{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a010f3b6-e731-4e9e-8c53-81970c9f28bf",
          "code": "74115-24-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=74115-24-5",
          "code_system": "CAS",
          "references": [
            "ee340cd5-e2ee-47cf-8c32-014c44689a19",
            "17662bdb-1ba5-44cd-95d3-bdf7c4c9c126"
          ]
        },
        {
          "uuid": "76bbf3bc-db2d-47aa-9573-046707aa9e2a",
          "code": "C062106",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67062106",
          "code_system": "MESH",
          "references": [
            "ee340cd5-e2ee-47cf-8c32-014c44689a19"
          ]
        },
        {
          "uuid": "ae236379-9d08-4735-884f-274eb5cfc813",
          "code": "125501",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1850",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "ee340cd5-e2ee-47cf-8c32-014c44689a19"
          ]
        },
        {
          "uuid": "bfeefb8c-5022-4af1-a17f-3745c76dcfee",
          "code": "m3639",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3639?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ee340cd5-e2ee-47cf-8c32-014c44689a19"
          ]
        },
        {
          "uuid": "a2a26666-471f-43d9-b74d-f91ffe86b3fa",
          "code": "277-728-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.070.641",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ee340cd5-e2ee-47cf-8c32-014c44689a19"
          ]
        },
        {
          "uuid": "8fb3946e-af44-4752-871a-65c4d5df97e5",
          "code": "73670",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73670",
          "code_system": "PUBCHEM",
          "references": [
            "ee340cd5-e2ee-47cf-8c32-014c44689a19"
          ]
        },
        {
          "uuid": "1e2c8dfb-4737-80fc-f095-465db3f508c9",
          "code": "DTXSID9023881",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9023881",
          "code_system": "EPA CompTox",
          "references": [
            "e5b7b406-af03-d9f1-9170-fa7a696b417e"
          ]
        },
        {
          "uuid": "88b9aacb-206b-4c03-b97a-1749ddee8a94",
          "code": "JS4U0R0033",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "50b39e10-fcab-4e7b-f317-3d16fd1ca830",
          "code": "39315",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:39315",
          "code_system": "CHEBI",
          "references": [
            "3e306f8b-939a-3ce4-6441-c8a263f06d9c"
          ]
        },
        {
          "uuid": "a39db9ca-6f6e-52b0-bdcc-9b8b3fcdb016",
          "code": "clofentezine",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/clofentezine.html",
          "code_system": "ALANWOOD",
          "references": [
            "66a48359-a1db-dab3-14c7-9d422b839226"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e4139279-06ab-4562-b8e1-3c307076e8e3",
          "name": "3,6-BIS(2-CHLOROPHENYL)-1,2,4,5-TETRAZINE",
          "stdName": "3,6-BIS(2-CHLOROPHENYL)-1,2,4,5-TETRAZINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d1bb57c-683d-4d67-aad6-5083c37b5847",
            "ea5fbb47-96d6-40ad-bafd-34b0332763b2"
          ],
          "display_name": false
        },
        {
          "uuid": "9f16ca80-8b9a-4fe0-bd0e-4e92eb3633cb",
          "name": "APOLLO",
          "stdName": "APOLLO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39d9b88a-501c-4628-aa6b-b91ff0588f48",
            "b73bee39-9a7a-4350-885a-9eb0b182c11d"
          ],
          "display_name": false
        },
        {
          "uuid": "d6813335-6c33-48b7-9337-bf5f3d3bff3b",
          "name": "BISCLOFENTEZIN",
          "stdName": "BISCLOFENTEZIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d137f14d-8404-4471-a470-5af741720b8b",
            "39d9b88a-501c-4628-aa6b-b91ff0588f48"
          ],
          "display_name": false
        },
        {
          "uuid": "b6b64576-4db4-4d33-913c-700cacd8abce",
          "name": "CLOFENTEZINE",
          "stdName": "CLOFENTEZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39d9b88a-501c-4628-aa6b-b91ff0588f48",
            "3d7337f2-57db-45ab-9fae-e87287e47bad",
            "c389ebe3-688e-41a3-902f-a472e86a4f6d",
            "17f45346-133b-46bd-a8ce-82af49af6adc",
            "6c25e9ae-4a4f-4ffb-a5e6-f5c67093b31e",
            "96209cf3-9083-4c3c-a857-b284a69df9ae"
          ],
          "display_name": true
        },
        {
          "uuid": "33c3e25b-1b3a-4d67-94ef-c5cc207bd868",
          "name": "CLOFENTEZINE [ISO]",
          "stdName": "CLOFENTEZINE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39d9b88a-501c-4628-aa6b-b91ff0588f48",
            "c389ebe3-688e-41a3-902f-a472e86a4f6d"
          ],
          "display_name": false
        },
        {
          "uuid": "8b176a62-d176-4058-8915-5022dc6e6a23",
          "name": "CLOFENTEZINE [MI]",
          "stdName": "CLOFENTEZINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39d9b88a-501c-4628-aa6b-b91ff0588f48",
            "3d7337f2-57db-45ab-9fae-e87287e47bad"
          ],
          "display_name": false
        },
        {
          "uuid": "5215bb0c-814d-4f37-a7fb-68eb63a3b22e",
          "name": "NC-21314",
          "stdName": "NC-21314",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d137f14d-8404-4471-a470-5af741720b8b",
