{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c0457325-973d-4e0c-b64e-538cb523952f",
          "code": "119-13-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=119-13-1",
          "code_system": "CAS",
          "references": [
            "e23831b2-c04f-4ad5-b7ac-e68dc10fe5fe",
            "e177c7d0-4c4f-470e-b26c-50d0b01da4c3"
          ]
        },
        {
          "uuid": "faee8df7-42bf-4d00-9b8f-0fe49cc9157a",
          "code": "C63645",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C63645",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e23831b2-c04f-4ad5-b7ac-e68dc10fe5fe"
          ]
        },
        {
          "uuid": "9d68f455-0269-4352-b2a5-13130fa58188",
          "code": "C479072",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67479072",
          "code_system": "MESH",
          "references": [
            "e23831b2-c04f-4ad5-b7ac-e68dc10fe5fe"
          ]
        },
        {
          "uuid": "5d7bec68-e4b4-4932-986f-6abd11ebea6d",
          "code": "DELTA-TOCOPHEROL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Delta-Tocopherol",
          "code_system": "WIKIPEDIA",
          "references": [
            "e23831b2-c04f-4ad5-b7ac-e68dc10fe5fe"
          ]
        },
        {
          "uuid": "c129f00b-c8e7-47e0-b0fb-8ab26874635a",
          "code": "204-299-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.909",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e23831b2-c04f-4ad5-b7ac-e68dc10fe5fe"
          ]
        },
        {
          "uuid": "8ff8343c-77bb-4ae4-ba69-7c50d5955870",
          "code": "m10926",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10926?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e23831b2-c04f-4ad5-b7ac-e68dc10fe5fe"
          ]
        },
        {
          "uuid": "69fbac1a-a249-47ef-af05-1e076228595d",
          "code": "92094",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92094",
          "code_system": "PUBCHEM",
          "references": [
            "e23831b2-c04f-4ad5-b7ac-e68dc10fe5fe"
          ]
        },
        {
          "uuid": "3e8adb30-1089-9edb-c8f9-aad1810b3ee3",
          "code": "DTXSID1046263",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1046263",
          "code_system": "EPA CompTox",
          "references": [
            "df35540c-c44d-f778-06ca-57670e59d93a"
          ]
        },
        {
          "uuid": "41e0df3d-70bc-4a7e-25fd-af034b85613d",
          "code": "C68313",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Tocopherol",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68313",
          "code_system": "NCI_THESAURUS",
          "references": [
            "924fe2ef-45ae-8637-201d-186e60d59231"
          ]
        },
        {
          "uuid": "736b93e7-2bea-2932-8fbe-1b92f39b2e0d",
          "code": "2109747",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2109747/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0b23d7ed-1f19-ee38-5684-7ddfd738a254"
          ]
        },
        {
          "uuid": "82e6fb8a-40cb-eac4-c77a-a2e442dcb7db",
          "code": "2420 (Number of products:73)",
          "comments": "Dietary Supplement Label Database|vitamin|Vitamin E (delta tocopherol)",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2420&item=Vitamin E (delta tocopherol)",
          "code_system": "DSLD",
          "references": [
            "924fe2ef-45ae-8637-201d-186e60d59231"
          ]
        },
        {
          "uuid": "9ec94d86-711b-4cef-84c3-882226116044",
          "code": "JU84X1II0N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "416b5def-5480-3c07-b733-57cb439e8bbf",
          "code": "3108 (Number of products:50)",
          "comments": "Dietary Supplement Label Database|vitamin|Vitamin E (delta tocotrienol)",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3108&item=Vitamin E (delta tocotrienol)",
          "code_system": "DSLD",
          "references": [
            "924fe2ef-45ae-8637-201d-186e60d59231"
          ]
        },
        {
          "uuid": "d1cef889-8947-2905-1317-52a65807ec09",
          "code": "47772",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:47772",
          "code_system": "CHEBI",
          "references": [
            "924fe2ef-45ae-8637-201d-186e60d59231"
          ]
        },
        {
          "uuid": "e542829f-7b20-ff12-80d6-fe8d7a91b8b9",
          "code": "100000181908",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "821618f3-1499-4ef7-993c-f409ee135a03"
          ]
        },
        {
          "uuid": "7bafd760-e1f0-73b1-7756-31db24f19205",
          "code": "JU84X1II0N",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=JU84X1II0N",
          "code_system": "DAILYMED",
          "references": [
            "9d2c3425-0f4c-1999-2b85-3b0f3720a571"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fb356786-6911-4985-b655-afae55de64e0",
          "name": "(2R)-3,4-DIHYDRO-2,8-DIMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-OL",
          "stdName": "(2R)-3,4-DIHYDRO-2,8-DIMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e8999bc-af1c-4e1d-9122-bd9c1e0b9ad3",
            "ea7c6c10-f3c4-4144-9758-22d2b9b705a7"
          ],
          "display_name": false
        },
        {
          "uuid": "27aac4a2-5dba-48c3-a1bd-16bf35ebcd1d",
          "name": ".DELTA.-TOCOPHEROL",
          "stdName": ".DELTA.-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4bf4f6a6-8b23-474b-ac0f-464592e91fc6",
            "22109ae5-f8fa-4cfa-8cf1-da8ba7c39b3f",
            "faced694-dd59-434b-816a-99374a7d94f6",
            "ea7c6c10-f3c4-4144-9758-22d2b9b705a7"
          ],
          "display_name": true
        },
