{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "175b4fb3-dcb0-4662-9c56-c972d5a43c1d",
          "code": "C01EB10",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|CARDIAC THERAPY|OTHER CARDIAC PREPARATIONS|Other cardiac preparations|adenosine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C01EB10&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "daa991c3-9842-43ab-b017-caaa7f672c43",
          "code": "N0000178375",
          "comments": "Established Pharmacologic Class [EPC]|Adenosine Receptor Agonist [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000178375",
          "code_system": "NDF-RT",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "ddb0a9d0-c8d9-48f8-bcbc-3439a878276c",
          "code": "N0000175788",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|G-Protein-linked Receptor Interactions [MoA]|Adenosine Receptor Interactions [MoA]|Adenosine Receptor Agonists [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175788",
          "code_system": "NDF-RT",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "b0301831-8d19-42f5-895e-6a781d889a48",
          "code": "QC01EB10",
          "comments": "VATC|CARDIAC THERAPY|OTHER CARDIAC PREPARATIONS|Other cardiac preparations|adenosine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC01EB10&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "e1dba513-325d-4934-ad26-aded824d030c",
          "code": "58-61-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58-61-7",
          "code_system": "CAS",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d",
            "7cd82d0c-195b-4943-8eef-94750f3c9250"
          ]
        },
        {
          "uuid": "3225b9e7-a90b-4ddd-b236-2d2c19099751",
          "code": "D000241",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68000241",
          "code_system": "MESH",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "5679f42f-24e2-40b4-8943-f0cd867d3482",
          "code": "ADENOSINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Adenosine",
          "code_system": "WIKIPEDIA",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "ceb9ec38-1bf1-4169-8850-a65910f2bd13",
          "code": "200-389-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.354",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "70546170-7200-4a65-82b5-4372f60522ec",
          "code": "2844",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=2844",
          "code_system": "IUPHAR",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "d19fa1aa-9f23-445f-a171-c31220e4e343",
          "code": "C207",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C207",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "13a46fed-c593-42e2-bd15-4cb97d7af5f4",
          "code": "296",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/296/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "9a7010b8-f83e-4fba-bdf5-9a00b659d7ac",
          "code": "m1411",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1411?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "156454d2-c490-4eee-a6bc-594a792e242f",
          "code": "DB00640",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00640",
          "code_system": "DRUG BANK",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "49fb24b2-7c85-442c-a5a0-72af6b771bed",
          "code": "SUB00297MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "b787bf45-b18f-4c08-9c9b-466928421bd9",
          "code": "CHEMBL477",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL477",
          "code_system": "ChEMBL",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "b24003dc-0d3d-4f4e-b404-f5bc623bbf5a",
          "code": "60961",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/60961",
          "code_system": "PUBCHEM",
          "references": [
            "5364905c-4f31-403b-8150-5aa283d4755d"
          ]
        },
        {
          "uuid": "9de07720-1eb1-0009-4e58-de46f1d1f217",
          "code": "7774",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7774",
          "code_system": "HSDB",
          "references": [
            "477f39ee-341f-c2f1-b836-164f480cbafa"
          ]
        },
        {
          "uuid": "0781c28d-0ea6-c9c8-9f14-736160dd88e0",
          "code": "DTXSID1022558",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1022558",
          "code_system": "EPA CompTox",
          "references": [
            "e23ec668-59b8-04c4-4d92-d1457cf3b33f"
          ]
        },
        {
          "uuid": "2e510ecb-cb7b-e489-ee0a-35cb01707786",
          "code": "32388",
