{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e071c17d-22ad-493a-9d14-881a37a9529a",
          "code": "7691-02-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7691-02-3",
          "code_system": "CAS",
          "references": [
            "f33bc935-94d8-4604-ad3d-a5906dbf8761",
            "3fdcc1c3-6ca7-4e07-a401-ca8c28a73b84"
          ]
        },
        {
          "uuid": "d744ef54-1af9-48ef-b50c-1ff164a4b5a9",
          "code": "231-701-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.820",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f33bc935-94d8-4604-ad3d-a5906dbf8761"
          ]
        },
        {
          "uuid": "3dabf17e-47c7-4cd4-8544-e43311fb5c7a",
          "code": "82126",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82126",
          "code_system": "PUBCHEM",
          "references": [
            "f33bc935-94d8-4604-ad3d-a5906dbf8761"
          ]
        },
        {
          "uuid": "5d604bfa-a555-740a-5c81-0c88f1586661",
          "code": "DTXSID3064770",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3064770",
          "code_system": "EPA CompTox",
          "references": [
            "51e8f35c-e561-e7e4-7bf9-6ef414def4e0"
          ]
        },
        {
          "uuid": "21f75933-a508-4f32-adbd-85d333b07414",
          "code": "K53X6928T7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a0ea9442-d304-42d3-ac15-5fda352e8c30",
          "name": "1,1,3,3-TETRAMETHYL-1,3-DIVINYLDISILAZANE",
          "stdName": "1,1,3,3-TETRAMETHYL-1,3-DIVINYLDISILAZANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ac7f4af-1d7b-417e-8d97-56a22b7d3689"
          ],
          "display_name": true
        },
        {
          "uuid": "feadfd7e-2b42-47cf-91ff-21ef29f1d7c0",
          "name": "1,3-DIVINYLTETRAMETHYLDISILAZANE",
          "stdName": "1,3-DIVINYLTETRAMETHYLDISILAZANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91a0d951-98d6-4c0d-ab78-64a76edecf0b",
            "cbdcdb48-cdab-4762-9e10-95499e683891"
          ],
          "display_name": false
        },
        {
          "uuid": "529e2a6f-24c6-4e41-8f63-d90953b82e0e",
          "name": "BIS(DIMETHYL(VINYL)SILYL)AMINE",
          "stdName": "BIS(DIMETHYL(VINYL)SILYL)AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91a0d951-98d6-4c0d-ab78-64a76edecf0b",
            "cbdcdb48-cdab-4762-9e10-95499e683891"
          ],
          "display_name": false
        },
        {
          "uuid": "e919e5c2-0ac4-4757-a346-76172de2a23f",
          "name": "BIS(VINYLDIMETHYLSILYL)AMINE",
          "stdName": "BIS(VINYLDIMETHYLSILYL)AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91a0d951-98d6-4c0d-ab78-64a76edecf0b",
            "cbdcdb48-cdab-4762-9e10-95499e683891"
          ],
          "display_name": false
        },
        {
          "uuid": "8ed68d95-41d8-4097-8f70-b634f8b42b8c",
          "name": "DISILAZANE, 1,1,3,3-TETRAMETHYL-1,3-DIVINYL-",
          "stdName": "DISILAZANE, 1,1,3,3-TETRAMETHYL-1,3-DIVINYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91a0d951-98d6-4c0d-ab78-64a76edecf0b",
            "cbdcdb48-cdab-4762-9e10-95499e683891"
          ],
          "display_name": false
        },
        {
          "uuid": "2e8cef9b-0338-4348-9aa2-12931f2366bc",
          "name": "N-(DIMETHYLVINYLSILYL)-1,1-DIMETHYL-1-VINYLSILYLAMINE",
          "stdName": "N-(DIMETHYLVINYLSILYL)-1,1-DIMETHYL-1-VINYLSILYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91a0d951-98d6-4c0d-ab78-64a76edecf0b",
            "0ac7f4af-1d7b-417e-8d97-56a22b7d3689"
          ],
          "display_name": false
        },
        {
          "uuid": "b2e8331c-7a6e-4682-8b6c-f6f0d5198fc0",
          "name": "SILANAMINE, 1-ETHENYL-N-(ETHENYLDIMETHYLSILYL)-1,1-DIMETHYL-",
          "stdName": "SILANAMINE, 1-ETHENYL-N-(ETHENYLDIMETHYLSILYL)-1,1-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91a0d951-98d6-4c0d-ab78-64a76edecf0b",
            "cbdcdb48-cdab-4762-9e10-95499e683891"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0ac7f4af-1d7b-417e-8d97-56a22b7d3689",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cbdcdb48-cdab-4762-9e10-95499e683891",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "91a0d951-98d6-4c0d-ab78-64a76edecf0b",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f33bc935-94d8-4604-ad3d-a5906dbf8761",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391039000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa338a44-776d-482c-bc7d-5340b4326cf6",
          "citation": "SRS import [K53X6928T7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K53X6928T7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391039000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1aec22d5-ccbc-49b5-80b2-8d57fb8ef1f3",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac5f8282-b051-e6a5-481c-591a2c94453c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7691-02-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3fdcc1c3-6ca7-4e07-a401-ca8c28a73b84",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "51e8f35c-e561-e7e4-7bf9-6ef414def4e0",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "59bcc61f-9732-4ed3-a76d-f9deff3c4e90",
          "id": "59bcc61f-9732-4ed3-a76d-f9deff3c4e90",
          "molfile": "\n  Marvin  01132104392D          \n\n 11 10  0  0  0  0            999 V2000\n    8.4419   -4.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6294   -4.8365    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9163   -4.0609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9227   -4.4238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2050   -4.8365    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    5.9234   -4.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3916   -4.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2050   -5.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4861   -6.0687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6294   -5.6610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3372   -6.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2 10  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10 11  2  0  0  0  0\nM  END",
          "smiles": "C=C[Si](C)(C)N[Si](C)(C)C=C",
          "formula": "C8H19NSi2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d9fbb9f7-1548-4854-b68d-bb123b140a4f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "185.4142",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cca533fa-f1a4-4876-9112-ae2534310b27",
      "version": "5",
      "structure": {
        "id": "f7c7d315-139d-4721-b537-bb9227dcd042",
        "molfile": "\n  Marvin  01132112512D          \n\n 11 10  0  0  0  0            999 V2000\n    7.6294   -4.8365    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    8.4419   -4.9828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9163   -4.0609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9227   -4.4238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2050   -4.8365    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    5.9234   -4.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3916   -4.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2050   -5.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4861   -6.0687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6294   -5.6610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3372   -6.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  2  0  0  0  0\nM  END",
        "smiles": "C=C[Si](C)(C)N[Si](C)(C)C=C",
        "formula": "C8H19NSi2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "185.4142",
        "optical_activity": "NONE",
        "references": [
          "1aec22d5-ccbc-49b5-80b2-8d57fb8ef1f3",
          "fa338a44-776d-482c-bc7d-5340b4326cf6"
        ],
        "stereo_centers": 0
      },
      "unii": "K53X6928T7"
    }
  ]
}