{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "431c9bcb-c3ee-4e42-a9e6-689068dc84dd",
          "code": "1742-14-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1742-14-9",
          "code_system": "CAS",
          "references": [
            "597847d1-454b-430d-af4a-0aa45663479e",
            "1d15bba6-6ed7-443f-8d29-406d491dbb0b"
          ]
        },
        {
          "uuid": "466fb55f-05aa-4b2c-bdd2-92f0e04b1be8",
          "code": "217-108-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.553",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "597847d1-454b-430d-af4a-0aa45663479e"
          ]
        },
        {
          "uuid": "7a20ca73-efb9-4c38-97ef-5fdb10819afb",
          "code": "74448",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/74448",
          "code_system": "PUBCHEM",
          "references": [
            "597847d1-454b-430d-af4a-0aa45663479e"
          ]
        },
        {
          "uuid": "744c002f-e293-4db8-83f7-cfd7d7b26ff0",
          "code": "DTXSID9029223",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9029223",
          "code_system": "EPA CompTox",
          "references": [
            "40b260a9-8e6e-14a8-ee27-cfef4e450e61"
          ]
        },
        {
          "uuid": "f6cffe37-ac9f-42c5-b5ea-a9bc21626a97",
          "code": "K2ND496F5P",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "dcf29046-1335-45af-babf-46d2572ec931",
          "name": ".ALPHA.-(3,4-DIMETHYLPHENYL)-.ALPHA.-METHYL-3,4-DIMETHYLTOLUENE",
          "stdName": ".ALPHA.-(3,4-DIMETHYLPHENYL)-.ALPHA.-METHYL-3,4-DIMETHYLTOLUENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f09cc51f-f8c1-49f3-908e-9447316643f1"
          ],
          "display_name": false
        },
        {
          "uuid": "1d1aa855-d9d0-4b12-be37-02d50686d9bf",
          "name": "1,1'-(1,1-ETHANEDIYL)BIS(3,4-DIMETHYLBENZENE)",
          "stdName": "1,1'-(1,1-ETHANEDIYL)BIS(3,4-DIMETHYLBENZENE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f09cc51f-f8c1-49f3-908e-9447316643f1"
          ],
          "display_name": false
        },
        {
          "uuid": "e74c94cb-d9c0-4489-b3c3-84aedf208e80",
          "name": "1,1'-ETHYLIDENEBIS(3,4-DIMETHYLBENZENE)",
          "stdName": "1,1'-ETHYLIDENEBIS(3,4-DIMETHYLBENZENE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24b2fcbe-7ba7-476d-98b8-4da1a131215e"
          ],
          "display_name": false
        },
        {
          "uuid": "2198fe83-783a-4082-bbe0-040f402e63f0",
          "name": "1,1-BIS(3,4-DIMETHYLPHENYL)ETHANE",
          "stdName": "1,1-BIS(3,4-DIMETHYLPHENYL)ETHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc2f512b-fa88-4f2b-baff-701070d32c4e"
          ],
          "display_name": true
        },
        {
          "uuid": "3b4fe015-e027-4ef2-a84d-c3c0cf1d1818",
          "name": "1,1-DI-3,4-XYLYLETHANE",
          "stdName": "1,1-DI-3,4-XYLYLETHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e841d6e1-7bfd-41ae-b334-92a2b882d0e2"
          ],
          "display_name": false
        },
        {
          "uuid": "1deac958-9f3f-4c12-a416-0c2f7a64981d",
          "name": "4,4'-(ETHANE-1,1-DIYL)BIS(1,2-DIMETHYLBENZENE)",
          "stdName": "4,4'-(ETHANE-1,1-DIYL)BIS(1,2-DIMETHYLBENZENE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe5fbb9b-7f3b-420a-a6ea-c45698fd2071"
          ],
          "display_name": false
        },
        {
          "uuid": "4543696e-f769-4ff5-99c3-2835cfe551d5",
          "name": "4-(1-(3,4-DIMETHYLPHENYL)ETHYL)-1,2-DIMETHYLBENZENE",
          "stdName": "4-(1-(3,4-DIMETHYLPHENYL)ETHYL)-1,2-DIMETHYLBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe5fbb9b-7f3b-420a-a6ea-c45698fd2071"
          ],
          "display_name": false
        },
        {
          "uuid": "0a6de558-1e8f-4a1a-b942-fc631aa56645",
          "name": "BENZENE, 1,1'-ETHYLIDENEBIS(3,4-DIMETHYL-",
          "stdName": "BENZENE, 1,1'-ETHYLIDENEBIS(3,4-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e841d6e1-7bfd-41ae-b334-92a2b882d0e2"
          ],
          "display_name": false
        },
        {
          "uuid": "a96b670f-5046-468a-a017-1c22b6529771",
          "name": "ETHANE, 1,1-DI-3,4-XYLYL-",
          "stdName": "ETHANE, 1,1-DI-3,4-XYLYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e841d6e1-7bfd-41ae-b334-92a2b882d0e2"
          ],
          "display_name": false
        },
        {
          "uuid": "bc43df20-4546-4114-93e2-91bb7faca741",
          "name": "J99.764A",
          "stdName": "J99.764A",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24b2fcbe-7ba7-476d-98b8-4da1a131215e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bc2f512b-fa88-4f2b-baff-701070d32c4e",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e841d6e1-7bfd-41ae-b334-92a2b882d0e2",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24b2fcbe-7ba7-476d-98b8-4da1a131215e",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J99.764A",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J99.764A",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f09cc51f-f8c1-49f3-908e-9447316643f1",
