{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9a01014b-8dfe-4844-9343-8f9c78e031e3",
          "code": "80-92-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=80-92-2",
          "code_system": "CAS",
          "references": [
            "38594e95-9e8e-4db3-8a5c-a04226844e2b",
            "13dffd16-ec0f-4616-b4f1-0b45e3358e78"
          ]
        },
        {
          "uuid": "673c3187-f474-4a18-80a5-4ecba368cfad",
          "code": "C82314",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C82314",
          "code_system": "NCI_THESAURUS",
          "references": [
            "38594e95-9e8e-4db3-8a5c-a04226844e2b"
          ]
        },
        {
          "uuid": "753ed9f8-26e5-473e-91fc-16bf468c48b6",
          "code": "D011276",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68011276",
          "code_system": "MESH",
          "references": [
            "38594e95-9e8e-4db3-8a5c-a04226844e2b"
          ]
        },
        {
          "uuid": "20678986-19cc-48e9-b45a-e2abf8346dda",
          "code": "PREGNANEDIOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pregnanediol",
          "code_system": "WIKIPEDIA",
          "references": [
            "38594e95-9e8e-4db3-8a5c-a04226844e2b"
          ]
        },
        {
          "uuid": "ed98aabb-a939-4928-8555-10b9c417ebd0",
          "code": "201-313-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.195",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "38594e95-9e8e-4db3-8a5c-a04226844e2b"
          ]
        },
        {
          "uuid": "8817b589-4585-4939-9579-8a535b024265",
          "code": "m9115",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9115?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "38594e95-9e8e-4db3-8a5c-a04226844e2b"
          ]
        },
        {
          "uuid": "ab06b490-5567-4dfa-ae3f-c6cda30253f8",
          "code": "SUB15006MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "38594e95-9e8e-4db3-8a5c-a04226844e2b"
          ]
        },
        {
          "uuid": "b8e3e636-15fc-4424-ad43-91e9f12f0a12",
          "code": "21 CFR 862.1605",
          "comments": "PART 862 -- CLINICAL CHEMISTRY AND CLINICAL TOXICOLOGY DEVICES|Subpart B--Clinical Chemistry Test Systems|Sec. 862.1605 Pregnanediol test system.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=862.1605",
          "code_system": "CFR",
          "references": [
            "38594e95-9e8e-4db3-8a5c-a04226844e2b"
          ]
        },
        {
          "uuid": "bd69680f-e3c0-4a2a-a4b4-f404f5f9d274",
          "code": "21 CFR 862.1430",
          "comments": "PART 862 -- CLINICAL CHEMISTRY AND CLINICAL TOXICOLOGY DEVICES|Subpart B--Clinical Chemistry Test Systems|Sec. 862.1430 17-Ketosteroids test system.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=862.1430",
          "code_system": "CFR",
          "references": [
            "38594e95-9e8e-4db3-8a5c-a04226844e2b"
          ]
        },
        {
          "uuid": "e517b37a-5623-49de-8f7b-2b8b257f7144",
          "code": "CHEMBL269897",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL269897",
          "code_system": "ChEMBL",
          "references": [
            "38594e95-9e8e-4db3-8a5c-a04226844e2b"
          ]
        },
        {
          "uuid": "c289791b-54b6-415b-92ee-bc293f9fe064",
          "code": "219833",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/219833",
          "code_system": "PUBCHEM",
          "references": [
            "38594e95-9e8e-4db3-8a5c-a04226844e2b"
          ]
        },
        {
          "uuid": "0fa77e6c-1d9d-ee2a-a3dd-13c31a6695a3",
          "code": "DTXSID6046218",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6046218",
          "code_system": "EPA CompTox",
          "references": [
            "c387c897-c365-8757-6996-9629f7cd310c"
          ]
        },
        {
          "uuid": "f2117681-dd7a-22d3-939a-c82c98013d68",
          "code": "C776",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Steroid Hormone[C1636]|Progestin",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C776",
          "code_system": "NCI_THESAURUS",
          "references": [
            "10ee2e90-10a6-6f35-5753-ae33f376b02b"
          ]
        },
        {
          "uuid": "9c0cb6d2-67fc-0aa4-2de2-ab8cb137e3d8",
          "code": "2833-2",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Pregnanediol [Mass/volume] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/2833-2/",
          "code_system": "LOINC",
          "references": [
            "10ee2e90-10a6-6f35-5753-ae33f376b02b"
          ]
        },
        {
          "uuid": "0b92fbb2-0294-95c6-7728-68ea7aa4087e",
          "code": "14885-8",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Pregnanediol [Moles/time] in 24 hour Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/14885-8/",
          "code_system": "LOINC",
          "references": [
            "10ee2e90-10a6-6f35-5753-ae33f376b02b"
          ]
        },
        {
          "uuid": "5ce694ac-458f-d973-bf84-e48ce5f6ab47",
