{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c98811ed-73ca-4644-bc19-ad741b7bc45b",
          "code": "68157-60-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68157-60-8",
          "code_system": "CAS",
          "references": [
            "b076abe9-e43d-41ca-9ebf-1572ff8069b0",
            "0a6f35f5-5414-4d19-8aa5-7f5f6c33c1f5"
          ]
        },
        {
          "uuid": "f49a7c06-4e8b-40ac-a5a9-da8bd235aba2",
          "code": "FORCHLORFENURON",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Forchlorfenuron",
          "code_system": "WIKIPEDIA",
          "references": [
            "b076abe9-e43d-41ca-9ebf-1572ff8069b0"
          ]
        },
        {
          "uuid": "a24d0359-4f74-4375-ace0-94ead67e01a5",
          "code": "128819",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2418",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "b076abe9-e43d-41ca-9ebf-1572ff8069b0"
          ]
        },
        {
          "uuid": "fe5dbe22-c553-4b48-a2ac-3ea97559f6f1",
          "code": "m5532",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5532?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b076abe9-e43d-41ca-9ebf-1572ff8069b0"
          ]
        },
        {
          "uuid": "d1750788-de24-40e5-a876-a12b28d235d4",
          "code": "93379",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/93379",
          "code_system": "PUBCHEM",
          "references": [
            "b076abe9-e43d-41ca-9ebf-1572ff8069b0"
          ]
        },
        {
          "uuid": "9e085402-3cc4-1c7f-a47c-9115d0fde854",
          "code": "7983",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7983",
          "code_system": "HSDB",
          "references": [
            "aca030ca-f4d7-cbd1-82e3-85005fda7f45"
          ]
        },
        {
          "uuid": "c53a4d4a-976a-b64d-2be4-07e4da9cb5e7",
          "code": "DTXSID1034634",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1034634",
          "code_system": "EPA CompTox",
          "references": [
            "dcb161ae-bf32-414c-073b-d0c964d52406"
          ]
        },
        {
          "uuid": "37d5965b-2a13-41f2-82b8-8d31698b3676",
          "code": "K62IP7463J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e3abd1e2-da76-6379-e9ed-4fec09a85965",
          "code": "forchlorfenuron",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/forchlorfenuron.html",
          "code_system": "ALANWOOD",
          "references": [
            "60d4d2fd-5999-cff4-9b26-cc39e5699332"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e45374c0-4e1d-4bad-affa-ddc9168c5c8b",
          "name": "1-(2-CHLORO-4-PYRIDYL)-3-PHENYLUREA",
          "stdName": "1-(2-CHLORO-4-PYRIDYL)-3-PHENYLUREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6aac055a-36ff-4be9-90e7-9e9081be9b7d",
            "6f315ac7-e84b-43e7-84e4-1908e9555b32"
          ],
          "display_name": false
        },
        {
          "uuid": "50805185-467f-4754-a2d2-cdd42b1de83b",
          "name": "CPPU",
          "stdName": "CPPU",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c171612-c28d-4112-af07-f8778c776371",
            "11a85629-6d7f-48b9-8ce4-e9e5d01f6a38"
          ],
          "display_name": false
        },
        {
          "uuid": "04f13cfb-f5ae-4945-bf8b-240ac5d2f6b4",
          "name": "FORCHLORFENURON",
          "stdName": "FORCHLORFENURON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "350beb94-cc09-4835-993f-8f3fb4327e51",
            "5c171612-c28d-4112-af07-f8778c776371",
            "ef6e6764-680d-4238-b8ed-f5278d08c9b8",
            "315a062e-c11f-4b7a-84ca-d4b209e7d173",
            "d7029465-ec13-4d81-9b87-11bff9387a94",
            "91791796-21ff-49bd-9cef-f239bee56bf7"
          ],
          "display_name": true
        },
        {
          "uuid": "70fc908e-ef88-4a75-aee3-06e2786fd7aa",
          "name": "FORCHLORFENURON [ISO]",
          "stdName": "FORCHLORFENURON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c171612-c28d-4112-af07-f8778c776371",
            "91791796-21ff-49bd-9cef-f239bee56bf7"
          ],
          "display_name": false
        },
        {
          "uuid": "ff6415bf-f815-4e51-beab-d4f82e6e2ff9",
          "name": "FORCHLORFENURON [MI]",
          "stdName": "FORCHLORFENURON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c171612-c28d-4112-af07-f8778c776371",
            "d7029465-ec13-4d81-9b87-11bff9387a94"
          ],
          "display_name": false
        },
        {
          "uuid": "a4d452cc-0de4-48b2-808a-d91aca90572e",
          "name": "KT-30",
          "stdName": "KT-30",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c171612-c28d-4112-af07-f8778c776371",
            "11a85629-6d7f-48b9-8ce4-e9e5d01f6a38"
          ],
          "display_name": false
        },
        {
          "uuid": "e77eea81-bd51-4398-9f7f-b143ff12a592",
          "name": "N-(2-CHLORO-4-PYRIDINYL)-N'-PHENYLUREA",
          "stdName": "N-(2-CHLORO-4-PYRIDINYL)-N'-PHENYLUREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85048779-d5b7-4e16-950d-337a80b89284",
            "6aac055a-36ff-4be9-90e7-9e9081be9b7d"
          ],
          "display_name": false
        },
        {
          "uuid": "317d1f9d-fcd7-4634-8a69-12f006256add",
          "name": "PRESTIGE",
          "stdName": "PRESTIGE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c171612-c28d-4112-af07-f8778c776371",
            "cfb4fdf6-789c-4dec-ae39-c0424b422ae3"
          ],
          "display_name": false
        },
        {
          "uuid": "fc279e2c-2bdb-4cab-887c-3e2d22aaeb22",
          "name": "SITOFEX",
          "stdName": "SITOFEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c171612-c28d-4112-af07-f8778c776371",
