{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ef0a077f-d347-4c8b-a4c7-3a7152e80ba8",
          "code": "546-46-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=546-46-3",
          "code_system": "CAS",
          "references": [
            "93d40a17-0f27-4099-b7b2-8e1f68f92994",
            "347a6c47-89ec-42c0-818b-d88928e169bc"
          ]
        },
        {
          "uuid": "927f68aa-0210-4de4-bf4b-de26014957bb",
          "code": "C84247",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C84247",
          "code_system": "NCI_THESAURUS",
          "references": [
            "93d40a17-0f27-4099-b7b2-8e1f68f92994"
          ]
        },
        {
          "uuid": "b6e5eaee-e92d-408c-b19f-5d70be64b89f",
          "code": "236911",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/236911/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "93d40a17-0f27-4099-b7b2-8e1f68f92994"
          ]
        },
        {
          "uuid": "d4e4f94f-d294-42c1-bddd-86bbcddea9e6",
          "code": "m11603",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11603?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "93d40a17-0f27-4099-b7b2-8e1f68f92994"
          ]
        },
        {
          "uuid": "73432c05-8be8-4b47-b674-ab4e8457d7b0",
          "code": "SUB15754MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "93d40a17-0f27-4099-b7b2-8e1f68f92994"
          ]
        },
        {
          "uuid": "de43a2c1-1828-4164-af2d-8b04df77028c",
          "code": "11023",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11023",
          "code_system": "PUBCHEM",
          "references": [
            "93d40a17-0f27-4099-b7b2-8e1f68f92994"
          ]
        },
        {
          "uuid": "193ef8e8-f96e-4487-8a56-f902bad789a3",
          "code": "208-901-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.093",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "93d40a17-0f27-4099-b7b2-8e1f68f92994"
          ]
        },
        {
          "uuid": "b1239e9e-8460-64b2-4f71-e42d07f99309",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "270f3aa5-1010-6cdf-d5dd-d7e3f6d120a5"
          ]
        },
        {
          "uuid": "4021a870-825c-64c4-227b-5ed6357c17c0",
          "code": "DB11154",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11154",
          "code_system": "DRUG BANK",
          "references": [
            "270f3aa5-1010-6cdf-d5dd-d7e3f6d120a5"
          ]
        },
        {
          "uuid": "de579e12-d5f4-4cda-a6a0-8d5bc2ebed67",
          "code": "K72I3DEX9B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6eb449d3-a646-916b-58da-9b9004501e72",
          "code": "137 (Number of products:9660)",
          "comments": "Dietary Supplement Label Database|Mineral|Zinc",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=137&item=Zinc",
          "code_system": "DSLD",
          "references": [
            "270f3aa5-1010-6cdf-d5dd-d7e3f6d120a5"
          ]
        },
        {
          "uuid": "ab08f9a0-08c5-daf7-09c9-b04a0f6141bd",
          "code": "K72I3DEX9B",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=K72I3DEX9B",
          "code_system": "DAILYMED",
          "references": [
            "01c20ab4-2171-55c3-e0ab-4256a6397730"
          ]
        },
        {
          "uuid": "db709b70-c95b-453b-bde6-de2b014009e4",
          "code": "100000089512",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5833f56c-06af-c83b-e5d5-4dbe0d9469ab"
          ]
        },
        {
          "uuid": "112bc398-41b2-f624-e3f5-9da7b659722d",
          "code": "DTXSID90889427",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90889427",
          "code_system": "EPA CompTox",
          "references": [
            "270f3aa5-1010-6cdf-d5dd-d7e3f6d120a5"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "e2aa9e7e-2e0e-4a15-ba5a-3132cf228b95",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c193d0b6-675a-4cd8-a9a2-2ee00b422dc3",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c97f7452-c11b-42c3-bde7-4bdce399b926",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "1f4a5c26-09b8-447f-b2b3-3884c5a175aa",
            "refuuid": "7495c063-0afe-4404-b6dc-1327ce06fa4e",
            "name": "Anhydrous citric acid",
            "unii": "XF417D3PSL",
            "linking_id": "XF417D3PSL",
            "ref_pname": "Anhydrous citric acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9d07663a-017e-4bd5-8f11-1456f344fe75",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "38c44879-902a-4e9d-871d-58173834018b",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "03c8611c-bd2a-ebac-170d-2dc9be118519",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "347a6c47-89ec-42c0-818b-d88928e169bc"
          ],
          "related_substance": {
            "uuid": "c5c5e15a-af2f-4482-8519-33cdf5885e5a",
            "refuuid": "031a5151-2571-43a8-a986-cfd8383340ea",
            "name": "ZINC CITRATE DIHYDRATE",
            "unii": "021IBV57IL",
            "linking_id": "021IBV57IL",
            "ref_pname": "ZINC CITRATE DIHYDRATE"
          }
        },
        {
          "uuid": "b533952b-97ca-3d79-2785-d603740f2246",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "347a6c47-89ec-42c0-818b-d88928e169bc"
          ],
          "related_substance": {
            "uuid": "6b371d0c-3813-4bc2-8691-3ba4b60f1c9c",
            "refuuid": "af38eaff-fcb3-4441-a0eb-92f5a0adee0e",
            "name": "ZINC CITRATE TRIHYDRATE",
            "unii": "GNM26GAX7R",