          "code": "15091-2",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Pregnanediol [Moles/volume] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/15091-2/",
          "code_system": "LOINC",
          "references": [
            "10ee2e90-10a6-6f35-5753-ae33f376b02b"
          ]
        },
        {
          "uuid": "555e243d-c026-f6d5-315e-d4e7a272f8ec",
          "code": "2832-4",
          "comments": "LOINC|ACTIVE|CHEM|Amnio fld|Pregnanediol [Mass/volume] in Amniotic fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/2832-4/",
          "code_system": "LOINC",
          "references": [
            "10ee2e90-10a6-6f35-5753-ae33f376b02b"
          ]
        },
        {
          "uuid": "562be443-8820-349f-0e41-fa531344eeb6",
          "code": "2834-0",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Pregnanediol [Mass/time] in 24 hour Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/2834-0/",
          "code_system": "LOINC",
          "references": [
            "10ee2e90-10a6-6f35-5753-ae33f376b02b"
          ]
        },
        {
          "uuid": "90ce37a1-9012-cfbe-8c76-de49e807a5e1",
          "code": "34359-0",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Pregnanediol/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/34359-0/",
          "code_system": "LOINC",
          "references": [
            "10ee2e90-10a6-6f35-5753-ae33f376b02b"
          ]
        },
        {
          "uuid": "ed3f030d-4abd-6a42-dd40-aac24a7ad2e9",
          "code": "82894-7",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Pregnanediol/Tetrahydrocortisone+tetrahydrocortisol+5-alpha tetrahydrocortisol [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/82894-7/",
          "code_system": "LOINC",
          "references": [
            "10ee2e90-10a6-6f35-5753-ae33f376b02b"
          ]
        },
        {
          "uuid": "0a756ea9-2d5b-09af-5164-3ebc080a4607",
          "code": "34358-2",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Pregnanediol [Moles/volume] in 24 hour Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/34358-2/",
          "code_system": "LOINC",
          "references": [
            "10ee2e90-10a6-6f35-5753-ae33f376b02b"
          ]
        },
        {
          "uuid": "354fbe41-6bec-1e79-dd59-8579652dad85",
          "code": "82895-4",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Pregnanediol/Tetrahydrocortisone+tetrahydrocortisol+5-alpha tetrahydrocortisol [Molar ratio] in 24 hour Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/82895-4/",
          "code_system": "LOINC",
          "references": [
            "10ee2e90-10a6-6f35-5753-ae33f376b02b"
          ]
        },
        {
          "uuid": "3830e27f-29ef-4861-b34c-6e3750b072de",
          "code": "JR3JD1Y22C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fe7c8487-a34c-87ea-d533-60140bfbdd9f",
          "code": "100000078869",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8b4cf05c-dc24-84a9-9906-d59fce23af6b"
          ]
        },
        {
          "uuid": "1d2f4bbb-957b-b6fb-0ce3-3844ec551dd0",
          "code": "47462",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=47462",
          "code_system": "NSC",
          "references": [
            "2a338d4b-22d6-4e89-b096-8ca32fadf355"
          ]
        },
        {
          "uuid": "74248799-58f5-83ab-a602-4b9fedd0558e",
          "code": "1612",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=1612",
          "code_system": "NSC",
          "references": [
            "2a338d4b-22d6-4e89-b096-8ca32fadf355"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5edd0e99-160f-4849-bae3-e7bdc029e18d",
          "name": "(3.ALPHA.,5.BETA.,20.ALPHA.)-PREGNANE-3,20-DIOL",
          "stdName": "(3.ALPHA.,5.BETA.,20.ALPHA.)-PREGNANE-3,20-DIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66837cd4-4606-412c-808b-9738397f1d11"
          ],
          "display_name": false
        },
        {
          "uuid": "ba8455e8-2d9d-4994-9edf-261f01ed3d90",
          "name": "3.ALPHA.,20.ALPHA.-DIHYDROXY-5.BETA.-PREGNANE",
          "stdName": "3.ALPHA.,20.ALPHA.-DIHYDROXY-5.BETA.-PREGNANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "05ee4b4a-bf05-491d-824a-826a00347c45"
          ],
          "display_name": false
        },
        {
          "uuid": "5a4899e1-cc17-4fc4-a3b1-f4d50863e79a",
          "name": "5.BETA.-PREGNANE-3.ALPHA.,20.ALPHA.-DIOL",
          "stdName": "5.BETA.-PREGNANE-3.ALPHA.,20.ALPHA.-DIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66837cd4-4606-412c-808b-9738397f1d11"
          ],
          "display_name": false
        },
        {
          "uuid": "39e68aeb-529c-4826-87dc-26743cc89f62",
          "name": "DIOL",
          "stdName": "DIOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "05ee4b4a-bf05-491d-824a-826a00347c45"
          ],
          "display_name": false
        },
        {
          "uuid": "e6e717f0-b25d-4e4d-80a8-e04f904a443e",
          "name": "NSC-1612",
          "stdName": "NSC-1612",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3c72804-1e03-4689-a933-e4bf029393e0"
