{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7e86be5f-d243-4c36-a9f8-21a317ac7f27",
          "code": "11013-97-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=11013-97-1",
          "code_system": "CAS",
          "references": [
            "dbe30542-6623-499a-a826-8d1e7c625c2c",
            "0a5537ff-4961-4041-bea0-7eb569528a72"
          ]
        },
        {
          "uuid": "34ff608a-5980-4026-a55f-8a1a6dace907",
          "code": "C052037",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67052037",
          "code_system": "MESH",
          "references": [
            "dbe30542-6623-499a-a826-8d1e7c625c2c"
          ]
        },
        {
          "uuid": "c17885da-d3e9-4ebd-b95d-2b3baae7114b",
          "code": "SUB180597",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "dbe30542-6623-499a-a826-8d1e7c625c2c"
          ]
        },
        {
          "uuid": "0afc5a17-98dd-4d36-8b7d-d51ed9a4a642",
          "code": "5284419",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5284419",
          "code_system": "PUBCHEM",
          "references": [
            "dbe30542-6623-499a-a826-8d1e7c625c2c"
          ]
        },
        {
          "uuid": "bd37ecf9-91aa-7482-7975-4d802c4a0967",
          "code": "DTXSID7020841",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7020841",
          "code_system": "EPA CompTox",
          "references": [
            "3af80f52-d652-3d07-7a7b-899ba4951985"
          ]
        },
        {
          "uuid": "74306657-c72a-4a2c-93bb-7ca97fefa8af",
          "code": "K324U7386B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "679204e5-2aaa-78aa-e566-cbb19905310b",
          "code": "100000166450",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e840f6c2-4678-8d44-78e2-6496949f33c6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "758a9e30-17e4-4bb4-8b55-294b3c1a8ce2",
          "name": "4H-1-BENZOPYRAN-4-ONE, 7-((6-O-(6DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-2,3-DIHYDRO-5-HYDROXY-2-(3,4-DIMETHOXYPHENYL)-, (2S)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 7-((6-O-(6DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-2,3-DIHYDRO-5-HYDROXY-2-(3,4-DIMETHOXYPHENYL)-, (2S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a92f93e-7e9c-41de-b5ed-b3f37da69e3f",
            "73310723-e584-46a6-9f50-3f4ccfa0b2e9"
          ],
          "display_name": false
        },
        {
          "uuid": "b83f83ea-6e20-4bc7-a3ef-7e46ba20c94f",
          "name": "4H-1-BENZOPYRAN-4-ONE, 7-((6-O-(6DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-2,3-DIHYDRO-5-HYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-, MONOMETHYL ETHER, (2S)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 7-((6-O-(6DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-2,3-DIHYDRO-5-HYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-, MONOMETHYL ETHER, (2S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73310723-e584-46a6-9f50-3f4ccfa0b2e9",
            "1390faa5-b092-40cc-b5a6-4bbee4ae5a68"
          ],
          "display_name": false
        },
        {
          "uuid": "479c7db3-0b05-4d5c-ba4d-4fadadd4a389",
          "name": "METHYL HESPERIDIN",
          "stdName": "METHYL HESPERIDIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2814280d-2730-47dd-b4df-af5b917f7547",
            "9399a08b-3796-4056-9cb3-c9bd275e8069",
            "73310723-e584-46a6-9f50-3f4ccfa0b2e9",
            "1390faa5-b092-40cc-b5a6-4bbee4ae5a68",
            "0bc5164b-133e-4a49-8399-d12d1447fc2c"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ade6b5e0-6940-4a21-8d4e-c5ba0f7582af",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d731b41f-9fd9-42b6-8e16-ab2a6ba9861e",
          "name": "METHYLHESPERIDIN",
          "stdName": "METHYLHESPERIDIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f152fa24-7c0e-4b9a-9091-b2e6c76e4699",
            "73310723-e584-46a6-9f50-3f4ccfa0b2e9"
          ],
          "display_name": false
        },
        {
          "uuid": "a97851ec-a248-744b-8565-47cc5e173973",
          "name": "Methyl hesperidin [WHO-DD]",
          "stdName": "METHYL HESPERIDIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "df4c284e-d9f6-3045-c551-ba3c9d073114"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3a92f93e-7e9c-41de-b5ed-b3f37da69e3f",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2814280d-2730-47dd-b4df-af5b917f7547",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f152fa24-7c0e-4b9a-9091-b2e6c76e4699",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbe30542-6623-499a-a826-8d1e7c625c2c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391043000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c7b94f0-b062-4e13-a203-90ca1000e64d",
          "citation": "SRS import [K324U7386B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K324U7386B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391043000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a36c7d8-b3c5-418b-bf29-f5936316d4ae",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9399a08b-3796-4056-9cb3-c9bd275e8069",
          "citation": "METHYL HESPERIDIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0bc5164b-133e-4a49-8399-d12d1447fc2c",
          "citation": "METHYL HESPERIDIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1390faa5-b092-40cc-b5a6-4bbee4ae5a68",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "73310723-e584-46a6-9f50-3f4ccfa0b2e9",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3af80f52-d652-3d07-7a7b-899ba4951985",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=11013-97-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0a5537ff-4961-4041-bea0-7eb569528a72",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "df4c284e-d9f6-3045-c551-ba3c9d073114",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e840f6c2-4678-8d44-78e2-6496949f33c6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e873a747-a786-42c8-9a89-69c6d067aae9",
          "id": "e873a747-a786-42c8-9a89-69c6d067aae9",
          "molfile": "\n  Marvin  01132112022D          \n\n 44 48  0  0  1  0            999 V2000\n    8.2041  -25.3332    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.2041  -24.5107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9194  -25.7444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9194  -26.5668    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.6301  -26.9781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3454  -26.5668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0560  -26.9781    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.7713  -26.5668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4820  -26.9781    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   13.1973  -26.5668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1973  -25.7444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4820  -25.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4820  -24.5107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7713  -24.0995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1973  -24.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1973  -23.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4820  -22.8612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9080  -22.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6231  -23.2724    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   14.6231  -24.0995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9080  -24.5107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9080  -25.