{
"meta": {
"disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
"terms": "https://open.fda.gov/terms/",
"license": "https://open.fda.gov/license/",
"last_updated": "2025-09-19",
"results": {
"skip": 0,
"limit": 1,
"total": 1
}
},
"results": [
{
"codes": [
{
"uuid": "19d41abb-a76a-4806-bf06-449a7776885b",
"code": "132-69-4",
"type": "PRIMARY",
"url": "https://commonchemistry.cas.org/detail?cas_rn=132-69-4",
"code_system": "CAS",
"references": [
"0976b6cf-d7ae-41ad-b053-b87209b1adda",
"39e7486b-0403-41ac-9310-74538986c725"
]
},
{
"uuid": "0addad59-d9e9-41b3-9c35-bd5648f2ecbc",
"code": "C1581",
"type": "PRIMARY",
"url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1581",
"code_system": "NCI_THESAURUS",
"references": [
"0976b6cf-d7ae-41ad-b053-b87209b1adda"
]
},
{
"uuid": "8a5e8abb-be59-43a9-aaa4-8a32dc2ededd",
"code": "205-076-0",
"type": "PRIMARY",
"url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.616",
"code_system": "ECHA (EC/EINECS)",
"references": [
"0976b6cf-d7ae-41ad-b053-b87209b1adda"
]
},
{
"uuid": "3cb2ea90-58c1-4478-bdda-8f6a2c62cd86",
"code": "81963",
"comments": "RxNorm",
"type": "PRIMARY",
"url": "https://rxnav.nlm.nih.gov/REST/rxcui/81963/allProperties.xml?prop=all",
"code_system": "RXCUI",
"references": [
"0976b6cf-d7ae-41ad-b053-b87209b1adda"
]
},
{
"uuid": "2ed3ce68-777c-43a2-9ded-d38a80451d3d",
"code": "m2395",
"comments": "Merck Index",
"type": "PRIMARY",
"url": "https://merckindex.rsc.org/monographs/m2395?q=authorize",
"code_system": "MERCK INDEX",
"references": [
"0976b6cf-d7ae-41ad-b053-b87209b1adda"
]
},
{
"uuid": "9ff5fa5a-8db1-40d9-9f53-50c846b340c8",
"code": "SUB00737MIG",
"type": "PRIMARY",
"code_system": "EVMPD",
"references": [
"0976b6cf-d7ae-41ad-b053-b87209b1adda"
]
},
{
"uuid": "6997e0d2-c06b-4883-b9db-7706c8b2e45d",
"code": "CHEMBL12610",
"type": "PRIMARY",
"url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL12610",
"code_system": "ChEMBL",
"references": [
"0976b6cf-d7ae-41ad-b053-b87209b1adda"
]
},
{
"uuid": "94df890a-95a9-6f4e-3e2e-3a915bdfdb8d",
"code": "DTXSID1045293",
"type": "PRIMARY",
"url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1045293",
"code_system": "EPA CompTox",
"references": [
"5efc2a81-1a0e-115f-06a6-ba243eb92c61"
]
},
{
"uuid": "67e28831-fdd5-92fb-32e4-4ed38a17ac15",
"code": "111898",
"comments": "ORPHAN DRUG|Designated|Prophylactic treatment of oral mucositis resulting from radiation therapy for head and neck cancer.",
"type": "PRIMARY",
"url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=111898",
"code_system": "FDA ORPHAN DRUG"
},
{
"uuid": "67feb8a8-c1f0-eba0-c53e-fcc31f015314",
"code": "C257",
"comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug",
"type": "CONCEPT",
"url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257",
"code_system": "NCI_THESAURUS",
"references": [
"4c46e8b7-cd3d-16ad-cd6f-b7a997e2fd05"
]
},
{
"uuid": "fae42b76-9154-6358-417e-a2fb730e6f45",
"code": "65464",
