system": "NCI_THESAURUS",
          "references": [
            "53206486-061a-7b48-9863-94c684721ed5"
          ]
        },
        {
          "uuid": "02dbee2e-07fa-fe23-8643-4668876beee8",
          "code": "66259",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66259",
          "code_system": "PUBCHEM",
          "references": [
            "3ab13bc8-5189-34ae-d44d-e8f3d6546b1d"
          ]
        },
        {
          "uuid": "52419b50-f358-6167-f618-06a9eb8614aa",
          "code": "DBSALT000821",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT000821",
          "code_system": "DRUG BANK",
          "references": [
            "53206486-061a-7b48-9863-94c684721ed5"
          ]
        },
        {
          "uuid": "61034dd5-9484-401f-b73a-774673d4e34f",
          "code": "K89MJ0S5VY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "28550886-1e79-166e-478a-ed705846ebd8",
          "code": "7863",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:7863",
          "code_system": "CHEBI",
          "references": [
            "53206486-061a-7b48-9863-94c684721ed5"
          ]
        },
        {
          "uuid": "e6a2b52a-c7dc-f018-7371-ccc1e8042177",
          "code": "1486004",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1486004",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "53206486-061a-7b48-9863-94c684721ed5"
          ]
        },
        {
          "uuid": "3ab3afd4-4d40-9430-d602-126ffed6c8f0",
          "code": "K89MJ0S5VY",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=K89MJ0S5VY",
          "code_system": "DAILYMED",
          "references": [
            "9111bcf1-0729-cbb9-13d3-0b0570723f09"
          ]
        },
        {
          "uuid": "a6ade8c5-5359-0787-f30c-692644749d8f",
          "code": "100000090269",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "25609e52-1f8d-5739-f50c-878f50515722"
          ]
        },
        {
          "uuid": "4fffeb82-9d93-2aec-401e-c85f85174061",
          "code": "757254",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=757254",
          "code_system": "NSC",
          "references": [
            "0d60219b-f752-cd5c-7b6b-70bf2e64d0b4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0333392c-d7c4-4b96-b3ec-ebbaf7d897cc",
          "amount": {
            "uuid": "e8f493a5-fe44-4761-8e43-c4858db15a73"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9880c582-e36b-4b90-b152-222e712aea93",
            "refuuid": "2568e713-8613-48ab-b306-0df18b68a6c0",
            "name": "OXYMETAZOLINE",
            "unii": "8VLN5B44ZY",
            "linking_id": "8VLN5B44ZY",
            "ref_pname": "OXYMETAZOLINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7891c934-9041-4db9-a329-5771899fa2cb",
          "amount": {
            "uuid": "bba0da72-74a2-45ef-bf19-0d2de98875b1"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "6b797ccb-cbeb-4033-b74c-a1c9540cbf20",
            "refuuid": "2568e713-8613-48ab-b306-0df18b68a6c0",
            "name": "OXYMETAZOLINE",
            "unii": "8VLN5B44ZY",
            "linking_id": "8VLN5B44ZY",
            "ref_pname": "OXYMETAZOLINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "47fa0b11-e65a-4cd8-ab4b-84bb8ff79e20",
          "amount": {
            "uuid": "5b3667b8-614f-402c-aa67-26d0c858aef7"
          },
          "type": "IMPURITY->PARENT",
          "related_substance": {
            "uuid": "1d77b8d8-85e9-469e-beac-671887b4d5b0",
            "refuuid": "9b8facdb-43f8-4af7-ae5d-7f2d000456aa",
            "name": "N-(2-AMINOETHYL)-2-(4-(TERT-BUTYL)-3-HYDROXY-2,6-DIMETHYLPHENYL)ACETAMIDE",
            "unii": "ASO8C395KB",
            "linking_id": "ASO8C395KB",
            "ref_pname": "N-(2-AMINOETHYL)-2-(4-(TERT-BUTYL)-3-HYDROXY-2,6-DIMETHYLPHENYL)ACETAMIDE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b72b4768-03a8-4167-a46d-9061fb2ecece",
          "name": "6-tert-Butyl-3-(2-imidazolin-2-ylmethyl)-2,4-dimethylphenol monohydrochloride",
          "stdName": "6-TERT-BUTYL-3-(2-IMIDAZOLIN-2-YLMETHYL)-2,4-DIMETHYLPHENOL MONOHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf747e53-535c-4852-88dc-591729f9b534",
            "0ea6877c-749c-49aa-a9d1-cf8111cf15b9"
          ],
          "display_name": false
        },
        {
          "uuid": "4feae8f3-fe13-3aae-6ee6-3a6090a4e893",
          "name": "AGN-199201",
          "stdName": "AGN-199201",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8741177-9c27-cd98-4f9f-bf3c6819bfca"
          ],
          "display_name": false
