{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "735668c0-dbbb-437d-8852-94aabe377a3d",
          "code": "1987-71-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1987-71-9",
          "code_system": "CAS",
          "references": [
            "ce055695-b7b4-4c44-8d6a-76a6a01eedb9",
            "8202d18f-8264-4680-a778-4faff2cb57d9"
          ]
        },
        {
          "uuid": "8f7ecf45-3a0f-486e-bf71-373bedafc297",
          "code": "21 CFR 172.310",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart D--Special Dietary and Nutritional Additives|Sec. 172.315 Nicotinamide-ascorbic acid complex.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.315",
          "code_system": "CFR",
          "references": [
            "ce055695-b7b4-4c44-8d6a-76a6a01eedb9"
          ]
        },
        {
          "uuid": "bbe8e9ae-ed77-47aa-8f3d-f4c49a58d15c",
          "code": "1363721",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1363721/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ce055695-b7b4-4c44-8d6a-76a6a01eedb9"
          ]
        },
        {
          "uuid": "39cff049-ef6d-4e77-ae8d-8b49086c4f1a",
          "code": "m7878",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7878?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ce055695-b7b4-4c44-8d6a-76a6a01eedb9"
          ]
        },
        {
          "uuid": "577ccda1-389e-4276-956b-19e9790859f5",
          "code": "SUB48277",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ce055695-b7b4-4c44-8d6a-76a6a01eedb9"
          ]
        },
        {
          "uuid": "a32a06b3-5d95-4521-b7d1-2a6c7c3edb69",
          "code": "54710212",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54710212",
          "code_system": "PUBCHEM",
          "references": [
            "ce055695-b7b4-4c44-8d6a-76a6a01eedb9"
          ]
        },
        {
          "uuid": "19afaa9d-91a3-730e-9c18-0e86af59b532",
          "code": "DTXSID90872475",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90872475",
          "code_system": "EPA CompTox",
          "references": [
            "d8bbd0c5-f309-d860-9ca2-9cce7fbd1a0f"
          ]
        },
        {
          "uuid": "ac1b76c9-d926-3ca0-a2c0-58688e374489",
          "code": "DB14486",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14486",
          "code_system": "DRUG BANK",
          "references": [
            "cbec2fba-8e89-8f24-60c2-0678e3d07a34"
          ]
        },
        {
          "uuid": "21c1d760-b518-4b1d-ba62-44b1650fab49",
          "code": "JTL8B7TVW7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3aef5437-a7f6-286a-ccb1-658d2ef5f070",
          "code": "3103 (Number of products:9)",
          "comments": "Dietary Supplement Label Database|chemical|Niacinamide ascorbate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3103&item=Niacinamide ascorbate",
          "code_system": "DSLD",
          "references": [
            "cbec2fba-8e89-8f24-60c2-0678e3d07a34"
          ]
        },
        {
          "uuid": "103baf07-f171-9acc-fc0f-6b365d4c14bb",
          "code": "100000132794",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f01f685c-260c-4727-70b0-f61a2fd5fa60"
          ]
        },
        {
          "uuid": "2bf90a81-c9e2-6797-4b44-a023834444b6",
          "code": "13130",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=13130",
          "code_system": "NSC",
          "references": [
            "fe18949f-3492-3bbd-8655-112e46f42772"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1fd2c75b-213a-40ce-84f2-ff202af03c68",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a4adb473-329e-4e2e-8855-424e1357bff7",
            "refuuid": "57ca4d1b-fb8c-4302-8789-70655308ebc1",
            "name": "ASCORBIC ACID",
            "unii": "PQ6CK8PD0R",
            "linking_id": "PQ6CK8PD0R",
            "ref_pname": "ASCORBIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "70c1f2a8-aaa1-457a-a642-2b6c9615a8b3",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "116b1a99-eab0-4e2a-ad1f-2d2d4d2ebb0e",
            "refuuid": "29c1f526-9f37-4821-be3b-f1922c0ea9c1",
            "name": "NIACINAMIDE",
            "unii": "25X51I8RD4",
            "linking_id": "25X51I8RD4",
            "ref_pname": "NIACINAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "803fbc89-c11b-4aea-aa4c-e8613194b81d",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "e819fb35-c6f5-4084-a633-573d8f2e24cd",
            "refuuid": "57ca4d1b-fb8c-4302-8789-70655308ebc1",
            "name": "ASCORBIC ACID",
            "unii": "PQ6CK8PD0R",
            "linking_id": "PQ6CK8PD0R",
            "ref_pname": "ASCORBIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "375d09f6-e8fb-41fc-a2c7-7acc4dad7ec8",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "1f6da42e-cd10-41c1-8ebf-bd23ca423172",
            "refuuid": "29c1f526-9f37-4821-be3b-f1922c0ea9c1",
            "name": "NIACINAMIDE",
            "unii": "25X51I8RD4",
            "linking_id": "25X51I8RD4",
            "ref_pname": "NIACINAMIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ce1c6b17-38a0-4d92-a2d1-2bc9431a13e6",
          "name": "NIACINAMIDE ASCORBATE",
          "stdName": "NIACINAMIDE ASCORBATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0547012b-311d-4cc9-bdce-d0261ccccfae",
            "eee0d5ce-da21-405c-8423-acf0a756b4ca",
            "b96e2aca-6c05-466f-bb93-5fe03407cdcd",
            "6bd70f4e-d535-497a-a498-b66f760f4992",
            "f7f7098c-f9d7-491a-b971-3cfb64bb0881",
            "7b08cbf7-e0c8-41d6-afb1-8326b70c7c6f",
