{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fade40e6-7d52-4f79-bb72-259d192128b7",
          "code": "482-44-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=482-44-0",
          "code_system": "CAS",
          "references": [
            "517f17d0-7458-4bfa-9b0d-5c9d4e194746",
            "b6cb9e57-81ab-4b45-8cfc-244fc2185884"
          ]
        },
        {
          "uuid": "25ef1897-274b-46f8-86a0-40895e723cb5",
          "code": "C63672",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C63672",
          "code_system": "NCI_THESAURUS",
          "references": [
            "517f17d0-7458-4bfa-9b0d-5c9d4e194746"
          ]
        },
        {
          "uuid": "dd3d1ba4-a17b-4f38-901e-839fc49364af",
          "code": "C031534",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67031534",
          "code_system": "MESH",
          "references": [
            "517f17d0-7458-4bfa-9b0d-5c9d4e194746"
          ]
        },
        {
          "uuid": "44b48e88-e60f-47d1-b7a9-8a384bac8cb2",
          "code": "IMPERATORIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Imperatorin",
          "code_system": "WIKIPEDIA",
          "references": [
            "517f17d0-7458-4bfa-9b0d-5c9d4e194746"
          ]
        },
        {
          "uuid": "0e67b507-41d7-4526-815f-d4836df6d4b9",
          "code": "207-581-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.893",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "517f17d0-7458-4bfa-9b0d-5c9d4e194746"
          ]
        },
        {
          "uuid": "4c42e117-355b-44b6-ba16-08a8ff680ecf",
          "code": "m6237",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6237?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "517f17d0-7458-4bfa-9b0d-5c9d4e194746"
          ]
        },
        {
          "uuid": "b31bf059-fc25-4486-9d4f-0cf139d037c7",
          "code": "SUB14799MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "517f17d0-7458-4bfa-9b0d-5c9d4e194746"
          ]
        },
        {
          "uuid": "9f4c4127-3352-4501-aace-2751895b10c2",
          "code": "CHEMBL453805",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL453805",
          "code_system": "ChEMBL",
          "references": [
            "517f17d0-7458-4bfa-9b0d-5c9d4e194746"
          ]
        },
        {
          "uuid": "901961a6-b53c-4c35-bd00-3fd177449cd8",
          "code": "10212",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10212",
          "code_system": "PUBCHEM",
          "references": [
            "517f17d0-7458-4bfa-9b0d-5c9d4e194746"
          ]
        },
        {
          "uuid": "4251d7c8-1e3c-3220-a88f-5178817e9717",
          "code": "3497",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3497",
          "code_system": "HSDB",
          "references": [
            "8d41390e-0385-76be-363a-d419b8b8cc7f"
          ]
        },
        {
          "uuid": "5790fe3b-54eb-2978-6bbe-0a875f2807b1",
          "code": "DTXSID8048737",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8048737",
          "code_system": "EPA CompTox",
          "references": [
            "8a8ab4f5-a53e-7aa5-9ba0-e6113fb2aa50"
          ]
        },
        {
          "uuid": "c2058fb2-ca71-df09-9086-8e479871ad4a",
          "code": "C45597",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Ring Compound[C1933]|Heterocyclic Compound[C542]|Coumarin Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45597",
          "code_system": "NCI_THESAURUS",
          "references": [
            "63fdfb25-8ce4-0e3f-e7c5-190433eec669"
          ]
        },
        {
          "uuid": "d9733a37-67ca-e53b-6959-666ef51297a1",
          "code": "1375295",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1375295",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "63fdfb25-8ce4-0e3f-e7c5-190433eec669"
          ]
        },
        {
          "uuid": "5ef20dbe-89b8-4cba-8fca-7dde47d0fc1d",
          "code": "K713N25C78",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "916789c0-13a9-f125-0b90-fd9885a6352b",
          "code": "5885",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5885",
          "code_system": "CHEBI",
          "references": [
            "63fdfb25-8ce4-0e3f-e7c5-190433eec669"
          ]
        },
        {
          "uuid": "f71f9ad7-cedd-b0d2-bbcd-df2c334a1d25",
          "code": "100000079778",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "eda7ea13-8430-9547-970b-a548c84d75ec"
          ]
        },
        {
          "uuid": "85224ed6-0989-4642-eecc-7347b14210c4",
          "code": "402949",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=402949",
          "code_system": "NSC",
          "references": [
            "4ea58ac7-a64b-4a7a-31da-0214d77f99d5"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b6d5e14e-a522-49f9-86d4-cb739f4c0c87",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "c7180419-b5a9-4203-befd-877ebc635ca8",
            "refuuid": "a5ca6c76-aac8-43a1-be65-6afd27e71f46",
            "name": "AMMI MAJUS SEED",
            "unii": "59C7HJU797",
            "linking_id": "59C7HJU797",
            "ref_pname": "AMMI MAJUS SEED"
          }
        },
        {
          "uuid": "2930c3ee-594c-4809-8076-9c37e298f82d",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "9812abc4-6b89-4b2c-be4b-5aa78bf0be7d",
            "refuuid": "54fde9a8-969b-44a0-9500-6178998c1a55",
            "name": "VISNAGA DAUCOIDES FRUIT",
            "unii": "3UN285QN0C",
            "linking_id": "3UN285QN0C",
            "ref_pname": "VISNAGA DAUCOIDES FRUIT"
          }
        },
        {
          "uuid": "35fe5480-e4cb-4583-b6da-e8aaa351aff7",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "5185f76e-ded3-4032-be72-f39b76daa085",
