{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b71f1137-85bb-42ed-987a-55899a6752ad",
          "code": "926281-37-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=926281-37-0",
          "code_system": "CAS",
          "references": [
            "0e144af1-4ee9-4d3b-9fd4-0aa55ffe14a4",
            "f991668d-bb44-445d-95f1-88514c559691"
          ]
        },
        {
          "uuid": "4718e393-65aa-4aef-a530-2cd0c973cef2",
          "code": "K48QWH6YGJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6770ef52-1cbe-8280-a556-039c0846f29a",
          "code": "23582776",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23582776",
          "code_system": "PUBCHEM",
          "references": [
            "67b3f669-9e92-3a67-f570-1144565c4712"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8d54b5a1-eaf9-4c84-b866-cba5c32de5af",
          "name": "3-[[(3-Amino-3-carboxypropyl)methoxyphosphinyl]oxy]benzeneacetic acid",
          "stdName": "3-(((3-AMINO-3-CARBOXYPROPYL)METHOXYPHOSPHINYL)OXY)BENZENEACETIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f991668d-bb44-445d-95f1-88514c559691"
          ],
          "display_name": false
        },
        {
          "uuid": "e715253f-011e-4d05-8816-507c69f18269",
          "name": "Benzeneacetic acid, 3-[[(3-amino-3-carboxypropyl)methoxyphosphinyl]oxy]-",
          "stdName": "BENZENEACETIC ACID, 3-(((3-AMINO-3-CARBOXYPROPYL)METHOXYPHOSPHINYL)OXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f991668d-bb44-445d-95f1-88514c559691"
          ],
          "display_name": false
        },
        {
          "uuid": "f24c1e41-4c34-46f4-b32c-5b36d51786f2",
          "name": "Collagenup",
          "stdName": "COLLAGENUP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e144af1-4ee9-4d3b-9fd4-0aa55ffe14a4"
          ],
          "display_name": false
        },
        {
          "uuid": "f683c577-e880-4cbf-aff4-80418231821b",
          "name": "GGsTop",
          "stdName": "GGSTOP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f991668d-bb44-445d-95f1-88514c559691"
          ],
          "display_name": false
        },
        {
          "uuid": "08e8cf64-c3da-495c-b662-e37ed55bf65a",
          "name": "Kyocollagen",
          "stdName": "KYOCOLLAGEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e144af1-4ee9-4d3b-9fd4-0aa55ffe14a4"
          ],
          "display_name": false
        },
        {
          "uuid": "44cfb92e-5d2d-42c1-8e85-a9fedcece28e",
          "name": "Methyl Carboxymethylphenyl Aminocarboxypropylphosphonate",
          "stdName": "METHYL CARBOXYMETHYLPHENYL AMINOCARBOXYPROPYLPHOSPHONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e144af1-4ee9-4d3b-9fd4-0aa55ffe14a4"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "85dd2970-0a9e-47e6-b8e1-f25ed5411106",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6ccf9cbe-6b2e-4916-a5bf-c9c955922b37",
          "name": "Nahlsgen",
          "stdName": "NAHLSGEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f991668d-bb44-445d-95f1-88514c559691"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0e144af1-4ee9-4d3b-9fd4-0aa55ffe14a4",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f991668d-bb44-445d-95f1-88514c559691",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "67b3f669-9e92-3a67-f570-1144565c4712",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ee7fc9c2-e5dc-4086-85c2-ad5625c45610",
          "id": "ee7fc9c2-e5dc-4086-85c2-ad5625c45610",
          "molfile": "3-[[(3-Amino-3-carboxypropyl)methoxyphosphinyl]oxy]benzeneacetic acid\n  CDK     02082416592D\n926281-37-0 Copyright (C) 2024 ACS\n 22 22  0  0  0  0  0  0  0  0999 V2000\n    4.0011    6.9300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0011    8.4700    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0011   10.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4611    8.4700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5411    8.4700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6674   10.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6911    7.1364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6674   12.3200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3336   13.0900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0011   13.0900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   12.3200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3336   14.6300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6684    2.3100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0021    1.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3358    2.3100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0021    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3347    6.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3347    4.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6684    6.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6684    3.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0021    6.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0021    4.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 17  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 20  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 20 22  2  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "COP(=O)(CCC(C(=O)O)N)Oc1cccc(c1)CC(=O)O",
          "formula": "C13H18NO7P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d4666df8-62be-4bca-8db9-02ec7440ce91"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "331.2588",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "83755aff-5281-4978-89ac-95460ff5d791",
      "version": "4",
      "structure": {
        "id": "c4f9a7ae-938d-4220-b021-71e9670045ef",
        "molfile": "3-[[(3-Amino-3-carboxypropyl)methoxyphosphinyl]oxy]benzeneacetic acid\n   JSDraw202082416592D\n\n 22 22  0  0  0  0              0 V2000\n   28.6586   -9.3599    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6586   -7.7999    0.0000 P   0  0  0  0  0  0  5  0  0  0  0  0\n   28.6586   -6.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.0986   -7.7999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.2186   -7.7999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3076   -5.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.3186   -9.1508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.3076   -3.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9565   -3.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6586   -3.1200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6056   -3.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9565   -1.5600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   31.3605  -14.0399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.7115  -14.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   34.0625  -14.0399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   32.7115  -16.3798    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.0095  -10.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.0095  -11.6999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.3605   -9.3599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.3605  -12.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.7115  -10.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.7115  -11.6999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 17  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  2  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 20  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 20 22  2  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
        "smiles": "COP(=O)(CCC(C(=O)O)N)Oc1cccc(c1)CC(=O)O",
        "formula": "C13H18NO7P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "331.2588",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f991668d-bb44-445d-95f1-88514c559691"
        ],
        "stereo_centers": 2
      },
      "unii": "K48QWH6YGJ"
    }
  ]
}