{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "08bc10f7-c026-481a-9fa1-34c323c8f486", "code": "301-03-1", "type": "ALTERNATIVE", "url": "https://commonchemistry.cas.org/detail?cas_rn=301-03-1", "code_system": "CAS", "references": [ "c9bae3f7-96a1-4941-b4b8-7ff2f01316c9", "498c707b-7b3a-4c3a-9558-8b53706b48d7" ] }, { "uuid": "4cb86ec9-df6e-42bb-ac00-3d061afa0972", "code": "12427-38-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=12427-38-2", "code_system": "CAS", "references": [ "c9bae3f7-96a1-4941-b4b8-7ff2f01316c9", "e254155f-e607-46e7-b334-d235bf6930a3" ] }, { "uuid": "ae4881df-f9cc-4199-ab44-d503531c4496", "code": "D008344", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68008344", "code_system": "MESH", "references": [ "c9bae3f7-96a1-4941-b4b8-7ff2f01316c9" ] }, { "uuid": "27db9e51-0f5f-489b-89d0-f6716a472741", "code": "MANEB", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Maneb", "code_system": "WIKIPEDIA", "references": [ "c9bae3f7-96a1-4941-b4b8-7ff2f01316c9" ] }, { "uuid": "50002683-5ceb-4880-8f76-069e4ab43524", "code": "14505", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2737", "code_system": "EPA PESTICIDE CODE", "references": [ "c9bae3f7-96a1-4941-b4b8-7ff2f01316c9" ] }, { "uuid": "4395f4ec-356d-4f97-953e-38f18ddddf37", "code": "m7056", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m7056?q=authorize", "code_system": "MERCK INDEX", "references": [ "c9bae3f7-96a1-4941-b4b8-7ff2f01316c9" ] }, { "uuid": "d60fd6c2-9be8-4dc6-b73d-bcfefda15e6e", "code": "235-654-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.032.400", "code_system": "ECHA (EC/EINECS)", "references": [ "c9bae3f7-96a1-4941-b4b8-7ff2f01316c9" ] }, { "uuid": "d634439e-918e-c496-c7e7-16228de06b94", "code": "4063", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4063", "code_system": "HSDB", "references": [ "63212142-63e3-1693-fded-273675769db0" ] }, { "uuid": "3968e6f8-57f2-f372-b87d-5fef8d421fd2", "code": "3032581", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3032581", "code_system": "PUBCHEM", "references": [ "29e137a8-fdc6-a9e7-2799-1142ad66bb1f" ] }, { "uuid": "9b7b117d-406f-47e0-a158-6c3c4e2e079d", "code": "K221E12G7T", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "5e7e1ab2-6f2e-f0c0-6f66-7503ca0f2a90", "code": "maneb", "type": "PRIMARY", "url": "https://pesticidecompendium.bcpc.org/maneb.html", "code_system": "ALANWOOD", "references": [ "8f9fb0a9-cffa-05fd-96a2-829c9c4e6caa" ] }, { "uuid": "f6204227-9d84-fee7-ce81-c0d04211fc11", "code": "DTXSID9020794", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9020794", "code_system": "EPA CompTox", "references": [ "645ca721-b1c2-4764-344a-849ef1ad0e45" ] } ], "relationships": [ { "uuid": "e27446a9-78f0-4ecd-8b26-abfcab753fe4", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "19732d69-6c24-4da1-be8f-29b77ac3b1db", "refuuid": "c01ce385-4f1a-408c-80b1-76f6930fc7a0", "name": "ETHYLENEBISDITHIOCARBAMIC ACID", "unii": "IO46B19O1Q", "linking_id": "IO46B19O1Q", "ref_pname": "ETHYLENEBISDITHIOCARBAMIC ACID", "substance_class": "reference" } }, { "uuid": "688416e4-0f3c-4cec-a190-25817c0ea454", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "741c3ff2-0f5c-46aa-8e25-6ef4a370d577", "refuuid": "8248332c-8739-4872-8639-9ac1fb9d7f19", "name": "MANGANOUS CATION", "unii": "H6EP7W5457", "linking_id": "H6EP7W5457", "ref_pname": "MANGANOUS CATION", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "17adaee9-0018-4f93-8502-0ca1232968c5", "name": "1,2-ETHYLENEDIYLBIS(CARBAMODITHIOATO)MANGANESE", "stdName": "1,2-ETHYLENEDIYLBIS(CARBAMODITHIOATO)MANGANESE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "853ba493-7af3-4a01-b6fb-337d81093842", "702869e4-feb3-4ecf-80ed-6d35a7f49c9a" ], "display_name": false }, { "uuid": "e1e1f784-7e9f-425c-8a2a-8d10038f9dd9", "name": "CARBAMODITHIOIC ACID, 