          ],
          "display_name": false
        },
        {
          "uuid": "0def42ca-fe07-40ea-b05a-d2d36d2c91a6",
          "name": "NSC-47462",
          "stdName": "NSC-47462",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3c72804-1e03-4689-a933-e4bf029393e0"
          ],
          "display_name": false
        },
        {
          "uuid": "42b2760d-241e-4bcb-a5af-1f0d1f3629e8",
          "name": "PREGNANDIOL",
          "stdName": "PREGNANDIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f11c151-3090-4bdb-9658-e2cf6b3543f9",
            "90aee9d2-a667-47ac-962e-f709b08abdfe",
            "cb489f4e-6c5f-4a22-860b-87df76bfc5cb",
            "971df21f-a798-40af-b26a-a584c9529043",
            "7322a863-46c0-473c-a2b4-c2b0f10f93ad"
          ],
          "display_name": true
        },
        {
          "uuid": "fd55908f-7b7c-4b20-b1fb-f02cd431f2d7",
          "name": "PREGNANDIOL [JAN]",
          "stdName": "PREGNANDIOL [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb489f4e-6c5f-4a22-860b-87df76bfc5cb"
          ],
          "display_name": false
        },
        {
          "uuid": "b6ebdef2-52e5-4056-bca3-ae1c72bfed6c",
          "name": "PREGNANE-3,20-DIOL, (3.ALPHA.,5.BETA.,20S)-",
          "stdName": "PREGNANE-3,20-DIOL, (3.ALPHA.,5.BETA.,20S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66837cd4-4606-412c-808b-9738397f1d11"
          ],
          "display_name": false
        },
        {
          "uuid": "302f62ec-f649-4ee7-a26a-6afcffad4a20",
          "name": "PREGNANEDIOL",
          "stdName": "PREGNANEDIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "723253ed-69e6-4f33-b1dd-acb55c52de12",
            "0c1f8c6d-4b43-4b60-963c-2bc4fc6f0cac"
          ],
          "display_name": false
        },
        {
          "uuid": "4dfe1abc-07cc-4beb-967f-f98f6e9228bd",
          "name": "PREGNANEDIOL [MI]",
          "stdName": "PREGNANEDIOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "723253ed-69e6-4f33-b1dd-acb55c52de12"
          ],
          "display_name": false
        },
        {
          "uuid": "d327f7df-ac51-7a16-b028-0a686d3ebb82",
          "name": "Pregnandiol [WHO-DD]",
          "stdName": "PREGNANDIOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b42d6c2a-10b0-8c69-f305-5e7618ee3ded"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9f11c151-3090-4bdb-9658-e2cf6b3543f9",
          "citation": "USP Dictionary 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cb489f4e-6c5f-4a22-860b-87df76bfc5cb",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05ee4b4a-bf05-491d-824a-826a00347c45",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "723253ed-69e6-4f33-b1dd-acb55c52de12",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66837cd4-4606-412c-808b-9738397f1d11",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7322a863-46c0-473c-a2b4-c2b0f10f93ad",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3c72804-1e03-4689-a933-e4bf029393e0",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38594e95-9e8e-4db3-8a5c-a04226844e2b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390779000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc02df6e-816c-4922-9e36-22861b582e78",
          "citation": "SRS import [JR3JD1Y22C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JR3JD1Y22C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390779000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "291b652a-6308-4695-9f01-9c550cf98561",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90aee9d2-a667-47ac-962e-f709b08abdfe",
          "citation": "PREGNANDIOL [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0c1f8c6d-4b43-4b60-963c-2bc4fc6f0cac",
          "citation": "PREGNANEDIOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "971df21f-a798-40af-b26a-a584c9529043",
          "citation": "PREGNANDIOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c387c897-c365-8757-6996-9629f7cd310c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=80-92-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "10ee2e90-10a6-6f35-5753-ae33f376b02b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "13dffd16-ec0f-4616-b4f1-0b45e3358e78",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2a338d4b-22d6-4e89-b096-8ca32fadf355",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b42d6c2a-10b0-8c69-f305-5e7618ee3ded",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8b4cf05c-dc24-84a9-9906-d59fce23af6b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fd83bcae-8962-4221-a5e2-9fb9cb2db9c4",
          "id": "fd83bcae-8962-4221-a5e2-9fb9cb2db9c4",