            "cfb4fdf6-789c-4dec-ae39-c0424b422ae3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "85048779-d5b7-4e16-950d-337a80b89284",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7029465-ec13-4d81-9b87-11bff9387a94",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c171612-c28d-4112-af07-f8778c776371",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11a85629-6d7f-48b9-8ce4-e9e5d01f6a38",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cfb4fdf6-789c-4dec-ae39-c0424b422ae3",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "91791796-21ff-49bd-9cef-f239bee56bf7",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b076abe9-e43d-41ca-9ebf-1572ff8069b0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12a798eb-df8a-4ed1-a45f-f9d4f682c713",
          "citation": "SRS import [K62IP7463J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K62IP7463J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b19baed8-84b6-45e7-8116-4524637d1e0e",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "350beb94-cc09-4835-993f-8f3fb4327e51",
          "citation": "FORCHLORFENURON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "315a062e-c11f-4b7a-84ca-d4b209e7d173",
          "citation": "FORCHLORFENURON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ef6e6764-680d-4238-b8ed-f5278d08c9b8",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6aac055a-36ff-4be9-90e7-9e9081be9b7d",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f315ac7-e84b-43e7-84e4-1908e9555b32",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aca030ca-f4d7-cbd1-82e3-85005fda7f45",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+68157-60-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dcb161ae-bf32-414c-073b-d0c964d52406",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68157-60-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "60d4d2fd-5999-cff4-9b26-cc39e5699332",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "0a6f35f5-5414-4d19-8aa5-7f5f6c33c1f5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "71ae21cd-4571-48f7-bc17-459c387f29b8",
          "id": "71ae21cd-4571-48f7-bc17-459c387f29b8",
          "molfile": "\n  Marvin  01132105542D          \n\n 17 18  0  0  0  0            999 V2000\n    5.2034   -3.5761    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.2034   -4.4012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9221   -4.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9221   -5.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6359   -6.0523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3540   -5.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0670   -6.0503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3540   -4.8138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0710   -4.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0710   -3.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7850   -3.1675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4991   -3.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4991   -4.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7850   -4.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2034   -6.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4956   -5.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4956   -4.8138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 17  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n 15  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 14  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)NC(=O)Nc2ccnc(c2)Cl",
          "formula": "C12H10ClN3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f39a2f4b-3c05-4f85-8e31-146348ea507d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "247.6807",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ae77da79-4f8c-469a-81c0-d9a87e1bdad2",
      "version": "7",
      "structure": {
        "id": "c0870a53-0903-4cb3-ba5d-0c3da89ba9ac",
        "molfile": "\n  Marvin  01132109572D          \n\n 17 18  0  0  0  0            999 V2000\n    5.9221   -4.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2034   -4.4012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2034   -3.5761    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.4956   -4.8138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4956   -5.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2034   -6.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9221   -5.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6359   -6.0523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3540   -5.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0670   -6.0503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3540   -4.8138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0710   -4.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0710   -3.5738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7850   -3.1675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4991   -3.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4991   -4.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7850   -4.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  1  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 12  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)NC(=O)Nc2ccnc(c2)Cl",
        "formula": "C12H10ClN3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "247.6807",
        "optical_activity": "NONE",
        "references": [
          "b19baed8-84b6-45e7-8116-4524637d1e0e",
          "12a798eb-df8a-4ed1-a45f-f9d4f682c713"
        ],
        "stereo_centers": 0
      },
      "unii": "K62IP7463J"
    }
  ]
}