{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2647e8f5-53d3-48b3-b0fe-d89e813d3113",
          "code": "34175-96-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=34175-96-7",
          "code_system": "CAS",
          "references": [
            "1d6c368b-690f-455e-a98c-552f85431d6a",
            "3b2bd4be-a3fb-4713-9147-11e26a8779bb"
          ]
        },
        {
          "uuid": "28cb32b0-8866-4d19-8252-65bb6b78a2a7",
          "code": "115049",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/115049",
          "code_system": "PUBCHEM",
          "references": [
            "1d6c368b-690f-455e-a98c-552f85431d6a"
          ]
        },
        {
          "uuid": "5105b4dd-6746-1f75-d0b8-4d9554d1f1f3",
          "code": "DTXSID70955715",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70955715",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "cd50a1d5-6cbc-4d1e-9aca-4eaf3c215bd5",
          "code": "JUQ6ED3KYL",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "3b2bd4be-a3fb-4713-9147-11e26a8779bb"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "95c31464-e24f-455a-95fd-1d35cf4c61b0",
          "amount": {
            "uuid": "b82f58a6-56c1-4443-95e6-0ab06c2463c8"
          },
          "type": "RACEMATE->ENANTIOMER",
          "references": [
            "5582663b-06cb-4c9a-9882-b88dfa35c2c6"
          ],
          "related_substance": {
            "uuid": "6e62c0d9-9f7a-486c-a28c-94e5c4a3aa7c",
            "refuuid": "7f9b9318-9518-4eba-8ad8-ed7d84657dec",
            "name": "Pterosin B, (±)-",
            "unii": "DLS4YMJ3MM",
            "linking_id": "DLS4YMJ3MM",
            "ref_pname": "Pterosin B, (±)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a9c960ad-d752-4aa3-a6b7-4690e00b355c",
          "name": "(2R)-2,3-Dihydro-6-(2-hydroxyethyl)-2,5,7-trimethyl-1H-inden-1-one",
          "stdName": "(2R)-2,3-DIHYDRO-6-(2-HYDROXYETHYL)-2,5,7-TRIMETHYL-1H-INDEN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b2bd4be-a3fb-4713-9147-11e26a8779bb"
          ],
          "display_name": false
        },
        {
          "uuid": "34567ea4-a1d6-499d-ad12-f4191496ffdc",
          "name": "1H-Inden-1-one, 2,3-dihydro-6-(2-hydroxyethyl)-2,5,7-trimethyl-, (2R)-",
          "stdName": "1H-INDEN-1-ONE, 2,3-DIHYDRO-6-(2-HYDROXYETHYL)-2,5,7-TRIMETHYL-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b2bd4be-a3fb-4713-9147-11e26a8779bb"
          ],
          "display_name": false
        },
        {
          "uuid": "1afa3c6a-ca4e-4db4-8be3-853413bc4bbf",
          "name": "2,3-Dihydro-6-(2-hydroxyethyl)-2,5,7-trimethyl-1H-inden-1-one, (2R)-",
          "stdName": "2,3-DIHYDRO-6-(2-HYDROXYETHYL)-2,5,7-TRIMETHYL-1H-INDEN-1-ONE, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b2bd4be-a3fb-4713-9147-11e26a8779bb"
          ],
          "display_name": false
        },
        {
          "uuid": "e8b1ef00-4a8a-444c-bd21-4635ae8e9f6c",
          "name": "Pterosin B",
          "stdName": "PTEROSIN B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e6cc9c2-73e7-458d-b701-be267d244478"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "6e6cc9c2-73e7-458d-b701-be267d244478",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d6c368b-690f-455e-a98c-552f85431d6a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392075000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b2bd4be-a3fb-4713-9147-11e26a8779bb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "5582663b-06cb-4c9a-9882-b88dfa35c2c6",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f8882028-9057-4aff-8e9f-dbac70eeb16a",
          "id": "f8882028-9057-4aff-8e9f-dbac70eeb16a",
          "molfile": "\n  Marvin  01132112532D          \n\n 16 17  0  0  1  0            999 V2000\n    4.9840   -1.2346    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.6895   -0.8193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9840   -2.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5559   -2.0710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8391   -2.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1279   -2.0710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4167   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1279   -1.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4167   -0.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7112   -1.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8391   -0.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8334   -0.0114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5502   -1.2403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2614   -0.8193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2557    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 15  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n 14  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 12  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\nM  END",
          "smiles": "Cc1cc2C[C@@H](C)C(=O)c2c(C)c1CCO",
          "formula": "C14H18O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ff7e4184-159b-46c5-b087-a55a49f3b426"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "218.292",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b1602b23-aadd-4660-9c9b-3fc1867be576",
      "version": "6",
      "structure": {
        "id": "18a051b9-1f7f-448a-868d-e7520ae819f4",
        "molfile": "\n   JSDraw209112416502D\n\n 16 17  0  0  1  0              0 V2000\n   20.0664   -5.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.4172   -6.1361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7692   -5.3561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1212   -6.1361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6084   -5.6577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5236   -6.9161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0836   -6.9161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6084   -8.1745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.0924   -9.6575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1212   -7.6961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7692   -8.4761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7692  -10.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.4172   -7.6961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0664   -8.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7152   -7.6965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3644   -8.4767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  1  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n  4 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n  2 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc2C[C@@H](C)C(=O)c2c(C)c1CCO",
        "formula": "C14H18O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "218.292",
        "optical_activity": "( - )",
        "references": [
          "6e6cc9c2-73e7-458d-b701-be267d244478",
          "3b2bd4be-a3fb-4713-9147-11e26a8779bb"
        ],
        "stereo_centers": 1
      },
      "unii": "JUQ6ED3KYL"
    }
  ]
}