          "comments": "ORPHAN DRUG|Designated/Withdrawn|For use in conjunction with BCNU in the treatment of brain tumors.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=32388",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "535b20a6-3e62-9a6b-8093-9efee6a1e292",
          "code": "C707",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Nucleic Acids, Nucleosides, and Nucleotides[C708]|Nucleoside",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C707",
          "code_system": "NCI_THESAURUS",
          "references": [
            "014a9297-f218-9650-8f1d-2d5a3382c80c"
          ]
        },
        {
          "uuid": "16171909-dee2-c4fb-2aa4-1f40dc4c02e8",
          "code": "75136-2",
          "comments": "LOINC|ACTIVE|CHEM|CSF|Adenosine [Moles/volume] in Cerebral spinal fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/75136-2/",
          "code_system": "LOINC",
          "references": [
            "014a9297-f218-9650-8f1d-2d5a3382c80c"
          ]
        },
        {
          "uuid": "8a53076d-ef28-0e37-79bf-522560dc1106",
          "code": "75142-0",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Adenosine [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/75142-0/",
          "code_system": "LOINC",
          "references": [
            "014a9297-f218-9650-8f1d-2d5a3382c80c"
          ]
        },
        {
          "uuid": "f6d41882-bb7d-d861-ddf8-557a3777f92a",
          "code": "75160-2",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Adenosine/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/75160-2/",
          "code_system": "LOINC",
          "references": [
            "014a9297-f218-9650-8f1d-2d5a3382c80c"
          ]
        },
        {
          "uuid": "c5358bc7-5b58-cbeb-f677-5b13cf3905a1",
          "code": "90",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/90",
          "code_system": "DRUG CENTRAL",
          "references": [
            "014a9297-f218-9650-8f1d-2d5a3382c80c"
          ]
        },
        {
          "uuid": "078c44b8-9606-73f2-6911-596a47650705",
          "code": "496 (Number of products:57)",
          "comments": "Dietary Supplement Label Database|Chemical|Adenosine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=496&item=Adenosine",
          "code_system": "DSLD",
          "references": [
            "014a9297-f218-9650-8f1d-2d5a3382c80c"
          ]
        },
        {
          "uuid": "8c23a052-d50f-4b11-b576-d6b2d976d7ef",
          "code": "K72T3FS567",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cf7da5b1-a534-237d-55d6-2c5c1bbf763c",
          "code": "1012123",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1012123",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "014a9297-f218-9650-8f1d-2d5a3382c80c"
          ]
        },
        {
          "uuid": "17f1b7c0-d956-b59c-cdc2-814453825f96",
          "code": "16335",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16335",
          "code_system": "CHEBI",
          "references": [
            "014a9297-f218-9650-8f1d-2d5a3382c80c"
          ]
        },
        {
          "uuid": "7ef5840c-600d-6e61-b3d2-71bd1b5bb205",
          "code": "100000078834",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "679b81d6-98f6-07a8-228d-f8f8cd4a4f2b"
          ]
        },
        {
          "uuid": "dadc9148-3743-035a-1a6b-ef9d0cdb0328",
          "code": "7652",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7652",
          "code_system": "NSC",
          "references": [
            "d7077803-7446-af16-dccc-35733fe7409b"
          ]
        },
        {
          "uuid": "673445b4-6fba-0d53-b243-8aa4054c47a9",
          "code": "K72T3FS567",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=K72T3FS567",
          "code_system": "DAILYMED",
          "references": [
            "86bfcabc-efad-2623-bb65-b1548f49832d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "60481005-139b-49ad-b667-ad0b29221f56",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8e2af1f6-3013-459c-bb4b-3a243ace459f",
            "refuuid": "dc70f2f3-5a14-4f5f-bf00-2fb0ad0100e2",
            "name": "ADENOSINE",
            "unii": "K72T3FS567",
            "linking_id": "K72T3FS567",
            "ref_pname": "ADENOSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d08d85fa-ec81-4445-80e5-c9e7e3ab34fb",
          "comments": "Adenosine is broken down by adenosine deaminase, which is present in red cells and the vessel wall.",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "0fcf5811-bc87-4b72-99c5-ca23a3a71aec"
          ],
          "related_substance": {
            "uuid": "44e22c56-36a8-4fc2-bc40-8984de48a7ec",
            "refuuid": "ced849b0-9a9d-4718-be57-c9a932f622c6",