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3338  -22.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0492  -23.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7645  -22.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7645  -22.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4706  -21.6276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4706  -20.8012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0492  -21.6276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0492  -20.6118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7645  -20.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3338  -22.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4820  -27.8051    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.1973  -28.2164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7713  -28.2164    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   11.7713  -29.0388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0560  -27.8051    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   10.3454  -28.2164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2041  -26.9781    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.2041  -27.8051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4888  -26.5668    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.7782  -26.9781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4888  -25.7444    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.7782  -25.3332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n 43  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n 39  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n 37  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 33  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 22 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 21  2  0  0  0  0\n 16 17  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  1  0  0  0\n 19 23  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 32  2  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 29 26  2  0  0  0  0\n 27 28  1  0  0  0  0\n 29 30  1  0  0  0  0\n 32 29  1  0  0  0  0\n 30 31  1  0  0  0  0\n 33 34  1  6  0  0  0\n 35 33  1  0  0  0  0\n 35 36  1  1  0  0  0\n 37 35  1  0  0  0  0\n 37 38  1  6  0  0  0\n 39 40  1  6  0  0  0\n 39 41  1  0  0  0  0\n 41 42  1  6  0  0  0\n 41 43  1  0  0  0  0\n 43 44  1  1  0  0  0\nM  END",
          "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](Oc3cc(c4C(=O)C[C@@H](c5ccc(c(c5)OC)OC)Oc4c3)O)O2)O)O)O)O1)O)O)O",
          "formula": "C29H36O15",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "11a6370e-cf30-43a6-a632-8c225f2b21cb"
          },
          "defined_stereo": 11,
          "ez_centers": 0,
          "molecular_weight": "624.5883",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 11
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "010c738c-119e-45e0-8ddb-7e6d71b05117",
      "version": "9",
      "structure": {
        "id": "698db0d3-07c1-4d37-a50c-267019995194",
        "molfile": "\n  Marvin  01132105292D          \n\n 44 48  0  0  1  0            999 V2000\n   14.6231  -23.2724    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.4820  -26.9781    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.4820  -27.8051    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.7713  -28.2164    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.0560  -27.8051    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.0560  -26.9781    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.9194  -26.5668    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2041  -26.9781    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.4888  -26.5668    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.4888  -25.7444    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2041  -25.3332    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.9080  -22.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1973  -23.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1973  -24.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9080  -24.5107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6231  -24.0995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9080  -25.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1973  -25.7444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4820  -25.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4820  -24.5107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7713  -24.0995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1973  -26.5668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1973  -28.2164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7713  -29.0388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3454  -28.2164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7713  -26.5668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3454  -26.5668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6301  -26.9781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2041  -27.8051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7782  -26.9781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7782  -25.3332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9194  -25.7444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2041  -24.5107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4820  -22.8612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3338  -22.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3338  -22.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0492  -21.6276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7645  -22.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7645  -22.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0492  -23.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4706  -21.6276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4706  -20.8012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0492  -20.6118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7645  -20.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  1 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 14 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 18 22  1  0  0  0  0\n  2 22  1  1  0  0  0\n  3 23  1  6  0  0  0\n  4 24  1  1  0  0  0\n  5 25  1  6  0  0  0\n  6 26  1  0  0  0  0\n  2 26  1  0  0  0  0\n  6 27  1  1  0  0  0\n 27 28  1  0  0  0  0\n  7 28  1  1  0  0  0\n  8 29  1  6  0  0  0\n  9 30  1  6  0  0  0\n 10 31  1  1  0  0  0\n 11 32  1  0  0  0  0\n  7 32  1  0  0  0  0\n 11 33  1  6  0  0  0\n 13 34  2  0  0  0  0\n  1 35  1  1  0  0  0\n 35 36  1  0  0  0  0\n 36 37  2  0  0  0  0\n 37 38  1  0  0  0  0\n 38 39  2  0  0  0  0\n 39 40  1  0  0  0  0\n 35 40  2  0  0  0  0\n 38 41  1  0  0  0  0\n 41 42  1  0  0  0  0\n 37 43  1  0  0  0  0\n 43 44  1  0  0  0  0\nM  END",
        "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](Oc3cc(c4C(=O)C[C@@H](c5ccc(c(c5)OC)OC)Oc4c3)O)O2)O)O)O)O1)O)O)O",
        "formula": "C29H36O15",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 11,
        "ez_centers": 0,
        "molecular_weight": "624.5883",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "5a36c7d8-b3c5-418b-bf29-f5936316d4ae",
          "3c7b94f0-b062-4e13-a203-90ca1000e64d"
        ],
        "stereo_centers": 11
      },
      "unii": "K324U7386B"
    }
  ]
}