            "39d9b88a-501c-4628-aa6b-b91ff0588f48"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6c25e9ae-4a4f-4ffb-a5e6-f5c67093b31e",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6d1bb57c-683d-4d67-aad6-5083c37b5847",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea5fbb47-96d6-40ad-bafd-34b0332763b2",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d7337f2-57db-45ab-9fae-e87287e47bad",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39d9b88a-501c-4628-aa6b-b91ff0588f48",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d137f14d-8404-4471-a470-5af741720b8b",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b73bee39-9a7a-4350-885a-9eb0b182c11d",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c389ebe3-688e-41a3-902f-a472e86a4f6d",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee340cd5-e2ee-47cf-8c32-014c44689a19",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05b217c0-5263-4408-afb0-2f6eefe858d3",
          "citation": "SRS import [JS4U0R0033]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JS4U0R0033",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390951000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba9df4ce-1043-4666-9e81-82fe7257cc0a",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96209cf3-9083-4c3c-a857-b284a69df9ae",
          "citation": "CLOFENTEZINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "17f45346-133b-46bd-a8ce-82af49af6adc",
          "citation": "CLOFENTEZINE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e5b7b406-af03-d9f1-9170-fa7a696b417e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=74115-24-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "66a48359-a1db-dab3-14c7-9d422b839226",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "3e306f8b-939a-3ce4-6441-c8a263f06d9c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "17662bdb-1ba5-44cd-95d3-bdf7c4c9c126",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "25b56b45-15eb-4230-b50a-d47ce4f31ac9",
          "id": "25b56b45-15eb-4230-b50a-d47ce4f31ac9",
          "molfile": "\n  Marvin  01132102052D          \n\n 20 22  0  0  0  0            999 V2000\n    8.6809   -3.3530    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.0846   -4.0763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9131   -4.0763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3211   -4.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8947   -5.5064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0757   -5.5064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6653   -4.7853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8462   -4.7853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4198   -5.4847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5976   -5.4847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1929   -4.7854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6098   -4.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4337   -4.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4555   -4.7854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0431   -4.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2181   -4.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7987   -4.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2046   -5.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0450   -5.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4704   -6.1939    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 13  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 14 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 19 14  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(c(c1)-c2nnc(-c3ccccc3Cl)nn2)Cl",
          "formula": "C14H8Cl2N4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0f20c903-fcf1-4d23-aff9-ce690383133e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "303.1465",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b34cdf54-bd52-4749-8140-62835d2d5a83",
      "version": "5",
      "structure": {
        "id": "61f71809-74bc-4a93-b50e-5ec8d0566ee2",
        "molfile": "\n  Marvin  01132105052D          \n\n 20 22  0  0  0  0            999 V2000\n    4.2181   -4.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0431   -4.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4555   -4.7854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1929   -4.7854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5976   -5.4847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4198   -5.4847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8462   -4.7853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4337   -4.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6098   -4.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6653   -4.7853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0846   -4.0763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9131   -4.0763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3211   -4.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8947   -5.5064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0757   -5.5064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6809   -3.3530    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.0450   -5.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4704   -6.1939    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2046   -5.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7987   -4.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9  4  2  0  0  0  0\n  7 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 10 15  1  0  0  0  0\n 11 16  1  0  0  0  0\n 17  3  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  2  0  0  0  0\n 20 19  1  0  0  0  0\n  1 20  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(c(c1)-c2nnc(-c3ccccc3Cl)nn2)Cl",
        "formula": "C14H8Cl2N4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "303.1465",
        "optical_activity": "NONE",
        "references": [
          "05b217c0-5263-4408-afb0-2f6eefe858d3",
          "ba9df4ce-1043-4666-9e81-82fe7257cc0a"
        ],
        "stereo_centers": 0
      },
      "unii": "JS4U0R0033"
    }
  ]
}