            "name": "INOSINE",
            "unii": "5A614L51CT",
            "linking_id": "5A614L51CT",
            "ref_pname": "INOSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "13bf61fa-dff5-4b03-931f-1d8cc3f23069",
          "amount": {
            "uuid": "d1f883a0-ecab-4298-b64e-422f890f7b99",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 101,
            "low_limit": 99
          },
          "qualification": "EP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "15cb7267-3eb3-46ff-bd0d-2e7c85cea623"
          ],
          "related_substance": {
            "uuid": "f64f584c-b604-4b5c-bc2f-6ad052f3e04c",
            "refuuid": "dc70f2f3-5a14-4f5f-bf00-2fb0ad0100e2",
            "name": "ADENOSINE",
            "unii": "K72T3FS567",
            "linking_id": "K72T3FS567",
            "ref_pname": "ADENOSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "993ab282-1311-4311-bb47-538517ed3f14",
          "amount": {
            "uuid": "5edecbc1-d9a0-4fb8-92ee-23665551a66c",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 101,
            "low_limit": 99
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "bf8eba74-3ab6-4a73-a7e9-ace60a4b9d9e"
          ],
          "related_substance": {
            "uuid": "313d8521-bb3a-4247-867a-e593bdfe8bee",
            "refuuid": "dc70f2f3-5a14-4f5f-bf00-2fb0ad0100e2",
            "name": "ADENOSINE",
            "unii": "K72T3FS567",
            "linking_id": "K72T3FS567",
            "ref_pname": "ADENOSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a4592778-2556-44fb-a8c6-4707fc4286ed",
          "amount": {
            "uuid": "d5922294-104c-4811-8ffe-c4b1c3d181d2",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "15cb7267-3eb3-46ff-bd0d-2e7c85cea623"
          ],
          "related_substance": {
            "uuid": "7905954c-860d-4aed-9ae7-37d1dc95c3b3",
            "refuuid": "64b178eb-1662-44fd-8a46-184a0e2bb701",
            "name": "ADENINE",
            "unii": "JAC85A2161",
            "linking_id": "JAC85A2161",
            "ref_pname": "ADENINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "35b263c5-b968-4f99-92f9-9df26e3999ca",
          "amount": {
            "uuid": "bc75d7c3-178b-491f-99e4-9703b543ceb5",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "comments": "correction factors: for the calculation of content, multiply the peak areas of the following impurities by the corresponding correction factor: impurity A = 0.6; impurity G = 1.4",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "2aa54bb9-48f2-49b4-9a0e-9bdd9d550df7"
          ],
          "related_substance": {
            "uuid": "6250c84d-01b4-4097-84f5-37958f8162b4",
            "refuuid": "64b178eb-1662-44fd-8a46-184a0e2bb701",
            "name": "ADENINE",
            "unii": "JAC85A2161",
            "linking_id": "JAC85A2161",
            "ref_pname": "ADENINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "50a33df3-a5b4-4b86-aa2f-bcedd5fe833a",
          "amount": {
            "uuid": "e7b67de2-9fd4-4d6e-8340-0646e8f2b188",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "comments": "correction factors: for the calculation of content, multiply the peak areas of the following impurities by the corresponding correction factor: impurity A = 0.6; impurity G = 1.4",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "ba77e334-0c02-4b36-aa64-cad989b35bf9"
          ],
          "related_substance": {
            "uuid": "450ca328-7b62-49e5-9361-bf39c3a7a41f",
            "refuuid": "ced849b0-9a9d-4718-be57-c9a932f622c6",
            "name": "INOSINE",
            "unii": "5A614L51CT",
            "linking_id": "5A614L51CT",
            "ref_pname": "INOSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "30594fcf-5973-4bbe-8dc4-cc819594dc44",
          "amount": {
            "uuid": "e1366729-1fa0-4a8c-b5b4-421b08fddcf2",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "984787b4-8822-4dc2-8517-51af604a8ac9"
          ],
          "related_substance": {
            "uuid": "91e308aa-9094-4c54-b836-c8b9bd5a7ff8",
            "refuuid": "bfddc2a1-cfd7-4295-90f9-1e84425417a4",
            "name": "URIDINE",
            "unii": "WHI7HQ7H85",
            "linking_id": "WHI7HQ7H85",
            "ref_pname": "URIDINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "909d86a5-2bc7-435d-888d-9240553674c1",
          "amount": {
            "uuid": "46ae64c0-6a38-4873-99d5-b2a31ad5134b",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "6647d61d-90f2-45c1-ad10-fea934b6da70"
          ],
          "related_substance": {
            "uuid": "791fd668-4bbf-44af-9fc5-3c76716c20ef",