            "refuuid": "090364c8-1999-4029-89d3-fc1eca372567",
            "name": "AEGLE MARMELOS FRUIT",
            "unii": "MQT45905E6",
            "linking_id": "MQT45905E6",
            "ref_pname": "AEGLE MARMELOS FRUIT"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bf9db4c7-e2a4-4725-873a-55e093147e08",
          "name": "6-HYDROXY-7-(3-METHYL-2-BUTENYLOXY)-5-BENZOFURANACRYLIC ACID .GAMMA.-LACTONE",
          "stdName": "6-HYDROXY-7-(3-METHYL-2-BUTENYLOXY)-5-BENZOFURANACRYLIC ACID .GAMMA.-LACTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1553dc70-e931-43d7-bd91-6a350bdc2013",
            "99977320-694d-4a00-8add-58f28d5cc509"
          ],
          "display_name": false
        },
        {
          "uuid": "595e8af0-3606-4551-a438-2957f044ac80",
          "name": "8-ISOAMYLENOXYPSORALEN",
          "stdName": "8-ISOAMYLENOXYPSORALEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1553dc70-e931-43d7-bd91-6a350bdc2013",
            "99977320-694d-4a00-8add-58f28d5cc509"
          ],
          "display_name": false
        },
        {
          "uuid": "ec03e381-6a5f-4716-9777-f74d65c4b4d0",
          "name": "9-((3-METHYL-2-BUTENYL)OXY)-7H-FURO(3,2-G)(1)BENZOPYRAN-7-ONE",
          "stdName": "9-((3-METHYL-2-BUTENYL)OXY)-7H-FURO(3,2-G)(1)BENZOPYRAN-7-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1553dc70-e931-43d7-bd91-6a350bdc2013",
            "99977320-694d-4a00-8add-58f28d5cc509"
          ],
          "display_name": false
        },
        {
          "uuid": "2d754a65-e9a5-4e48-916d-7456d92fe7b6",
          "name": "9-(3-METHYLBUT-2-ENYLOXY)FURO(3,2-G)CHROMEN-7-ONE",
          "stdName": "9-(3-METHYLBUT-2-ENYLOXY)FURO(3,2-G)CHROMEN-7-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e81c177-e6f0-4e38-b833-32165b70fa27"
          ],
          "display_name": false
        },
        {
          "uuid": "13d80bdd-b92f-43ac-ab4c-1c2963b3b961",
          "name": "AMMIDIN",
          "stdName": "AMMIDIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1553dc70-e931-43d7-bd91-6a350bdc2013",
            "99977320-694d-4a00-8add-58f28d5cc509"
          ],
          "display_name": false
        },
        {
          "uuid": "94e4bcce-5f28-4263-bea3-21902fdc4037",
          "name": "IMPERATORIN",
          "stdName": "IMPERATORIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd0ef90b-53d1-409c-ab27-3ab327aa150b",
            "fe2d88cc-7d58-4c38-b401-f89fbdfb7ef4",
            "1553dc70-e931-43d7-bd91-6a350bdc2013",
            "8b4d93e9-c411-46a2-a2be-5bb0f2bae79e"
          ],
          "display_name": false
        },
        {
          "uuid": "cec35386-49f8-4109-8dde-e9aed59f9911",
          "name": "IMPERATORIN [MI]",
          "stdName": "IMPERATORIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd0ef90b-53d1-409c-ab27-3ab327aa150b",
            "1553dc70-e931-43d7-bd91-6a350bdc2013"
          ],
          "display_name": false
        },
        {
          "uuid": "2208435c-9a66-4ba8-b8b2-7320df629ae6",
          "name": "MARMELOSIN",
          "stdName": "MARMELOSIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1553dc70-e931-43d7-bd91-6a350bdc2013",
            "99977320-694d-4a00-8add-58f28d5cc509"
          ],
          "display_name": false
        },
        {
          "uuid": "f43d1f81-80e7-9523-3759-b9f85c55048f",
          "name": "MARMELOSIN [USP-RS]",
          "stdName": "MARMELOSIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc74a483-48bc-bf93-eb05-4a0983de7304"
          ],
          "display_name": false
        },
        {
          "uuid": "1aa9d1c2-1ad9-41a1-9862-b8e9e4092e49",
          "name": "NSC-402949",
          "stdName": "NSC-402949",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1553dc70-e931-43d7-bd91-6a350bdc2013",
            "777ff18d-e87a-4844-a1f5-dd3648cf015d"
          ],
          "display_name": false
        },
        {
          "uuid": "81f50754-b7b7-4373-8467-fe2c90461210",
          "name": "PENTOSALEN",
          "stdName": "PENTOSALEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "794f7e22-9a5c-41b5-921b-ba2986e916d8",
            "130faac7-a9ef-4151-ba4b-95ab9087d067",
            "c7c5787c-8b2a-406e-844f-d41cf2d1ecc3",
            "1553dc70-e931-43d7-bd91-6a350bdc2013",
            "4d23a43a-61af-4f6a-b32d-eb21c9f17768",
            "5e81c177-e6f0-4e38-b833-32165b70fa27"
          ],
          "display_name": true
        },
        {
          "uuid": "9b6da514-a755-4c9b-b223-bd7fbf9048ad",
          "name": "PENTOSALEN [HSDB]",
          "stdName": "PENTOSALEN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "794f7e22-9a5c-41b5-921b-ba2986e916d8",
            "1553dc70-e931-43d7-bd91-6a350bdc2013"
          ],
          "display_name": false
        },
        {
          "uuid": "0128213d-2ba2-71cc-0ee4-bec02a0e10dd",
          "name": "Pentosalen [WHO-DD]",
          "stdName": "PENTOSALEN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70e3251c-f6f6-ba6b-edf5-9863d1040d60"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5e81c177-e6f0-4e38-b833-32165b70fa27",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fe2d88cc-7d58-4c38-b401-f89fbdfb7ef4",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1553dc70-e931-43d7-bd91-6a350bdc2013",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99977320-694d-4a00-8add-58f28d5cc509",
          "citation": "Merck 14.3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd0ef90b-53d1-409c-ab27-3ab327aa150b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "794f7e22-9a5c-41b5-921b-ba2986e916d8",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7c5787c-8b2a-406e-844f-d41cf2d1ecc3",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "777ff18d-e87a-4844-a1f5-dd3648cf015d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "517f17d0-7458-4bfa-9b0d-5c9d4e194746",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390768000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a49fb97-c2c0-4fe1-a1a5-d6fdcb297158",