            "84c338a0-57b9-47a9-8ca3-eb15cc2664e0"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e1ae1af5-d957-45c5-866a-12d354c54909",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f88a5d81-cc8a-468f-9d75-42986a7818ae",
          "name": "NIACINAMIDE ASCORBATE [FCC]",
          "stdName": "NIACINAMIDE ASCORBATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bd70f4e-d535-497a-a498-b66f760f4992",
            "7b08cbf7-e0c8-41d6-afb1-8326b70c7c6f"
          ],
          "display_name": false
        },
        {
          "uuid": "783ca0be-eb59-4dd6-bc1c-4da27647bed7",
          "name": "NIACINAMIDE L-ASCORBATE",
          "stdName": "NIACINAMIDE L-ASCORBATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1a2fe8b-d6db-4aaf-b7ea-d423c8922a56",
            "6bd70f4e-d535-497a-a498-b66f760f4992"
          ],
          "display_name": false
        },
        {
          "uuid": "57d0e677-ea5a-4ddf-96a4-3609505bab86",
          "name": "NICOSCORBINE",
          "stdName": "NICOSCORBINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b96e2aca-6c05-466f-bb93-5fe03407cdcd",
            "6bd70f4e-d535-497a-a498-b66f760f4992"
          ],
          "display_name": false
        },
        {
          "uuid": "0a3f84b6-2e5e-407d-924f-10dca9e346a9",
          "name": "NICOTINAMIDE ASCORBATE",
          "stdName": "NICOTINAMIDE ASCORBATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60908e23-fafc-4cdf-b23d-8bcc37d2461d",
            "b1746963-62f5-49fa-9a93-6fd3a5faedaa",
            "ac3a3f42-f99c-4d6c-9687-7390f19bc321",
            "50d9c645-1380-4aa6-b80a-631f26bf458b",
            "6bd70f4e-d535-497a-a498-b66f760f4992",
            "9078fc66-c911-4e61-a035-c27b8916c6e3"
          ],
          "display_name": false
        },
        {
          "uuid": "57482638-3570-41ef-85cd-58eda454a1a4",
          "name": "NICOTINAMIDE ASCORBATE [MART.]",
          "stdName": "NICOTINAMIDE ASCORBATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50d9c645-1380-4aa6-b80a-631f26bf458b",
            "6bd70f4e-d535-497a-a498-b66f760f4992"
          ],
          "display_name": false
        },
        {
          "uuid": "e4085b5b-a07a-4be1-9fb8-83a270a080c8",
          "name": "NICOTINAMIDE COMPD WITH ASCORBIC ACID",
          "stdName": "NICOTINAMIDE COMPD WITH ASCORBIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b96e2aca-6c05-466f-bb93-5fe03407cdcd",
            "6bd70f4e-d535-497a-a498-b66f760f4992",
            "e820689a-092a-4642-92e4-be0b3c6d2785"
          ],
          "display_name": false
        },
        {
          "uuid": "b65fcb5e-e150-4c2c-9565-1617c2f753e2",
          "name": "NICOTINAMIDE COMPD WITH ASCORBIC ACID [MI]",
          "stdName": "NICOTINAMIDE COMPD WITH ASCORBIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b96e2aca-6c05-466f-bb93-5fe03407cdcd",
            "6bd70f4e-d535-497a-a498-b66f760f4992"
          ],
          "display_name": false
        },
        {
          "uuid": "5c5199c7-f6c1-4413-8fac-0071a770b02d",
          "name": "NSC-13130",
          "stdName": "NSC-13130",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eda195ab-fa8a-4eda-8a23-54421761862e",
            "6bd70f4e-d535-497a-a498-b66f760f4992"
          ],
          "display_name": false
        },
        {
          "uuid": "1cfe0899-9729-06fd-1a4d-d64e7b04cf0d",
          "name": "Nicotinamide ascorbate [WHO-DD]",
          "stdName": "NICOTINAMIDE ASCORBATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f298632d-fe4c-8557-c1f2-060f906c78fc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b96e2aca-6c05-466f-bb93-5fe03407cdcd",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0547012b-311d-4cc9-bdce-d0261ccccfae",
          "citation": "OTC",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50d9c645-1380-4aa6-b80a-631f26bf458b",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1746963-62f5-49fa-9a93-6fd3a5faedaa",
          "citation": "INN BAN",
          "doc_type": "MARTINDALE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6bd70f4e-d535-497a-a498-b66f760f4992",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1a2fe8b-d6db-4aaf-b7ea-d423c8922a56",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b08cbf7-e0c8-41d6-afb1-8326b70c7c6f",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eee0d5ce-da21-405c-8423-acf0a756b4ca",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac3a3f42-f99c-4d6c-9687-7390f19bc321",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eda195ab-fa8a-4eda-8a23-54421761862e",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce055695-b7b4-4c44-8d6a-76a6a01eedb9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd06c1ec-aa1c-4864-a045-4986ff6d3b9a",
          "citation": "SRS import [JTL8B7TVW7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JTL8B7TVW7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60908e23-fafc-4cdf-b23d-8bcc37d2461d",
          "citation": "NICOTINAMIDE ASCORBATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f7f7098c-f9d7-491a-b971-3cfb64bb0881",
          "citation": "NIACINAMIDE ASCORBATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "84c338a0-57b9-47a9-8ca3-eb15cc2664e0",
          "citation": "NIACINAMIDE ASCORBATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9078fc66-c911-4e61-a035-c27b8916c6e3",
          "citation": "NICOTINAMIDE ASCORBATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e820689a-092a-4642-92e4-be0b3c6d2785",