            "linking_id": "GNM26GAX7R",
            "ref_pname": "ZINC CITRATE TRIHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6204decf-9cea-4e70-94b7-66e130b6cebf",
          "name": "2-HYDROXY-1,2,3-PROPANETRICARBOXYLIC ACID ZINC SALT",
          "stdName": "2-HYDROXY-1,2,3-PROPANETRICARBOXYLIC ACID ZINC SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ef5e0a6-13b1-4c71-bea9-8533f54b170b",
            "04d967c2-98c8-4edf-a03d-bf8109df1893"
          ],
          "display_name": false
        },
        {
          "uuid": "fc8ced92-b0f8-4a1a-ba74-6f338a25d790",
          "name": "CITRATED ZINC",
          "stdName": "CITRATED ZINC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ef5e0a6-13b1-4c71-bea9-8533f54b170b",
            "3932c169-34e6-4fa5-b4da-4f1f0025339b",
            "7398b3ba-1f2e-41d6-bb31-0f01e5921325"
          ],
          "display_name": false
        },
        {
          "uuid": "52e5076f-3925-404e-a78a-d51ba35f8982",
          "name": "CITRATED ZINC [VANDF]",
          "stdName": "CITRATED ZINC [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ef5e0a6-13b1-4c71-bea9-8533f54b170b",
            "7398b3ba-1f2e-41d6-bb31-0f01e5921325"
          ],
          "display_name": false
        },
        {
          "uuid": "719161dd-67af-4888-acf0-552ea3bcbe3d",
          "name": "ZINC CITRATE",
          "stdName": "ZINC CITRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4e930d1-02e4-48c7-b60c-ca01e669ae05",
            "b602d184-5968-4b03-b49c-ba278d01f42b",
            "4277d694-3ccd-4792-897c-172baee15fea",
            "b597c9ea-dc2a-413e-9079-a575097ed5fa",
            "ae70dde1-8a0d-4b00-8d3f-8c9c78826d14",
            "4ef5e0a6-13b1-4c71-bea9-8533f54b170b",
            "cc7c3941-1f50-45b0-b865-098228ef1093",
            "c1f71de8-ca9c-459e-b586-5b35e40016ae",
            "466b09df-b7e8-4612-a383-20bea08be1c9",
            "b0102d28-625e-4c7c-882f-108408205579"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f7414519-e4be-4c41-8013-b433f65d9675",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7c66e255-02b7-4fb9-8c90-423d753f0d51",
          "name": "ZINC CITRATE [MART.]",
          "stdName": "ZINC CITRATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "466b09df-b7e8-4612-a383-20bea08be1c9"
          ],
          "display_name": false
        },
        {
          "uuid": "8e50ac0d-eef1-421b-8fd0-f8495c8984fe",
          "name": "ZINC CITRATE [MI]",
          "stdName": "ZINC CITRATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ef5e0a6-13b1-4c71-bea9-8533f54b170b",
            "4277d694-3ccd-4792-897c-172baee15fea"
          ],
          "display_name": false
        },
        {
          "uuid": "cc5b7969-f8e3-8eeb-fa03-e72f20df74b2",
          "name": "Zinc citrate [WHO-DD]",
          "stdName": "ZINC CITRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e52e0094-97d1-6d5b-7366-2ca834cb3f28"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "04d967c2-98c8-4edf-a03d-bf8109df1893",
          "citation": "MERCK 14TH",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4ef5e0a6-13b1-4c71-bea9-8533f54b170b",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0102d28-625e-4c7c-882f-108408205579",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "466b09df-b7e8-4612-a383-20bea08be1c9",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4277d694-3ccd-4792-897c-172baee15fea",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae70dde1-8a0d-4b00-8d3f-8c9c78826d14",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b597c9ea-dc2a-413e-9079-a575097ed5fa",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7398b3ba-1f2e-41d6-bb31-0f01e5921325",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93d40a17-0f27-4099-b7b2-8e1f68f92994",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389667000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c57992c7-9888-4b03-8885-7d3d70085eaa",
          "citation": "SRS import [K72I3DEX9B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K72I3DEX9B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389667000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf43628c-42e0-4c45-9f18-cc27111d99d1",
          "citation": "otc",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1f71de8-ca9c-459e-b586-5b35e40016ae",
          "citation": "ZINC CITRATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f4e930d1-02e4-48c7-b60c-ca01e669ae05",
          "citation": "ZINC CITRATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cc7c3941-1f50-45b0-b865-098228ef1093",
          "citation": "ZINC CITRATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b602d184-5968-4b03-b49c-ba278d01f42b",
          "citation": "ZINC CITRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3932c169-34e6-4fa5-b4da-4f1f0025339b",
          "citation": "CITRATED ZINC [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "270f3aa5-1010-6cdf-d5dd-d7e3f6d120a5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "347a6c47-89ec-42c0-818b-d88928e169bc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e52e0094-97d1-6d5b-7366-2ca834cb3f28",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "01c20ab4-2171-55c3-e0ab-4256a6397730",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "5833f56c-06af-c83b-e5d5-4dbe0d9469ab",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "acb50ae5-6090-49b6-89c4-57e55a77c1c5",
          "id": "acb50ae5-6090-49b6-89c4-57e55a77c1c5",