"type": "PRIMARY",
"url": "https://pubchem.ncbi.nlm.nih.gov/compound/65464",
"code_system": "PUBCHEM",
"references": [
"2ff435fa-d3c5-98c2-1927-4e07a6612821"
]
},
{
"uuid": "e33f32f6-6118-76ec-06f3-46705a9492b9",
"code": "DBSALT001124",
"type": "PRIMARY",
"url": "http://www.drugbank.ca/drugs/DBSALT001124",
"code_system": "DRUG BANK",
"references": [
"4c46e8b7-cd3d-16ad-cd6f-b7a997e2fd05"
]
},
{
"uuid": "ccc0c3c5-4595-4e15-b71d-1abbe38a5692",
"code": "K2GI407R4Q",
"type": "PRIMARY",
"code_system": "FDA UNII"
},
{
"uuid": "cca967b9-cbfa-d03a-2389-58502a4be995",
"code": "100000091695",
"type": "PRIMARY",
"code_system": "SMS_ID",
"references": [
"0444cce7-0676-65db-3ca9-501366d75b11"
]
},
{
"uuid": "7ed089bf-eb3c-89cb-8588-696bdf9d4027",
"code": "759276",
"type": "PRIMARY",
"url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759276",
"code_system": "NSC",
"references": [
"551d6569-e77b-b6ad-7c47-84119c477c0b"
]
}
],
"relationships": [
{
"uuid": "d3aa0e00-c625-4479-b6a3-69a81482bee6",
"type": "ACTIVE MOIETY",
"related_substance": {
"uuid": "fc330fee-f99d-4cf8-b7f3-4d170d07eab3",
"refuuid": "87eacf31-db16-4cb5-a7e3-71af49fc5d6a",
"name": "BENZYDAMINE",
"unii": "4O21U048EF",
"linking_id": "4O21U048EF",
"ref_pname": "BENZYDAMINE",
"substance_class": "reference"
}
},
{
"uuid": "03cd25c3-44cc-4d24-8c1f-d1e0a8e659a7",
"type": "PARENT->SALT/SOLVATE",
"related_substance": {
"uuid": "fe19187a-ce33-4199-bc6f-0c73440201a0",
"refuuid": "87eacf31-db16-4cb5-a7e3-71af49fc5d6a",
"name": "BENZYDAMINE",
"unii": "4O21U048EF",
"linking_id": "4O21U048EF",
"ref_pname": "BENZYDAMINE",
"substance_class": "reference"
}
},
{
"uuid": "5cdedd43-c2ca-449b-b9d6-b775fc1760cf",
"amount": {
"uuid": "5dbdfceb-bb72-44f9-9a5e-693078d306ca"
},
"type": "IMPURITY->PARENT",
"references": [
"3871cfd1-2ed3-4260-8442-e9cd018e0b32"
],
"related_substance": {
"uuid": "e8e62bda-a4c0-4bb9-8f76-2d72094c2067",
"refuuid": "7d995716-69a0-4571-8799-05282684f597",
"name": "3-Dimethylaminopropyl-2-benzylaminobenzoate",
"unii": "KR9SQ56TGM",
"linking_id": "KR9SQ56TGM",
"ref_pname": "3-Dimethylaminopropyl-2-benzylaminobenzoate",
"substance_class": "reference"
}
},
{
"uuid": "ccd83fb5-4bbb-469a-8df1-774e9e504f22",
"amount": {
"uuid": "bf4c7da2-5216-4a70-8e0b-3b046ab232ca"
},
"type": "IMPURITY->PARENT",
"references": [
"8a2ab739-568f-4681-8782-583a3a9a5564"
],
"related_substance": {
"uuid": "b1bece38-923a-416a-a888-1fc858352d0f",
"refuuid": "2c841ad7-b829-4b6a-8863-8d7b18b944ae",
"name": "3-(DIMETHYLAMINO)PROPYL CHLORIDE",
"unii": "G41F3T7H6Q",
"linking_id": "G41F3T7H6Q",
"ref_pname": "3-(DIMETHYLAMINO)PROPYL CHLORIDE",
"substance_class": "reference"
}
},
{
"uuid": "a2f27b1a-833c-43d8-8c69-4350783731dd",
"amount": {
"uuid": "2365da74-7c40-4134-ac64-07f1b406b2dd"
},
"type": "IMPURITY->PARENT",
"references": [
"c98db8ea-969c-46d3-bf53-c1a1f51c35c2"
],
"related_substance": {
"uuid": "0f678eb4-8370-4152-842f-336b5fbb9887",
"refuuid": "7bad1f1c-5ad8-429b-a64f-e952c486403c",
