{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1ccffd5f-bc04-4de9-a4e9-b92111775bf1",
          "code": "SUB10211MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7332f342-2bdf-497b-b064-115590f4349f"
          ]
        },
        {
          "uuid": "c05b7548-424e-4048-a14c-49b9f900c92f",
          "code": "1612",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1612",
          "code_system": "INN",
          "references": [
            "7332f342-2bdf-497b-b064-115590f4349f"
          ]
        },
        {
          "uuid": "3ef2d087-6c9b-4f9b-b03e-9e69bdc96228",
          "code": "7097",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7097",
          "code_system": "IUPHAR",
          "references": [
            "7332f342-2bdf-497b-b064-115590f4349f"
          ]
        },
        {
          "uuid": "e0a9e8f2-4f99-438e-9f52-dff45ed16957",
          "code": "9066",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/9066/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7332f342-2bdf-497b-b064-115590f4349f"
          ]
        },
        {
          "uuid": "0a86fb92-2aa2-459b-b9fd-6e43f4b2e92b",
          "code": "m9441",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9441?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7332f342-2bdf-497b-b064-115590f4349f"
          ]
        },
        {
          "uuid": "dc5aafcf-fbed-46de-804e-4aef87df2bb9",
          "code": "DB04575",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB04575",
          "code_system": "DRUG BANK",
          "references": [
            "7332f342-2bdf-497b-b064-115590f4349f"
          ]
        },
        {
          "uuid": "ac1a22cd-5958-4aab-9d63-71a78cf931f9",
          "code": "CHEMBL1201165",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1201165",
          "code_system": "ChEMBL",
          "references": [
            "7332f342-2bdf-497b-b064-115590f4349f"
          ]
        },
        {
          "uuid": "b7bc195d-ba0a-4878-96ba-5e02ef4770ee",
          "code": "205-803-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.277",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7332f342-2bdf-497b-b064-115590f4349f"
          ]
        },
        {
          "uuid": "27754a4a-195f-4e81-af2e-112b65940ca7",
          "code": "9046",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9046",
          "code_system": "PUBCHEM",
          "references": [
            "7332f342-2bdf-497b-b064-115590f4349f"
          ]
        },
        {
          "uuid": "4a98f892-b684-403d-8507-7c727dc60552",
          "code": "152-43-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=152-43-2",
          "code_system": "CAS",
          "references": [
            "7332f342-2bdf-497b-b064-115590f4349f",
            "73c4e316-1cc4-4d68-b317-42d299024681"
          ]
        },
        {
          "uuid": "850bbdf6-a732-41c2-a770-da78a6404497",
          "code": "C66500",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66500",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7332f342-2bdf-497b-b064-115590f4349f"
          ]
        },
        {
          "uuid": "09993574-a23e-4a5a-bec1-a0199d16da3c",
          "code": "QUINESTROL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Quinestrol",
          "code_system": "WIKIPEDIA",
          "references": [
            "7332f342-2bdf-497b-b064-115590f4349f"
          ]
        },
        {
          "uuid": "c20cee1c-6c45-4dd8-a89a-d8ea5e9d2cfc",
          "code": "D011800",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68011800",
          "code_system": "MESH",
          "references": [
            "7332f342-2bdf-497b-b064-115590f4349f"
          ]
        },
        {
          "uuid": "6e3abf2d-bc9d-d662-08e2-0d57a8552c6d",
          "code": "DTXSID6046553",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6046553",
          "code_system": "EPA CompTox",
          "references": [
            "b97e95da-f3a4-10c3-4b9e-a9515a1ceb4b"
          ]
        },
        {
          "uuid": "a83aa6f7-2517-0bbb-3828-488b477f2957",
          "code": "C2181",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Estrogen[C483]|Steroidal Estrogen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2181",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ba379d7c-e742-b4cf-b216-171e1ded2ad2"
          ]
        },
        {
          "uuid": "f82dc2db-8621-431f-b857-f64c50207086",
          "code": "JR0N7XD5GZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0d9ffc67-e26d-3f20-becd-6c926b2f2e03",
          "code": "2342",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2342",
          "code_system": "DRUG CENTRAL",
          "references": [
            "ba379d7c-e742-b4cf-b216-171e1ded2ad2"
          ]
        },
        {
          "uuid": "789aa489-4c49-42b5-2b3b-95f9c2c6a618",
          "code": "8716",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:8716",
          "code_system": "CHEBI",
          "references": [
            "ba379d7c-e742-b4cf-b216-171e1ded2ad2"
          ]
        },
        {
          "uuid": "f60a4a10-3b3b-ae41-75ee-6183176ff406",