            "refuuid": "d7deb216-be02-42ae-934c-55bccdf95e50",
            "name": "GUANOSINE",
            "unii": "12133JR80S",
            "linking_id": "12133JR80S",
            "ref_pname": "GUANOSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "eac34daf-052b-4a3e-8ff0-5f7cbf07823f",
          "amount": {
            "uuid": "5563fb8e-0e9e-4a9d-9cf0-fbff7dd0c0a1",
            "average": 70,
            "units": "NANOMOLAR"
          },
          "qualification": "Ki",
          "type": "TARGET->AGONIST",
          "related_substance": {
            "uuid": "cf19fb19-73fa-4d57-8d0a-0fa383991107",
            "refuuid": "ee9c39bd-5774-43c4-8eaa-23b333741b5e",
            "name": "ADENOSINE RECEPTOR A1",
            "unii": "9J6QGP7WEA",
            "linking_id": "9J6QGP7WEA",
            "ref_pname": "ADENOSINE RECEPTOR A1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f9d63f9e-7aeb-4f84-8e40-bbd69a13deda",
          "amount": {
            "uuid": "7d6e0c10-f1fd-4ad8-8235-41fdead110c4"
          },
          "comments": "Reduces the production of adenosine",
          "type": "INHIBITOR OF EXPRESSION->TARGET",
          "related_substance": {
            "uuid": "cf8c7de6-3397-4542-b20e-2cb28195396e",
            "refuuid": "cc543792-44ef-4685-998d-14ab71eb6c55",
            "name": "Perenostobart",
            "unii": "O84ZK2F68E",
            "linking_id": "O84ZK2F68E",
            "ref_pname": "Perenostobart",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b0dd39a9-7bfb-4311-b112-9b327e4399f3",
          "name": "6-AMINO-9-.BETA.-D-RIBOFURANOSYL-9H-PURINE",
          "stdName": "6-AMINO-9-.BETA.-D-RIBOFURANOSYL-9H-PURINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d4033d2-c31d-4001-b1c5-5e0523e439dd"
          ],
          "display_name": false
        },
        {
          "uuid": "18c5f31e-5714-4498-986d-abf00f96a406",
          "name": "9-.BETA.-D-RIBOFURANOSYLADENINE",
          "stdName": "9-.BETA.-D-RIBOFURANOSYLADENINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d4033d2-c31d-4001-b1c5-5e0523e439dd"
          ],
          "display_name": false
        },
        {
          "uuid": "7d8fc66a-9cf3-4496-b575-7937a8109915",
          "name": "ADENOCARD",
          "stdName": "ADENOCARD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02c5cf56-5dca-47eb-83db-26cc96a8470f"
          ],
          "display_name": false
        },
        {
          "uuid": "46e437e4-55df-4b51-ad4a-fd934a4a1eb3",
          "name": "ADENOSCAN",
          "stdName": "ADENOSCAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02c5cf56-5dca-47eb-83db-26cc96a8470f"
          ],
          "display_name": false
        },
        {
          "uuid": "fe0ee4a1-6814-4228-bfb2-278b882a99e7",
          "name": "ADENOSINE",
          "stdName": "ADENOSINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09b80caf-336f-46d9-9883-2a40d1a87d59",
            "b412bf90-e10f-4661-adcc-cb8ac85b71f9",
            "899cbdf2-b666-46d9-b07e-7387bdf7dc01",
            "9b609d76-274c-4a81-acd8-790bb8728d42",
            "120e75b0-1c16-4ba7-8744-8394eedd9367",
            "87fd13bc-4266-45bf-b082-b8cf6490ecb8",
            "7b834e1a-54ad-4b18-8347-da231a6e059f",
            "d0e083fd-f9f5-4d21-97a4-749ff4b180af",
            "51cbe9b8-3203-4184-86d1-90c57e0d7d9f",
            "9a75d5cb-ac56-4b80-b503-cd721177be43",
            "59d6c2c0-7d5c-4db4-b6ce-8904a8041867",
            "19bdafa2-30f3-4e04-99c8-fdbc281d8c2f",
            "cc6961c3-36b8-41b5-a3f8-f75a60a8ee92",
            "7c6c03b2-7916-4a8e-8134-be2f14e9f425",
            "0b471732-be48-419b-963e-9a6fc714374b",
            "3794a9f5-fc6b-4f85-b605-fa8f0141bdcf",
            "90808825-d981-44e1-a36b-2bbffeb2b7a9",
            "f7594298-2b17-4a6b-9ded-a66cc1ad4fd7",
            "df00fda3-b37d-491d-8344-d4d44c7b3bbd",
            "090ab99a-78ff-487c-a7b6-5c37ee2d5823",
            "ea39b0aa-5a41-4cd6-b758-141513be1365",
            "095ad75a-0ce7-4ee6-b909-7c43f6c77886",
            "1906655d-bf4c-4674-b71a-839484c1c07e",
            "dd33ae31-40c6-48d5-b449-7004e78c7287",
            "42d843ca-ffbc-439a-b9d7-c8b93a14e792"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c1d8da18-6e83-45c8-bada-961d61f3ec07",
              "name_org": "USAN"
            },
            {
              "uuid": "6d2f47a5-359c-4d66-a685-0d20dbd3de8d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1f4c9b66-f8ee-220d-ed2d-8fc216b9edc3",
          "name": "ADENOSINE [EP IMPURITY]",
          "stdName": "ADENOSINE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b412bf90-e10f-4661-adcc-cb8ac85b71f9"