"name": "1-Benzyl-1H-indazol-3-ol",
"unii": "YL5ZXN63Q6",
"linking_id": "YL5ZXN63Q6",
"ref_pname": "1-Benzyl-1H-indazol-3-ol",
"substance_class": "reference"
}
},
{
"uuid": "97b8a74c-fb8f-4419-b9a3-e035fb472f2b",
"amount": {
"uuid": "05994e2d-2ab4-4218-8039-b61acabc70d8"
},
"type": "IMPURITY->PARENT",
"references": [
"c3d3db12-0d5b-4ae8-a762-eacbe32fbe48"
],
"related_substance": {
"uuid": "17da50c5-7cf1-4b01-8c90-8402b798006e",
"refuuid": "e9db7c29-d389-44d4-923b-3f5ee3c74bbb",
"name": "1-benzyl-2-[3-(dimethylamino)propyl]-1,2-dihydro-3H-indazol-3-one",
"unii": "CUJ3PM9MWU",
"linking_id": "CUJ3PM9MWU",
"ref_pname": "1-benzyl-2-[3-(dimethylamino)propyl]-1,2-dihydro-3H-indazol-3-one",
"substance_class": "reference"
}
},
{
"uuid": "6284c722-9fdc-40dc-be59-5000deede2c3",
"amount": {
"uuid": "9edef9b9-5ab6-4da1-8699-7ef04dc3a2b4"
},
"type": "IMPURITY->PARENT",
"references": [
"83579b26-fd92-4226-b85c-6eabfcc8114e"
],
"related_substance": {
"uuid": "691908ae-cfb5-441a-a511-32096d9ec6aa",
"refuuid": "07634464-a2dd-4fb2-a9a2-e51d171a2d45",
"name": "N1,N1,N3-Trimethyl-N3-[3-[[1-(phenylmethyl)-1H-indazol-3-yl]oxy]propyl]-1,3-propanediamine",
"unii": "785DCP7QRM",
"linking_id": "785DCP7QRM",
"ref_pname": "N1,N1,N3-Trimethyl-N3-[3-[[1-(phenylmethyl)-1H-indazol-3-yl]oxy]propyl]-1,3-propanediamine",
"substance_class": "reference"
}
},
{
"uuid": "7f046a82-d0e7-4420-babe-4ffd8622bdf6",
"amount": {
"uuid": "c880a513-5f19-442e-bd0f-070ea204ea26"
},
"type": "IMPURITY->PARENT",
"references": [
"ccd9750c-3ff1-4012-ad7c-843d8a95326c"
],
"related_substance": {
"uuid": "13f4246c-e3fb-41b5-b122-1ac492519f94",
"refuuid": "a4770133-e1bc-45cd-91c0-f6b2fb5da12c",
"name": "3-[[1,5-Bis(phenylmethyl)-1H-indazol-3-yl]oxy]-N,N-dimethyl-1-propanamine",
"unii": "V558MA99D4",
"linking_id": "V558MA99D4",
"ref_pname": "3-[[1,5-Bis(phenylmethyl)-1H-indazol-3-yl]oxy]-N,N-dimethyl-1-propanamine",
"substance_class": "reference"
}
},
{
"uuid": "7168f459-46db-4f63-a681-55a68f86436f",
"amount": {
"uuid": "67d3275e-9eb2-44b5-8ff9-64ed0584ccc8"
},
"type": "IMPURITY->PARENT",
"references": [
"657d67ae-d5b4-4c9a-8517-471fe6e255aa"
],
"related_substance": {
"uuid": "e7533098-473b-4ea1-afd2-f31d63e80fd6",
"refuuid": "bcbf86d6-c2aa-464b-b674-c0a17ea04c37",
"name": "3-(Dimethylamino)propyl 2-aminobenzoate",
"unii": "ZMN5WEK9AQ",
"linking_id": "ZMN5WEK9AQ",
"ref_pname": "3-(Dimethylamino)propyl 2-aminobenzoate",
"substance_class": "reference"
}
}
],
"substance_class": "chemical",
"names": [
{
"uuid": "16373220-4456-4c32-9620-e4358c5c0763",
"name": "1-BENZYL-3-(3-(DIMETHYLAMINO) PROPOXY)-1H INDOZALE HYDROCHLORIDE",
"stdName": "1-BENZYL-3-(3-(DIMETHYLAMINO) PROPOXY)-1H INDOZALE HYDROCHLORIDE",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"37e82b50-6965-48b6-8e5a-ac83550853fb",
"d14937b2-d6fb-4de9-bc8b-89ea9db80005"
],
"display_name": false
},
{
"uuid": "79113d46-79da-4c47-95d1-7627c0ce2af3",