        },
        {
          "uuid": "102b68bb-cc56-40f8-8edd-b236adbf7413",
          "name": "KOVANAZE COMPONENT OXYMETAZOLINE HYDROCHLORIDE",
          "stdName": "KOVANAZE COMPONENT OXYMETAZOLINE HYDROCHLORIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ea6877c-749c-49aa-a9d1-cf8111cf15b9",
            "a44fdf38-d134-4639-981d-ca8f2f734780"
          ],
          "display_name": false
        },
        {
          "uuid": "446196de-eedb-c904-3470-ba78eddabd32",
          "name": "NSC-757254",
          "stdName": "NSC-757254",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d60219b-f752-cd5c-7b6b-70bf2e64d0b4"
          ],
          "display_name": false
        },
        {
          "uuid": "c92b0b2e-71cf-4760-b648-5060a0441db4",
          "name": "OCUCLEAR",
          "stdName": "OCUCLEAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ea6877c-749c-49aa-a9d1-cf8111cf15b9",
            "8c0ebc4e-9f02-4579-be55-df80583adcbd"
          ],
          "display_name": false
        },
        {
          "uuid": "dd945165-c370-468e-afd8-d88b1d8ad9e7",
          "name": "OXYMETAZOLINE HCL",
          "stdName": "OXYMETAZOLINE HCL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0eeab1f3-5fdb-408a-a0ae-13d0bed38ac5"
          ],
          "display_name": false
        },
        {
          "uuid": "9be17b06-c1ab-468c-8088-eecd5a614c8f",
          "name": "OXYMETAZOLINE HYDROCHLORIDE",
          "stdName": "OXYMETAZOLINE HYDROCHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f6f26a5-9b98-4210-b1b3-3e617d3b8207",
            "b43e70fb-8f39-4ae3-ab97-1cac1d6deedd",
            "0845aef3-ae66-4590-b199-5ad9224eb1f4",
            "190f6842-3859-424d-b26d-1440076439ea",
            "0339f17f-c6fd-4de5-89b8-85e424eb33a5",
            "1baf738c-516b-4c02-8aa6-96f1a58ccaf5",
            "a400808f-9bee-4b82-bd8c-786446586943",
            "dbf49b5f-6b5c-4ef6-8241-b07d3653e96f",
            "80d030f9-1e6c-4e79-88ed-a72fb3420a92",
            "0ea6877c-749c-49aa-a9d1-cf8111cf15b9",
            "23f4f79c-90eb-4aaf-8011-440e6bb9443e",
            "bc322406-c631-4765-9c9d-4301b93f7993",
            "92afb963-8705-4c40-9415-e230f8954fc7",
            "d3914d82-1195-49e1-a383-3f07f41aba7a",
            "3770604b-8e23-40d6-a0d2-002381025a87",
            "5833616f-fc39-4939-8fb7-c6052f2eba24",
            "6175d99b-03a4-45e1-b7e6-b123af4853e6",
            "29fa2c8a-b821-428f-8929-290010d8b012",
            "9dedbd17-82a0-4307-b633-13a1ab4915da",
            "44e0b44e-79c0-4c93-ae74-366d0354abeb",
            "90914c83-f31e-4705-abd8-38b452255810",
            "213f0248-fd63-4f81-a74b-2e5ff4d60e67"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "5ea389e9-35b4-40e5-b84f-aa4919cde56e",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "5a945e27-bc73-259b-bc07-ebf7c61775e4",
          "name": "OXYMETAZOLINE HYDROCHLORIDE [EP MONOGRAPH]",
          "stdName": "OXYMETAZOLINE HYDROCHLORIDE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39d0824f-46d3-82eb-7fef-a13ff0810139"
          ],
          "display_name": false
        },
        {
          "uuid": "7c94875b-dc6d-4184-82fc-330c3d740f8a",
          "name": "OXYMETAZOLINE HYDROCHLORIDE [JAN]",
          "stdName": "OXYMETAZOLINE HYDROCHLORIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6175d99b-03a4-45e1-b7e6-b123af4853e6",
            "0ea6877c-749c-49aa-a9d1-cf8111cf15b9"
          ],
          "display_name": false
        },
        {
          "uuid": "0a6299ef-f860-4749-8e29-fccadb997608",
          "name": "OXYMETAZOLINE HYDROCHLORIDE [MART.]",
          "stdName": "OXYMETAZOLINE HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f6f26a5-9b98-4210-b1b3-3e617d3b8207"
          ],
          "display_name": false
        },
        {
          "uuid": "b65ef449-1973-4a1a-b8ab-0a3150b0ce44",
          "name": "OXYMETAZOLINE HYDROCHLORIDE [MI]",
          "stdName": "OXYMETAZOLINE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ea6877c-749c-49aa-a9d1-cf8111cf15b9",
            "b43e70fb-8f39-4ae3-ab97-1cac1d6deedd"
          ],
          "display_name": false
        },
        {
          "uuid": "fb937d84-1653-4448-abf9-2af8c5c2529f",
          "name": "OXYMETAZOLINE HYDROCHLORIDE [ORANGE BOOK]",
          "stdName": "OXYMETAZOLINE HYDROCHLORIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1baf738c-516b-4c02-8aa6-96f1a58ccaf5"
          ],
          "display_name": false
        },
        {
          "uuid": "99128b19-3907-41ae-83fa-80a8d5fc6f5f",