          "citation": "NICOTINAMIDE COMPD WITH ASCORBIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d8bbd0c5-f309-d860-9ca2-9cce7fbd1a0f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1987-71-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8202d18f-8264-4680-a778-4faff2cb57d9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cbec2fba-8e89-8f24-60c2-0678e3d07a34",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fe18949f-3492-3bbd-8655-112e46f42772",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f298632d-fe4c-8557-c1f2-060f906c78fc",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "82a15392-c667-0e9b-4f1c-538d01d97583",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "f01f685c-260c-4727-70b0-f61a2fd5fa60",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2277fb40-19b4-4bb2-8018-fd6da738aa12",
          "id": "2277fb40-19b4-4bb2-8018-fd6da738aa12",
          "molfile": "\n  Marvin  01132101562D          \n\n  9  9  0  0  1  0            999 V2000\n    0.5806   -3.3528    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1304   -2.9419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1304   -2.1201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8369   -3.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5523   -2.9466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2633   -3.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2633   -4.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5523   -4.5946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8369   -4.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  9  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\nM  END",
          "smiles": "c1cc(cnc1)C(=O)N",
          "formula": "C6H6N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7c8fccb0-fe88-40a5-9300-0d1aa691721a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "122.1249",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "a5838cfb-bd49-407a-8b6d-2ed949ae94d6",
          "id": "a5838cfb-bd49-407a-8b6d-2ed949ae94d6",
          "molfile": "\n  Marvin  01132108362D          \n\n 12 12  0  0  1  0            999 V2000\n    4.8802   -3.1708    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.5446   -3.6506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8802   -2.3449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5769   -1.9113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1696   -3.5907    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.5099   -3.1016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8455   -3.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0519   -3.3415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0947   -4.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6103   -5.0395    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9205   -4.3751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4003   -5.0440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  3  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  2  0  0  0  0\nM  END",
          "smiles": "C([C@@H]([C@@H]1C(=O)C(=C(O)O1)O)O)O",
          "formula": "C6H8O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4df18bd2-a5e2-4026-a798-3a3d6df823db"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "176.1244",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "01d4b89a-db90-4814-ad8f-16dfe90e3e70",
      "version": "13",
      "structure": {
        "id": "ea697214-9520-4891-9ed7-9e751a381727",
        "molfile": "\n  Marvin  01132112082D          \n\n 22 22  0  0  1  0            999 V2000\n    3.0966   -4.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9229   -4.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1722   -3.5929    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.8278   -4.0915    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5121   -3.1035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8473   -3.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0532   -3.3436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8832   -3.1728    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.5480   -3.6529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8832   -2.3464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5804   -1.9125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4030   -5.0471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6119   -5.0426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1304   -2.9419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8369   -3.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8369   -4.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5523   -4.5946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2633   -4.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2633   -3.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5523   -2.9466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1304   -2.1201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5806   -3.3528    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  8  3  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  1  6  0  0  0\n 11 10  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  1  1  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  6  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 15  2  0  0  0  0\n 21 14  2  0  0  0  0\n 22 14  1  0  0  0  0\nM  END",
        "smiles": "c1cc(cnc1)C(=O)N.C([C@@H]([C@]1([H])C(=C(C(=O)O1)O)O)O)O",
        "formula": "C6H8O6.C6H6N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "298.2492",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b96e2aca-6c05-466f-bb93-5fe03407cdcd",
          "cd06c1ec-aa1c-4864-a045-4986ff6d3b9a"
        ],
        "stereo_centers": 2
      },
      "unii": "JTL8B7TVW7"
    }
  ]
}