          ],
          "display_name": false
        },
        {
          "uuid": "134418df-cba8-1dcf-89b7-f867f72c6503",
          "name": "ADENOSINE [EP MONOGRAPH]",
          "stdName": "ADENOSINE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1a73541-e524-6502-5e75-5c2904680508"
          ],
          "display_name": false
        },
        {
          "uuid": "cb574f76-0a33-4b69-8895-793c78602ca6",
          "name": "ADENOSINE [HSDB]",
          "stdName": "ADENOSINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea39b0aa-5a41-4cd6-b758-141513be1365"
          ],
          "display_name": false
        },
        {
          "uuid": "75d60b1e-7dec-4737-a28c-6402cb382436",
          "name": "ADENOSINE [JAN]",
          "stdName": "ADENOSINE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b834e1a-54ad-4b18-8347-da231a6e059f"
          ],
          "display_name": false
        },
        {
          "uuid": "3986ac0a-ad9c-43fa-a364-d0b3185240b1",
          "name": "ADENOSINE [MART.]",
          "stdName": "ADENOSINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd33ae31-40c6-48d5-b449-7004e78c7287"
          ],
          "display_name": false
        },
        {
          "uuid": "56c3344e-8318-4c5a-89b0-50b9a094def6",
          "name": "ADENOSINE [MI]",
          "stdName": "ADENOSINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1906655d-bf4c-4674-b71a-839484c1c07e"
          ],
          "display_name": false
        },
        {
          "uuid": "2b3728f7-56f1-40ad-baa5-3e16e3b94133",
          "name": "ADENOSINE [ORANGE BOOK]",
          "stdName": "ADENOSINE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c6c03b2-7916-4a8e-8134-be2f14e9f425"
          ],
          "display_name": false
        },
        {
          "uuid": "ecdaa92d-ec53-487c-b93c-73258d9e1aee",
          "name": "ADENOSINE [USAN]",
          "stdName": "ADENOSINE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59d6c2c0-7d5c-4db4-b6ce-8904a8041867"
          ],
          "display_name": false
        },
        {
          "uuid": "a2bc72ad-1b7a-0e15-490d-5a53fdef902b",
          "name": "ADENOSINE [USP MONOGRAPH]",
          "stdName": "ADENOSINE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7e7dfd1-1823-9e4a-0918-6fd9791ac7b8"
          ],
          "display_name": false
        },
        {
          "uuid": "ad8f319c-c02a-4c2d-9a87-a8893acb28b1",
          "name": "ADENOSINE [USP-RS]",
          "stdName": "ADENOSINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87fd13bc-4266-45bf-b082-b8cf6490ecb8"
          ],
          "display_name": false
        },
        {
          "uuid": "28ea2bab-10a2-4f2a-b351-5e7bfd96e308",
          "name": "ADENOSINE [VANDF]",
          "stdName": "ADENOSINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "090ab99a-78ff-487c-a7b6-5c37ee2d5823"
          ],
          "display_name": false
        },
        {
          "uuid": "f9dd9a2a-bfbf-dc5b-0caf-c913df9db7f3",
          "name": "Adenosine [WHO-DD]",
          "stdName": "ADENOSINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30bfb4ca-f802-ef89-41aa-fdba6ece0dc3"
          ],
          "display_name": false
        },
        {
          "uuid": "56c7c0ce-568c-4dc1-94ae-90411cce1461",
          "name": "NSC-7652",
          "stdName": "NSC-7652",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aea35be5-a1eb-4084-927c-4dfa8ac608af"
          ],
          "display_name": false
        },
        {
          "uuid": "7311643c-66b9-4587-805f-5ba1bcbfb072",
          "name": "SR 96225",
          "stdName": "SR 96225",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d4033d2-c31d-4001-b1c5-5e0523e439dd"
          ],
          "display_name": false
        },
        {
          "uuid": "d3a0b830-2bf5-446c-a0fd-cc8f45da38a8",
          "name": "SR-96225",
          "stdName": "SR-96225",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3bd985b-e2a3-435e-803d-48ddc6253f48"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0b471732-be48-419b-963e-9a6fc714374b",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8d4033d2-c31d-4001-b1c5-5e0523e439dd",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3bd985b-e2a3-435e-803d-48ddc6253f48",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02c5cf56-5dca-47eb-83db-26cc96a8470f",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59d6c2c0-7d5c-4db4-b6ce-8904a8041867",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b412bf90-e10f-4661-adcc-cb8ac85b71f9",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42d843ca-ffbc-439a-b9d7-c8b93a14e792",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