          "name": "OXYMETAZOLINE HYDROCHLORIDE [USAN]",
          "stdName": "OXYMETAZOLINE HYDROCHLORIDE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a400808f-9bee-4b82-bd8c-786446586943"
          ],
          "display_name": false
        },
        {
          "uuid": "757a6e11-1bbc-2462-4c4e-9044b4403e3d",
          "name": "OXYMETAZOLINE HYDROCHLORIDE [USP IMPURITY]",
          "stdName": "OXYMETAZOLINE HYDROCHLORIDE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3770604b-8e23-40d6-a0d2-002381025a87"
          ],
          "display_name": false
        },
        {
          "uuid": "09689df6-d490-f1c7-2b23-24066b2c51bc",
          "name": "OXYMETAZOLINE HYDROCHLORIDE [USP MONOGRAPH]",
          "stdName": "OXYMETAZOLINE HYDROCHLORIDE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62b85ddc-3b2a-efe1-0138-4af209a132d7"
          ],
          "display_name": false
        },
        {
          "uuid": "ad32d559-4f25-454d-a091-c67c744770af",
          "name": "OXYMETAZOLINE HYDROCHLORIDE [VANDF]",
          "stdName": "OXYMETAZOLINE HYDROCHLORIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ea6877c-749c-49aa-a9d1-cf8111cf15b9",
            "92afb963-8705-4c40-9415-e230f8954fc7"
          ],
          "display_name": false
        },
        {
          "uuid": "89eaaa21-6239-5a5f-ce7d-280b7edd85c0",
          "name": "Oxymetazoline hydrochloride [WHO-DD]",
          "stdName": "OXYMETAZOLINE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31bf7c48-20c2-61bd-e7f0-7cfdd7c0a604"
          ],
          "display_name": false
        },
        {
          "uuid": "a4e76aa9-693d-420c-a9b7-7103e8803e0a",
          "name": "PHENOL, 3-((4,5-DIHYDRO-1H-IMIDAZOL-2-YL)METHYL)-6-(1,1-DIMETHYLETHYL)-2,4-DIMETHYL-, MONOHYDROCHLORIDE",
          "stdName": "PHENOL, 3-((4,5-DIHYDRO-1H-IMIDAZOL-2-YL)METHYL)-6-(1,1-DIMETHYLETHYL)-2,4-DIMETHYL-, MONOHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf747e53-535c-4852-88dc-591729f9b534",
            "0ea6877c-749c-49aa-a9d1-cf8111cf15b9"
          ],
          "display_name": false
        },
        {
          "uuid": "fd6a1fe0-08b6-43ab-beb8-0ff4eedadcb0",
          "name": "RHOFADE",
          "stdName": "RHOFADE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ea6877c-749c-49aa-a9d1-cf8111cf15b9",
            "13e5af30-4e82-4199-b5ec-c834a3476283"
          ],
          "display_name": false
        },
        {
          "uuid": "f49f2273-0e2e-44b4-b5f0-86fe958f67cb",
          "name": "SCH 9384",
          "stdName": "SCH 9384",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf747e53-535c-4852-88dc-591729f9b534",
            "0ea6877c-749c-49aa-a9d1-cf8111cf15b9"
          ],
          "display_name": false
        },
        {
          "uuid": "856d6d7c-696d-487b-be6c-99a6e08a7501",
          "name": "SCH-9384",
          "stdName": "SCH-9384",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9567b7c8-6dfc-4b04-a1f0-484eff2d2cb9",
            "0ea6877c-749c-49aa-a9d1-cf8111cf15b9"
          ],
          "display_name": false
        },
        {
          "uuid": "47dd2b7b-7cd6-c6eb-0483-1c92cc227386",
          "name": "UPNEEQ",
          "stdName": "UPNEEQ",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f867c71b-3e6c-397e-a992-e840839c2bfd"
          ],
          "display_name": false
        },
        {
          "uuid": "7d61b649-d9c5-4ce6-929f-6e08e367b2aa",
          "name": "VISINE L.R.",
          "stdName": "VISINE L.R.",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ea6877c-749c-49aa-a9d1-cf8111cf15b9",
            "8c0ebc4e-9f02-4579-be55-df80583adcbd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a44fdf38-d134-4639-981d-ca8f2f734780",
          "citation": "https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=d2af5404-3cfe-445d-8328-19e667ecdc43",
          "url": "https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=d2af5404-3cfe-445d-8328-19e667ecdc43",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13e5af30-4e82-4199-b5ec-c834a3476283",
          "citation": "https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=1ba1cc5b-4f7f-491b-a5af-a6a14fb5affd&audien",
          "url": "https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=1ba1cc5b-4f7f-491b-a5af-a6a14fb5affd&audien",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59f32d2e-73da-4921-a708-a7ae0b8ea82d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389655000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2578efc5-25cc-4e8f-9a8a-1562092efb9b",