          "molfile": "\n  Marvin  01132108582D          \n\n  1  0  0  0  0  0            999 V2000\n    8.1293   -2.4258    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 3,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 3,
            "units": "MOL RATIO",
            "uuid": "00b1017d-9e28-4545-b642-0450c261ec80"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "d5cb988e-0cd3-41a6-8eb7-0aad3f9d27f6",
          "id": "d5cb988e-0cd3-41a6-8eb7-0aad3f9d27f6",
          "molfile": "\n  Marvin  01132111052D          \n\n 13 12  0  0  0  0            999 V2000\n    3.8538   -1.1858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8580   -2.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1440   -2.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4300   -2.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7118   -2.4258    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.4258   -1.1858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5720   -2.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2859   -2.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9999   -2.4258    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.2776   -1.1858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8538   -2.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1357   -3.2400    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.5677   -3.2484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  1  0  0  0  0\n  2 11  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  CHG  3   5  -1   9  -1  12  -1\nM  END",
          "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O",
          "formula": "C6H5O7",
          "atropisomerism": "No",
          "charge": -3,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "4882bae0-18ba-47a8-bd57-98a40c0f658e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "189.1",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c83e51a4-df4e-4dc8-a7d8-3ee9eaf3b469",
      "version": "13",
      "structure": {
        "id": "5bec21ad-8af7-4c5d-a31d-8c168b8a88fd",
        "molfile": "\n  Marvin  01132104462D          \n\n 29 24  0  0  0  0            999 V2000\n    8.1293   -2.4258    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    1.7118   -2.4258    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.4300   -2.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1440   -2.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8580   -2.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5720   -2.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2859   -2.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9999   -2.4258    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.4258   -1.1858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8538   -1.1858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8538   -2.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2776   -1.1858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1357   -3.2400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5677   -3.2484    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.1293   -2.4258    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    8.1293   -2.4258    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    1.7118   -2.4258    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.4300   -2.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1440   -2.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8580   -2.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5720   -2.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2859   -2.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9999   -2.4258    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.4258   -1.1858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8538   -1.1858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8538   -2.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2776   -1.1858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1357   -3.2400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5677   -3.2484    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  3  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n  7 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 24  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 25  1  0  0  0  0\n 20 26  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 27  2  0  0  0  0\n 22 23  1  0  0  0  0\n 26 28  2  0  0  0  0\n 26 29  1  0  0  0  0\nM  CHG  8   1   2   2  -1   8  -1  14  -1  15   2  16   2  17  -1  23  -1\nM  CHG  1  29  -1\nM  STY  2   1 MUL   2 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  17  18\nM  SAL   1 11  19  20  21  22  23  24  25  26  27  28  29\nM  SPA   1 13   2   3   4   5   6   7   8   9  10  11  12  13  14\nM  SDI   1  4    1.2918   -3.6684    1.2918   -0.7658\nM  SDI   1  4    6.4199   -0.7658    6.4199   -3.6684\nM  SMT   1 2\nM  SCN  1   2 HT \nM  SAL   2  3   1  15  16\nM  SPA   2  1   1\nM  SDI   2  4    7.7093   -2.8458    7.7093   -2.0058\nM  SDI   2  4    8.5493   -2.0058    8.5493   -2.8458\nM  SMT   2 3\nM  END",
        "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[Zn+2].[Zn+2].[Zn+2]",
        "formula": "2C6H5O7.3Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "574.3866",
        "optical_activity": "NONE",
        "references": [
          "cf43628c-42e0-4c45-9f18-cc27111d99d1",
          "c57992c7-9888-4b03-8885-7d3d70085eaa"
        ],
        "stereo_centers": 0
      },
      "unii": "K72I3DEX9B"
    }
  ]
}