"name": "1-Benzyl-3-[3-(dimethylamino)propoxy]-1H-indazole monohydrochloride",
"stdName": "1-BENZYL-3-(3-(DIMETHYLAMINO)PROPOXY)-1H-INDAZOLE MONOHYDROCHLORIDE",
"type": "sys",
"languages": [
"en"
],
"preferred": false,
"references": [
"37e82b50-6965-48b6-8e5a-ac83550853fb",
"a0e30041-90a9-43da-9e33-e4a213d874e8"
],
"display_name": false
},
{
"uuid": "aae309ed-e432-48a5-aeca-777eb86e8b57",
"name": "1-PROPANAMINE, N,N-DIMETHYL-3-((1-(PHENYLMETHYL)-1H-INDAZOL-3-YL)OXY)-, MONOHYDROCHLORIDE",
"stdName": "1-PROPANAMINE, N,N-DIMETHYL-3-((1-(PHENYLMETHYL)-1H-INDAZOL-3-YL)OXY)-, MONOHYDROCHLORIDE",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"37e82b50-6965-48b6-8e5a-ac83550853fb",
"a0e30041-90a9-43da-9e33-e4a213d874e8"
],
"display_name": false
},
{
"uuid": "f21e5cb0-3374-4a6d-bec1-306592285207",
"name": "AF-864",
"stdName": "AF-864",
"type": "cd",
"languages": [
"en"
],
"preferred": false,
"references": [
"37e82b50-6965-48b6-8e5a-ac83550853fb",
"a0e30041-90a9-43da-9e33-e4a213d874e8"
],
"display_name": false
},
{
"uuid": "e94b3c2d-e65e-4db8-bb96-122ee0c9e807",
"name": "BENZIDAMINE HYDROCHLORIDE",
"stdName": "BENZIDAMINE HYDROCHLORIDE",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"37e82b50-6965-48b6-8e5a-ac83550853fb",
"a0d61a4c-f817-46b8-8a93-64bc01d89e26"
],
"display_name": false
},
{
"uuid": "07ac116f-dded-46fe-8570-c82f326528b7",
"name": "BENZYDAMINE HCL",
"stdName": "BENZYDAMINE HCL",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"db6f62c8-a06a-470e-8390-daf80cec60f9"
],
"display_name": false
},
{
"uuid": "1de35a26-2041-4e06-a071-d1b3994abfe7",
"name": "BENZYDAMINE HYDROCHLORIDE",
"stdName": "BENZYDAMINE HYDROCHLORIDE",
"type": "of",
"languages": [
"en"
],
"preferred": false,
"references": [
"714a6d22-b213-4b99-b8b9-fcf33747e594",
"ce9a6370-2284-408d-ad66-019099cd85af",
"4c8ed618-dbca-442b-86b7-58f6622a8953",
"23a9c85b-d3d4-469d-b194-fcb3e17d242e",
"667ccf59-9ea5-4034-8d32-bca2f1e4732e",
"1ce76fbc-f720-4c11-9c11-e76d37e5868b",
"d217c827-3087-4a1c-a4d8-1cd8c583613e",
"de076a61-f681-4566-988f-14515626e5d7",
"1a18e66e-8088-4442-addc-0141fbb8bfee",
"e42baf03-26d4-4818-b9cb-189a64a3793a",
"37e82b50-6965-48b6-8e5a-ac83550853fb",
"a0e30041-90a9-43da-9e33-e4a213d874e8"
],
"display_name": true,
"domains": [
"drug"
],
"name_orgs": [
{
"uuid": "d7e8545b-a254-47aa-8be8-6d5e02ad7b0e",
"name_org": "USAN"
}
]
},
{
"uuid": "200704dd-afba-e3c4-1654-f6393c469e5d",
"name": "BENZYDAMINE HYDROCHLORIDE [EP MONOGRAPH]",
"stdName": "BENZYDAMINE HYDROCHLORIDE [EP MONOGRAPH]",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"7ebd80b5-dde0-735a-8f9e-19173d79d275"
],
"display_name": false
},
{
"uuid": "744ab115-002e-424a-b0f9-9027c9e73080",
"name": "BENZYDAMINE HYDROCHLORIDE [JAN]",
"stdName": "BENZYDAMINE HYDROCHLORIDE [JAN]",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"37e82b50-6965-48b6-8e5a-ac83550853fb",
"de076a61-f681-4566-988f-14515626e5d7"
],
"display_name": false
},
{
"uuid": "0302fc87-ea1a-44af-b9a8-0ea635510dc1",