          "code": "100000080276",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "46c2d6ad-fef9-73f9-36d8-6c28e84173b1"
          ]
        },
        {
          "uuid": "38b17299-a24e-7471-867c-2f1644f7065b",
          "code": "759637",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759637",
          "code_system": "NSC",
          "references": [
            "2fc29273-a625-69e3-cb88-ea7f1a91275c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c89deec0-f52d-444b-9995-ea8e6da1f985",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "38ccd65d-01eb-428b-919b-af5203289e8c",
            "refuuid": "0f64e325-2210-4109-baa9-0be218f41b32",
            "name": "QUINESTROL",
            "unii": "JR0N7XD5GZ",
            "linking_id": "JR0N7XD5GZ",
            "ref_pname": "QUINESTROL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "301e8d09-3af4-40ea-8b60-178fbf86e887",
          "type": "TARGET->AGONIST",
          "related_substance": {
            "uuid": "898551a8-2d03-45e3-bd1c-356292c742a7",
            "refuuid": "4673cf81-dd46-4a8d-8696-823ccebce65d",
            "name": "ESTROGEN RECEPTOR",
            "unii": "SIDP85PFD6",
            "linking_id": "SIDP85PFD6",
            "ref_pname": "ESTROGEN RECEPTOR"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1cfa3a6f-d8d3-43d1-9739-ac7b27ead9c2",
          "name": "19-NORPREGNA-1,3,5(10)-TRIEN-20-YN-17-OL, 3-(CYCLOPENTYLOXY)-, 17.ALPHA.",
          "stdName": "19-NORPREGNA-1,3,5(10)-TRIEN-20-YN-17-OL, 3-(CYCLOPENTYLOXY)-, 17.ALPHA.",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78704958-305c-4c78-be4e-5a641bfb1744"
          ],
          "display_name": false
        },
        {
          "uuid": "dba7c656-4e25-4c32-9fee-dabf4cb28867",
          "name": "3-(Cyclopentyloxy)-19-nor-17α-pregna-1,3,5(10)-trien-20-yn-17-ol",
          "stdName": "3-(CYCLOPENTYLOXY)-19-NOR-17.ALPHA.-PREGNA-1,3,5(10)-TRIEN-20-YN-17-OL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "78704958-305c-4c78-be4e-5a641bfb1744"
          ],
          "display_name": false
        },
        {
          "uuid": "42cca5a2-6463-4ec7-8488-3ed63307e202",
          "name": "ESTROVIS",
          "stdName": "ESTROVIS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "027980d0-8316-4de2-ad62-3451bbce0f58"
          ],
          "display_name": false
        },
        {
          "uuid": "5f1e07ac-61f0-c501-0a5b-aeb93a23b9eb",
          "name": "NSC-759637",
          "stdName": "NSC-759637",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2fc29273-a625-69e3-cb88-ea7f1a91275c"
          ],
          "display_name": false
        },
        {
          "uuid": "01d8e766-f0e1-497d-ab20-9754c882f7e9",
          "name": "QUINESTROL",
          "stdName": "QUINESTROL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ca1ea01-b19b-4d30-a5d4-5beb98183188",
            "eff33e52-0c00-4b89-aa4b-a7422e55ce68",
            "5c401b6d-de5d-46ac-b35d-7bd1c835c3c6",
            "ea8be1e6-e750-4204-b55e-6dd9d10366b3",
            "b9ac6cc7-e472-458a-bb2d-29e6909471c6",
            "69396db4-7977-4788-bcf9-1c5585b08998",
            "7442fa21-47f0-4217-8c39-804a8ec7cb40",
            "6faec105-54c6-40f2-9866-9073a8b3f33e",
            "4e66f386-cc0c-4438-90a7-180da0c6b5e6",
            "78704958-305c-4c78-be4e-5a641bfb1744",
            "f9070308-55cf-4c42-868e-c7438933442e",
            "8d58bdd2-80a2-4217-9798-e0342a7f4118",
            "b7e4e29a-2dd7-4789-bfb1-08b46192e742",
            "3a43b831-7080-426e-93dd-3e90e15ccb2b",
            "98f6fcfe-5c95-45c2-afe7-95ea8a267b91"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "07850c89-0adc-492e-a0f2-019f9c54a6d7",
              "name_org": "INN"
            },
            {
              "uuid": "35e06895-04e1-41a0-a3bd-96d1b5da494f",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "375f26fa-5b45-4835-9b23-63463f7a3dbb",
          "name": "QUINESTROL [MART.]",
          "stdName": "QUINESTROL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7442fa21-47f0-4217-8c39-804a8ec7cb40"
          ],
          "display_name": false
        },
        {
          "uuid": "a2b9c5f8-8e4b-49e2-ad3c-5a8696d2d973",
          "name": "QUINESTROL [MI]",
          "stdName": "QUINESTROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6faec105-54c6-40f2-9866-9073a8b3f33e"
          ],
          "display_name": false
        },
        {
          "uuid": "792147b9-7bab-40a1-8c41-f7488461fc2f",
          "name": "QUINESTROL [ORANGE BOOK]",
          "stdName": "QUINESTROL [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9070308-55cf-4c42-868e-c7438933442e"
          ],
          "display_name": false
        },
        {
          "uuid": "437d3291-ea05-45ad-b393-ec4c6d50ee83",
          "name": "QUINESTROL [USAN]",
          "stdName": "QUINESTROL [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7e4e29a-2dd7-4789-bfb1-08b46192e742"
          ],
          "display_name": false
        },
        {
          "uuid": "f53e5091-1487-4afc-9da9-6eb1bf48aaf7",
          "name": "QUINESTROL [VANDF]",