        {
          "uuid": "c998fd36-99c6-4779-b621-f52706d9094b",
          "name": ".DELTA.-TOCOPHEROL [MI]",
          "stdName": ".DELTA.-TOCOPHEROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22109ae5-f8fa-4cfa-8cf1-da8ba7c39b3f",
            "ea7c6c10-f3c4-4144-9758-22d2b9b705a7"
          ],
          "display_name": false
        },
        {
          "uuid": "aed26e6f-1dff-4793-9393-32f5a160f67a",
          "name": "8-METHYLTOCOL",
          "stdName": "8-METHYLTOCOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e8999bc-af1c-4e1d-9122-bd9c1e0b9ad3",
            "ea7c6c10-f3c4-4144-9758-22d2b9b705a7"
          ],
          "display_name": false
        },
        {
          "uuid": "8718aac7-1127-45e2-b5f1-36c9d3405375",
          "name": "DELTA-TOCOPHEROL",
          "stdName": "DELTA-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e8999bc-af1c-4e1d-9122-bd9c1e0b9ad3",
            "39f85f0a-7dc2-4a8c-a1e7-ad13fc17eb71",
            "4bbb8c18-2bf2-4557-8560-03470903fba8",
            "ea7c6c10-f3c4-4144-9758-22d2b9b705a7"
          ],
          "display_name": false
        },
        {
          "uuid": "1b0c6c8f-1f72-4532-916b-8434b0ac6c1a",
          "name": "DELTA-TOCOPHEROL (CONSTITUENT OF LYCOPENE AND TOMATO EXTRACT CONTAINING LYCOPENE) [DSC]",
          "stdName": "DELTA-TOCOPHEROL (CONSTITUENT OF LYCOPENE AND TOMATO EXTRACT CONTAINING LYCOPENE) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4bf4f6a6-8b23-474b-ac0f-464592e91fc6",
            "ea7c6c10-f3c4-4144-9758-22d2b9b705a7"
          ],
          "display_name": false
        },
        {
          "uuid": "8624fd12-a846-4749-99c6-24c3404623f7",
          "name": "DELTA-TOCOPHEROL, D-",
          "stdName": "DELTA-TOCOPHEROL, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e8999bc-af1c-4e1d-9122-bd9c1e0b9ad3"
          ],
          "display_name": false
        },
        {
          "uuid": "f72967ef-5544-4b1a-7ab3-e747ea3777bb",
          "name": "Delta-tocopherol [WHO-DD]",
          "stdName": "DELTA-TOCOPHEROL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb31a920-ff77-ae17-f718-fedca11d7c1a"
          ],
          "display_name": false
        },
        {
          "uuid": "d57690bc-da18-40bb-9e59-cd0fabce997a",
          "name": "J5.309K",
          "stdName": "J5.309K",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0261b94d-f85a-4ee7-9370-e3e8d38a453f",
            "ea7c6c10-f3c4-4144-9758-22d2b9b705a7"
          ],
          "display_name": false
        },
        {
          "uuid": "c72c113f-55ce-9066-9953-1369fc7fd387",
          "name": "RRR-.ALPHA.-TOCOPHEROL IMPURITY A [EP IMPURITY]",
          "stdName": "RRR-.ALPHA.-TOCOPHEROL IMPURITY A [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e111365-c2d5-46be-97dc-4ea6109f9d86",
            "ea7c6c10-f3c4-4144-9758-22d2b9b705a7"
          ],
          "display_name": false
        },
        {
          "uuid": "86883508-fbb3-40b0-9ecf-8b0a57475c77",
          "name": "RRR-.DELTA.-TOCOPHEROL",
          "stdName": "RRR-.DELTA.-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e111365-c2d5-46be-97dc-4ea6109f9d86",
            "ea7c6c10-f3c4-4144-9758-22d2b9b705a7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6e8999bc-af1c-4e1d-9122-bd9c1e0b9ad3",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ea7c6c10-f3c4-4144-9758-22d2b9b705a7",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4bf4f6a6-8b23-474b-ac0f-464592e91fc6",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22109ae5-f8fa-4cfa-8cf1-da8ba7c39b3f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4bbb8c18-2bf2-4557-8560-03470903fba8",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e111365-c2d5-46be-97dc-4ea6109f9d86",
          "citation": "EP 7.8",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0261b94d-f85a-4ee7-9370-e3e8d38a453f",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J5.309K",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J5.309K",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e23831b2-c04f-4ad5-b7ac-e68dc10fe5fe",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390831000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92b4e8f5-af91-4062-b4f2-b5f154da58d4",
          "citation": "USP-DSC",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cfd759bb-bbbd-43e6-865f-81616b0557f1",
          "citation": "SRS import [JU84X1II0N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JU84X1II0N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390831000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "faced694-dd59-434b-816a-99374a7d94f6",
          "citation": ".DELTA.-TOCOPHEROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "39f85f0a-7dc2-4a8c-a1e7-ad13fc17eb71",
          "citation": "DELTA-TOCOPHEROL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "df35540c-c44d-f778-06ca-57670e59d93a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=119-13-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "924fe2ef-45ae-8637-201d-186e60d59231",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e177c7d0-4c4f-470e-b26c-50d0b01da4c3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0b23d7ed-1f19-ee38-5684-7ddfd738a254",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "9d2c3425-0f4c-1999-2b85-3b0f3720a571",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "cb31a920-ff77-ae17-f718-fedca11d7c1a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "821618f3-1499-4ef7-993c-f409ee135a03",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3969c49c-e886-493d-89f5-7d51d9567221",
          "id": "3969c49c-e886-493d-89f5-7d51d9567221",