          "citation": "SRS import [K89MJ0S5VY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K89MJ0S5VY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389655000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "213f0248-fd63-4f81-a74b-2e5ff4d60e67",
          "citation": "OXYMETAZOLINE HYDROCHLORIDE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d3914d82-1195-49e1-a383-3f07f41aba7a",
          "citation": "OXYMETAZOLINE HYDROCHLORIDE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5833616f-fc39-4939-8fb7-c6052f2eba24",
          "citation": "OXYMETAZOLINE HYDROCHLORIDE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dbf49b5f-6b5c-4ef6-8241-b07d3653e96f",
          "citation": "OXYMETAZOLINE HYDROCHLORIDE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bc322406-c631-4765-9c9d-4301b93f7993",
          "citation": "OXYMETAZOLINE HYDROCHLORIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "190f6842-3859-424d-b26d-1440076439ea",
          "citation": "OXYMETAZOLINE HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0845aef3-ae66-4590-b199-5ad9224eb1f4",
          "citation": "OXYMETAZOLINE HYDROCHLORIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "44e0b44e-79c0-4c93-ae74-366d0354abeb",
          "citation": "OXYMETAZOLINE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "80d030f9-1e6c-4e79-88ed-a72fb3420a92",
          "citation": "OXYMETAZOLINE HYDROCHLORIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "29fa2c8a-b821-428f-8929-290010d8b012",
          "citation": "OXYMETAZOLINE HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "23f4f79c-90eb-4aaf-8011-440e6bb9443e",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8c0ebc4e-9f02-4579-be55-df80583adcbd",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ea6877c-749c-49aa-a9d1-cf8111cf15b9",
          "citation": "ORANGE BOOK",
          "doc_type": "ORANGE BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf747e53-535c-4852-88dc-591729f9b534",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0eeab1f3-5fdb-408a-a0ae-13d0bed38ac5",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9567b7c8-6dfc-4b04-a1f0-484eff2d2cb9",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a400808f-9bee-4b82-bd8c-786446586943",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9dedbd17-82a0-4307-b633-13a1ab4915da",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3770604b-8e23-40d6-a0d2-002381025a87",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6175d99b-03a4-45e1-b7e6-b123af4853e6",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1baf738c-516b-4c02-8aa6-96f1a58ccaf5",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f6f26a5-9b98-4210-b1b3-3e617d3b8207",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90914c83-f31e-4705-abd8-38b452255810",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0339f17f-c6fd-4de5-89b8-85e424eb33a5",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92afb963-8705-4c40-9415-e230f8954fc7",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b43e70fb-8f39-4ae3-ab97-1cac1d6deedd",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7314e9e8-19bb-c8db-6b29-226f91dde282",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2315-02-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "53206486-061a-7b48-9863-94c684721ed5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a8741177-9c27-cd98-4f9f-bf3c6819bfca",
          "citation": "https://adisinsight.springer.com/drugs/800032402",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "660acc8b-55e8-4003-8154-3794ef2057bf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3ab13bc8-5189-34ae-d44d-e8f3d6546b1d",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "f867c71b-3e6c-397e-a992-e840839c2bfd",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2020/0212520s000lbl.pdf",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "62b85ddc-3b2a-efe1-0138-4af209a132d7",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "0d60219b-f752-cd5c-7b6b-70bf2e64d0b4",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "39d0824f-46d3-82eb-7fef-a13ff0810139",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "9111bcf1-0729-cbb9-13d3-0b0570723f09",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "31bf7c48-20c2-61bd-e7f0-7cfdd7c0a604",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "25609e52-1f8d-5739-f50c-878f50515722",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9c5ea0e1-d089-499e-8ea3-ee6e2f1b5843",
          "id": "9c5ea0e1-d089-499e-8ea3-ee6e2f1b5843",