          "stdName": "QUINESTROL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c401b6d-de5d-46ac-b35d-7bd1c835c3c6"
          ],
          "display_name": false
        },
        {
          "uuid": "959e746c-5120-9d8d-a579-2812c4862293",
          "name": "Quinestrol [WHO-DD]",
          "stdName": "QUINESTROL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "149df304-0d80-a7f3-0219-afc9170d0f9b"
          ],
          "display_name": false
        },
        {
          "uuid": "ddb34c37-5b0d-468b-8770-24bd2513aa23",
          "name": "W 3566",
          "stdName": "W 3566",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "027980d0-8316-4de2-ad62-3451bbce0f58"
          ],
          "display_name": false
        },
        {
          "uuid": "d955bb01-275d-4fac-861b-8421fcceb07f",
          "name": "W-3566",
          "stdName": "W-3566",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "027980d0-8316-4de2-ad62-3451bbce0f58"
          ],
          "display_name": false
        },
        {
          "uuid": "0fdf3ea3-5bbf-4c70-9bec-6eec6e41530f",
          "name": "quinestrol [INN]",
          "stdName": "QUINESTROL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a43b831-7080-426e-93dd-3e90e15ccb2b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "78704958-305c-4c78-be4e-5a641bfb1744",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "027980d0-8316-4de2-ad62-3451bbce0f58",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a43b831-7080-426e-93dd-3e90e15ccb2b",
          "citation": "INN Proposed List 14",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL14.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b7e4e29a-2dd7-4789-bfb1-08b46192e742",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9070308-55cf-4c42-868e-c7438933442e",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7442fa21-47f0-4217-8c39-804a8ec7cb40",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6faec105-54c6-40f2-9866-9073a8b3f33e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98f6fcfe-5c95-45c2-afe7-95ea8a267b91",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c401b6d-de5d-46ac-b35d-7bd1c835c3c6",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7332f342-2bdf-497b-b064-115590f4349f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389652000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19310386-ad2f-40fb-b2b2-a0cf75b2653b",
          "citation": "SRS import [JR0N7XD5GZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=JR0N7XD5GZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389652000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9ac6cc7-e472-458a-bb2d-29e6909471c6",
          "citation": "QUINESTROL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "69396db4-7977-4788-bcf9-1c5585b08998",
          "citation": "QUINESTROL [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8d58bdd2-80a2-4217-9798-e0342a7f4118",
          "citation": "QUINESTROL [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4ca1ea01-b19b-4d30-a5d4-5beb98183188",
          "citation": "QUINESTROL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eff33e52-0c00-4b89-aa4b-a7422e55ce68",
          "citation": "QUINESTROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ea8be1e6-e750-4204-b55e-6dd9d10366b3",
          "citation": "QUINESTROL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4e66f386-cc0c-4438-90a7-180da0c6b5e6",
          "citation": "QUINESTROL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b97e95da-f3a4-10c3-4b9e-a9515a1ceb4b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=152-43-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ba379d7c-e742-b4cf-b216-171e1ded2ad2",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "73c4e316-1cc4-4d68-b317-42d299024681",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2fc29273-a625-69e3-cb88-ea7f1a91275c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "149df304-0d80-a7f3-0219-afc9170d0f9b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "46c2d6ad-fef9-73f9-36d8-6c28e84173b1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2b59dbfd-0ecb-40e1-b613-7a438c4aa86e",
          "id": "2b59dbfd-0ecb-40e1-b613-7a438c4aa86e",
          "molfile": "\n  Marvin  01132102212D          \n\n 27 31  0  0  1  0            999 V2000\n    4.6868   -2.5641    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.4768   -2.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9704   -2.1634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4970   -1.4868    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.4883   -0.6651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3189   -1.4868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1406   -1.4868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7072   -1.7337    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.6985   -0.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9958   -1.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2698   -1.7134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2611   -2.5467    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.5467   -2.