b834e1a-54ad-4b18-8347-da231a6e059f",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c6c03b2-7916-4a8e-8134-be2f14e9f425",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd33ae31-40c6-48d5-b449-7004e78c7287",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1906655d-bf4c-4674-b71a-839484c1c07e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a75d5cb-ac56-4b80-b503-cd721177be43",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea39b0aa-5a41-4cd6-b758-141513be1365",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87fd13bc-4266-45bf-b082-b8cf6490ecb8",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "120e75b0-1c16-4ba7-8744-8394eedd9367",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "090ab99a-78ff-487c-a7b6-5c37ee2d5823",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aea35be5-a1eb-4084-927c-4dfa8ac608af",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5364905c-4f31-403b-8150-5aa283d4755d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389720000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0fcf5811-bc87-4b72-99c5-ca23a3a71aec",
          "citation": "PROC. NATI. ACAD. SCI. USA, VOL.73, NO8, PP. 2867-2871, AUGUST 1976",
          "url": "http://www.pnas.org/content/73/8/2867.full.pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15cb7267-3eb3-46ff-bd0d-2e7c85cea623",
          "citation": "EP 7.5 ADENOSINE MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf8eba74-3ab6-4a73-a7e9-ace60a4b9d9e",
          "citation": "USP 35 ADENOSINE MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a114f5d5-8540-43e7-8fe2-c1655fae8ec5",
          "citation": "SRS import [K72T3FS567]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K72T3FS567",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389720000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c2dca2f-6058-4a26-ac78-12b5a4cb4ebf",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19bdafa2-30f3-4e04-99c8-fdbc281d8c2f",
          "citation": "ADENOSINE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f7594298-2b17-4a6b-9ded-a66cc1ad4fd7",
          "citation": "ADENOSINE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "095ad75a-0ce7-4ee6-b909-7c43f6c77886",
          "citation": "ADENOSINE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "df00fda3-b37d-491d-8344-d4d44c7b3bbd",
          "citation": "ADENOSINE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d0e083fd-f9f5-4d21-97a4-749ff4b180af",
          "citation": "ADENOSINE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "51cbe9b8-3203-4184-86d1-90c57e0d7d9f",
          "citation": "ADENOSINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3794a9f5-fc6b-4f85-b605-fa8f0141bdcf",
          "citation": "ADENOSINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "09b80caf-336f-46d9-9883-2a40d1a87d59",
          "citation": "ADENOSINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9b609d76-274c-4a81-acd8-790bb8728d42",
          "citation": "ADENOSINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "90808825-d981-44e1-a36b-2bbffeb2b7a9",
          "citation": "ADENOSINE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "899cbdf2-b666-46d9-b07e-7387bdf7dc01",
          "citation": "ADENOSINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cc6961c3-36b8-41b5-a3f8-f75a60a8ee92",
          "citation": "ADENOSINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "477f39ee-341f-c2f1-b836-164f480cbafa",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+58-61-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e23ec668-59b8-04c4-4d92-d1457cf3b33f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=58-61-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "014a9297-f218-9650-8f1d-2d5a3382c80c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7cd82d0c-195b-4943-8eef-94750f3c9250",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6647d61d-90f2-45c1-ad10-fea934b6da70",
          "citation": "EP 10.6",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a7e7dfd1-1823-9e4a-0918-6fd9791ac7b8",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "f1a73541-e524-6502-5e75-5c2904680508",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "30bfb4ca-f802-ef89-41aa-fdba6ece0dc3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2aa54bb9-48f2-49b4-9a0e-9bdd9d550df7",
          "citation": "EP 10.6",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "984787b4-8822-4dc2-8517-51af604a8ac9",
          "citation": "EP 10.6",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ba77e334-0c02-4b36-aa64-cad989b35bf9",
