{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b6a5615c-1404-4772-a98b-d302eccdd2ac", "code": "K3UHJ2QZ7F", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8c7bca34-db09-383e-4120-45d2ff8a290c", "code": "62106", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62106", "code_system": "PUBCHEM", "references": [ "69482017-6162-5c7b-b44d-15fac21f0d7f" ] }, { "uuid": "6fb34d57-0ac8-e2b9-8886-55404eab8f47", "code": "55764-31-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=55764-31-3", "code_system": "CAS", "references": [ "38e04c1d-7f7b-4fec-8451-fef4b29e40f5" ] }, { "uuid": "9c6d4f4b-ae43-4efe-09db-660a9d94cf85", "code": "DTXSID60971141", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60971141", "code_system": "EPA CompTox", "references": [ "53ad5997-a94e-4a68-051a-79c2b417d963" ] } ], "substance_class": "chemical", "names": [ { "uuid": "1c629c2c-c562-4b75-8fdc-8e539347c72c", "name": "2-Furancarbothioic acid, S-(2,5-dimethyl-3-furanyl) ester", "stdName": "2-FURANCARBOTHIOIC ACID, S-(2,5-DIMETHYL-3-FURANYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "38e04c1d-7f7b-4fec-8451-fef4b29e40f5" ], "display_name": false }, { "uuid": "176b5cc5-1dd0-4640-b5f0-7f70bf0dbc27", "name": "S-(2,5-Dimethyl-3-furanyl) 2-furancarbothioate", "stdName": "S-(2,5-DIMETHYL-3-FURANYL) 2-FURANCARBOTHIOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "38e04c1d-7f7b-4fec-8451-fef4b29e40f5" ], "display_name": true }, { "uuid": "e1f8d1f7-fef9-cc26-4386-81b65b9fe366", "name": "S-(2,5-dimethylfuran-3-yl) furan-2-carbothioate", "stdName": "S-(2,5-DIMETHYLFURAN-3-YL) FURAN-2-CARBOTHIOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ea530c45-141a-cc3a-aa42-3d9134880b0a" ], "display_name": false } ], "references": [ { "uuid": "ea530c45-141a-cc3a-aa42-3d9134880b0a", "citation": "ZINC", "url": "http://zinc.docking.org/substances/subsets/in-vivo/", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "38e04c1d-7f7b-4fec-8451-fef4b29e40f5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "69482017-6162-5c7b-b44d-15fac21f0d7f", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "53ad5997-a94e-4a68-051a-79c2b417d963", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d2fb2e65-b68d-4c59-9c56-fca9e3fdc14d", "id": "d2fb2e65-b68d-4c59-9c56-fca9e3fdc14d", "molfile": "\n Marvin 01132110542D \n\n 15 16 0 0 0 0 999 V2000\n 1.5268 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7018 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2169 0.6674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5678 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2352 0.8974 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1490 1.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3953 2.0535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8164 2.2028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6010 1.9479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0859 2.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6010 3.2828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8164 3.0278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5678 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2352 -0.8974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2169 -0.6674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 15 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 13 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 12 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\nM END", "smiles": "Cc1cc(c(C)o1)SC(=O)c2ccco2", "formula": "C11H10O3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "34ddba15-c2e9-43df-845e-ac87018e2a7a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "222.2618", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "47471952-e58e-4410-837d-b622bbdd97d0", "version": "6", "structure": { "id": "56d48304-0a23-4766-af55-a2ab82043325", "molfile": "\n JSDraw208302415032D\n\n 15 16 0 0 0 0 0 V2000\n 27.6980 -5.5451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5413 -6.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0231 -6.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2431 -7.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2829 -8.7715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9547 -10.2966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7137 -8.1445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6917 -7.7825 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7741 -6.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4080 -5.0954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2227 -6.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4395 -8.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9131 -7.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7500 -6.1628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1702 -5.5271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 2 7 1 0 0 0 0\n 4 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 11 15 1 0 0 0 0\nM END", "smiles": "Cc1cc(c(C)o1)SC(=O)c2ccco2", "formula": "C11H10O3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "222.2618", "optical_activity": "NONE", "references": [ "ea530c45-141a-cc3a-aa42-3d9134880b0a", "38e04c1d-7f7b-4fec-8451-fef4b29e40f5" ], "stereo_centers": 0 }, "unii": "K3UHJ2QZ7F" } ] }