{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7160e61c-92a9-49a6-b11d-cca78ce8c10a", "code": "845959-55-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=845959-55-9", "code_system": "CAS", "references": [ "872a5522-36b1-4d6d-97d3-497003a79e16", "896e5135-f123-45b1-b6e0-8a8d77e64698" ] }, { "uuid": "6d7ac61d-a48c-4333-b994-9cba9c73cae8", "code": "11672005", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11672005", "code_system": "PUBCHEM", "references": [ "872a5522-36b1-4d6d-97d3-497003a79e16" ] }, { "uuid": "ff2bccbe-a415-46c7-a035-a2b7e0369ebd", "code": "K27MHH614O", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "5925de5a-7ca3-2cc6-e54f-3a4cbccbccb4", "code": "300000035889", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "6b0884e6-4c9d-0922-152d-da279edf97c3" ] } ], "relationships": [ { "uuid": "5ccb8d85-2647-49b7-8e3b-b2a5eb404fce", "amount": { "uuid": "01192055-7b21-45ad-afe9-70a98887c572" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "ea07bd7a-3ee8-473b-9bcc-5e2e961c545d", "refuuid": "bbcab636-2b80-414a-b104-c5bb847216ad", "name": "MITOQUINOL CATION", "unii": "65M41NIO61", "linking_id": "65M41NIO61", "ref_pname": "MITOQUINOL CATION", "substance_class": "reference" } }, { "uuid": "b528a206-cce7-44ee-88ba-80bbe9aca797", "amount": { "uuid": "ced67742-f4dd-4bef-8619-bddcb39452c8" }, "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "2d1a8050-6003-482d-94ef-6cb29b61346f", "refuuid": "bbcab636-2b80-414a-b104-c5bb847216ad", "name": "MITOQUINOL CATION", "unii": "65M41NIO61", "linking_id": "65M41NIO61", "ref_pname": "MITOQUINOL CATION", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "a9cb6e30-f01c-4daa-9958-f12f6e792dcd", "name": "MITOQUINOL MESYLATE", "stdName": "MITOQUINOL MESYLATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "e12b9ad4-d3c7-4c56-abad-17ea08ae5548" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "cb0c1f74-d4a3-4564-a923-74cb1206aea7", "name_org": "INCI" } ] }, { "uuid": "dab4c7dd-8647-408b-934d-525f42db6674", "name": "Mitoquinol mesilate", "stdName": "MITOQUINOL MESILATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "419b4d42-fb23-4d79-90e6-6f9e62743566" ], "display_name": false }, { "uuid": "1a7476eb-8438-42ca-b17e-14b6ecc8ec0a", "name": "Mitoquinol mesilate [WHO-DD]", "stdName": "MITOQUINOL MESILATE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "419b4d42-fb23-4d79-90e6-6f9e62743566" ], "display_name": false }, { "uuid": "a62ec76a-8fd1-4c1b-b37a-51c8addab9d8", "name": "PHOSPHONIUM, (10-(2,5-DIHYDROXY-3,4-DIMETHOXY-6-METHYLPHENYL)DECYL)TRIPHENYL-, METHANESULFONATE (1:1)", "stdName": "PHOSPHONIUM, (10-(2,5-DIHYDROXY-3,4-DIMETHOXY-6-METHYLPHENYL)DECYL)TRIPHENYL-, METHANESULFONATE (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bb0dc06e-d089-40f4-9de9-8b83f638b35e", "3fbd6628-aaf8-439d-9c07-dfbb74ce4505" ], "display_name": false }, { "uuid": "85424965-98f4-45dc-ac05-84854a5941c9", "name": "PHOSPHONIUM, (10-(3,6-DIHYDROXY-4,5-DIMETHOXY-2-METHYLPHENYL)DECYL)TRIPHENYL-, METHANESULFONATE", "stdName": "PHOSPHONIUM, (10-(3,6-DIHYDROXY-4,5-DIMETHOXY-2-METHYLPHENYL)DECYL)TRIPHENYL-, METHANESULFONATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bb0dc06e-d089-40f4-9de9-8b83f638b35e", "3fbd6628-aaf8-439d-9c07-dfbb74ce4505" ], "display_name": false } ], "references": [ { "uuid": "e12b9ad4-d3c7-4c56-abad-17ea08ae5548", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "bb0dc06e-d089-40f4-9de9-8b83f638b35e", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3fbd6628-aaf8-439d-9c07-dfbb74ce4505", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "872a5522-36b1-4d6d-97d3-497003a79e16", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393611000, "tags": [ "NOMEN" ] }, { "uuid": "a3e66bd0-3002-41b6-b828-e8370a27266e", "citation": "SRS import [K27MHH614O]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K27MHH614O", "doc_type": "SRS", "public_domain": true, "document_date": 1493393611000, "tags": [ "NOMEN" ] }, { "uuid": "22543881-114a-bc7b-dcc2-06021e2e9d97", "citation": "PCPC", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true }, { "uuid": "896e5135-f123-45b1-b6e0-8a8d77e64698", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "419b4d42-fb23-4d79-90e6-6f9e62743566", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6b0884e6-4c9d-0922-152d-da279edf97c3", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c2f9ecb1-bff2-4b0b-bd4f-0f316ff5ed5c", "id": "c2f9ecb1-bff2-4b0b-bd4f-0f316ff5ed5c", "molfile": "\n Marvin 01132110052D \n\n 5 4 0 0 0 0 999 V2000\n 7.4732 -9.6657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6482 -9.6657 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8232 -9.6657 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.6482 -10.4907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6482 -8.8407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\n 2 5 2 0 0 0 0\nM CHG 1 3 -1\nM END", "smiles": "CS(=O)(=O)[O-]", "formula": "CH3O3S", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b48a5b98-bd89-4ccd-87f3-dacdf7447ef2" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "95.0989", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "dca89178-9dbb-4c6d-bf49-f9b2e4d47006", "id": "dca89178-9dbb-4c6d-bf49-f9b2e4d47006", "molfile": "\n Marvin 01132111262D \n\n 42 45 0 0 0 0 999 V2000\n 12.5275 -0.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1150 -1.6818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2900 -1.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8775 -0.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2900 -0.2529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0525 -0.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6400 -0.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6400 -1.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8150 -1.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4025 -2.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5775 -2.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1650 -3.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3400 -3.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9275 -3.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1025 -3.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6900 -4.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8650 -4.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4525 -5.