{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a577f859-1e85-40b0-8937-2d7de4b82e14", "code": "185568-16-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=185568-16-5", "code_system": "CAS", "references": [ "81d530eb-19a4-4d5d-a782-37881763c137", "430c0aa1-01b7-4e20-b5fe-b8801efbc06a" ] }, { "uuid": "88f48cd8-68aa-40f7-be78-75e67a734af6", "code": "71587602", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587602", "code_system": "PUBCHEM", "references": [ "81d530eb-19a4-4d5d-a782-37881763c137" ] }, { "uuid": "c11fa08e-5424-413e-9985-6d6559fe1c7c", "code": "JV1IM71CBE", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "898d2e3e-4914-1737-3546-9dc8450acf7f", "code": "DTXSID40939981", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40939981", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "66f292a2-3a49-4c22-8103-5980355dc32a", "name": "(±)-ISODECYL IPDI", "stdName": "(+/-)-ISODECYL IPDI", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b19f4fe9-28fa-432e-b196-3280e9a9c7dd", "ef9fc9b9-5e91-47dd-9526-392f94479bde" ], "display_name": false }, { "uuid": "66be30a0-c233-4b2d-944c-68b3d3d7efda", "name": "CARBAMIC ACID, (3-((((ISODECYLOXY)CARBONYL)AMINO)METHYL)-3,5,5-TRIMETHYLCYCLOHEXYL)-, ISODECYL ESTER", "stdName": "CARBAMIC ACID, (3-((((ISODECYLOXY)CARBONYL)AMINO)METHYL)-3,5,5-TRIMETHYLCYCLOHEXYL)-, ISODECYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "93204f4d-465d-46ee-a7da-eac642235977", "ef9fc9b9-5e91-47dd-9526-392f94479bde" ], "display_name": false }, { "uuid": "14ede902-f9fe-4172-beb2-6c1c4c9c944e", "name": "DIBUTYLHEXYL IPDI", "stdName": "DIBUTYLHEXYL IPDI", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "70dafbc0-27b5-4e26-9dc1-b7ce77570e97", "93204f4d-465d-46ee-a7da-eac642235977", "ef9fc9b9-5e91-47dd-9526-392f94479bde" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "801a0518-8288-49bb-b5be-a486bcd8e133", "name_org": "INCI" } ] }, { "uuid": "afec61cc-cd50-4320-9480-71d989fc897e", "name": "DIBUTYLHEXYL ISOPHORONE DIISOCYANATE", "stdName": "DIBUTYLHEXYL ISOPHORONE DIISOCYANATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b19f4fe9-28fa-432e-b196-3280e9a9c7dd", "ef9fc9b9-5e91-47dd-9526-392f94479bde" ], "display_name": true }, { "uuid": "8f244158-f333-4888-b47f-d26807739d5d", "name": "ISODECYL IPDI", "stdName": "ISODECYL IPDI", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b19f4fe9-28fa-432e-b196-3280e9a9c7dd", "ef9fc9b9-5e91-47dd-9526-392f94479bde" ], "display_name": false }, { "uuid": "9d72c645-f085-40ea-81c6-68bb38ca83ac", "name": "MONODERM I-10", "stdName": "MONODERM I-10", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "93204f4d-465d-46ee-a7da-eac642235977", "ef9fc9b9-5e91-47dd-9526-392f94479bde" ], "display_name": false } ], "references": [ { "uuid": "93204f4d-465d-46ee-a7da-eac642235977", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ef9fc9b9-5e91-47dd-9526-392f94479bde", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b19f4fe9-28fa-432e-b196-3280e9a9c7dd", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "81d530eb-19a4-4d5d-a782-37881763c137", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391634000, "tags": [ "NOMEN" ] }, { "uuid": "fdf7c7ca-b54d-42b9-8d16-41c89a79c1a6", "citation": "SRS import [JV1IM71CBE]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JV1IM71CBE", "doc_type": "SRS", "public_domain": true, "document_date": 1493391634000, "tags": [ "NOMEN" ] }, { "uuid": "70dafbc0-27b5-4e26-9dc1-b7ce77570e97", "citation": "DIBUTYLHEXYL IPDI [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "430c0aa1-01b7-4e20-b5fe-b8801efbc06a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "19ac0244-5323-4bdb-9ff6-62af3c64dc6d", "id": "19ac0244-5323-4bdb-9ff6-62af3c64dc6d", "molfile": "\n Marvin 01132101312D \n\n 38 38 0 0 0 0 999 V2000\n 9.3917 -15.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2166 -15.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6292 -16.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4542 -16.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8667 -17.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4542 -17.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6292 -17.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2166 -18.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3917 -18.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6917 -17.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1041 -17.8664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9291 -17.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3417 -17.1519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3417 -18.5809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9291 -19.2953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3417 -20.0098 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 13.5664 -20.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9737 -19.4795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7489 -19.7617 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 15.8921 -20.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2602 -21.1044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8477 -21.8189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8921 -21.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4849 -20.8223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3809 -19.2314 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1561 -19.5135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2994 -20.3260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7881 -18.9832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5633 -19.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1953 -18.7351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9705 -19.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6025 -18.4870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3777 -18.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0097 -18.2388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0520 -17.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2768 -17.6405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1335 -16.8280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3583 -16.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 10 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 12 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 24 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 25 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 21 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 26 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 35 1 0 0 0 0\n 32 31 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 38 37 1 0 0 0 0\nM END", "smiles": "CCCCC(CCCC)COC(=O)NCC1(C)CC(CC(C)(C)C1)NC(=O)OCC(CCCC)CCCC", "formula": "C32H62N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "955cb431-a219-42a9-aee2-caf253b4ddef" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "538.8469", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "ccb9b930-cb45-4207-a92e-67b8a24467dd", "version": "4", "structure": { "id": "bd3b4237-72ea-476d-9afe-33408fcfecce", "molfile": "\n Marvin 01132109472D \n\n 38 38 0 0 0 0 999 V2000\n 10.6292 -16.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4542 -16.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8667 -17.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4542 -17.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6292 -17.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6917 -17.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1041 -17.8664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9291 -17.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3417 -18.5809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9291 -19.2953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3417 -20.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9737 -19.4795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7489 -19.7617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3809 -19.2314 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1561 -19.5135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2994 -20.3260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7881 -18.9832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5633 -19.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1953 -18.7351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0520 -17.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2768 -17.6405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9705 -19.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.6025 -18.4870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3777 -18.7691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0097 -18.2388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8921 -20.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2602 -21.1044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8477 -21.8189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8921 -21.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4849 -20.8223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5664 -20.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3417 -17.1519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2166 -15.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3917 -15.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3583 -16.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1335 -16.8280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3917 -18.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2166 -18.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 3 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 13 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 27 30 1 0 0 0 0\n 30 11 1 0 0 0 0\n 11 31 1 0 0 0 0\n 8 32 2 0 0 0 0\n 1 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 21 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 5 38 1 0 0 0 0\nM END", "smiles": "CCCCC(CCCC)COC(=O)NCC1(C)CC(CC(C)(C)C1)NC(=O)OCC(CCCC)CCCC", "formula": "C32H62N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "538.8469", "optical_activity": "UNSPECIFIED", "references": [ "fdf7c7ca-b54d-42b9-8d16-41c89a79c1a6", "93204f4d-465d-46ee-a7da-eac642235977" ], "stereo_centers": 2 }, "unii": "JV1IM71CBE" } ] }