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8324   -2.5380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1209   -2.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1209   -3.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4036   -4.1932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3107   -3.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0918   -4.0422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5797   -3.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1035   -2.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3194   -2.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8324   -4.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5438   -3.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2552   -4.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9725   -3.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9725   -2.9649    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n  1  2  1  1  0  0  0\n  1  8  1  0  0  0  0\n 27  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  8  4  1  0  0  0  0\n  7  6  3  0  0  0  0\n  8  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 27 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 24 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 23 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 22 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 26  1  6  0  0  0\nM  END",
          "smiles": "C#C[C@@]1(CC[C@H]2[C@@H]3CCc4cc(ccc4[C@H]3CC[C@@]21C)OC5CCCC5)O",
          "formula": "C25H32O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fba79020-86a5-4096-aa2f-40164d6068f4"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "364.5213",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0f64e325-2210-4109-baa9-0be218f41b32",
      "version": "15",
      "structure": {
        "id": "5abfd55f-a311-48ed-888d-28924722b916",
        "molfile": "\n  Marvin  01132104422D          \n\n 30 34  0  0  1  0            999 V2000\n    4.7072   -1.7337    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.6868   -2.5641    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.9725   -2.9649    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.2611   -2.5467    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.5467   -2.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4970   -1.4868    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.5438   -3.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3189   -1.4868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9958   -1.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2698   -1.7134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4768   -2.8285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9725   -3.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1406   -1.4868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8324   -2.5380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8324   -4.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2552   -4.1990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9704   -2.1634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1209   -3.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4036   -4.1932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1209   -2.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4883   -0.6651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6985   -0.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3107   -3.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3194   -2.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0918   -4.0422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5797   -3.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1035   -2.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6868   -3.3860    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9696   -2.1431    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2582   -3.3685    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4 10  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  5  2  0  0  0  0\n  6  8  1  6  0  0  0\n  9  1  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  8  3  0  0  0  0\n 14  5  1  0  0  0  0\n 15  7  1  0  0  0  0\n 16 12  1  0  0  0  0\n 17  6  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 14  2  0  0  0  0\n  6 21  1  1  0  0  0\n  1 22  1  1  0  0  0\n 23 19  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 23  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 24  1  0  0  0  0\n  2 28  1  6  0  0  0\n  3 29  1  1  0  0  0\n  4 30  1  6  0  0  0\n 11 17  1  0  0  0  0\n  3  4  1  0  0  0  0\n  7 16  1  0  0  0  0\n 15 18  2  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
        "smiles": "C#C[C@@]1(CC[C@@]2([H])[C@]3([H])CCc4cc(ccc4[C@@]3([H])CC[C@@]21C)OC5CCCC5)O",
        "formula": "C25H32O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "364.5213",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "19310386-ad2f-40fb-b2b2-a0cf75b2653b",
          "78704958-305c-4c78-be4e-5a641bfb1744",
          "3a43b831-7080-426e-93dd-3e90e15ccb2b"
        ],
        "stereo_centers": 5
      },
      "unii": "JR0N7XD5GZ"
    }
  ]
}