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6275 -5.2542 0.0000 P 0 3 0 0 0 0 0 0 0 0 0 0\n 2.6275 -4.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3420 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3420 -3.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6275 -2.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9130 -3.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9130 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8025 -5.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3900 -5.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5650 -5.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1525 -5.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5650 -4.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3900 -4.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6275 -6.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3420 -6.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3420 -7.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6275 -7.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9130 -7.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9130 -6.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0525 -2.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6400 -3.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8775 -2.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2900 -3.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8775 -3.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 40 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 6 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 38 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 26 1 0 0 0 0\n 19 32 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 25 2 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 31 2 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 30 29 2 0 0 0 0\n 31 30 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 37 2 0 0 0 0\n 33 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 36 35 2 0 0 0 0\n 37 36 1 0 0 0 0\n 38 39 1 0 0 0 0\n 38 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\nM CHG 1 19 1\nM END", "smiles": "Cc1c(CCCCCCCCCC[P+](c2ccccc2)(c3ccccc3)c4ccccc4)c(c(c(c1O)OC)OC)O", "formula": "C37H46O4P", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e7f6e58e-3f09-4c84-a64d-50d6b3b5a5db" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "585.7339", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "26d093fd-0583-4fd5-85ce-9f6bc93e3baa", "version": "7", "structure": { "id": "a6f1b7c0-b442-4a0a-a7d3-d10bae5f7a81", "molfile": "\n Marvin 01132108402D \n\n 47 49 0 0 0 0 999 V2000\n 2.6275 -5.2542 0.0000 P 0 3 0 0 0 0 0 0 0 0 0 0\n 2.6275 -4.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3420 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3420 -3.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6275 -2.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9130 -3.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9130 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8025 -5.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3900 -5.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5650 -5.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1525 -5.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5650 -4.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3900 -4.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6275 -6.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3420 -6.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3420 -7.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6275 -7.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9130 -7.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9130 -6.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4525 -5.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8650 -4.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6900 -4.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1025 -3.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9275 -3.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3400 -3.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1650 -3.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5775 -2.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4025 -2.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8150 -1.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6400 -1.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0525 -0.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6400 -0.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8775 -0.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2900 -0.2529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2900 -1.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1150 -1.6818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5275 -0.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8775 -2.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2900 -3.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8775 -3.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0525 -2.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6400 -3.1108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6482 -9.6657 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8232 -9.6657 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.6482 -10.4907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6482 -8.8407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4732 -9.6657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 2 7 2 0 0 0 0\n 1 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 8 13 2 0 0 0 0\n 1 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 14 19 2 0 0 0 0\n 1 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 33 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 38 35 2 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 41 38 1 0 0 0 0\n 30 41 2 0 0 0 0\n 41 42 1 0 0 0 0\n 43 44 1 0 0 0 0\n 43 45 2 0 0 0 0\n 43 46 2 0 0 0 0\n 43 47 1 0 0 0 0\nM CHG 2 1 1 44 -1\nM END", "smiles": "Cc1c(CCCCCCCCCC[P+](c2ccccc2)(c3ccccc3)c4ccccc4)c(c(c(c1O)OC)OC)O.CS(=O)(=O)[O-]", "formula": "C37H46O4P.CH3O3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "680.8327", "optical_activity": "NONE", "references": [ "bb0dc06e-d089-40f4-9de9-8b83f638b35e", "a3e66bd0-3002-41b6-b828-e8370a27266e" ], "stereo_centers": 0 }, "unii": "K27MHH614O" } ] }