          "citation": "http://www.chemspider.com/Chemical-Structure.67039.html?rid=e3fe2e78-adc1-46c2-8660-db7785239d91",
          "url": "http://www.chemspider.com/Chemical-Structure.67039.html?rid=e3fe2e78-adc1-46c2-8660-db7785239d91",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe5fbb9b-7f3b-420a-a6ea-c45698fd2071",
          "citation": "http://pubchem.ncbi.nlm.nih.gov/compound/74448#section=Top",
          "url": "http://pubchem.ncbi.nlm.nih.gov/compound/74448#section=Top",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "597847d1-454b-430d-af4a-0aa45663479e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392095000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e83d0908-e202-4edc-89cb-c4ba87b5e85b",
          "citation": "SRS import [K2ND496F5P]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K2ND496F5P",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392095000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40b260a9-8e6e-14a8-ee27-cfef4e450e61",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1742-14-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1d15bba6-6ed7-443f-8d29-406d491dbb0b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "069648ff-9a20-4d29-8e2c-4fc22d86a9b5",
          "id": "069648ff-9a20-4d29-8e2c-4fc22d86a9b5",
          "molfile": "\n  Marvin  01132100382D          \n\n 18 19  0  0  0  0            999 V2000\n    2.8645    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8645   -0.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5806   -1.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2967   -0.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0129   -1.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0129   -2.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7290   -2.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2967   -2.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2967   -3.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5806   -2.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1483   -1.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1483   -2.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4323   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7161   -2.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7161   -1.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4323   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 11  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 10  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 18  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1C)C(C)c2ccc(C)c(C)c2",
          "formula": "C18H22",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ffa21fae-bcf9-46fd-96df-19f40b8fabb0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "238.3679",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7ef7b278-9891-447f-8eab-951701a0eaa5",
      "version": "3",
      "structure": {
        "id": "df8e9707-bdd4-419d-a7d4-263992e0d100",
        "molfile": "\n  Marvin  01132111352D          \n\n 18 19  0  0  0  0            999 V2000\n    3.5806   -1.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2967   -0.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0129   -1.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0129   -2.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2967   -2.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5806   -2.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2967   -3.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7290   -2.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1483   -1.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1483   -2.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4323   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7161   -2.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7161   -1.2432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4323   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8645   -0.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8645    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  6  1  0  0  0  0\n  1 17  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 14  1  0  0  0  0\n  9 17  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 16  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1C)C(C)c2ccc(C)c(C)c2",
        "formula": "C18H22",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "238.3679",
        "optical_activity": "NONE",
        "references": [
          "bc2f512b-fa88-4f2b-baff-701070d32c4e",
          "e83d0908-e202-4edc-89cb-c4ba87b5e85b"
        ],
        "stereo_centers": 0
      },
      "unii": "K2ND496F5P"
    }
  ]
}