{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2deb0681-687c-4e27-8a35-3a06e1c2b4a6", "code": "59447-55-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=59447-55-1", "code_system": "CAS", "references": [ "15e80c17-eab4-4689-94a2-2ec18c7dfd03", "8fa6856c-024e-4ee0-b019-aacd05dd7037" ] }, { "uuid": "f0d29557-3034-400b-afbb-81588ca96be8", "code": "261-767-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.056.134", "code_system": "ECHA (EC/EINECS)", "references": [ "15e80c17-eab4-4689-94a2-2ec18c7dfd03" ] }, { "uuid": "d8816eb6-c0ce-4c1b-9b0b-5416facdaf0a", "code": "101059", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101059", "code_system": "PUBCHEM", "references": [ "15e80c17-eab4-4689-94a2-2ec18c7dfd03" ] }, { "uuid": "4688816d-87dc-892a-fe66-eb2f96e65bca", "code": "DTXSID9052719", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9052719", "code_system": "EPA CompTox", "references": [ "f301eda6-0b5c-0585-c945-68c3ff8e4b71" ] }, { "uuid": "1132ce6d-f1cf-4fe5-b1d8-21f31461b8f9", "code": "K55L5VE7PP", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "8fa6856c-024e-4ee0-b019-aacd05dd7037" ] } ], "substance_class": "chemical", "names": [ { "uuid": "746c5ecc-be38-454a-804d-f46a0dd73524", "name": "2,3,4,5,6-PENTABROMOBENZYL ACRYLATE", "stdName": "2,3,4,5,6-PENTABROMOBENZYL ACRYLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8fa6856c-024e-4ee0-b019-aacd05dd7037" ], "display_name": false }, { "uuid": "5d60af5f-b1fb-4434-bb97-713dc26059f8", "name": "2-PROPENOIC ACID, (2,3,4,5,6-PENTABROMOPHENYL)METHYL ESTER", "stdName": "2-PROPENOIC ACID, (2,3,4,5,6-PENTABROMOPHENYL)METHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bfc8ea18-4c33-40a8-8541-de47720a6094", "cc95a90a-f39a-45b8-ac32-bd453e7ff020" ], "display_name": true }, { "uuid": "d08d0184-53af-4572-afeb-17e35f0f770b", "name": "PENTABROMOBENZYL ACRYLATE", "stdName": "PENTABROMOBENZYL ACRYLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8fa6856c-024e-4ee0-b019-aacd05dd7037" ], "display_name": false } ], "references": [ { "uuid": "bfc8ea18-4c33-40a8-8541-de47720a6094", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cc95a90a-f39a-45b8-ac32-bd453e7ff020", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "15e80c17-eab4-4689-94a2-2ec18c7dfd03", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392810000, "tags": [ "NOMEN" ] }, { "uuid": "a49791e2-4911-4c20-b0b1-97d122c6339c", "citation": "CHEMID RECORD 59447-55-1", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f301eda6-0b5c-0585-c945-68c3ff8e4b71", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=59447-55-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8fa6856c-024e-4ee0-b019-aacd05dd7037", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f66782d5-5a43-424d-956c-a853113e9c93", "id": "f66782d5-5a43-424d-956c-a853113e9c93", "molfile": "\n Marvin 01132112462D \n\n 17 17 0 0 0 0 999 V2000\n 6.4376 10.8674 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4376 10.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7265 9.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0196 10.0308 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7265 8.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0196 8.3618 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4376 8.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4376 7.5251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1487 7.1069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1487 6.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8598 5.8520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4376 5.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4376 5.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1487 8.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8598 8.3618 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1487 9.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8598 10.0308 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 16 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 3 5 2 0 0 0 0\n 6 5 1 0 0 0 0\n 5 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 14 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 10 1 0 0 0 0\n 13 12 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 14 1 0 0 0 0\n 17 16 1 0 0 0 0\nM END", "smiles": "C=CC(=O)OCc1c(c(c(c(c1Br)Br)Br)Br)Br", "formula": "C10H5Br5O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8c02ead3-04da-46b6-8913-ebcc779d7d0d" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "556.6635", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "b5053211-a4a5-462d-8d72-7d05f8ddd905", "version": "7", "structure": { "id": "d3e848c2-9c10-44cc-b939-2ffa1a5f0958", "molfile": "\n Marvin 01132110592D \n\n 17 17 0 0 0 0 999 V2000\n 6.4376 8.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4376 10.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1487 9.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7265 9.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1487 8.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7265 8.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4376 7.5251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1487 6.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1487 7.1069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4376 5.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4376 10.8674 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0196 10.0308 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8598 10.0308 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8598 5.8520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0196 8.3618 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8598 8.3618 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4376 5.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 4 6 2 0 0 0 0\n 5 1 2 0 0 0 0\n 6 1 1 0 0 0 0\n 7 1 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 7 1 0 0 0 0\n 10 8 1 0 0 0 0\n 11 2 1 0 0 0 0\n 12 4 1 0 0 0 0\n 13 3 1 0 0 0 0\n 14 8 2 0 0 0 0\n 15 6 1 0 0 0 0\n 16 5 1 0 0 0 0\n 17 10 2 0 0 0 0\n 3 2 2 0 0 0 0\nM END", "smiles": "C=CC(=O)OCc1c(c(c(c(c1Br)Br)Br)Br)Br", "formula": "C10H5Br5O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "556.6635", "optical_activity": "NONE", "references": [ "a49791e2-4911-4c20-b0b1-97d122c6339c" ], "stereo_centers": 0 }, "unii": "K55L5VE7PP" } ] }