{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "39d060d3-bf89-641f-6a0f-146a3bb89e13",
          "code": "643765-11-1",
          "type": "GENERIC (FAMILY)",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=643765-11-1",
          "code_system": "CAS",
          "references": [
            "c63e7b86-c636-fe5f-0823-b8c86afacb32"
          ]
        },
        {
          "uuid": "8a439148-9340-3d27-af00-2ff57d5ab093",
          "code": "156153-06-9",
          "type": "MAJOR COMPONENT STRUCTURE/SEQUENCE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=156153-06-9",
          "code_system": "CAS",
          "references": [
            "c63e7b86-c636-fe5f-0823-b8c86afacb32"
          ]
        },
        {
          "uuid": "24628475-231c-2068-01c9-a35e1e82ea9f",
          "code": "2169283",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2169283/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ce7cbe82-b796-090e-3bfd-5a4fe7fb2791"
          ]
        },
        {
          "uuid": "be7b5640-2b79-fab7-f276-d548a39a65d0",
          "code": "9905161",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9905161",
          "code_system": "PUBCHEM",
          "references": [
            "19a9e195-92ab-2e11-cba5-fd1dbaf6d3ac"
          ]
        },
        {
          "uuid": "41c5ad75-f86e-4901-90af-a5c217143715",
          "code": "JX7WXJ41DH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "70cdaebf-d7e1-06f1-d025-8c6104a448ae",
          "code": "JX7WXJ41DH",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=JX7WXJ41DH",
          "code_system": "DAILYMED",
          "references": [
            "eff8f19c-aa84-32ae-2a45-0f7193f22aaa"
          ]
        },
        {
          "uuid": "bcb2ce45-8351-f62f-91d7-74efdc4077ae",
          "code": "DTXSID201021384",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201021384",
          "code_system": "EPA CompTox",
          "references": [
            "6fd1c8c3-4db0-01ea-f707-28a01a890a0f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fc06a9f2-d04f-62c9-6c17-f8eb27ac8e3e",
          "name": "CAPRIC ACID, MONOESTER WITH DIGLYCEROL",
          "stdName": "CAPRIC ACID, MONOESTER WITH DIGLYCEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c55e96f-0f86-de6e-e189-8cc6887c4cbb"
          ],
          "display_name": false
        },
        {
          "uuid": "9053afab-12b0-7e4d-610b-2c6f17a6c1c8",
          "name": "CREMERCOOR PG2 C10",
          "stdName": "CREMERCOOR PG2 C10",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c55e96f-0f86-de6e-e189-8cc6887c4cbb"
          ],
          "display_name": false
        },
        {
          "uuid": "abec7821-1899-7ac6-b8bf-7fe73f6e7222",
          "name": "DECANOIC ACID, 3-(2,3-DIHYDROXYPROPOXY)-2-HYDROXYPROPYL ESTER",
          "stdName": "DECANOIC ACID, 3-(2,3-DIHYDROXYPROPOXY)-2-HYDROXYPROPYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c55e96f-0f86-de6e-e189-8cc6887c4cbb"
          ],
          "display_name": false
        },
        {
          "uuid": "4b0e2329-f44a-71c9-46f3-52018940cb30",
          "name": "DERMOSOFT DGMC",
          "stdName": "DERMOSOFT DGMC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c55e96f-0f86-de6e-e189-8cc6887c4cbb"
          ],
          "display_name": false
        },
        {
          "uuid": "e658191d-e491-38cb-9306-4378551de736",
          "name": "DIGLYCERYL MONOCAPRATE",
          "stdName": "DIGLYCERYL MONOCAPRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c63e7b86-c636-fe5f-0823-b8c86afacb32"
          ],
          "display_name": false
        },
        {
          "uuid": "e2b84fa2-3462-bd72-a934-597bee493b53",
          "name": "POLYGLYCERYL-2 CAPRATE",
          "stdName": "POLYGLYCERYL-2 CAPRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c55e96f-0f86-de6e-e189-8cc6887c4cbb"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "77eedbc2-17ac-edd2-cb6c-f98c6da1f866",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "074d74d6-8009-2829-11a9-7128eea48462",
          "name": "SUNSOFT Q-10D",
          "stdName": "SUNSOFT Q-10D",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c55e96f-0f86-de6e-e189-8cc6887c4cbb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1c55e96f-0f86-de6e-e189-8cc6887c4cbb",
          "citation": "PCPC-DB",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "document_date": 1493393769000,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c63e7b86-c636-fe5f-0823-b8c86afacb32",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ce7cbe82-b796-090e-3bfd-5a4fe7fb2791",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "19a9e195-92ab-2e11-cba5-fd1dbaf6d3ac",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "eff8f19c-aa84-32ae-2a45-0f7193f22aaa",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "6fd1c8c3-4db0-01ea-f707-28a01a890a0f",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "398f9ee5-e897-9ee0-def0-487a4e0d0469",
          "id": "398f9ee5-e897-9ee0-def0-487a4e0d0469",
          "molfile": "\n  Marvin  01132103032D          \n\n 22 21  0  0  0  0            999 V2000\n   23.2060   -7.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2060   -7.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4915   -6.5996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4915   -5.7746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7769   -5.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7769   -4.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.0623   -4.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.0623   -3.2998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.3478   -2.8873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.3478   -2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.0622   -1.6498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6333   -1.6499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9188   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2043   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   18.2043   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4899   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7754   -1.6501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0609   -2.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3464   -1.6503    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   15.3464   -0.8253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6320   -2.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9174   -1.6504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCCC(=O)OCC(COCC(CO)O)O",
          "formula": "C16H32O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c040569c-f7e8-4666-8628-2a4d5f669f33"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "320.4223",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "978dd44a-a71c-77df-fb97-c15f4e7712ab",
      "version": "14",
      "structure": {
        "id": "c4bd1455-5ac4-22cd-d09a-658f90971109",
        "molfile": "\n  Marvin  01132110102D          \n\n 22 21  0  0  0  0            999 V2000\n   18.2043   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3464   -0.8253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9174   -1.6504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6320   -2.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3464   -1.6503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0609   -2.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7754   -1.6501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4899   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2043   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9188   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6333   -1.6499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2060   -7.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2060   -7.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4915   -6.5996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4915   -5.7746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7769   -5.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7769   -4.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.0623   -4.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.0623   -3.2998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.3478   -2.8873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.3478   -2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.0622   -1.6498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n 21 22  2  0  0  0  0\n 21 20  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 12  1  0  0  0  0\n 21 11  1  0  0  0  0\n 10 11  1  0  0  0  0\n  9 10  1  0  0  0  0\n  8  9  1  0  0  0  0\n  7  8  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  6  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  2  1  0  0  0  0\n  9  1  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCCC(=O)OCC(COCC(CO)O)O",
        "formula": "C16H32O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "320.4223",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "1c55e96f-0f86-de6e-e189-8cc6887c4cbb",
          "c63e7b86-c636-fe5f-0823-b8c86afacb32"
        ],
        "stereo_centers": 2,
        "stereo_comments": "Assumed mixed"
      },
      "unii": "JX7WXJ41DH"
    }
  ]
}