"name": "BENZYDAMINE HYDROCHLORIDE [MART.]",
"stdName": "BENZYDAMINE HYDROCHLORIDE [MART.]",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"1a18e66e-8088-4442-addc-0141fbb8bfee"
],
"display_name": false
},
{
"uuid": "25ae83ac-4bb0-4c18-a1d2-9462a2219d50",
"name": "BENZYDAMINE HYDROCHLORIDE [MI]",
"stdName": "BENZYDAMINE HYDROCHLORIDE [MI]",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"37e82b50-6965-48b6-8e5a-ac83550853fb",
"1ce76fbc-f720-4c11-9c11-e76d37e5868b"
],
"display_name": false
},
{
"uuid": "3ca30dab-8424-47a1-9761-882a3cce0a12",
"name": "BENZYDAMINE HYDROCHLORIDE [USAN]",
"stdName": "BENZYDAMINE HYDROCHLORIDE [USAN]",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"ce9a6370-2284-408d-ad66-019099cd85af"
],
"display_name": false
},
{
"uuid": "c0b53800-1cd0-a586-e236-94d708467637",
"name": "Benzydamine hydrochloride [WHO-DD]",
"stdName": "BENZYDAMINE HYDROCHLORIDE [WHO-DD]",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"306f4cda-fa1a-332f-7cf6-edd1e0810660"
],
"display_name": false
},
{
"uuid": "70147181-3aca-214a-d958-1c4d16ba6cb1",
"name": "NSC-759276",
"stdName": "NSC-759276",
"type": "cd",
"languages": [
"en"
],
"preferred": false,
"references": [
"551d6569-e77b-b6ad-7c47-84119c477c0b"
],
"display_name": false
},
{
"uuid": "6f61a0e4-d7c1-4e8c-8019-5be8eaf01d6c",
"name": "TANTUM",
"stdName": "TANTUM",
"type": "bn",
"languages": [
"en"
],
"preferred": false,
"references": [
"00e98039-2436-4f42-a301-5d0c8a77366f",
"de076a61-f681-4566-988f-14515626e5d7"
],
"display_name": false
}
],
"references": [
{
"uuid": "d14937b2-d6fb-4de9-bc8b-89ea9db80005",
"citation": "Merck 14.3",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN",
"PUBLIC_DOMAIN_RELEASE",
"AUTO_SELECTED"
]
},
{
"uuid": "37e82b50-6965-48b6-8e5a-ac83550853fb",
"citation": "MERCK INDEX",
"doc_type": "MERCK INDEX",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "a0e30041-90a9-43da-9e33-e4a213d874e8",
"citation": "USP DICTIONARY 2009",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "db6f62c8-a06a-470e-8390-daf80cec60f9",
"citation": "FDA-SRS 2010",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "ce9a6370-2284-408d-ad66-019099cd85af",
"citation": "USP DICTIONARY 2011",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "de076a61-f681-4566-988f-14515626e5d7",
"citation": "KEGG 2011",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "1a18e66e-8088-4442-addc-0141fbb8bfee",
"citation": "MARTINDALE 2011",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "00e98039-2436-4f42-a301-5d0c8a77366f",
"citation": "D01410",
"doc_type": "KEGG",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "e42baf03-26d4-4818-b9cb-189a64a3793a",
"citation": "WHO-DD",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "1ce76fbc-f720-4c11-9c11-e76d37e5868b",
"citation": "MERCK",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "a0d61a4c-f817-46b8-8a93-64bc01d89e26",