          "molfile": "\n  Marvin  01132103032D          \n\n 29 30  0  0  1  0            999 V2000\n    6.5945   -0.0233    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.6101   -0.8794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3417    0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0421   -0.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7659    0.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5130   -0.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5130   -0.8405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2057    0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8708    0.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1781   -0.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4543    0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7435   -0.0233    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.7305   -0.8405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0379    0.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2985   -0.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6136    0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8821   -0.0233    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    0.8821    0.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8821   -0.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1816   -1.2608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5110   -0.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2348   -1.2608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9742   -0.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6824   -1.2608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9742   -0.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2348    0.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2348    1.2141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5110   -0.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1816    0.3736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  9  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  1  0  0  0\n 19 17  1  0  0  0  0\n 17 29  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 28  2  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 23 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 27 26  1  0  0  0  0\n 26 28  1  0  0  0  0\n 29 28  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2cc(cc(C)c2O1)O",
          "formula": "C27H46O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f0b523b9-5058-48ee-857d-a5680345adb0"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "402.654",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "301ba6e1-f3fd-4a1f-8e9e-e35c29755f41",
      "version": "15",
      "structure": {
        "id": "36aff46a-eb39-491b-a6c1-4c76f19159de",
        "molfile": "\n  Marvin  01132102552D          \n\n 29 30  0  0  1  0            999 V2000\n   -0.5110   -0.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1816    0.3736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5110   -0.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2348    0.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8821   -0.0233    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -1.2348   -1.2608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9742   -0.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9742   -0.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1816   -1.2608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8821   -0.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6824   -1.2608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2348    1.2141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6136    0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2985   -0.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1781   -0.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0421   -0.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8821    0.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7659    0.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0379    0.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8708    0.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3417    0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4543    0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7435   -0.0233    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5945   -0.0233    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.5130   -0.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5130   -0.8405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2057    0.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6101   -0.8794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7305   -0.8405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  4  2  0  0  0  0\n  8  6  2  0  0  0  0\n  9  3  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12  4  1  0  0  0  0\n  5 13  1  6  0  0  0\n 14 13  1  0  0  0  0\n 15 22  1  0  0  0  0\n 16 21  1  0  0  0  0\n  5 17  1  1  0  0  0\n 18 16  1  0  0  0  0\n 19 14  1  0  0  0  0\n 20 15  1  0  0  0  0\n 21 24  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 19  1  0  0  0  0\n 24 20  1  0  0  0  0\n 25 18  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 25  1  0  0  0  0\n 24 28  1  1  0  0  0\n 23 29  1  1  0  0  0\n 10  5  1  0  0  0  0\n  8  7  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2cc(cc(C)c2O1)O",
        "formula": "C27H46O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "402.654",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "6e8999bc-af1c-4e1d-9122-bd9c1e0b9ad3",
          "cfd759bb-bbbd-43e6-865f-81616b0557f1"
        ],
        "stereo_centers": 3
      },
      "unii": "JU84X1II0N"
    }
  ]
}