{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "061353f0-7d17-e43b-4f74-3a3de193f915",
          "code": "4293571",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4293571",
          "code_system": "PUBCHEM",
          "references": [
            "9323bed1-5eb8-bc22-5de8-2af570b35a0e"
          ]
        },
        {
          "uuid": "1e46c2e9-76cf-4a07-8d77-f92df7b849d7",
          "code": "K5893QLJ58",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "db0be4c3-27cc-4751-830f-6ecae3cb4b0a",
          "code": "120023-19-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=120023-19-0",
          "code_system": "CAS",
          "references": [
            "9bfcf6e7-70e9-44ea-838f-eb3b03ad8388"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f851c25e-116e-4da0-9b8b-198f650db52f",
          "amount": {
            "uuid": "9ebb0666-b193-403d-9a38-db49ef9849a6"
          },
          "type": "PARENT->IMPURITY",
          "references": [
            "4fed2277-0f46-457c-99e7-1e83b8c6cf97"
          ],
          "related_substance": {
            "uuid": "f2ff314d-73d6-43e5-8aec-110e0f946a3c",
            "refuuid": "8231d86a-8996-4d88-831d-670daeed7d78",
            "name": "ASPIRIN DL-LYSINE",
            "unii": "2JJ274J145",
            "linking_id": "2JJ274J145",
            "ref_pname": "ASPIRIN DL-LYSINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6bcea1db-355f-4329-9310-ee26adf6ffa0",
          "name": "(2RS)-6-amino-2-[(2R)-2,6-diaminohexanamido]hexanoic acid and (2RS)-6-amino-2-[(2S)-2,6-diaminohexanamido]hexanoic acid",
          "stdName": "(2RS)-6-AMINO-2-((2R)-2,6-DIAMINOHEXANAMIDO)HEXANOIC ACID AND (2RS)-6-AMINO-2-((2S)-2,6-DIAMINOHEXANAMIDO)HEXANOIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fed2277-0f46-457c-99e7-1e83b8c6cf97"
          ],
          "display_name": false
        },
        {
          "uuid": "27a54aab-cbef-4418-a7a7-fbf96d51b5ca",
          "name": "DL-LYSINE ACETYLSALICYLATE IMPURITY B [EP IMPURITY]",
          "stdName": "DL-LYSINE ACETYLSALICYLATE IMPURITY B [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fed2277-0f46-457c-99e7-1e83b8c6cf97"
          ],
          "display_name": false
        },
        {
          "uuid": "3c8fb9ed-4d55-47de-8d64-ea3f29ebbe8f",
          "name": "DL-Lysine, N<SUP>2</SUP>-DL-lysyl-",
          "stdName": "N2-DL-LYSYL-DL-LYSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bfcf6e7-70e9-44ea-838f-eb3b03ad8388"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "9323bed1-5eb8-bc22-5de8-2af570b35a0e",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "4fed2277-0f46-457c-99e7-1e83b8c6cf97",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9bfcf6e7-70e9-44ea-838f-eb3b03ad8388",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "528474b3-4815-4b3b-abe9-46d15af5517e",
          "id": "528474b3-4815-4b3b-abe9-46d15af5517e",
          "molfile": "\n  Marvin  01092312182D          \n\n 19 18  0  0  0  0            999 V2000\n    2.8875    1.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7125    1.4290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4750    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4750    0.7144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1250    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6500    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6500    0.7144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8875    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9500    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7125    2.8579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2375    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3625    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3625    1.4290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4125    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1875    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    3.5724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6000    3.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4250    3.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8375    4.2868    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  5  9  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "C(CCN)CC(C(=O)NC(CCCCN)C(=O)O)N",
          "formula": "C12H26N4O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e1dd96fe-fcec-40e5-9abf-85aa11271136"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "274.3603",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6ee4cb67-02e3-4e57-a019-008af8f8ac48",
      "version": "4",
      "structure": {
        "id": "588e6ee4-1a31-4284-ab4e-4ce6c472ee17",
        "molfile": "Lysyllysine\n   JSDraw201092312182D\n\n 19 18  0  0  0  0              0 V2000\n   23.2180   -9.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7780   -9.0470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4380   -7.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4380  -10.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.5580   -7.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8780   -7.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8780  -10.3981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2180  -11.7490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1180   -7.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7780   -6.3450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0980   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8980   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8980   -9.0470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5380   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.4580   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7580   -4.9939    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   30.2380   -4.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.7980   -4.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.5780   -3.6430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  5  9  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
        "smiles": "C(CCN)CC(C(=O)NC(CCCCN)C(=O)O)N",
        "formula": "C12H26N4O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "274.3603",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4fed2277-0f46-457c-99e7-1e83b8c6cf97",
          "9bfcf6e7-70e9-44ea-838f-eb3b03ad8388"
        ],
        "stereo_centers": 2
      },
      "unii": "K5893QLJ58"
    }
  ]
}