"citation": "NCT02178293",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "0976b6cf-d7ae-41ad-b053-b87209b1adda",
"citation": "SRS CODE IMPORT",
"doc_type": "SRS",
"public_domain": true,
"document_date": 1493389715000,
"tags": [
"NOMEN"
]
},
{
"uuid": "cafe51fa-fd5d-4f91-8723-3e4f913c3848",
"citation": "SRS import [K2GI407R4Q]",
"url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K2GI407R4Q",
"doc_type": "SRS",
"public_domain": true,
"document_date": 1493389715000,
"tags": [
"NOMEN"
]
},
{
"uuid": "714a6d22-b213-4b99-b8b9-fcf33747e594",
"citation": "BENZYDAMINE HYDROCHLORIDE [USAN]",
"doc_type": "SRS_LOCATOR",
"public_domain": true
},
{
"uuid": "667ccf59-9ea5-4034-8d32-bca2f1e4732e",
"citation": "BENZYDAMINE HYDROCHLORIDE [JAN]",
"doc_type": "SRS_LOCATOR",
"public_domain": true
},
{
"uuid": "d217c827-3087-4a1c-a4d8-1cd8c583613e",
"citation": "BENZYDAMINE HYDROCHLORIDE [MART.]",
"doc_type": "SRS_LOCATOR",
"public_domain": true
},
{
"uuid": "4c8ed618-dbca-442b-86b7-58f6622a8953",
"citation": "BENZYDAMINE HYDROCHLORIDE [WHO-DD]",
"doc_type": "SRS_LOCATOR",
"public_domain": true
},
{
"uuid": "23a9c85b-d3d4-469d-b194-fcb3e17d242e",
"citation": "BENZYDAMINE HYDROCHLORIDE [MI]",
"doc_type": "SRS_LOCATOR",
"public_domain": true
},
{
"uuid": "5efc2a81-1a0e-115f-06a6-ba243eb92c61",
"citation": "WEBSITE",
"url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=132-69-4",
"doc_type": "WEBSITE",
"public_domain": true,
"tags": [
"NOMEN",
"PUBLIC_DOMAIN_RELEASE"
]
},
{
"uuid": "4c46e8b7-cd3d-16ad-cd6f-b7a997e2fd05",
"doc_type": "SYSTEM",
"public_domain": true
},
{
"uuid": "39e7486b-0403-41ac-9310-74538986c725",
"citation": "STN",
"doc_type": "STN (SCIFINDER)",
"public_domain": true
},
{
"uuid": "2ff435fa-d3c5-98c2-1927-4e07a6612821",
"citation": "PUBCHEM",
"doc_type": "PUBCHEM",
"public_domain": true
},
{
"uuid": "551d6569-e77b-b6ad-7c47-84119c477c0b",
"citation": "NCI",
"doc_type": "NCI DRUG DICTIONARY",
"public_domain": true
},
{
"uuid": "7ebd80b5-dde0-735a-8f9e-19173d79d275",
"citation": "EP 10.5",
"doc_type": "EP",
"public_domain": true
},
{
"uuid": "306f4cda-fa1a-332f-7cf6-edd1e0810660",
"citation": "WHO-DD",
"doc_type": "WHO DRUG DICTIONARY",
"public_domain": true
},
{
"uuid": "83579b26-fd92-4226-b85c-6eabfcc8114e",
"citation": "11.2",
"doc_type": "EP",
"public_domain": true,
"tags": [
"PUBLIC_DOMAIN_RELEASE"
]
},
{
"uuid": "c3d3db12-0d5b-4ae8-a762-eacbe32fbe48",
"citation": "11.2",
"doc_type": "EP",
"public_domain": true,
"tags": [
"PUBLIC_DOMAIN_RELEASE"
]
},
{
"uuid": "c98db8ea-969c-46d3-bf53-c1a1f51c35c2",
"citation": "11.2",
"doc_type": "EP",
"public_domain": true,
"tags": [
"PUBLIC_DOMAIN_RELEASE"
]
},
{
"uuid": "0444cce7-0676-65db-3ca9-501366d75b11",
"citation": "EU-SRS",
"doc_type": "EMA LIST",
"public_domain": true
},
{
"uuid": "8a2ab739-568f-4681-8782-583a3a9a5564",
"citation": "11.2",
"doc_type": "EP",
"public_domain": true,
"tags": [
"PUBLIC_DOMAIN_RELEASE"
]
},
{
"uuid": "3871cfd1-2ed3-4260-8442-e9cd018e0b32",
"citation": "11.2",