          "molfile": "\n  Marvin  01132108072D          \n\n  1  0  0  0  0  0            999 V2000\n   12.3792  -16.3542    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ad80bb95-c42a-4864-aaf2-a8f39faa852b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "a55f1e01-7c76-4272-a5c6-729330251007",
          "id": "a55f1e01-7c76-4272-a5c6-729330251007",
          "molfile": "\n  Marvin  01132108362D          \n\n 19 20  0  0  0  0            999 V2000\n    9.6875  -17.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9750  -16.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2542  -17.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5417  -16.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5417  -15.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8292  -15.5292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2542  -15.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2542  -14.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9750  -15.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6875  -15.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3958  -15.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1875  -15.6875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6667  -16.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1792  -17.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3917  -16.7667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8292  -17.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1125  -17.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1125  -16.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8250  -18.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  9  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n 16  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  3  0  0  0\n 15 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 16  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(c(c(C)c1CC2=NCCN2)O)C(C)(C)C",
          "formula": "C16H24N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d8344087-073b-48d6-8356-bdc66b4778ea"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "260.3752",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b4e83765-188f-4e73-8598-720efdf6054a",
      "version": "29",
      "structure": {
        "id": "1012ff77-4e03-45e5-936c-ce87dda6326e",
        "molfile": "\n  Marvin  01132101042D          \n\n 20 20  0  0  0  0            999 V2000\n    7.5417  -16.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5417  -15.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9750  -15.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2542  -15.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2542  -17.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9750  -16.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3958  -15.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3917  -16.7667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8292  -17.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6875  -15.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1875  -15.6875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8292  -15.5292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2542  -14.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1792  -17.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6875  -17.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6667  -16.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1125  -17.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1125  -16.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8250  -18.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3792  -16.3542    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  6  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7 10  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  1  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  4  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15  6  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17  9  1  0  0  0  0\n 18  9  1  0  0  0  0\n 19  9  1  0  0  0  0\n  3  4  2  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc(c(c(C)c1CC2=NCCN2)O)C(C)(C)C.Cl",
        "formula": "C16H24N2O.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "296.836",
        "optical_activity": "NONE",
        "references": [
          "23f4f79c-90eb-4aaf-8011-440e6bb9443e",
          "2578efc5-25cc-4e8f-9a8a-1562092efb9b"
        ],
        "stereo_centers": 0
      },
      "unii": "K89MJ0S5VY"
    }
  ]
}