          "molfile": "\n  Marvin  01132113082D          \n\n 23 26  0  0  1  0            999 V2000\n    8.7321   -1.6349    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.1749   -1.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5543   -1.6349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4838   -2.4189    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.9627   -3.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4838   -3.7462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6894   -3.4942    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.9775   -3.9078    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.9775   -4.7350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2685   -5.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5568   -4.7350    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.8336   -5.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1178   -4.7350    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.4019   -5.1482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1178   -3.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8336   -3.4942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5568   -3.9078    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.5568   -3.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2685   -3.4942    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.2685   -2.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9775   -2.2573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6894   -2.6708    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.6894   -1.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  6  0  0  0\n  1  4  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4 22  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n 22  7  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 19  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  6  0  0  0\n 17 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  1  0  0  0\n 19 17  1  0  0  0  0\n 19 20  1  1  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  1  0  0  0\nM  END",
          "smiles": "C[C@@H]([C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@H](CC[C@]4(C)[C@H]3CC[C@]12C)O)O",
          "formula": "C21H36O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "01397141-4120-4fd5-b107-49a8382ca419"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "320.5101",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "053dac40-323f-44c2-ab3d-2ba1175544f0",
      "version": "20",
      "structure": {
        "id": "da206524-abbc-4243-9c66-6694547bce09",
        "molfile": "\n  Marvin  01132111192D          \n\n 28 31  0  0  1  0            999 V2000\n    6.2807   -3.5010    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.9910   -3.9154    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.9910   -3.0912    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7043   -3.5010    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.7043   -2.6760    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.5003   -2.4236    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.7490   -1.6381    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.1908   -1.0145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5728   -1.6381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9801   -3.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5003   -3.7535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3061   -2.6363    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9910   -2.2617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2807   -2.6760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7043   -1.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7043   -4.3228    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9910   -4.7442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2807   -5.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5676   -4.7442    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.8430   -5.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1258   -4.7442    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.1258   -3.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8430   -3.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5676   -3.9154    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.5676   -3.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4085   -5.1582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5676   -5.5682    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2807   -4.3228    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  1  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  6  0  0  0\n  6 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n  4 11  1  0  0  0  0\n  6 12  1  6  0  0  0\n 13  5  1  0  0  0  0\n 14 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n  5 15  1  1  0  0  0\n  4 16  1  6  0  0  0\n  2 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  1  0  0  0\n  1 24  1  0  0  0  0\n 24 19  1  0  0  0  0\n 21 26  1  6  0  0  0\n 19 27  1  1  0  0  0\n  1 28  1  6  0  0  0\nM  END",
        "smiles": "C[C@@H]([C@@]1([H])CC[C@@]2([H])[C@]3([H])CC[C@]4([H])C[C@@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)O)O",
        "formula": "C21H36O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "320.5101",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bc02df6e-816c-4922-9e36-22861b582e78",
          "291b652a-6308-4695-9f01-9c550cf98561"
        ],
        "stereo_centers": 9
      },
      "unii": "JR3JD1Y22C"
    }
  ]
}