1,2-ETHANEDIYLBIS-, MANGANESE COMPLEX", "stdName": "CARBAMODITHIOIC ACID, 1,2-ETHANEDIYLBIS-, MANGANESE COMPLEX", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "853ba493-7af3-4a01-b6fb-337d81093842", "702869e4-feb3-4ecf-80ed-6d35a7f49c9a" ], "display_name": false }, { "uuid": "48577ad3-330e-4893-813a-06ea153f3822", "name": "ETHYLENEBIS(DITHIOCARBAMIC ACID) MANGANOUS SALT", "stdName": "ETHYLENEBIS(DITHIOCARBAMIC ACID) MANGANOUS SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "853ba493-7af3-4a01-b6fb-337d81093842", "702869e4-feb3-4ecf-80ed-6d35a7f49c9a" ], "display_name": false }, { "uuid": "2dbfe743-15c9-4408-b5e3-e3157c7762d7", "name": "MANEB", "stdName": "MANEB", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0086bfbe-006e-4f0d-92dc-9f9096d7de6b", "853ba493-7af3-4a01-b6fb-337d81093842", "e963e5e9-7435-4456-9f04-1b06973aecfe", "702869e4-feb3-4ecf-80ed-6d35a7f49c9a", "d055b93c-6947-472c-bc5c-0575bef604e0", "3bc1abb1-5f47-49fa-8074-59dfcf7b77f0" ], "display_name": true }, { "uuid": "8fb6474a-517c-4626-a912-83ae76b27f09", "name": "MANEB 80", "stdName": "MANEB 80", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "853ba493-7af3-4a01-b6fb-337d81093842", "702869e4-feb3-4ecf-80ed-6d35a7f49c9a" ], "display_name": false }, { "uuid": "ccfbb215-c8bf-158c-4fdd-0f86786bb172", "name": "MANEB [IARC]", "stdName": "MANEB [IARC]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d8e8acb7-f3bf-edcf-c45d-5d94ef6c271f" ], "display_name": false }, { "uuid": "d372c260-914e-4956-9c28-0105deba2afd", "name": "MANEB [ISO]", "stdName": "MANEB [ISO]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0086bfbe-006e-4f0d-92dc-9f9096d7de6b", "853ba493-7af3-4a01-b6fb-337d81093842" ], "display_name": false }, { "uuid": "e36fbced-99c1-46af-89c3-447480ee39b5", "name": "MANEB [MI]", "stdName": "MANEB [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "853ba493-7af3-4a01-b6fb-337d81093842", "d055b93c-6947-472c-bc5c-0575bef604e0" ], "display_name": false }, { "uuid": "c20f9490-27ce-4d6d-b7ee-82682579873a", "name": "MANEBGAN", "stdName": "MANEBGAN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "853ba493-7af3-4a01-b6fb-337d81093842", "702869e4-feb3-4ecf-80ed-6d35a7f49c9a" ], "display_name": false }, { "uuid": "fbeeb9c0-7e88-4256-937a-4d08510e27a0", "name": "MANGANESE, ((1,2-ETHANEDIYLBIS(CARBAMODITHIOATO))(2-))-", "stdName": "MANGANESE, ((1,2-ETHANEDIYLBIS(CARBAMODITHIOATO))(2-))-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "853ba493-7af3-4a01-b6fb-337d81093842", "702869e4-feb3-4ecf-80ed-6d35a7f49c9a" ], "display_name": false }, { "uuid": "f335609f-4ca1-4288-a716-115ba273c4df", "name": "MANGANESE, (N-(2-((DITHIOCARBOXY)AMINO)ETHYL)CARBAMODITHIOATO(2-)-.KAPPA.S,.KAPPA.S')-", "stdName": "MANGANESE, (N-(2-((DITHIOCARBOXY)AMINO)ETHYL)CARBAMODITHIOATO(2-)-.KAPPA.S,.KAPPA.S')-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "853ba493-7af3-4a01-b6fb-337d81093842", "702869e4-feb3-4ecf-80ed-6d35a7f49c9a" ], "display_name": false } ], "references": [ { "uuid": "702869e4-feb3-4ecf-80ed-6d35a7f49c9a", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "853ba493-7af3-4a01-b6fb-337d81093842", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0086bfbe-006e-4f0d-92dc-9f9096d7de6b", "citation": "ISO", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d055b93c-6947-472c-bc5c-0575bef604e0", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c9bae3f7-96a1-4941-b4b8-7ff2f01316c9", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391913000, "tags": [ "NOMEN" ] }, { "uuid": "34f69d86-7242-40cd-a744-f7a39448807c", "citation": "SRS import [K221E12G7T]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=K221E12G7T", "doc_type": "SRS", "public_domain": true, "document_date": 1493391913000, "tags": [ "NOMEN" ] }, { "uuid": "e963e5e9-7435-4456-9f04-1b06973aecfe", "citation": "MANEB [ISO]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3bc1abb1-5f47-49fa-8074-59dfcf7b77f0", "citation": "MANEB [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "29e137a8-fdc6-a9e7-2799-1142ad66bb1f", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "498c707b-7b3a-4c3a-9558-8b53706b48d7", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "e254155f-e607-46e7-b334-d235bf6930a3", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "63212142-63e3-1693-fded-273675769db0", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+12427-38-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "74b726a0-5553-1845-35b2-abfbc20f9da2", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=12427-38-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d8e8acb7-f3bf-edcf-c45d-5d94ef6c271f", "citation": "IARC", "doc_type": "IARC", "public_domain": true }, { "uuid": "8f9fb0a9-cffa-05fd-96a2-829c9c4e6caa", "citation": "AW", "doc_type": "ALANWOOD", "public_domain": true }, { "uuid": "645ca721-b1c2-4764-344a-849ef1ad0e45", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ceb8c18d-6fe6-45da-9fc2-8013c530abeb", "id": "ceb8c18d-6fe6-45da-9fc2-8013c530abeb", "molfile": "\n Marvin 01132110402D \n\n 1 0 0 0 0 0 999 V2000\n 7.1275 -3.0887 0.0000 Mn 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Mn+2]", "formula": "Mn", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "16825182-4659-4586-8ed3-8cc6767a904c" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "54.938", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "362f3de9-3cf4-4602-b2bf-84c9f9442d94", "id": "362f3de9-3cf4-4602-b2bf-84c9f9442d94", "molfile": "\n Marvin 01132102532D \n\n 10 9 0 0 0 0 999 V2000\n 0.4951 -2.6917 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2046 -3.0988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2046 -3.9268 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9181 -2.6872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6276 -3.0988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3412 -2.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0548 -3.0942 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7642 -2.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4778 -3.0897 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7642 -1.8541 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\nM END", "smiles": "C(CNC(=S)S)NC(=S)S", "formula": "C4H8N2S4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f9651b13-b871-4ee6-bc58-7abb7d92891b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "212.3842", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "739d65c0-1248-472c-a38d-1ad2becdb30a", "version": "10", "structure": { "id": "bf52b9ba-3bd5-45b2-ac66-115d91ceecb2", "molfile": "\n Marvin 01132109532D \n\n 11 9 0 0 0 0 999 V2000\n 0.4951 -2.6915 0.0000 S 0 5 0 0 0 0 0 0 0 0 0 0\n 1.2045 -3.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9180 -2.6870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6274 -3.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3410 -2.6824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0546 -3.0940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7639 -2.6824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4775 -3.0895 0.0000 S 0 5 0 0 0 0 0 0 0 0 0 0\n 4.7639 -1.8540 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2045 -3.9266 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1291 -3.0895 0.0000 Mn 0 2 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 2 10 2 0 0 0 0\nM CHG 3 1 -1 8 -1 11 2\nM END", "smiles": "C(CNC(=S)[S-])NC(=S)[S-].[Mn+2]", "formula": "C4H6N2S4.Mn", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "265.3064", "optical_activity": "NONE", "references": [ "702869e4-feb3-4ecf-80ed-6d35a7f49c9a", "34f69d86-7242-40cd-a744-f7a39448807c" ], "stereo_centers": 0 }, "unii": "K221E12G7T" } ] }