"doc_type": "EP",
"public_domain": true,
"tags": [
"PUBLIC_DOMAIN_RELEASE"
]
},
{
"uuid": "657d67ae-d5b4-4c9a-8517-471fe6e255aa",
"citation": "11.2",
"doc_type": "EP",
"public_domain": true,
"tags": [
"PUBLIC_DOMAIN_RELEASE"
]
},
{
"uuid": "ccd9750c-3ff1-4012-ad7c-843d8a95326c",
"citation": "11.2",
"doc_type": "EP",
"public_domain": true,
"tags": [
"PUBLIC_DOMAIN_RELEASE"
]
}
],
"definition_type": "PRIMARY",
"moieties": [
{
"uuid": "65936b95-659c-41f8-a998-395481cc6432",
"id": "65936b95-659c-41f8-a998-395481cc6432",
"molfile": "\n Marvin 01132105172D \n\n 1 0 0 0 0 0 999 V2000\n -2.3163 -7.0290 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\nM END",
"smiles": "Cl",
"formula": "ClH",
"atropisomerism": "No",
"charge": 0,
"count": 1,
"stereochemistry": "ACHIRAL",
"count_amount": {
"type": "MOL RATIO",
"average": 1,
"units": "MOL RATIO",
"uuid": "83ad0846-31ba-41cb-aba2-ed31e206d6ac"
},
"defined_stereo": 0,
"ez_centers": 0,
"molecular_weight": "36.4609",
"optical_activity": "NONE",
"stereo_centers": 0
},
{
"uuid": "6c57a513-a2ca-4432-accf-0277a922593e",
"id": "6c57a513-a2ca-4432-accf-0277a922593e",
"molfile": "\n Marvin 01132105382D \n\n 23 25 0 0 0 0 999 V2000\n -2.9309 -3.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7682 -3.8863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3802 -4.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9858 -4.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8205 -4.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0329 -5.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8728 -6.0219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0852 -6.2723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5810 -5.7843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2421 -6.2827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0245 -6.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2078 -5.2214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9903 -4.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1581 -4.1626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5461 -3.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7689 -3.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5932 -4.6713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9890 -7.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3996 -7.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9890 -8.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1627 -8.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2505 -7.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1627 -7.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 23 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 18 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 17 12 2 0 0 0 0\n 14 13 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 23 18 2 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 2 0 0 0 0\n 22 23 1 0 0 0 0\nM END",