          "citation": "EP 10.6",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "86bfcabc-efad-2623-bb65-b1548f49832d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d7077803-7446-af16-dccc-35733fe7409b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "679b81d6-98f6-07a8-228d-f8f8cd4a4f2b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4da4f681-af17-424d-adc2-210629885e72",
          "id": "4da4f681-af17-424d-adc2-210629885e72",
          "molfile": "\n  Marvin  01132104032D          \n\n 19 21  0  0  1  0            999 V2000\n    3.9435   -3.0325    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.1884   -2.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4786   -2.7001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6041   -2.5524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2689   -3.0407    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.7285   -1.3460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7285   -0.4966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1253   -0.0288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5221   -0.4801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7793   -0.0492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7793    0.8248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0202   -0.4801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0202   -1.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7793   -1.7769    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5221   -1.3460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0268   -3.7958    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.6424   -4.4236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2102   -3.7958    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.7342   -4.4564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 18  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  6  0  0  0\n  5  6  1  0  0  0  0\n 16  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 15  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 15  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  6  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  6  0  0  0\nM  END",
          "smiles": "C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc32)O1)O)O)O",
          "formula": "C10H13N5O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "562fc2b5-9082-431e-8bd7-643eda2a494b"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "267.2417",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dc70f2f3-5a14-4f5f-bf00-2fb0ad0100e2",
      "version": "40",
      "structure": {
        "id": "6dccd52b-5c74-43f0-98cd-fd5c229c8d35",
        "molfile": "ADENOSINE\n  Marvin  01132105422D          \n\n 19 21  0  0  1  0            999 V2000\n   15.8605   -4.3239    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n   15.0748   -4.5757    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.8168   -5.3592    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.9918   -5.3560    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.5042   -6.0214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7400   -4.5703    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.4094   -4.0880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9564   -4.3122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3411   -4.8618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2990   -6.0286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1186   -3.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9436   -3.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3589   -2.8308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1839   -2.8341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9493   -2.1148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1243   -2.1114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7090   -2.8242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1954   -4.3293    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5260   -4.8115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  1  0  0  0  0\n  6  8  1  1  0  0  0\n  9  8  1  0  0  0  0\n  3 10  1  6  0  0  0\n 11  1  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 11  1  0  0  0  0\n 12 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19  1  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc32)O1)O)O)O",
        "formula": "C10H13N5O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "267.2417",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a114f5d5-8540-43e7-8fe2-c1655fae8ec5",
          "1c2dca2f-6058-4a26-ac78-12b5a4cb4ebf"
        ],
        "stereo_centers": 4
      },
      "unii": "K72T3FS567"
    }
  ]
}