          "citation": "SRS import [K713N25C78]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K713N25C78",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390768000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b4d93e9-c411-46a2-a2be-5bb0f2bae79e",
          "citation": "IMPERATORIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "130faac7-a9ef-4151-ba4b-95ab9087d067",
          "citation": "PENTOSALEN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4d23a43a-61af-4f6a-b32d-eb21c9f17768",
          "citation": "PENTOSALEN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8d41390e-0385-76be-363a-d419b8b8cc7f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+482-44-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8a8ab4f5-a53e-7aa5-9ba0-e6113fb2aa50",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=482-44-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "63fdfb25-8ce4-0e3f-e7c5-190433eec669",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cc74a483-48bc-bf93-eb05-4a0983de7304",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "b6cb9e57-81ab-4b45-8cfc-244fc2185884",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4ea58ac7-a64b-4a7a-31da-0214d77f99d5",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "70e3251c-f6f6-ba6b-edf5-9863d1040d60",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "eda7ea13-8430-9547-970b-a548c84d75ec",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1a1d9eb3-b234-40f2-a4e5-00efed655ca4",
          "id": "1a1d9eb3-b234-40f2-a4e5-00efed655ca4",
          "molfile": "\n  Marvin  01132101322D          \n\n 20 22  0  0  0  0            999 V2000\n    5.2541   -4.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9323   -3.9892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6995   -3.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7066   -4.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7066   -5.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4788   -5.3683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4788   -6.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1946   -6.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9819   -6.3353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4652   -7.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9819   -7.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1946   -7.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4788   -7.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7724   -7.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0512   -7.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3426   -7.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3426   -6.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6265   -6.1809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0512   -6.1809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7724   -6.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 20  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 12  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 20 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCOc1c2c(cco2)cc3ccc(=O)oc31)C",
          "formula": "C16H14O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d6a95b96-1af8-4dc3-9ea4-dc743751731a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.2806",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a261b6ee-2576-4e43-ba6c-4f13c22b943c",
      "version": "19",
      "structure": {
        "id": "c8eb48ef-9aec-4dc1-a8db-d411f3aba0d2",
        "molfile": "\n  Marvin  01132110232D          \n\n 20 22  0  0  0  0            999 V2000\n    7.4788   -6.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7724   -6.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7724   -7.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4788   -7.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1946   -7.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1946   -6.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9819   -6.3353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4652   -7.0060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9819   -7.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0512   -7.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3426   -7.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3426   -6.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0512   -6.1809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6265   -6.1809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4788   -5.3683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7066   -5.0825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7066   -4.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9323   -3.9892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2541   -4.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6995   -3.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  5  9  1  0  0  0  0\n  3 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n  2 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n  1 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCOc1c2c(cco2)cc3ccc(=O)oc31)C",
        "formula": "C16H14O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "270.2806",
        "optical_activity": "NONE",
        "references": [
          "7a49fb97-c2c0-4fe1-a1a5-d6fdcb297158",
          "5e81c177-e6f0-4e38-b833-32165b70fa27"
        ],
        "stereo_centers": 0
      },
      "unii": "K713N25C78"
    }
  ]
}