"smiles": "CN(C)CCCOc1c2ccccc2n(Cc3ccccc3)n1",
"formula": "C19H23N3O",
"atropisomerism": "No",
"charge": 0,
"count": 1,
"stereochemistry": "ACHIRAL",
"count_amount": {
"type": "MOL RATIO",
"average": 1,
"units": "MOL RATIO",
"uuid": "98567754-533f-4ed7-aaa3-e046f2030425"
},
"defined_stereo": 0,
"ez_centers": 0,
"molecular_weight": "309.4061",
"optical_activity": "NONE",
"stereo_centers": 0
}
],
"definition_level": "COMPLETE",
"uuid": "c7056563-6e27-4591-820a-f854cd505ca8",
"version": "25",
"structure": {
"id": "09700300-fae2-447c-8aeb-d714b184dcef",
"molfile": "\n Marvin 01132100452D \n\n 24 25 0 0 0 0 999 V2000\n 1.2421 -6.2827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5810 -5.7843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0852 -6.2723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1627 -7.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9890 -7.0548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0245 -6.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8728 -6.0219 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7682 -3.8863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2505 -7.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2078 -5.2214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3996 -7.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8205 -4.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9858 -4.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0329 -5.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9309 -3.0858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3802 -4.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5932 -4.6713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9903 -4.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1627 -8.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9890 -8.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1581 -4.1626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7689 -3.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5461 -3.6100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3163 -7.0290 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 1 1 0 0 0 0\n 6 1 1 0 0 0 0\n 7 3 1 0 0 0 0\n 8 13 1 0 0 0 0\n 9 4 1 0 0 0 0\n 10 6 1 0 0 0 0\n 11 5 1 0 0 0 0\n 12 14 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 7 1 0 0 0 0\n 15 8 1 0 0 0 0\n 16 8 1 0 0 0 0\n 17 10 1 0 0 0 0\n 18 10 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 11 2 0 0 0 0\n 21 18 1 0 0 0 0\n 22 17 2 0 0 0 0\n 23 22 1 0 0 0 0\n 3 4 1 0 0 0 0\n 9 19 2 0 0 0 0\n 21 23 2 0 0 0 0\nM END",
"smiles": "CN(C)CCCOc1c2ccccc2n(Cc3ccccc3)n1.Cl",
"formula": "C19H23N3O.ClH",
"atropisomerism": "No",
"charge": 0,
"count": 1,
"stereochemistry": "ACHIRAL",
"defined_stereo": 0,
"ez_centers": 0,
"molecular_weight": "345.867",
"optical_activity": "NONE",
"references": [
"cafe51fa-fd5d-4f91-8723-3e4f913c3848",
"a0e30041-90a9-43da-9e33-e4a213d874e8"
],
"stereo_centers": 0
},
"unii": "K2GI407R4Q"
}
]
}